SE435270B - Forfarande for framstellning av en hydraulisk cementkomposition samt komposition for genomforande av forfarandet - Google Patents
Forfarande for framstellning av en hydraulisk cementkomposition samt komposition for genomforande av forfarandetInfo
- Publication number
- SE435270B SE435270B SE7811105A SE7811105A SE435270B SE 435270 B SE435270 B SE 435270B SE 7811105 A SE7811105 A SE 7811105A SE 7811105 A SE7811105 A SE 7811105A SE 435270 B SE435270 B SE 435270B
- Authority
- SE
- Sweden
- Prior art keywords
- composition
- cement
- hydroxide
- water
- aromatic sulfonic
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 60
- 238000000034 method Methods 0.000 title claims description 23
- 239000011396 hydraulic cement Substances 0.000 title claims description 15
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 45
- 239000000654 additive Substances 0.000 claims description 32
- 239000004568 cement Substances 0.000 claims description 29
- 150000003839 salts Chemical class 0.000 claims description 29
- -1 aromatic sulfonic acids Chemical class 0.000 claims description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 239000002270 dispersing agent Substances 0.000 claims description 16
- 230000000996 additive effect Effects 0.000 claims description 15
- 239000007859 condensation product Substances 0.000 claims description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- 239000011575 calcium Substances 0.000 claims description 7
- 150000004679 hydroxides Chemical class 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- 239000011591 potassium Substances 0.000 claims description 6
- 239000002893 slag Substances 0.000 claims description 5
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 4
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 4
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 3
- 239000000920 calcium hydroxide Substances 0.000 claims description 3
- 238000010348 incorporation Methods 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 claims description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 claims description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 claims description 2
- 229910001866 strontium hydroxide Inorganic materials 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 1
- 239000011777 magnesium Substances 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 34
- 125000003118 aryl group Chemical class 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 8
- 239000004570 mortar (masonry) Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 238000006277 sulfonation reaction Methods 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 239000004567 concrete Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000011398 Portland cement Substances 0.000 description 4
- 229910052788 barium Inorganic materials 0.000 description 4
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 238000005452 bending Methods 0.000 description 3
- 150000001767 cationic compounds Chemical class 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910001411 inorganic cation Inorganic materials 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000011083 cement mortar Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 229910052602 gypsum Inorganic materials 0.000 description 2
- 239000010440 gypsum Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 2
- 239000011513 prestressed concrete Substances 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 239000011150 reinforced concrete Substances 0.000 description 2
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 2
- 101100256077 Caenorhabditis elegans aos-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910003550 H2 O Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000001491 aromatic compounds Chemical group 0.000 description 1
- MPDDDPYHTMZBMG-UHFFFAOYSA-N butyl(triethyl)azanium Chemical compound CCCC[N+](CC)(CC)CC MPDDDPYHTMZBMG-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical class [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- XXVUUWBSFBORGU-UHFFFAOYSA-N decacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC6=CC7=CC8=CC9=CC%10=CC=CC=C%10C=C9C=C8C=C7C=C6C=C5C=C4C=C3C=C21 XXVUUWBSFBORGU-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 239000010881 fly ash Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- KDEZIUOWTXJEJK-UHFFFAOYSA-N heptacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC6=CC7=CC=CC=C7C=C6C=C5C=C4C=C3C=C21 KDEZIUOWTXJEJK-UHFFFAOYSA-N 0.000 description 1
- QSQIGGCOCHABAP-UHFFFAOYSA-N hexacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC6=CC=CC=C6C=C5C=C4C=C3C=C21 QSQIGGCOCHABAP-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000001905 inorganic group Chemical group 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- FKBSHNBSEUWDAC-UHFFFAOYSA-L lithium sodium dihydroxide Chemical compound [Li+].[OH-].[OH-].[Na+] FKBSHNBSEUWDAC-UHFFFAOYSA-L 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- YKSIHFDRGQQOCJ-LHHMOHDTSA-N mycothione Chemical compound O([C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)[C@@H](NC(C)=O)CSSC[C@H](NC(=O)C)C(=O)N[C@H]1[C@H](O[C@H](CO)[C@@H](O)[C@@H]1O)O[C@@H]1[C@@H]([C@H](O)[C@@H](O)[C@H](O)[C@H]1O)O)[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O YKSIHFDRGQQOCJ-LHHMOHDTSA-N 0.000 description 1
- UIFXPOUSHBMMEG-UHFFFAOYSA-N nonacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC6=CC7=CC8=CC9=CC=CC=C9C=C8C=C7C=C6C=C5C=C4C=C3C=C21 UIFXPOUSHBMMEG-UHFFFAOYSA-N 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- PFTXKXWAXWAZBP-UHFFFAOYSA-N octacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC6=CC7=CC8=CC=CC=C8C=C7C=C6C=C5C=C4C=C3C=C21 PFTXKXWAXWAZBP-UHFFFAOYSA-N 0.000 description 1
- SLIUAWYAILUBJU-UHFFFAOYSA-N pentacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC=CC=C5C=C4C=C3C=C21 SLIUAWYAILUBJU-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- IFLREYGFSNHWGE-UHFFFAOYSA-N tetracene Chemical compound C1=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C21 IFLREYGFSNHWGE-UHFFFAOYSA-N 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- SEACXNRNJAXIBM-UHFFFAOYSA-N triethyl(methyl)azanium Chemical compound CC[N+](C)(CC)CC SEACXNRNJAXIBM-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B28/00—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements
- C04B28/02—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements containing hydraulic cements other than calcium sulfates
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Organic Chemistry (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Phenolic Resins Or Amino Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7733343A FR2407184A1 (fr) | 1977-10-28 | 1977-10-28 | Procede pour ameliorer la mise en oeuvre et les proprietes mecaniques des compositions de ciment hydraulique |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7811105L SE7811105L (sv) | 1979-04-29 |
| SE435270B true SE435270B (sv) | 1984-09-17 |
Family
ID=9197308
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7811105A SE435270B (sv) | 1977-10-28 | 1978-10-25 | Forfarande for framstellning av en hydraulisk cementkomposition samt komposition for genomforande av forfarandet |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4247334A (de) |
| JP (1) | JPS5471112A (de) |
| AT (1) | AT371087B (de) |
| AU (1) | AU521885B2 (de) |
| BE (1) | BE871622A (de) |
| CA (1) | CA1125317A (de) |
| CH (1) | CH634805A5 (de) |
| DE (1) | DE2846966C2 (de) |
| DK (1) | DK479078A (de) |
| ES (1) | ES474591A1 (de) |
| FR (1) | FR2407184A1 (de) |
| GB (1) | GB2006745B (de) |
| GR (1) | GR64087B (de) |
| IT (1) | IT1100997B (de) |
| NL (1) | NL7810744A (de) |
| NO (1) | NO148028C (de) |
| SE (1) | SE435270B (de) |
| ZA (1) | ZA786042B (de) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS586702B2 (ja) * | 1979-08-31 | 1983-02-05 | 花王株式会社 | コンクリ−ト混和剤及び未硬化コンクリ−トのスランプ低下防止方法 |
| DE2935719A1 (de) * | 1979-09-04 | 1981-03-12 | Bayer Ag, 5090 Leverkusen | Moertel aus anorganischen bindemitteln, verfahren zu ihrer herstellung und ihre verwendung. |
| JPS58155398A (ja) * | 1982-03-12 | 1983-09-16 | 株式会社日立製作所 | 放射性廃棄物の固化方法 |
| JPS5926955A (ja) * | 1982-07-30 | 1984-02-13 | 株式会社竹中工務店 | 水中で分離しないコンクリ−トの製造方法 |
| SE452607B (sv) * | 1983-04-29 | 1987-12-07 | Ceskoslovenska Akademie Ved | Snabb-bindande hoghallfasthetscementbindemedel samt forfarande for framstellning derav |
| DE3537274A1 (de) * | 1984-10-27 | 1986-04-30 | Dynamit Nobel Ag, 5210 Troisdorf | Verarbeitungswilliger spritzbeton |
| DE3569720D1 (en) * | 1984-10-27 | 1989-06-01 | Huels Chemische Werke Ag | Gunite |
| DE3530258A1 (de) * | 1985-08-23 | 1987-02-26 | Lentia Gmbh | Verwendung von salzen wasserloeslicher naphtalinsulfonsaeure-formaldehydkondensate als zusatzmittel fuer anorganische bindemittel und baustoff |
| US5348584A (en) * | 1993-06-30 | 1994-09-20 | Halliburton Company | Hydrocarbon liquid and water dispersible particulate cement compositions |
| US9840066B2 (en) * | 2005-06-09 | 2017-12-12 | United States Gypsum Company | Light weight gypsum board |
| US11338548B2 (en) * | 2005-06-09 | 2022-05-24 | United States Gypsum Company | Light weight gypsum board |
| US7731794B2 (en) | 2005-06-09 | 2010-06-08 | United States Gypsum Company | High starch light weight gypsum wallboard |
| CA2523936A1 (en) * | 2005-10-20 | 2007-04-20 | Groupe Grb Inc. | System for filling molds with cementitious concrete-like material and for unmolding resulting products |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH257968A (de) * | 1946-10-24 | 1948-11-15 | Kaspar Winkler & Cie | Verfahren zur Herstellung von Mörtel oder Beton. |
| US2806530A (en) * | 1955-11-07 | 1957-09-17 | Exxon Research Engineering Co | Method for cementing wells |
| US2868295A (en) * | 1956-12-07 | 1959-01-13 | Jersey Prod Res Co | Method for cementing wells |
| DE1238831B (de) * | 1965-01-09 | 1967-04-13 | Kao Corp | Verfahren zur Herstellung von leicht verteilbarem Zement |
| AT303597B (de) * | 1970-05-12 | 1972-11-27 | Kaspar Winkler & Co | Verfahren zur Herstellung von Zement, Mörtel oder Beton mit verbesserten Eigenschaften |
| FR2303771A1 (fr) * | 1975-03-11 | 1976-10-08 | Rhone Poulenc Ind | Nouveaux composes alumino-calciques et leurs applications aux liants hydrauliques |
| US4028125A (en) * | 1976-03-25 | 1977-06-07 | The Dow Chemical Company | Cement composition |
-
1977
- 1977-10-28 FR FR7733343A patent/FR2407184A1/fr active Granted
-
1978
- 1978-10-25 SE SE7811105A patent/SE435270B/sv unknown
- 1978-10-26 AU AU41094/78A patent/AU521885B2/en not_active Expired
- 1978-10-26 NO NO783622A patent/NO148028C/no unknown
- 1978-10-26 ZA ZA00786042A patent/ZA786042B/xx unknown
- 1978-10-26 GR GR57522A patent/GR64087B/el unknown
- 1978-10-27 CH CH1114078A patent/CH634805A5/fr not_active IP Right Cessation
- 1978-10-27 CA CA314,607A patent/CA1125317A/fr not_active Expired
- 1978-10-27 DE DE2846966A patent/DE2846966C2/de not_active Expired
- 1978-10-27 NL NL7810744A patent/NL7810744A/xx not_active Application Discontinuation
- 1978-10-27 IT IT29201/78A patent/IT1100997B/it active
- 1978-10-27 JP JP13174778A patent/JPS5471112A/ja active Pending
- 1978-10-27 GB GB7842218A patent/GB2006745B/en not_active Expired
- 1978-10-27 BE BE191421A patent/BE871622A/xx not_active IP Right Cessation
- 1978-10-27 ES ES474591A patent/ES474591A1/es not_active Expired
- 1978-10-27 DK DK479078A patent/DK479078A/da not_active Application Discontinuation
- 1978-10-27 AT AT0770578A patent/AT371087B/de not_active IP Right Cessation
- 1978-10-27 US US05/955,510 patent/US4247334A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK479078A (da) | 1979-04-29 |
| FR2407184A1 (fr) | 1979-05-25 |
| AU521885B2 (en) | 1982-05-06 |
| AU4109478A (en) | 1980-05-01 |
| BE871622A (fr) | 1979-04-27 |
| ZA786042B (en) | 1979-10-31 |
| CH634805A5 (fr) | 1983-02-28 |
| ATA770578A (de) | 1982-10-15 |
| US4247334A (en) | 1981-01-27 |
| GB2006745A (en) | 1979-05-10 |
| FR2407184B1 (de) | 1983-02-11 |
| ES474591A1 (es) | 1979-04-16 |
| NL7810744A (nl) | 1979-05-02 |
| GR64087B (en) | 1980-01-21 |
| GB2006745B (en) | 1982-03-03 |
| DE2846966C2 (de) | 1982-11-25 |
| JPS5471112A (en) | 1979-06-07 |
| NO148028C (no) | 1983-07-27 |
| DE2846966A1 (de) | 1979-05-03 |
| NO148028B (no) | 1983-04-18 |
| NO783622L (no) | 1979-05-02 |
| AT371087B (de) | 1983-05-25 |
| CA1125317A (fr) | 1982-06-08 |
| IT7829201A0 (it) | 1978-10-27 |
| SE7811105L (sv) | 1979-04-29 |
| IT1100997B (it) | 1985-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69311731T2 (de) | Verflüssiger für wassersuspendierte partikeln und pasten aus hydraulischen bindern | |
| DE3883330T2 (de) | Aminoarylsulfonsäure-Phenol-Formaldehyd-Kondensat und Zementmischung, die dieses enthält. | |
| SE435270B (sv) | Forfarande for framstellning av en hydraulisk cementkomposition samt komposition for genomforande av forfarandet | |
| EP3339341B1 (de) | Polykondensationsprodukt auf basis von aromatischen verbindungen, verfahren zu seiner herstellung und seine verwendung | |
| US4504315A (en) | Liquid accelerator for the setting of concrete mixtures | |
| DE2913721C2 (de) | Verflüssigungsmittel für kalzinierten Gips sowie Verwendung des Mittels | |
| JPH0192212A (ja) | 有機コンパウンドの改良 | |
| DE19627531B4 (de) | Wasserlösliche formaldehydfreie Polykondensationsprodukte auf Basis von Amino-s-triazinen | |
| EP4119519A1 (de) | Festigkeitssteigernde zusatzstoffe für kohlenstoffarme zementzusammensetzungen | |
| DE60213624T2 (de) | Beschleunigerzusammensetzung | |
| EP2065351B1 (de) | Dispergiermittel für hydraulisch abbindende Systeme | |
| DE2322707B2 (de) | Mörtel aus anorganischen Bindemitteln | |
| WO2013117586A1 (fr) | Adjuvant accélérateur de prise à stabilité améliorée | |
| JPH02502629A (ja) | 水硬性セメント及びこれを使用する組成物 | |
| DE2405437A1 (de) | Den wassergehalt vermindernde zusaetze fuer keramische massen | |
| GB2036714A (en) | Process for manufacturing mortars and concretes from hydraulic binders | |
| GB2106527A (en) | Dispersing composition | |
| DE2609703C3 (de) | Organocalciumaluminate und ihre Verwendung in hydraulischen Bindemitteln | |
| KR910006230B1 (ko) | 나프탈렌설폰산-포름 알데히드 축합 생성물의 금속염의 비결정화 수용액 | |
| WO2020007664A1 (de) | ZUSAMMENSETZUNG FÜR FLIEßFÄHIGE FEUERFESTE MASSEN | |
| DE1224190B (de) | Verfahren zur Aufbereitung von synthetischem Gips | |
| DE2232240C3 (de) | Beschleuniger für das Abbinden und Aushärten von Portlandzementen und anderen tricalciumsilicatreichen Zementen | |
| DE102024121786A1 (de) | Zementfreies säurebeständiges alkalisches Bindemittel | |
| DE2433363A1 (de) | Stabilisierte dicalciumaluminathydrate | |
| JPH0768058B2 (ja) | セメント分散剤 |