SE430889B - Nya 3-substituerade 5-vinyl-2-pyrrolidonforeningar med terapeutiska egenskaper och forfarande for framstellning av desamma - Google Patents
Nya 3-substituerade 5-vinyl-2-pyrrolidonforeningar med terapeutiska egenskaper och forfarande for framstellning av desammaInfo
- Publication number
- SE430889B SE430889B SE7813352A SE7813352A SE430889B SE 430889 B SE430889 B SE 430889B SE 7813352 A SE7813352 A SE 7813352A SE 7813352 A SE7813352 A SE 7813352A SE 430889 B SE430889 B SE 430889B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- formula
- vinyl
- carbon atoms
- hours
- Prior art date
Links
- -1 3-SUBSTITUTED 5-VINYL-2-PYRROLIDONE COMPOUNDS Chemical class 0.000 title claims description 17
- 238000000034 method Methods 0.000 title claims description 8
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- AFEWNSCLQLQUEJ-UHFFFAOYSA-N 2-ethenylcyclopropane-1,1-dicarboxylic acid Chemical class OC(=O)C1(C(O)=O)CC1C=C AFEWNSCLQLQUEJ-UHFFFAOYSA-N 0.000 claims description 4
- BJNIHWSOVCDBHS-UHFFFAOYSA-N 4-aminohex-5-ynoic acid Chemical compound C#CC(N)CCC(O)=O BJNIHWSOVCDBHS-UHFFFAOYSA-N 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- PJDFLNIOAUIZSL-UHFFFAOYSA-N vigabatrin Chemical compound C=CC(N)CCC(O)=O PJDFLNIOAUIZSL-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 239000002831 pharmacologic agent Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000006114 decarboxylation reaction Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- UOLQECNNAKPUCK-UHFFFAOYSA-N 5-ethenyl-2-oxopyrrolidine-3-carboxylic acid Chemical compound OC(=O)C1CC(C=C)NC1=O UOLQECNNAKPUCK-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UOQTXZICFVMERR-UHFFFAOYSA-N diethyl 2-ethenylcyclopropane-1,1-dicarboxylate Chemical compound CCOC(=O)C1(C(=O)OCC)CC1C=C UOQTXZICFVMERR-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 235000003599 food sweetener Nutrition 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000003765 sweetening agent Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- LHOWRYQIMFIXLH-UHFFFAOYSA-N 2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Chemical compound O=C1OC(C)(C)OC(=O)C11C(C=C)C1 LHOWRYQIMFIXLH-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- RFOIWENXLZSKSY-UHFFFAOYSA-N 4-ethenylpyrrolidin-2-one Chemical class C=CC1CNC(=O)C1 RFOIWENXLZSKSY-UHFFFAOYSA-N 0.000 description 2
- OYVDXEVJHXWJAE-UHFFFAOYSA-N 5-ethenylpyrrolidin-2-one Chemical compound C=CC1CCC(=O)N1 OYVDXEVJHXWJAE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical group CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RMXLHIUHKIVPAB-OWOJBTEDSA-N (e)-1,4-dibromobut-2-ene Chemical compound BrC\C=C\CBr RMXLHIUHKIVPAB-OWOJBTEDSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- ZVCBCQNBOYCPPK-UHFFFAOYSA-N 1-ethenyl-2-oxopyrrolidine-3-carboxylic acid Chemical compound OC(=O)C1CCN(C=C)C1=O ZVCBCQNBOYCPPK-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- ISDXLMIGILNXFB-UHFFFAOYSA-N 4-aminohex-5-enoic acid azane Chemical compound N.NC(CCC(=O)O)C=C ISDXLMIGILNXFB-UHFFFAOYSA-N 0.000 description 1
- NKKMPIXWEPUSCG-UHFFFAOYSA-N 5-oxooctanal Chemical compound CCCC(=O)CCCC=O NKKMPIXWEPUSCG-UHFFFAOYSA-N 0.000 description 1
- 240000000073 Achillea millefolium Species 0.000 description 1
- 235000007754 Achillea millefolium Nutrition 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 101100440695 Dictyostelium discoideum corB gene Proteins 0.000 description 1
- 101100295738 Gallus gallus COR3 gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 102000003929 Transaminases Human genes 0.000 description 1
- 108090000340 Transaminases Proteins 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical class CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229940124277 aminobutyric acid Drugs 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001942 cyclopropanes Chemical class 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- ANYSGBYRTLOUPO-UHFFFAOYSA-N lithium tetramethylpiperidide Chemical compound [Li]N1C(C)(C)CCCC1(C)C ANYSGBYRTLOUPO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- FQDIANVAWVHZIR-OWOJBTEDSA-N trans-1,4-Dichlorobutene Chemical compound ClC\C=C\CCl FQDIANVAWVHZIR-OWOJBTEDSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/873,273 US4178463A (en) | 1978-01-30 | 1978-01-30 | Process for making 4-aminohex-5-enoic acid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7813352L SE7813352L (sv) | 1979-07-31 |
| SE430889B true SE430889B (sv) | 1983-12-19 |
Family
ID=25361312
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7813352A SE430889B (sv) | 1978-01-30 | 1978-12-28 | Nya 3-substituerade 5-vinyl-2-pyrrolidonforeningar med terapeutiska egenskaper och forfarande for framstellning av desamma |
| SE8207302A SE449358B (sv) | 1978-01-30 | 1982-12-21 | Forfarande for framstellning av 4-aminohex-5-ensyra eller salter derav |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8207302A SE449358B (sv) | 1978-01-30 | 1982-12-21 | Forfarande for framstellning av 4-aminohex-5-ensyra eller salter derav |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4178463A (show.php) |
| JP (2) | JPS54112860A (show.php) |
| AU (1) | AU520802B2 (show.php) |
| BE (1) | BE873766A (show.php) |
| CA (1) | CA1132992A (show.php) |
| CH (1) | CH640224A5 (show.php) |
| DE (1) | DE2902438A1 (show.php) |
| DK (2) | DK18179A (show.php) |
| ES (3) | ES476919A1 (show.php) |
| FR (1) | FR2415630A1 (show.php) |
| GB (1) | GB2013205B (show.php) |
| HK (1) | HK55387A (show.php) |
| IE (1) | IE47782B1 (show.php) |
| IL (1) | IL56254A (show.php) |
| IT (1) | IT1116500B (show.php) |
| NL (1) | NL7900028A (show.php) |
| NO (1) | NO150155C (show.php) |
| NZ (1) | NZ189213A (show.php) |
| PH (3) | PH14716A (show.php) |
| PT (1) | PT69026A (show.php) |
| SE (2) | SE430889B (show.php) |
| ZA (1) | ZA787116B (show.php) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4235778A (en) * | 1978-01-30 | 1980-11-25 | Merrell Toraude Et Compagnie | 2-Pyrrolidone compounds and processes for making same |
| US4380656A (en) * | 1981-07-27 | 1983-04-19 | Emery Industries, Inc. | 2-Vinyl- and 2-ethylcyclopropane carboxylates |
| GB2120244B (en) * | 1982-05-17 | 1985-05-01 | Merrell Toraude & Co | Aminoalkadiene derivative |
| GB2133002B (en) * | 1982-12-30 | 1986-01-29 | Merrell Toraude & Co | Process for preparing 4-amino-5-hexenoic acid |
| HU198902B (en) * | 1983-07-07 | 1989-12-28 | Syntex Corp | Process for production of derivatives of gamma-allenilgamma-amino butyric acid and medical compositions containing them |
| US4668703A (en) * | 1983-07-07 | 1987-05-26 | Syntex (U.S.A.) Inc. | γ-allenyl-γ-aminobutyric acids |
| ES535188A0 (es) * | 1983-08-17 | 1985-12-01 | Syntex Inc | Procedimiento para la preparacion de alfa-aminoacidos alfa-alenicos |
| US4912232A (en) * | 1983-10-14 | 1990-03-27 | Dow Chemical Company | Preparation of N-hydrocarbylcarbonyl-5-(1-hydrocarbylcarbonyloxy)hydrocarbyl-pyrrolidin-2-one |
| US4632994A (en) * | 1983-11-04 | 1986-12-30 | Gruppo Lepetit S.P.A. | Process for decomposing N-oxide derivatives producing 5-vinyl-2-pyrrolidones |
| AU629419B2 (en) * | 1989-11-07 | 1992-10-01 | Aventis Inc. | Process for the production of vinyl-gaba |
| DE4010709A1 (de) * | 1990-04-03 | 1991-10-10 | Huels Chemische Werke Ag | Verfahren zur herstellung von 3-carboxamido-5-vinyl-2-pyrrolidon |
| EP0546230A1 (en) * | 1991-12-10 | 1993-06-16 | Merrell Dow Pharmaceuticals Inc. | Novel process for preparing 4-amino-5-hexenoic acid |
| ITMI20060179A1 (it) | 2006-02-02 | 2007-08-03 | Abiogen Pharma Spa | Procedimento per la risoluzione di miscele racemiche e complesso diastereoisomerico di un agente risolvente e di unantiomero di interesse |
| EP2537827B1 (en) | 2011-06-24 | 2014-06-11 | Targeon SAS | Process for preparing 4-amino-5-hexenoic acid from succinimide |
| CN110713440B (zh) * | 2018-07-11 | 2022-01-25 | 武汉武药科技有限公司 | 一种氨己烯酸的制备方法 |
| CN112707832B (zh) * | 2019-10-25 | 2022-07-05 | 武汉武药科技有限公司 | 氨己烯酸及其制备方法 |
| CN116621720B (zh) * | 2023-07-21 | 2023-10-27 | 成都硕德药业有限公司 | 一种氨己烯酸的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960927A (en) * | 1975-03-18 | 1976-06-01 | Richardson-Merrell Inc. | Olefinic derivatives of amino acids |
| US3959356A (en) * | 1975-03-18 | 1976-05-25 | Richardson-Merrell Inc. | Acetylene derivatives of amino acids |
-
1978
- 1978-01-30 US US05/873,273 patent/US4178463A/en not_active Expired - Lifetime
- 1978-12-15 AU AU42601/78A patent/AU520802B2/en not_active Expired
- 1978-12-18 NZ NZ189213A patent/NZ189213A/xx unknown
- 1978-12-19 IL IL56254A patent/IL56254A/xx unknown
- 1978-12-19 ZA ZA00787116A patent/ZA787116B/xx unknown
- 1978-12-20 PH PH21973A patent/PH14716A/en unknown
- 1978-12-28 SE SE7813352A patent/SE430889B/sv not_active IP Right Cessation
- 1978-12-29 CA CA318,833A patent/CA1132992A/en not_active Expired
-
1979
- 1979-01-03 NL NL7900028A patent/NL7900028A/xx active Search and Examination
- 1979-01-04 PT PT69026A patent/PT69026A/pt unknown
- 1979-01-16 DK DK18179A patent/DK18179A/da not_active Application Discontinuation
- 1979-01-17 ES ES476919A patent/ES476919A1/es not_active Expired
- 1979-01-23 DE DE19792902438 patent/DE2902438A1/de active Granted
- 1979-01-25 JP JP663379A patent/JPS54112860A/ja active Granted
- 1979-01-26 FR FR7902087A patent/FR2415630A1/fr active Granted
- 1979-01-26 IT IT47795/79A patent/IT1116500B/it active Protection Beyond IP Right Term
- 1979-01-26 CH CH81979A patent/CH640224A5/de not_active IP Right Cessation
- 1979-01-29 BE BE193125A patent/BE873766A/xx not_active IP Right Cessation
- 1979-01-29 GB GB793066A patent/GB2013205B/en not_active Expired
- 1979-01-29 NO NO790285A patent/NO150155C/no unknown
- 1979-01-30 IE IE111/79A patent/IE47782B1/en unknown
- 1979-07-11 ES ES482414A patent/ES482414A1/es not_active Expired
- 1979-07-11 ES ES482415A patent/ES482415A1/es not_active Expired
-
1981
- 1981-07-08 PH PH25878A patent/PH24034A/en unknown
- 1981-07-08 PH PH25883A patent/PH19618A/en unknown
-
1982
- 1982-12-21 SE SE8207302A patent/SE449358B/sv unknown
-
1986
- 1986-10-18 JP JP61248261A patent/JPS62187440A/ja active Granted
-
1987
- 1987-07-30 HK HK553/87A patent/HK55387A/xx not_active IP Right Cessation
-
1988
- 1988-10-03 DK DK551388A patent/DK551388A/da not_active Application Discontinuation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE430889B (sv) | Nya 3-substituerade 5-vinyl-2-pyrrolidonforeningar med terapeutiska egenskaper och forfarande for framstellning av desamma | |
| DE69619809T2 (de) | Verfahren zur herstellung von (s)-3-(aminoethyl)-5-metylhexansäure | |
| HU195182B (en) | Process for production of /z/-1-phenil-1-diethil-amino-carbonil-2-amino-methil-cyclopropan hcl | |
| DE10028443C1 (de) | Verfahren zur Herstellung von 3,3-Diarylpropylaminen, (R,S)- und (R)-4-Phenyl-2-chromanon-6-carbonsäure sowie (R)-4-Phenyl-2-chromanon-carbonsäure-cinchonidinsalz und deren Verwendung zur Herstellung eines rechtsdrehenden Hydroxybenzylalkohols und von pharmazeutischen Zusammensetzungen | |
| SE452610B (sv) | Sett att spalta racemiska cis-1,2-cyklopropandikarboxylsyraderivat | |
| JPS63192753A (ja) | テトラヒドロキノリン誘導体の光学分割法 | |
| US4235778A (en) | 2-Pyrrolidone compounds and processes for making same | |
| FI75148B (fi) | Foerfarande foer framstaellning av ringsubstituerade cinnamoylantranilsyraderivat. | |
| US4393008A (en) | 2-Cyano-2-(3-phenoxy-phenyl)-propionic acid amide and preparation thereof | |
| US4254284A (en) | Process for preparing 4-aminohex-5-ynoic acid | |
| US3244725A (en) | 4, 5-diacyl-3-hydroxy-3-pyrrolin-2-ones | |
| US4119637A (en) | 4-Hydroxymethyl-2-pyrrolidinones | |
| Balenovic et al. | A Synthesis of Nγ-Phthaloyl Derivatives of Basic Amino Acids. Amino Acids. VII | |
| Carney et al. | Investigations in Heterocycles. XVIII. The Synthesis of 1, 2-Disubstituted 5, 6, 7, 8-Tetrahydro-4-quinazolinethiones1 | |
| EP0437566B1 (en) | Phenyl-glycine derivatives | |
| HU194857B (en) | Process for production of 4-amin-6-fluor-cromane-4-carbonic acid and its 2/r/ methilesther | |
| US5208342A (en) | Conversion of pyridine-2,3-dicarboxylic acid esters to cyclic anhydrides | |
| US4229375A (en) | 1-Aminomethyltricyclo[4.3.1.12,5 ]undecane and acid-addition salts thereof | |
| SU554810A3 (ru) | Способ получени производных бифенила или их солей, или рацематов, или оптически активных антиподов | |
| HU199855B (en) | Process for producing n-sulfonyl-square brackets open n-(phosphonomethyl)-glycyl square brackets closed-amine derivatives | |
| SU501668A3 (ru) | Способ получени производных 2-аминобензиламина | |
| JP2767295B2 (ja) | インドール―3―カルボニトリル化合物の製造方法 | |
| SU1583413A1 (ru) | 1-Ацил-2-фенилтиосемикарбазиды в качестве промежуточного продукта при получении 2-фенилтиосемикарбазида | |
| SU469242A3 (ru) | Способ получени третичных аминокислот или их солей | |
| KR850001036B1 (ko) | 2-아미노-4-메틸피리딘의 아미드의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7813352-7 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7813352-7 Format of ref document f/p: F |