CA1132992A - 2-pyrrolidone compounds and processes employing same - Google Patents
2-pyrrolidone compounds and processes employing sameInfo
- Publication number
- CA1132992A CA1132992A CA318,833A CA318833A CA1132992A CA 1132992 A CA1132992 A CA 1132992A CA 318833 A CA318833 A CA 318833A CA 1132992 A CA1132992 A CA 1132992A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- formula
- pyrrolidone
- hours
- preparing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 16
- 150000003953 γ-lactams Chemical class 0.000 title description 2
- -1 hydroxy, amino Chemical group 0.000 claims abstract description 17
- PJDFLNIOAUIZSL-UHFFFAOYSA-N vigabatrin Chemical compound C=CC(N)CCC(O)=O PJDFLNIOAUIZSL-UHFFFAOYSA-N 0.000 claims abstract description 7
- BJNIHWSOVCDBHS-UHFFFAOYSA-N 4-aminohex-5-ynoic acid Chemical compound C#CC(N)CCC(O)=O BJNIHWSOVCDBHS-UHFFFAOYSA-N 0.000 claims abstract description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 239000002585 base Substances 0.000 claims description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical group 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 9
- 238000011282 treatment Methods 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- OYVDXEVJHXWJAE-UHFFFAOYSA-N 5-ethenylpyrrolidin-2-one Chemical class C=CC1CCC(=O)N1 OYVDXEVJHXWJAE-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 3
- AFEWNSCLQLQUEJ-UHFFFAOYSA-N 2-ethenylcyclopropane-1,1-dicarboxylic acid Chemical class OC(=O)C1(C(O)=O)CC1C=C AFEWNSCLQLQUEJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000003456 ion exchange resin Substances 0.000 claims description 3
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical group CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 claims description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 2
- 125000000950 dibromo group Chemical group Br* 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 238000010791 quenching Methods 0.000 claims description 2
- 230000000171 quenching effect Effects 0.000 claims description 2
- 238000003756 stirring Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 3
- 230000000911 decarboxylating effect Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 33
- 238000002360 preparation method Methods 0.000 abstract description 4
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 abstract description 3
- 239000002831 pharmacologic agent Substances 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- UOLQECNNAKPUCK-UHFFFAOYSA-N 5-ethenyl-2-oxopyrrolidine-3-carboxylic acid Chemical compound OC(=O)C1CC(C=C)NC1=O UOLQECNNAKPUCK-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000006114 decarboxylation reaction Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229960003390 magnesium sulfate Drugs 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- RFOIWENXLZSKSY-UHFFFAOYSA-N 4-ethenylpyrrolidin-2-one Chemical class C=CC1CNC(=O)C1 RFOIWENXLZSKSY-UHFFFAOYSA-N 0.000 description 2
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- UOQTXZICFVMERR-UHFFFAOYSA-N diethyl 2-ethenylcyclopropane-1,1-dicarboxylate Chemical compound CCOC(=O)C1(C(=O)OCC)CC1C=C UOQTXZICFVMERR-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- LHOWRYQIMFIXLH-UHFFFAOYSA-N 2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Chemical compound O=C1OC(C)(C)OC(=O)C11C(C=C)C1 LHOWRYQIMFIXLH-UHFFFAOYSA-N 0.000 description 1
- XPYQFIISZQCINN-QVXDJYSKSA-N 4-amino-1-[(2r,3e,4s,5r)-3-(fluoromethylidene)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrate Chemical compound O.O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 XPYQFIISZQCINN-QVXDJYSKSA-N 0.000 description 1
- ISDXLMIGILNXFB-UHFFFAOYSA-N 4-aminohex-5-enoic acid azane Chemical compound N.NC(CCC(=O)O)C=C ISDXLMIGILNXFB-UHFFFAOYSA-N 0.000 description 1
- YIWFBNMYFYINAD-SMZGMGDZSA-N C(=C)C1C(C1)([2H])[2H] Chemical compound C(=C)C1C(C1)([2H])[2H] YIWFBNMYFYINAD-SMZGMGDZSA-N 0.000 description 1
- 101150047265 COR2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101100467189 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) QCR2 gene Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 102000003929 Transaminases Human genes 0.000 description 1
- 108090000340 Transaminases Proteins 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical class CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- UDHRYKZHHDJYNT-UHFFFAOYSA-N azane 5-ethenyl-2-oxopyrrolidine-3-carboxylic acid Chemical compound N.C(=O)(O)C1C(NC(C1)C=C)=O UDHRYKZHHDJYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001942 cyclopropanes Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- ANYSGBYRTLOUPO-UHFFFAOYSA-N lithium tetramethylpiperidide Chemical compound [Li]N1C(C)(C)CCCC1(C)C ANYSGBYRTLOUPO-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- 229940091250 magnesium supplement Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- FQDIANVAWVHZIR-OWOJBTEDSA-N trans-1,4-Dichlorobutene Chemical compound ClC\C=C\CCl FQDIANVAWVHZIR-OWOJBTEDSA-N 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US873,273 | 1978-01-30 | ||
| US05/873,273 US4178463A (en) | 1978-01-30 | 1978-01-30 | Process for making 4-aminohex-5-enoic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1132992A true CA1132992A (en) | 1982-10-05 |
Family
ID=25361312
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA318,833A Expired CA1132992A (en) | 1978-01-30 | 1978-12-29 | 2-pyrrolidone compounds and processes employing same |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4178463A (show.php) |
| JP (2) | JPS54112860A (show.php) |
| AU (1) | AU520802B2 (show.php) |
| BE (1) | BE873766A (show.php) |
| CA (1) | CA1132992A (show.php) |
| CH (1) | CH640224A5 (show.php) |
| DE (1) | DE2902438A1 (show.php) |
| DK (2) | DK18179A (show.php) |
| ES (3) | ES476919A1 (show.php) |
| FR (1) | FR2415630A1 (show.php) |
| GB (1) | GB2013205B (show.php) |
| HK (1) | HK55387A (show.php) |
| IE (1) | IE47782B1 (show.php) |
| IL (1) | IL56254A (show.php) |
| IT (1) | IT1116500B (show.php) |
| NL (1) | NL7900028A (show.php) |
| NO (1) | NO150155C (show.php) |
| NZ (1) | NZ189213A (show.php) |
| PH (3) | PH14716A (show.php) |
| PT (1) | PT69026A (show.php) |
| SE (2) | SE430889B (show.php) |
| ZA (1) | ZA787116B (show.php) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4235778A (en) * | 1978-01-30 | 1980-11-25 | Merrell Toraude Et Compagnie | 2-Pyrrolidone compounds and processes for making same |
| US4380656A (en) * | 1981-07-27 | 1983-04-19 | Emery Industries, Inc. | 2-Vinyl- and 2-ethylcyclopropane carboxylates |
| GB2120244B (en) * | 1982-05-17 | 1985-05-01 | Merrell Toraude & Co | Aminoalkadiene derivative |
| GB2133002B (en) * | 1982-12-30 | 1986-01-29 | Merrell Toraude & Co | Process for preparing 4-amino-5-hexenoic acid |
| HU198902B (en) * | 1983-07-07 | 1989-12-28 | Syntex Corp | Process for production of derivatives of gamma-allenilgamma-amino butyric acid and medical compositions containing them |
| US4668703A (en) * | 1983-07-07 | 1987-05-26 | Syntex (U.S.A.) Inc. | γ-allenyl-γ-aminobutyric acids |
| ES535188A0 (es) * | 1983-08-17 | 1985-12-01 | Syntex Inc | Procedimiento para la preparacion de alfa-aminoacidos alfa-alenicos |
| US4912232A (en) * | 1983-10-14 | 1990-03-27 | Dow Chemical Company | Preparation of N-hydrocarbylcarbonyl-5-(1-hydrocarbylcarbonyloxy)hydrocarbyl-pyrrolidin-2-one |
| US4632994A (en) * | 1983-11-04 | 1986-12-30 | Gruppo Lepetit S.P.A. | Process for decomposing N-oxide derivatives producing 5-vinyl-2-pyrrolidones |
| AU629419B2 (en) * | 1989-11-07 | 1992-10-01 | Aventis Inc. | Process for the production of vinyl-gaba |
| DE4010709A1 (de) * | 1990-04-03 | 1991-10-10 | Huels Chemische Werke Ag | Verfahren zur herstellung von 3-carboxamido-5-vinyl-2-pyrrolidon |
| EP0546230A1 (en) * | 1991-12-10 | 1993-06-16 | Merrell Dow Pharmaceuticals Inc. | Novel process for preparing 4-amino-5-hexenoic acid |
| ITMI20060179A1 (it) | 2006-02-02 | 2007-08-03 | Abiogen Pharma Spa | Procedimento per la risoluzione di miscele racemiche e complesso diastereoisomerico di un agente risolvente e di unantiomero di interesse |
| EP2537827B1 (en) | 2011-06-24 | 2014-06-11 | Targeon SAS | Process for preparing 4-amino-5-hexenoic acid from succinimide |
| CN110713440B (zh) * | 2018-07-11 | 2022-01-25 | 武汉武药科技有限公司 | 一种氨己烯酸的制备方法 |
| CN112707832B (zh) * | 2019-10-25 | 2022-07-05 | 武汉武药科技有限公司 | 氨己烯酸及其制备方法 |
| CN116621720B (zh) * | 2023-07-21 | 2023-10-27 | 成都硕德药业有限公司 | 一种氨己烯酸的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960927A (en) * | 1975-03-18 | 1976-06-01 | Richardson-Merrell Inc. | Olefinic derivatives of amino acids |
| US3959356A (en) * | 1975-03-18 | 1976-05-25 | Richardson-Merrell Inc. | Acetylene derivatives of amino acids |
-
1978
- 1978-01-30 US US05/873,273 patent/US4178463A/en not_active Expired - Lifetime
- 1978-12-15 AU AU42601/78A patent/AU520802B2/en not_active Expired
- 1978-12-18 NZ NZ189213A patent/NZ189213A/xx unknown
- 1978-12-19 IL IL56254A patent/IL56254A/xx unknown
- 1978-12-19 ZA ZA00787116A patent/ZA787116B/xx unknown
- 1978-12-20 PH PH21973A patent/PH14716A/en unknown
- 1978-12-28 SE SE7813352A patent/SE430889B/sv not_active IP Right Cessation
- 1978-12-29 CA CA318,833A patent/CA1132992A/en not_active Expired
-
1979
- 1979-01-03 NL NL7900028A patent/NL7900028A/xx active Search and Examination
- 1979-01-04 PT PT69026A patent/PT69026A/pt unknown
- 1979-01-16 DK DK18179A patent/DK18179A/da not_active Application Discontinuation
- 1979-01-17 ES ES476919A patent/ES476919A1/es not_active Expired
- 1979-01-23 DE DE19792902438 patent/DE2902438A1/de active Granted
- 1979-01-25 JP JP663379A patent/JPS54112860A/ja active Granted
- 1979-01-26 FR FR7902087A patent/FR2415630A1/fr active Granted
- 1979-01-26 IT IT47795/79A patent/IT1116500B/it active Protection Beyond IP Right Term
- 1979-01-26 CH CH81979A patent/CH640224A5/de not_active IP Right Cessation
- 1979-01-29 BE BE193125A patent/BE873766A/xx not_active IP Right Cessation
- 1979-01-29 GB GB793066A patent/GB2013205B/en not_active Expired
- 1979-01-29 NO NO790285A patent/NO150155C/no unknown
- 1979-01-30 IE IE111/79A patent/IE47782B1/en unknown
- 1979-07-11 ES ES482414A patent/ES482414A1/es not_active Expired
- 1979-07-11 ES ES482415A patent/ES482415A1/es not_active Expired
-
1981
- 1981-07-08 PH PH25878A patent/PH24034A/en unknown
- 1981-07-08 PH PH25883A patent/PH19618A/en unknown
-
1982
- 1982-12-21 SE SE8207302A patent/SE449358B/sv unknown
-
1986
- 1986-10-18 JP JP61248261A patent/JPS62187440A/ja active Granted
-
1987
- 1987-07-30 HK HK553/87A patent/HK55387A/xx not_active IP Right Cessation
-
1988
- 1988-10-03 DK DK551388A patent/DK551388A/da not_active Application Discontinuation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1132992A (en) | 2-pyrrolidone compounds and processes employing same | |
| DE69228073T2 (de) | Prozess zur darstellung von (5r)-1,1-dimethylethyl-6-cyano-5-oxo-hexanoaten | |
| EP0744400B1 (en) | Process for producing 4-trifluoromethylnicotinic acid | |
| US4321387A (en) | Process for the preparation of optically active nicotine analogs | |
| KR20190034582A (ko) | 스피로케탈-치환된 사이클릭 케토에놀의 제조 방법 | |
| KR100236237B1 (ko) | 2-아릴-3-치환-5-(트리플루오로메틸)피롤화합물의제조방법 | |
| US4235778A (en) | 2-Pyrrolidone compounds and processes for making same | |
| US4254284A (en) | Process for preparing 4-aminohex-5-ynoic acid | |
| US4434296A (en) | Process for preparing intermediates for antiatherosclerotic compounds | |
| DE3889957T2 (de) | Verfahren zur Herstellung von (+)-1,2-Dihydro-3H-pyrrolo[1,2-a]-pyrrol-1-carbonsäure und verwandten Verbindungen. | |
| US4827020A (en) | Propargyl amide precursor to 1-propargyl-2,4-dioxoimidazolidine | |
| US4212804A (en) | Process for the preparation of optionally substituted 2,3-indolinediones | |
| DE69623117T2 (de) | Verfahren zur herstellung von 4-hydroxy-2-pyrrolidon | |
| KR0171221B1 (ko) | N-2-클로로벤질-2-옥소 및 n-2-클로로벤질-2, 2-디옥소-1,2,3-옥사티아졸리딘 유도체, 그 제조방법 및 그로부터 합성되는 티에노 [3,2-c]피리딘 유도체의 제조방법 | |
| CA1121823A (en) | 1-pyrrole-and 1-pyrrolidine-carboxylic acid derivatives and process for preparing the same | |
| CA1050556A (en) | Aminopyrrole derivatives | |
| US4923993A (en) | Process for the preparation of 2-pyridinecarboxylic acid derivatives and 1-amino-1,4-dihydropyridine-2-carboxylic acid derivatives | |
| FI88292C (fi) | Foerfarande foer framstaellning av n-(sulfonylmetyl)formamider | |
| SK113598A3 (en) | Process for the preparation of heteroarylcarboxylic amides and esters | |
| FI113859B (fi) | Uusia menetelmiä (S)-4-amino-hepta-5,6-dieenihapon ja sen välituotteiden valmistamiseksi sekä uudet välituotteet | |
| GB1580203A (en) | Preparation of cyclopropane derivatives | |
| KR0145401B1 (ko) | 실릴아크릴레이트 유도체 및 그 제조방법 | |
| US4849526A (en) | Process for preparing (±)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates | |
| US4874872A (en) | Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-A]pyrrole-1,7-dicarboxylates | |
| DK163180B (da) | P-nitrophenyl-3-brom-2,3-diethoxypropionat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19991005 |