SE430888B - Optiskt aktiv vensterroterande n-(1-etyl-2-pyrrolidinyl-metyl)-2-metoxi-5-sulfamoylbensamid och forfarande att framstella denna - Google Patents
Optiskt aktiv vensterroterande n-(1-etyl-2-pyrrolidinyl-metyl)-2-metoxi-5-sulfamoylbensamid och forfarande att framstella dennaInfo
- Publication number
- SE430888B SE430888B SE7901337A SE7901337A SE430888B SE 430888 B SE430888 B SE 430888B SE 7901337 A SE7901337 A SE 7901337A SE 7901337 A SE7901337 A SE 7901337A SE 430888 B SE430888 B SE 430888B
- Authority
- SE
- Sweden
- Prior art keywords
- ethyl
- levo
- methoxy
- pyrrolidinylmethyl
- process according
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 15
- -1 1-ETHYL-2-PYRROLIDINYL-METHYL Chemical class 0.000 title description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 10
- 239000000243 solution Substances 0.000 claims description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 6
- GNMSLDIYJOSUSW-LURJTMIESA-N N-acetyl-L-proline Chemical compound CC(=O)N1CCC[C@H]1C(O)=O GNMSLDIYJOSUSW-LURJTMIESA-N 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- BGRJTUBHPOOWDU-UHFFFAOYSA-N sulpiride Chemical compound CCN1CCCC1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-UHFFFAOYSA-N 0.000 claims description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 3
- 229910010082 LiAlH Inorganic materials 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- ZQSFLXDMGBSJKV-UHFFFAOYSA-N ethyl 2-methoxy-5-sulfamoylbenzoate Chemical compound CCOC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC ZQSFLXDMGBSJKV-UHFFFAOYSA-N 0.000 claims description 2
- 229910052987 metal hydride Inorganic materials 0.000 claims description 2
- 150000004681 metal hydrides Chemical class 0.000 claims description 2
- OPXOXISNSVAALO-UHFFFAOYSA-N 1-ethyl-6-methoxy-6-(pyrrolidin-1-ylmethyl)-3-sulfamoylcyclohexa-2,4-diene-1-carboxamide Chemical compound C(C)C1(C(=O)N)C(C=CC(=C1)S(N)(=O)=O)(OC)CN1CCCC1 OPXOXISNSVAALO-UHFFFAOYSA-N 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- GHQCZUMSSZNLJP-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanol Chemical compound CCN1CCCC1CO GHQCZUMSSZNLJP-UHFFFAOYSA-N 0.000 description 2
- BGRJTUBHPOOWDU-NSHDSACASA-N (S)-(-)-sulpiride Chemical compound CCN1CCC[C@H]1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-NSHDSACASA-N 0.000 description 2
- SQAILWDRVDGLGY-UHFFFAOYSA-N 2-methoxy-5-sulfamoylbenzoic acid Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1C(O)=O SQAILWDRVDGLGY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229960004940 sulpiride Drugs 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000012345 acetylating agent Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 238000011978 dissolution method Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT20295/78A IT1095415B (it) | 1978-02-16 | 1978-02-16 | Processo per la produzione di una benzamide otticamente attiva,benzamide otticamente attiva cosi'ottenuta e composizioni |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7901337L SE7901337L (sv) | 1979-08-17 |
| SE430888B true SE430888B (sv) | 1983-12-19 |
Family
ID=11165504
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7901337A SE430888B (sv) | 1978-02-16 | 1979-02-15 | Optiskt aktiv vensterroterande n-(1-etyl-2-pyrrolidinyl-metyl)-2-metoxi-5-sulfamoylbensamid och forfarande att framstella denna |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS54130562A (cs) |
| AT (1) | AT373870B (cs) |
| CA (1) | CA1097662A (cs) |
| CH (1) | CH639951A5 (cs) |
| DE (1) | DE2903891A1 (cs) |
| DK (1) | DK152752C (cs) |
| EG (1) | EG14440A (cs) |
| FR (1) | FR2417498A1 (cs) |
| GB (1) | GB2014990B (cs) |
| GR (1) | GR78220B (cs) |
| IT (1) | IT1095415B (cs) |
| MX (1) | MX5632E (cs) |
| NL (1) | NL190845C (cs) |
| SE (1) | SE430888B (cs) |
| YU (1) | YU41145B (cs) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1141095B (it) * | 1980-11-27 | 1986-10-01 | Ravizza Spa | Processo di risoluzione della sulpiride racema |
| EP0088849A1 (fr) * | 1982-03-11 | 1983-09-21 | Choay S.A. | Isomères lévogyres de composés benzènesulfonamides N-substitués, leur procédé de préparation et compositions pharmaceutiques les contenant |
| SE8602339D0 (sv) * | 1986-05-22 | 1986-05-22 | Astra Laekemedel Ab | An efficient stereoconservative synthesis of 1-substituted (s)- and (r)-2-aminomethylpyrrolidines |
| DE4103451C2 (de) * | 1991-02-02 | 1994-08-25 | Hormosan Kwizda Gmbh | Verwendungen des Wirkstoffes Sulpirid in seiner R- bzw. S-Form |
| WO2003055857A1 (en) * | 2001-12-28 | 2003-07-10 | Farmaceutsko-Hemijska Industrija 'zdravlje' | A process for synthesis of heterocyclic aminoalkyl benzamides |
| USD580771S1 (en) * | 2004-08-13 | 2008-11-18 | Saverglass Inc. | Bottle |
| USD553009S1 (en) * | 2004-09-14 | 2007-10-16 | Drogheria E Alimentari S.R.L | Bottle with an inserted jar |
| USD545205S1 (en) * | 2005-09-21 | 2007-06-26 | Saverglass Inc. | Bottle |
| ITMI20051943A1 (it) * | 2005-10-14 | 2007-04-15 | Procos Spa | Processo di risoluzione anantiomerica di 2-aminometil-pirrolidine 1-sostitute per ammidazione in presenza di lipasi |
| CL2012000874S1 (es) | 2012-01-31 | 2013-03-22 | Saverglass | Botella de cuerpo paralelepipedico rectangular ahusado orientado de forma vertical, con su parte mas angosta situada en el extremo inferior, tiene todos su bordes curvos, en su extremo superior forma una superficie rectangular con sus lados convexos, la cual esta unida al cuello de botella mediante ligeras pendientes. |
| CN103772256B (zh) * | 2012-10-24 | 2017-10-10 | 江苏天士力帝益药业有限公司 | 一种高纯度舒必利或其光学异构体的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3891671A (en) * | 1968-08-01 | 1975-06-24 | Ile De France | N-(2-pyrrolidyl or piperidyl alkyl)-4-hydroxy benzamides |
| CH605793A5 (fr) * | 1974-03-05 | 1978-10-13 | Soc Et Scient Et Ind | Procédé de préparation de nouveaux N-(1benzylpyrrollidinil 2-alkyl) benzamides substitués |
| FR2393794A2 (fr) * | 1977-06-06 | 1979-01-05 | Synthelabo | Preparation de methoxy-2 benzamides |
| FR2394529A2 (fr) * | 1977-06-13 | 1979-01-12 | Synthelabo | Methoxy-2 benzamides et leur application en therapeutique |
| IL52645A (en) * | 1976-08-05 | 1980-02-29 | Synthelabo | Optically active 1 substituted 2 aminomethyl pyrrolidines stereospecifics synthesis thereof and process for the preparation of optically active 2 methoxy n pyrrolidylmethyl benzamides |
| JPS5365875A (en) * | 1976-11-24 | 1978-06-12 | Teijin Ltd | Preparation of benzenesulfone amide derivs. |
-
1978
- 1978-02-16 IT IT20295/78A patent/IT1095415B/it active
-
1979
- 1979-02-01 DE DE19792903891 patent/DE2903891A1/de active Granted
- 1979-02-05 GB GB7903902A patent/GB2014990B/en not_active Expired
- 1979-02-08 FR FR7903216A patent/FR2417498A1/fr active Granted
- 1979-02-12 YU YU308/79A patent/YU41145B/xx unknown
- 1979-02-13 JP JP1441979A patent/JPS54130562A/ja active Pending
- 1979-02-13 AT AT0110179A patent/AT373870B/de not_active IP Right Cessation
- 1979-02-13 MX MX797713U patent/MX5632E/es unknown
- 1979-02-14 CH CH142779A patent/CH639951A5/de not_active IP Right Cessation
- 1979-02-14 EG EG97/79A patent/EG14440A/xx active
- 1979-02-15 GR GR58375A patent/GR78220B/el unknown
- 1979-02-15 SE SE7901337A patent/SE430888B/sv not_active IP Right Cessation
- 1979-02-15 DK DK066579A patent/DK152752C/da not_active IP Right Cessation
- 1979-02-16 CA CA321,673A patent/CA1097662A/en not_active Expired
- 1979-02-16 NL NL7901251A patent/NL190845C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL190845C (nl) | 1994-09-16 |
| DE2903891A1 (de) | 1979-08-23 |
| SE7901337L (sv) | 1979-08-17 |
| YU30879A (en) | 1983-02-28 |
| YU41145B (en) | 1986-12-31 |
| FR2417498B1 (cs) | 1983-01-21 |
| EG14440A (en) | 1984-03-31 |
| DK66579A (da) | 1979-08-17 |
| MX5632E (es) | 1983-11-15 |
| DK152752B (da) | 1988-05-09 |
| NL190845B (nl) | 1994-04-18 |
| JPS54130562A (en) | 1979-10-09 |
| IT1095415B (it) | 1985-08-10 |
| GB2014990B (en) | 1982-06-09 |
| NL7901251A (nl) | 1979-08-20 |
| DK152752C (da) | 1988-09-26 |
| IT7820295A0 (it) | 1978-02-16 |
| ATA110179A (de) | 1983-07-15 |
| FR2417498A1 (fr) | 1979-09-14 |
| CA1097662A (en) | 1981-03-17 |
| AT373870B (de) | 1984-02-27 |
| GR78220B (cs) | 1984-09-26 |
| GB2014990A (en) | 1979-09-05 |
| DE2903891C2 (cs) | 1992-02-06 |
| CH639951A5 (de) | 1983-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| US3242190A (en) | 3-hydroxy-5-aminomethylisoxazole compounds | |
| SE430888B (sv) | Optiskt aktiv vensterroterande n-(1-etyl-2-pyrrolidinyl-metyl)-2-metoxi-5-sulfamoylbensamid och forfarande att framstella denna | |
| CN112679498B (zh) | 磺酸季铵盐化合物及其制备方法和用途 | |
| JPH0674243B2 (ja) | 光学純度の高い光学活性アテノロール塩及びアテノロールの製法 | |
| EP3524592B1 (en) | Method for preparing a phenylalanine compound | |
| KR102836734B1 (ko) | 소디움 타우로디옥시콜레이트의 대량 생산 방법 | |
| CA1085420A (en) | 1-aminomethyl-1-cycloalkane-acetic acid | |
| UA73472C2 (en) | A method for producing n-methyl-n-[(1s)-1-phenyl-2-((3s)-3-hydroxypyrrolidine-1-yl)ethyl]-2,2-diphenyl acetamide | |
| Tipson | N, N-phthaloyl-L-glutamic acid and some derivatives | |
| EP0382506B1 (en) | Optically active diastereomer salts of tetrahydro-2-furoic acid | |
| EP0053584B1 (en) | Raceme sulpiride resolution process | |
| US6087499A (en) | Process for producing 5-perfluoroalkyluracil derivatives | |
| US2762841A (en) | Process of producing l-glutamine | |
| US4010160A (en) | Process for the manufacture of 1,3-bis-(β-ethylhexyl)-5-amino-5-methyl-hexahydropyrimidine | |
| JP7693921B2 (ja) | プロリンアミド化合物の製造方法 | |
| US2515465A (en) | Preparation of 2-alkyl-4-isopropylidene-5(4)-oxazolones | |
| EP0293244A2 (en) | N epsilon-trifluoroacetyl-L-lysyl-L-proline.D-1O-camphorsulfonic acid salt and process for producing the same | |
| US4048169A (en) | 1,3-Bis-(β-ethylhexyl)-5-nitro-5-methyl-hexahydropyrimidine-naphthalene-1,5-disulphonate | |
| EP0484742A1 (en) | 2-Chloropropionaldehyde trimer and production process thereof | |
| US3178437A (en) | Process for simultaneously producing prolinols and 3-hydroxy-piperidines | |
| EP0406567A2 (en) | Process for the production of sulfonium compounds and novel methylthiophenol derivatives | |
| US2517496A (en) | Preparation of symmetrical monoaminodihydroxytoluene | |
| KR800001178B1 (ko) | 아세토 나이트릴유도체의 제조방법 | |
| CZ296992B6 (cs) | Príprava a izolace 2-substituovaných-3-pyridylkarboxylových kyselin, jejich karboxylových solí a produktu redukce |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7901337-1 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7901337-1 Format of ref document f/p: F |