SA00200911B1 - عملية لإنتاج حمض الخل acetic acid - Google Patents
عملية لإنتاج حمض الخل acetic acid Download PDFInfo
- Publication number
- SA00200911B1 SA00200911B1 SA00200911A SA00200911A SA00200911B1 SA 00200911 B1 SA00200911 B1 SA 00200911B1 SA 00200911 A SA00200911 A SA 00200911A SA 00200911 A SA00200911 A SA 00200911A SA 00200911 B1 SA00200911 B1 SA 00200911B1
- Authority
- SA
- Saudi Arabia
- Prior art keywords
- methanol
- methyl acetate
- carbon monoxide
- control unit
- acetic acid
- Prior art date
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 title claims abstract description 84
- 238000000034 method Methods 0.000 title claims abstract description 26
- 230000008569 process Effects 0.000 title claims abstract description 17
- 238000004519 manufacturing process Methods 0.000 title description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims abstract description 180
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 40
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 37
- 238000006243 chemical reaction Methods 0.000 claims abstract description 33
- 239000000203 mixture Substances 0.000 claims abstract description 32
- 239000003054 catalyst Substances 0.000 claims abstract description 31
- 239000007788 liquid Substances 0.000 claims abstract description 31
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims abstract description 28
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims abstract description 27
- 238000005810 carbonylation reaction Methods 0.000 claims abstract description 26
- 230000006315 carbonylation Effects 0.000 claims abstract description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 19
- -1 hydrocarbyl halide Chemical class 0.000 claims abstract description 12
- 238000012544 monitoring process Methods 0.000 claims abstract description 8
- 230000004044 response Effects 0.000 claims abstract description 7
- 229910000510 noble metal Inorganic materials 0.000 claims abstract description 6
- 238000010924 continuous production Methods 0.000 claims abstract description 4
- 229910052741 iridium Inorganic materials 0.000 claims description 12
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 11
- 239000007789 gas Substances 0.000 claims description 10
- 229910052703 rhodium Inorganic materials 0.000 claims description 10
- 239000010948 rhodium Substances 0.000 claims description 10
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 10
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 8
- 229910052707 ruthenium Inorganic materials 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 229910052762 osmium Inorganic materials 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 229910052733 gallium Inorganic materials 0.000 claims description 3
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 3
- LYYBDUVEZRFROU-UHFFFAOYSA-N [W].[In] Chemical compound [W].[In] LYYBDUVEZRFROU-UHFFFAOYSA-N 0.000 claims 1
- 230000000977 initiatory effect Effects 0.000 claims 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 abstract description 4
- 150000001875 compounds Chemical class 0.000 description 21
- 229910052751 metal Inorganic materials 0.000 description 8
- 239000002184 metal Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 6
- 150000004694 iodide salts Chemical class 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 238000005755 formation reaction Methods 0.000 description 5
- 230000007423 decrease Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- JKNHZOAONLKYQL-UHFFFAOYSA-K tribromoindigane Chemical compound Br[In](Br)Br JKNHZOAONLKYQL-UHFFFAOYSA-K 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- FYWVTSQYJIPZLW-UHFFFAOYSA-K diacetyloxygallanyl acetate Chemical compound [Ga+3].CC([O-])=O.CC([O-])=O.CC([O-])=O FYWVTSQYJIPZLW-UHFFFAOYSA-K 0.000 description 2
- OAGAGESCFZXSJR-UHFFFAOYSA-L dichloroosmium Chemical compound Cl[Os]Cl OAGAGESCFZXSJR-UHFFFAOYSA-L 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910021513 gallium hydroxide Inorganic materials 0.000 description 2
- SRVXDMYFQIODQI-UHFFFAOYSA-K gallium(iii) bromide Chemical compound Br[Ga](Br)Br SRVXDMYFQIODQI-UHFFFAOYSA-K 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- KZLHPYLCKHJIMM-UHFFFAOYSA-K iridium(3+);triacetate Chemical compound [Ir+3].CC([O-])=O.CC([O-])=O.CC([O-])=O KZLHPYLCKHJIMM-UHFFFAOYSA-K 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical group [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000007670 refining Methods 0.000 description 2
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- DMRVBCXRFYZCPR-PGUQZTAYSA-L (5Z)-cycloocta-1,5-diene dichlororuthenium Chemical compound Cl[Ru]Cl.C1C\C=C/CCC=C1 DMRVBCXRFYZCPR-PGUQZTAYSA-L 0.000 description 1
- ZVYYAYJIGYODSD-LNTINUHCSA-K (z)-4-bis[[(z)-4-oxopent-2-en-2-yl]oxy]gallanyloxypent-3-en-2-one Chemical compound [Ga+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O ZVYYAYJIGYODSD-LNTINUHCSA-K 0.000 description 1
- SNCQSZKBYORHGB-UHFFFAOYSA-N 2-methylpyridin-1-ium;iodide Chemical class [I-].CC1=CC=CC=[NH+]1 SNCQSZKBYORHGB-UHFFFAOYSA-N 0.000 description 1
- 229940101798 4-cymene Drugs 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910005258 GaBr3 Inorganic materials 0.000 description 1
- 108010001517 Galectin 3 Proteins 0.000 description 1
- 102100039558 Galectin-3 Human genes 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 229910021621 Indium(III) iodide Inorganic materials 0.000 description 1
- JRVCVMZVAVVPLX-UHFFFAOYSA-N O=[Os](=O)=O Chemical compound O=[Os](=O)=O JRVCVMZVAVVPLX-UHFFFAOYSA-N 0.000 description 1
- 229910021603 Ruthenium iodide Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- ROZSPJBPUVWBHW-UHFFFAOYSA-N [Ru]=O Chemical class [Ru]=O ROZSPJBPUVWBHW-UHFFFAOYSA-N 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- VNBCLZZFHLADIG-UHFFFAOYSA-K butanoate ruthenium(3+) Chemical compound [Ru+3].CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O VNBCLZZFHLADIG-UHFFFAOYSA-K 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- JYHHJVKGDCZCCL-UHFFFAOYSA-J carbon monoxide;dichlororuthenium Chemical compound [O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].Cl[Ru]Cl.Cl[Ru]Cl JYHHJVKGDCZCCL-UHFFFAOYSA-J 0.000 description 1
- VUBLMKVEIPBYME-UHFFFAOYSA-N carbon monoxide;osmium Chemical group [Os].[Os].[Os].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] VUBLMKVEIPBYME-UHFFFAOYSA-N 0.000 description 1
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical group [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- JIXOCHSERUXVMW-UHFFFAOYSA-M chlororuthenium Chemical compound [Ru]Cl JIXOCHSERUXVMW-UHFFFAOYSA-M 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- VBXWCGWXDOBUQZ-UHFFFAOYSA-K diacetyloxyindiganyl acetate Chemical compound [In+3].CC([O-])=O.CC([O-])=O.CC([O-])=O VBXWCGWXDOBUQZ-UHFFFAOYSA-K 0.000 description 1
- HBIHVBJJZAHVLE-UHFFFAOYSA-L dibromoruthenium Chemical compound Br[Ru]Br HBIHVBJJZAHVLE-UHFFFAOYSA-L 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002964 excitative effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- DNUARHPNFXVKEI-UHFFFAOYSA-K gallium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[Ga+3] DNUARHPNFXVKEI-UHFFFAOYSA-K 0.000 description 1
- DWRNSCDYNYYYHT-UHFFFAOYSA-K gallium(iii) iodide Chemical compound I[Ga](I)I DWRNSCDYNYYYHT-UHFFFAOYSA-K 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- SKWCWFYBFZIXHE-UHFFFAOYSA-K indium acetylacetonate Chemical compound CC(=O)C=C(C)O[In](OC(C)=CC(C)=O)OC(C)=CC(C)=O SKWCWFYBFZIXHE-UHFFFAOYSA-K 0.000 description 1
- PSCMQHVBLHHWTO-UHFFFAOYSA-K indium(iii) chloride Chemical compound Cl[In](Cl)Cl PSCMQHVBLHHWTO-UHFFFAOYSA-K 0.000 description 1
- IGUXCTSQIGAGSV-UHFFFAOYSA-K indium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[In+3] IGUXCTSQIGAGSV-UHFFFAOYSA-K 0.000 description 1
- ZMFWDTJZHRDHNW-UHFFFAOYSA-N indium;trihydrate Chemical compound O.O.O.[In] ZMFWDTJZHRDHNW-UHFFFAOYSA-N 0.000 description 1
- 229910001505 inorganic iodide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002504 iridium compounds Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- BJDYCCHRZIFCGN-UHFFFAOYSA-N pyridin-1-ium;iodide Chemical class I.C1=CC=NC=C1 BJDYCCHRZIFCGN-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- BPEVHDGLPIIAGH-UHFFFAOYSA-N ruthenium(3+) Chemical compound [Ru+3] BPEVHDGLPIIAGH-UHFFFAOYSA-N 0.000 description 1
- BNBKCTCLPAQLAH-UHFFFAOYSA-K ruthenium(3+) triformate Chemical compound [Ru+3].[O-]C=O.[O-]C=O.[O-]C=O BNBKCTCLPAQLAH-UHFFFAOYSA-K 0.000 description 1
- LJZVDOUZSMHXJH-UHFFFAOYSA-K ruthenium(3+);triiodide Chemical compound [Ru+3].[I-].[I-].[I-] LJZVDOUZSMHXJH-UHFFFAOYSA-K 0.000 description 1
- IREVRWRNACELSM-UHFFFAOYSA-J ruthenium(4+);tetrachloride Chemical compound Cl[Ru](Cl)(Cl)Cl IREVRWRNACELSM-UHFFFAOYSA-J 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- ZTWIEIFKPFJRLV-UHFFFAOYSA-K trichlororuthenium;trihydrate Chemical compound O.O.O.Cl[Ru](Cl)Cl ZTWIEIFKPFJRLV-UHFFFAOYSA-K 0.000 description 1
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/10—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide
- C07C51/12—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide on an oxygen-containing group in organic compounds, e.g. alcohols
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB9825424.6A GB9825424D0 (en) | 1998-11-19 | 1998-11-19 | Process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SA00200911B1 true SA00200911B1 (ar) | 2006-10-11 |
Family
ID=10842740
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SA00200911A SA00200911B1 (ar) | 1998-11-19 | 2000-01-31 | عملية لإنتاج حمض الخل acetic acid |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP1002785B1 (cg-RX-API-DMAC7.html) |
| JP (2) | JP5186069B2 (cg-RX-API-DMAC7.html) |
| KR (1) | KR100642565B1 (cg-RX-API-DMAC7.html) |
| CN (1) | CN1205164C (cg-RX-API-DMAC7.html) |
| CA (1) | CA2290011C (cg-RX-API-DMAC7.html) |
| DE (1) | DE69907607T2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB9825424D0 (cg-RX-API-DMAC7.html) |
| ID (1) | ID23849A (cg-RX-API-DMAC7.html) |
| MY (1) | MY120082A (cg-RX-API-DMAC7.html) |
| RS (1) | RS49627B (cg-RX-API-DMAC7.html) |
| RU (1) | RU2220130C2 (cg-RX-API-DMAC7.html) |
| SA (1) | SA00200911B1 (cg-RX-API-DMAC7.html) |
| SG (1) | SG82036A1 (cg-RX-API-DMAC7.html) |
| TW (1) | TW498065B (cg-RX-API-DMAC7.html) |
| UA (1) | UA69382C2 (cg-RX-API-DMAC7.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2826960B1 (fr) * | 2001-07-03 | 2005-10-21 | Acetex Chimie | Procede de controle d'une production d'acide acetique et/ou d'acetate de methyle en continu |
| US6677480B2 (en) * | 2002-01-28 | 2004-01-13 | Celanese International Corporation | Process control in production of acetic acid via use of heavy phase density measurement |
| GB0221800D0 (en) | 2002-09-19 | 2002-10-30 | Bp Chem Int Ltd | Process |
| US7005541B2 (en) * | 2002-12-23 | 2006-02-28 | Celanese International Corporation | Low water methanol carbonylation process for high acetic acid production and for water balance control |
| GB0311091D0 (en) * | 2003-05-14 | 2003-06-18 | Bp Chem Int Ltd | Process |
| GB0427821D0 (en) * | 2004-12-17 | 2005-01-19 | Bp Chem Int Ltd | Catalyst and process |
| US7767848B2 (en) | 2005-02-08 | 2010-08-03 | Celanese International Corporation | Method of controlling acetic acid process |
| GB0601865D0 (en) * | 2006-01-30 | 2006-03-08 | Bp Chem Int Ltd | Process |
| CN101928211B (zh) * | 2009-06-26 | 2013-06-12 | 上海焦化有限公司 | 一种羰化合成乙酸的方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4039395A (en) * | 1975-08-11 | 1977-08-02 | Monsanto Company | Purification of acetic acid |
| US4111982A (en) * | 1976-07-26 | 1978-09-05 | Monsanto Company | Coproduction of acetic and propionic acids |
| CA1228867A (en) * | 1984-05-03 | 1987-11-03 | Celanese Corporation | Methanol carbonylation process |
| GB8904125D0 (en) * | 1989-02-23 | 1989-04-05 | British Petroleum Co Plc | Process for preparing carboxylic acids |
| AU639630B2 (en) * | 1991-01-28 | 1993-07-29 | Celanese International Corporation | Removal of carbonyl impurities from carbonylation process stream |
| GB9211671D0 (en) * | 1992-06-02 | 1992-07-15 | Bp Chem Int Ltd | Process |
| US5672743A (en) * | 1993-09-10 | 1997-09-30 | Bp Chemicals Limited | Process for the production of acetic acid |
| BR9401362A (pt) * | 1993-03-31 | 1994-11-01 | Rhone Poulenc Chimie | Processo de preparação de ácidos carboxílicos, ou dos ésteres correspondentes |
| US5352415A (en) * | 1993-09-29 | 1994-10-04 | Hoechst Celanese Corporation | Control system for acetic acid manufacturing process |
| US5374774A (en) * | 1994-03-11 | 1994-12-20 | Hoechst Celanese Corporation | Control system for an acetic acid manufacturing process |
| US5696284A (en) * | 1995-06-21 | 1997-12-09 | Bp Chemicals Limited | Process for the carbonylation of alkyl alcohols and/or reactive derivatives thereof |
| GB9626324D0 (en) * | 1996-12-19 | 1997-02-05 | Bp Chem Int Ltd | Process |
-
1998
- 1998-11-19 GB GBGB9825424.6A patent/GB9825424D0/en not_active Ceased
-
1999
- 1999-11-04 DE DE69907607T patent/DE69907607T2/de not_active Expired - Lifetime
- 1999-11-04 EP EP99308792A patent/EP1002785B1/en not_active Expired - Lifetime
- 1999-11-15 KR KR1019990050634A patent/KR100642565B1/ko not_active Expired - Fee Related
- 1999-11-15 TW TW088119848A patent/TW498065B/zh not_active IP Right Cessation
- 1999-11-16 SG SG9905752A patent/SG82036A1/en unknown
- 1999-11-17 CA CA002290011A patent/CA2290011C/en not_active Expired - Fee Related
- 1999-11-17 RS YUP-594/99A patent/RS49627B/sr unknown
- 1999-11-18 JP JP32873299A patent/JP5186069B2/ja not_active Expired - Fee Related
- 1999-11-18 RU RU99124420/04A patent/RU2220130C2/ru not_active IP Right Cessation
- 1999-11-19 ID IDP991076A patent/ID23849A/id unknown
- 1999-11-19 MY MYPI99005069A patent/MY120082A/en unknown
- 1999-11-19 CN CNB991277430A patent/CN1205164C/zh not_active Expired - Fee Related
- 1999-11-19 UA UA99116309A patent/UA69382C2/uk unknown
-
2000
- 2000-01-31 SA SA00200911A patent/SA00200911B1/ar unknown
-
2010
- 2010-08-09 JP JP2010178899A patent/JP5356334B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JP5356334B2 (ja) | 2013-12-04 |
| YU59499A (sh) | 2002-06-19 |
| CA2290011C (en) | 2009-05-26 |
| ID23849A (id) | 2000-05-25 |
| DE69907607T2 (de) | 2004-01-22 |
| JP2000154162A (ja) | 2000-06-06 |
| RS49627B (sr) | 2007-08-03 |
| KR100642565B1 (ko) | 2006-11-13 |
| SG82036A1 (en) | 2001-07-24 |
| JP5186069B2 (ja) | 2013-04-17 |
| CA2290011A1 (en) | 2000-05-19 |
| UA69382C2 (uk) | 2004-09-15 |
| JP2010248272A (ja) | 2010-11-04 |
| RU2220130C2 (ru) | 2003-12-27 |
| MY120082A (en) | 2005-08-30 |
| DE69907607D1 (de) | 2003-06-12 |
| EP1002785A1 (en) | 2000-05-24 |
| CN1205164C (zh) | 2005-06-08 |
| KR20000035480A (ko) | 2000-06-26 |
| CN1268504A (zh) | 2000-10-04 |
| TW498065B (en) | 2002-08-11 |
| EP1002785B1 (en) | 2003-05-07 |
| GB9825424D0 (en) | 1999-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6255527B1 (en) | Carbonylation of methanol to acetic acid with carbon monoxide flow controls | |
| JP3884504B2 (ja) | アルキルアルコールおよび/またはその反応性誘導体のカルボニル化方法 | |
| JP5356334B2 (ja) | 酢酸の製造方法 | |
| US9227902B2 (en) | Compositions for carboxylic acid production and methods for making and using same | |
| MXPA96002083A (es) | Proceso para la carbonilacion de alcoholes alquilicos y/o derivados reactivos de los mismos | |
| JPH10310548A (ja) | 酢酸の製造用イリジウム触媒カルボニル化方法 | |
| SA99200739B1 (ar) | عملية المعالجة الكربونيلية | |
| US7915446B2 (en) | Catalyst and process for the production of acetic acid | |
| CA2188217C (en) | Process for the production of acetic acid by the carbonylation of dimethyl ether | |
| CA2524981C (en) | Carbonylation process using metal-polydentate ligand catalysts | |
| KR20070106575A (ko) | 촉매 안정화제로서 하나 이상의 금속 염을 혼입시키는아세트산의 제조방법 | |
| US7692040B2 (en) | Process for the production of acetic acid | |
| EP1397337B1 (en) | Vapor-phase carbonylation of lower aliphatic alcohols using tin promoted iridium catalyst | |
| EP1979303B1 (en) | Process for the production of acetic acid | |
| EP1397207B1 (en) | Tin promoted iridium catalyst for carbonylation of lower alkyl alcohols | |
| EP0999198A1 (en) | Process for the production of acetic acid | |
| GB2333773A (en) | Production of acetic anhydride | |
| MXPA97010431A (en) | Catalytic process of catalyzed with iridio for the production of acid acet |