RU2337911C2 - Производные гуанидина и их применение в качестве антагонистов рецептора нейропептида ff - Google Patents
Производные гуанидина и их применение в качестве антагонистов рецептора нейропептида ff Download PDFInfo
- Publication number
- RU2337911C2 RU2337911C2 RU2005132308/04A RU2005132308A RU2337911C2 RU 2337911 C2 RU2337911 C2 RU 2337911C2 RU 2005132308/04 A RU2005132308/04 A RU 2005132308/04A RU 2005132308 A RU2005132308 A RU 2005132308A RU 2337911 C2 RU2337911 C2 RU 2337911C2
- Authority
- RU
- Russia
- Prior art keywords
- guanidine
- tetrahydrobenzothiazol
- formate
- methyl
- group
- Prior art date
Links
- 102000011015 Neuropeptide FF receptor Human genes 0.000 title claims abstract description 13
- 108010061550 Neuropeptide FF receptor Proteins 0.000 title claims abstract description 13
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical class NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 title description 29
- 239000002464 receptor antagonist Substances 0.000 title description 3
- 229940044551 receptor antagonist Drugs 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 119
- 150000003839 salts Chemical class 0.000 claims abstract description 26
- 208000002193 Pain Diseases 0.000 claims abstract description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 11
- 230000036407 pain Effects 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 239000003814 drug Substances 0.000 claims abstract description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 8
- 238000011282 treatment Methods 0.000 claims abstract description 7
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims abstract description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract description 6
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims abstract description 6
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229940079593 drug Drugs 0.000 claims abstract description 5
- 230000006386 memory function Effects 0.000 claims abstract description 5
- 230000036772 blood pressure Effects 0.000 claims abstract description 4
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims abstract description 4
- UMWKPIKCOCKMIH-UHFFFAOYSA-N 5,6,7,8-tetrahydro-4h-cyclohepta[d][1,3]thiazole Chemical compound C1CCCCC2=C1SC=N2 UMWKPIKCOCKMIH-UHFFFAOYSA-N 0.000 claims abstract description 3
- QCCKBDNIBZPFCH-UHFFFAOYSA-N 5,6-dihydro-4h-cyclopenta[d][1,3]thiazole Chemical group N1=CSC2=C1CCC2 QCCKBDNIBZPFCH-UHFFFAOYSA-N 0.000 claims abstract description 3
- 208000004454 Hyperalgesia Diseases 0.000 claims abstract description 3
- 208000035154 Hyperesthesia Diseases 0.000 claims abstract description 3
- 206010057852 Nicotine dependence Diseases 0.000 claims abstract description 3
- 208000025569 Tobacco Use disease Diseases 0.000 claims abstract description 3
- RMFVVPBBEDMZQI-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound C1CCCC2=C1N=CS2 RMFVVPBBEDMZQI-UHFFFAOYSA-N 0.000 claims abstract 2
- 230000008030 elimination Effects 0.000 claims abstract 2
- 238000003379 elimination reaction Methods 0.000 claims abstract 2
- 230000000506 psychotropic effect Effects 0.000 claims abstract 2
- 208000011580 syndromic disease Diseases 0.000 claims abstract 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims description 53
- 239000002253 acid Substances 0.000 claims description 24
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 9
- 150000007514 bases Chemical class 0.000 claims description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 6
- 239000003792 electrolyte Substances 0.000 claims description 4
- 235000013305 food Nutrition 0.000 claims description 4
- NDKWSGBHKXFNCC-UHFFFAOYSA-N 2-(4-butan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound CCC(C)C1CCCC2=C1N=C(NC(N)=N)S2 NDKWSGBHKXFNCC-UHFFFAOYSA-N 0.000 claims description 3
- QSOMFWDDWOFLBS-UHFFFAOYSA-N 2-(4-ethyl-4-methyl-6,7-dihydro-5h-1,3-benzothiazol-2-yl)guanidine Chemical compound CCC1(C)CCCC2=C1N=C(NC(N)=N)S2 QSOMFWDDWOFLBS-UHFFFAOYSA-N 0.000 claims description 3
- LYLYGOUPJRCBLS-UHFFFAOYSA-N 2-(4-methyl-4-propyl-6,7-dihydro-5h-1,3-benzothiazol-2-yl)guanidine Chemical compound CCCC1(C)CCCC2=C1N=C(NC(N)=N)S2 LYLYGOUPJRCBLS-UHFFFAOYSA-N 0.000 claims description 3
- ALIMGROCSLBETQ-UHFFFAOYSA-N 2-(4-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound CC(C)(C)C1CCCC2=C1N=C(NC(N)=N)S2 ALIMGROCSLBETQ-UHFFFAOYSA-N 0.000 claims description 3
- WLACEDJDTIXJHA-UHFFFAOYSA-N 2-(5,5,7-trimethyl-6,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1CC(C)(C)CC2=C1SC(NC(N)=N)=N2 WLACEDJDTIXJHA-UHFFFAOYSA-N 0.000 claims description 3
- KLFUHWVGNPXLLK-UHFFFAOYSA-N 2-(5,5-dimethyl-6,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C)(C)CCC2=C1N=C(NC(N)=N)S2 KLFUHWVGNPXLLK-UHFFFAOYSA-N 0.000 claims description 3
- JVACMLRJYVWKJM-UHFFFAOYSA-N 2-(5,5-dimethyl-6-phenyl-6,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1(C)CC=2N=C(NC(N)=N)SC=2CC1C1=CC=CC=C1 JVACMLRJYVWKJM-UHFFFAOYSA-N 0.000 claims description 3
- LNXDWHDZNHLNAB-UHFFFAOYSA-N 2-(5-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(CCCC)CCC2=C1N=C(NC(N)=N)S2 LNXDWHDZNHLNAB-UHFFFAOYSA-N 0.000 claims description 3
- GMABAPWOAXNDDE-UHFFFAOYSA-N 2-(5-butyl-5,6,7,8-tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-yl)guanidine Chemical compound C1C(CCCC)CCCC2=C1N=C(NC(N)=N)S2 GMABAPWOAXNDDE-UHFFFAOYSA-N 0.000 claims description 3
- ZYPREDXHNDNTCV-UHFFFAOYSA-N 2-(5-ethyl-5-methyl-6,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(CC)(C)CCC2=C1N=C(NC(N)=N)S2 ZYPREDXHNDNTCV-UHFFFAOYSA-N 0.000 claims description 3
- RDQBDBMPQLZPSN-UHFFFAOYSA-N 2-(5-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C)CCC2=C1N=C(NC(N)=N)S2 RDQBDBMPQLZPSN-UHFFFAOYSA-N 0.000 claims description 3
- AKOBTVQNQFUIFL-UHFFFAOYSA-N 2-(6,6-dimethyl-5,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C)(C)CCC2=C1SC(NC(N)=N)=N2 AKOBTVQNQFUIFL-UHFFFAOYSA-N 0.000 claims description 3
- WPRMMSUIODPDQQ-UHFFFAOYSA-N 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC=CC=C1 WPRMMSUIODPDQQ-UHFFFAOYSA-N 0.000 claims description 3
- QDOXNVJQBUENNN-UHFFFAOYSA-N 2-(6-propan-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C(C)C)CCC2=C1SC(NC(N)=N)=N2 QDOXNVJQBUENNN-UHFFFAOYSA-N 0.000 claims description 3
- GGSJEFBOSRYGBZ-UHFFFAOYSA-N 2-(6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(CCC)CCC2=C1SC(NC(N)=N)=N2 GGSJEFBOSRYGBZ-UHFFFAOYSA-N 0.000 claims description 3
- RFZXGFBVQUEHCE-UHFFFAOYSA-N 2-(6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C(C)(C)C)CCC2=C1SC(NC(N)=N)=N2 RFZXGFBVQUEHCE-UHFFFAOYSA-N 0.000 claims description 3
- KUORHFIBNWNBCM-UHFFFAOYSA-N 2-[4-methyl-4-(2-methylpropyl)-6,7-dihydro-5h-1,3-benzothiazol-2-yl]guanidine Chemical compound CC(C)CC1(C)CCCC2=C1N=C(NC(N)=N)S2 KUORHFIBNWNBCM-UHFFFAOYSA-N 0.000 claims description 3
- 102000004877 Insulin Human genes 0.000 claims description 3
- 108090001061 Insulin Proteins 0.000 claims description 3
- 206010046543 Urinary incontinence Diseases 0.000 claims description 3
- 230000009102 absorption Effects 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 3
- 230000037149 energy metabolism Effects 0.000 claims description 3
- 229940125396 insulin Drugs 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- WUUADCHFBLXQKF-UHFFFAOYSA-N 2-(4,4-dimethyl-6,7-dihydro-5h-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1(C)CCCC2=C1N=C(NC(N)=N)S2 WUUADCHFBLXQKF-UHFFFAOYSA-N 0.000 claims description 2
- OYBQOMBJSHYEAL-UHFFFAOYSA-N 2-(4-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1CCCC2=C1N=C(NC(N)=N)S2 OYBQOMBJSHYEAL-UHFFFAOYSA-N 0.000 claims description 2
- BYPPQYJAMBPADG-UHFFFAOYSA-N 2-(4-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C1=CC=CC=C1 BYPPQYJAMBPADG-UHFFFAOYSA-N 0.000 claims description 2
- QXOFHSUKWFCEBI-UHFFFAOYSA-N 2-(5,5,7,7-tetramethyl-4,6-dihydro-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1(C)CC(C)(C)CC2=C1SC(NC(N)=N)=N2 QXOFHSUKWFCEBI-UHFFFAOYSA-N 0.000 claims description 2
- UFTXCRWHCXBQKN-UHFFFAOYSA-N 2-(5,6,7,8-tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-yl)guanidine Chemical compound C1CCCCC2=C1N=C(NC(=N)N)S2 UFTXCRWHCXBQKN-UHFFFAOYSA-N 0.000 claims description 2
- ICDGFGKAIBXUJJ-UHFFFAOYSA-N 2-(5-methyl-5-phenyl-6,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1CC=2SC(NC(N)=N)=NC=2CC1(C)C1=CC=CC=C1 ICDGFGKAIBXUJJ-UHFFFAOYSA-N 0.000 claims description 2
- AOCYGZXXCPMOJM-UHFFFAOYSA-N 2-(5-phenyl-5,6,7,8-tetrahydro-4h-cyclohepta[d][1,3]thiazol-2-yl)guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2CC1C1=CC=CC=C1 AOCYGZXXCPMOJM-UHFFFAOYSA-N 0.000 claims description 2
- GUWOIUDVUADBQM-UHFFFAOYSA-N 2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C(C)CCC2=C1SC(NC(N)=N)=N2 GUWOIUDVUADBQM-UHFFFAOYSA-N 0.000 claims description 2
- WVIAKQLSKCZTNT-UHFFFAOYSA-N 2-(7-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound CC1CCCC2=C1SC(NC(N)=N)=N2 WVIAKQLSKCZTNT-UHFFFAOYSA-N 0.000 claims description 2
- DNVHHWOTOLMWSB-UHFFFAOYSA-N 2-[6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C(C(C)(C)CC)CCC2=C1SC(NC(N)=N)=N2 DNVHHWOTOLMWSB-UHFFFAOYSA-N 0.000 claims description 2
- 230000003042 antagnostic effect Effects 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- 230000001105 regulatory effect Effects 0.000 claims 1
- -1 tret-butyl Chemical group 0.000 abstract description 242
- 239000000126 substance Substances 0.000 abstract description 14
- 230000000694 effects Effects 0.000 abstract description 11
- UMKHUSRDQFQHAK-RNJMTYCLSA-N RF9 Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)CCCNC(=N)N)C(N)=O)C1=CC=CC=C1 UMKHUSRDQFQHAK-RNJMTYCLSA-N 0.000 abstract description 2
- 230000006806 disease prevention Effects 0.000 abstract 2
- 230000001404 mediated effect Effects 0.000 abstract 2
- 208000008967 Enuresis Diseases 0.000 abstract 1
- 229940122109 Neuropeptide FF receptor antagonist Drugs 0.000 abstract 1
- 239000000654 additive Substances 0.000 abstract 1
- 230000029087 digestion Effects 0.000 abstract 1
- 230000010656 regulation of insulin secretion Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 69
- 238000002360 preparation method Methods 0.000 description 42
- 125000000217 alkyl group Chemical group 0.000 description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 239000007858 starting material Substances 0.000 description 35
- 239000000543 intermediate Substances 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000000243 solution Substances 0.000 description 27
- 102400001095 Neuropeptide FF Human genes 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 239000012043 crude product Substances 0.000 description 24
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 24
- 108010055752 phenylalanyl-leucyl-phenylalanyl-glutaminyl-prolyl-glutaminyl-arginyl-phenylalaninamide Proteins 0.000 description 24
- DWDUCMMIILBMMZ-UHFFFAOYSA-N 2-bromo-4-propan-2-ylcyclohexan-1-one Chemical compound CC(C)C1CCC(=O)C(Br)C1 DWDUCMMIILBMMZ-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 125000003118 aryl group Chemical group 0.000 description 21
- 239000012074 organic phase Substances 0.000 description 21
- 229910052938 sodium sulfate Inorganic materials 0.000 description 21
- 235000011152 sodium sulphate Nutrition 0.000 description 21
- 238000012512 characterization method Methods 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- 230000031709 bromination Effects 0.000 description 18
- 238000005893 bromination reaction Methods 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 238000000034 method Methods 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 16
- 125000001188 haloalkyl group Chemical group 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 101000634561 Homo sapiens Neuropeptide FF receptor 2 Proteins 0.000 description 14
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 14
- 102100029050 Neuropeptide FF receptor 2 Human genes 0.000 description 14
- 125000003545 alkoxy group Chemical group 0.000 description 14
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 14
- 108090000765 processed proteins & peptides Proteins 0.000 description 14
- 125000001424 substituent group Chemical group 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 13
- 102100029049 Neuropeptide FF receptor 1 Human genes 0.000 description 12
- 101150056943 Npffr1 gene Proteins 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000003342 alkenyl group Chemical group 0.000 description 12
- 238000001035 drying Methods 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- YWGVBWSGYICKHI-UHFFFAOYSA-N 2-tert-butyl-6-chlorocyclohexan-1-one Chemical compound CC(C)(C)C1CCCC(Cl)C1=O YWGVBWSGYICKHI-UHFFFAOYSA-N 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- 125000003710 aryl alkyl group Chemical group 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 125000004093 cyano group Chemical group *C#N 0.000 description 10
- OKGXJRGLYVRVNE-UHFFFAOYSA-N diaminomethylidenethiourea Chemical compound NC(N)=NC(N)=S OKGXJRGLYVRVNE-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- RUIDGPOZILPJAW-UHFFFAOYSA-N 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1CNCC2=C1N=C(NC(=N)N)S2 RUIDGPOZILPJAW-UHFFFAOYSA-N 0.000 description 9
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 238000005660 chlorination reaction Methods 0.000 description 9
- 125000000623 heterocyclic group Chemical group 0.000 description 9
- 102000004196 processed proteins & peptides Human genes 0.000 description 9
- 239000003643 water by type Substances 0.000 description 9
- UELDUEAYRHAPRG-UHFFFAOYSA-N 2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid Chemical compound OC(=O)C1CCCC2=C1N=C(NC(=N)N)S2 UELDUEAYRHAPRG-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 8
- 125000004966 cyanoalkyl group Chemical group 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- HWYCFZUSOBOBIN-AQJXLSMYSA-N (2s)-2-[[(2s)-1-[(2s)-5-amino-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-n-[(2s)-1-[[(2s)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminome Chemical compound C([C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCC(N)=O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)C1=CC=CC=C1 HWYCFZUSOBOBIN-AQJXLSMYSA-N 0.000 description 7
- 0 NC(Nc1nc(CCC*CC2)c2[s]1)=N Chemical compound NC(Nc1nc(CCC*CC2)c2[s]1)=N 0.000 description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 7
- 125000005097 aminocarbonylalkyl group Chemical group 0.000 description 7
- 230000036592 analgesia Effects 0.000 description 7
- 239000005557 antagonist Substances 0.000 description 7
- 125000005018 aryl alkenyl group Chemical group 0.000 description 7
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 7
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 7
- 125000004104 aryloxy group Chemical group 0.000 description 7
- 230000027455 binding Effects 0.000 description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 7
- 125000004181 carboxyalkyl group Chemical group 0.000 description 7
- 210000003169 central nervous system Anatomy 0.000 description 7
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 7
- 229940005483 opioid analgesics Drugs 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- NHOGKBUDALSELW-UHFFFAOYSA-N 2-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine;dihydrochloride Chemical compound Cl.Cl.C1CNCC2=C1N=C(NC(=N)N)S2 NHOGKBUDALSELW-UHFFFAOYSA-N 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 125000004103 aminoalkyl group Chemical group 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 150000002357 guanidines Chemical class 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- 229960005181 morphine Drugs 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- KNSPBSQWRKKAPI-UHFFFAOYSA-N 2,2-dimethylcyclohexan-1-one Chemical compound CC1(C)CCCCC1=O KNSPBSQWRKKAPI-UHFFFAOYSA-N 0.000 description 5
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 5
- 125000004414 alkyl thio group Chemical group 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 5
- 125000005110 aryl thio group Chemical group 0.000 description 5
- 125000005164 aryl thioalkyl group Chemical group 0.000 description 5
- 239000007822 coupling agent Substances 0.000 description 5
- 125000004438 haloalkoxy group Chemical group 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000012453 solvate Substances 0.000 description 5
- ISUXBNXLVOPNBA-UHFFFAOYSA-N spiro[5.5]undecan-5-one Chemical compound O=C1CCCCC11CCCCC1 ISUXBNXLVOPNBA-UHFFFAOYSA-N 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 description 5
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- IQSJJHUZFHAQCL-UHFFFAOYSA-N 2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid Chemical compound C1CC(C(O)=O)CC2=C1N=C(NC(=N)N)S2 IQSJJHUZFHAQCL-UHFFFAOYSA-N 0.000 description 4
- PXQMSTLNSHMSJB-UHFFFAOYSA-N 4,4-dimethylcyclohexan-1-one Chemical compound CC1(C)CCC(=O)CC1 PXQMSTLNSHMSJB-UHFFFAOYSA-N 0.000 description 4
- 101710151321 Melanostatin Proteins 0.000 description 4
- 102400001090 Neuropeptide AF Human genes 0.000 description 4
- 102400000064 Neuropeptide Y Human genes 0.000 description 4
- 108090000189 Neuropeptides Proteins 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 description 4
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 4
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 4
- 125000005530 alkylenedioxy group Chemical group 0.000 description 4
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 125000004967 formylalkyl group Chemical group 0.000 description 4
- 239000012634 fragment Substances 0.000 description 4
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 150000004677 hydrates Chemical class 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- URPYMXQQVHTUDU-OFGSCBOVSA-N nucleopeptide y Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 URPYMXQQVHTUDU-OFGSCBOVSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 210000000278 spinal cord Anatomy 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- HGWZSFXXGQVVAQ-UHFFFAOYSA-N 1-benzylazepan-3-one Chemical compound C1C(=O)CCCCN1CC1=CC=CC=C1 HGWZSFXXGQVVAQ-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- AGXWLXXFBICEON-UHFFFAOYSA-N 2-tert-butyl-4-phenylcyclohexan-1-one Chemical compound C1CC(=O)C(C(C)(C)C)CC1C1=CC=CC=C1 AGXWLXXFBICEON-UHFFFAOYSA-N 0.000 description 3
- QJPHZZUBQAASNR-UHFFFAOYSA-N 4,4-diphenylcyclohexan-1-one Chemical compound C1CC(=O)CCC1(C=1C=CC=CC=1)C1=CC=CC=C1 QJPHZZUBQAASNR-UHFFFAOYSA-N 0.000 description 3
- KSQIGHIYGAPXCW-UHFFFAOYSA-N 4-(4-fluorophenyl)cyclohexan-1-one Chemical compound C1=CC(F)=CC=C1C1CCC(=O)CC1 KSQIGHIYGAPXCW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 101800001049 Neuropeptide AF Proteins 0.000 description 3
- 101800000150 Neuropeptide AF-like Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 125000004321 azepin-2-yl group Chemical group [H]N1C([H])=C([H])C([H])=C([H])C([H])=C1* 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- TWUFTVMULHEFJW-UHFFFAOYSA-N ethyl 2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate Chemical compound CCOC(=O)C1CCCC2=C1N=C(NC(N)=N)S2 TWUFTVMULHEFJW-UHFFFAOYSA-N 0.000 description 3
- YIXNBCRNHLMGKU-UHFFFAOYSA-N ethyl 2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate Chemical compound C1C(C(=O)OCC)CCC2=C1SC(NC(N)=N)=N2 YIXNBCRNHLMGKU-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000002757 inflammatory effect Effects 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- DYSIROANKWMSGC-KWFINLGMSA-N npaf Chemical compound C([C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](C)N)CC(C)C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)C1=CC=CC=C1 DYSIROANKWMSGC-KWFINLGMSA-N 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 230000002035 prolonged effect Effects 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- OYRIEZNQPFTEKZ-UHFFFAOYSA-N tert-butyl 2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2=C1SC(NC(N)=N)=N2 OYRIEZNQPFTEKZ-UHFFFAOYSA-N 0.000 description 3
- KXXKKGFCNVGDAP-UHFFFAOYSA-N trimethyl-(3-methylcyclohexen-1-yl)oxysilane Chemical compound CC1CCCC(O[Si](C)(C)C)=C1 KXXKKGFCNVGDAP-UHFFFAOYSA-N 0.000 description 3
- PHEOJPAYHOJPBN-UHFFFAOYSA-N trimethyl-(4-phenylcyclohexen-1-yl)oxysilane Chemical compound C1CC(O[Si](C)(C)C)=CCC1C1=CC=CC=C1 PHEOJPAYHOJPBN-UHFFFAOYSA-N 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DKDWYSSSCHORRJ-UHFFFAOYSA-N 1-benzyl-4-bromoazepan-3-one Chemical compound C1C(=O)C(Br)CCCN1CC1=CC=CC=C1 DKDWYSSSCHORRJ-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- SGUKNSYVBNMKLK-UHFFFAOYSA-N 2-(5-but-3-enoyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1CN(C(=O)CC=C)CC2=C1N=C(NC(=N)N)S2 SGUKNSYVBNMKLK-UHFFFAOYSA-N 0.000 description 2
- DDMZPDGUXYIEAU-UHFFFAOYSA-N 2-(5-hexyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(CCCCCC)CCC2=C1SC(NC(N)=N)=N2 DDMZPDGUXYIEAU-UHFFFAOYSA-N 0.000 description 2
- QJHYMDXVSYZIDQ-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-phenyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1C(=O)NC1=CC=CC=C1 QJHYMDXVSYZIDQ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- WVJSAIQHGDIBGB-UHFFFAOYSA-N 2-[4-(cyclohexen-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C1=CCCCC1 WVJSAIQHGDIBGB-UHFFFAOYSA-N 0.000 description 2
- VBWKHBVNGLOMEL-UHFFFAOYSA-N 2-[6-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(SC(NC(N)=N)=N2)=C2CC1 VBWKHBVNGLOMEL-UHFFFAOYSA-N 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- HWWMXGWPAOOQOE-UHFFFAOYSA-N 2-ethyl-2-methylcyclohexan-1-one Chemical compound CCC1(C)CCCCC1=O HWWMXGWPAOOQOE-UHFFFAOYSA-N 0.000 description 2
- MQYJJCJOKJTXHT-UHFFFAOYSA-N 2-methyl-2-(2-methylpropyl)cyclohexan-1-one Chemical compound CC(C)CC1(C)CCCCC1=O MQYJJCJOKJTXHT-UHFFFAOYSA-N 0.000 description 2
- XPDCYLHNNYXXFF-UHFFFAOYSA-N 2-methyl-2-propylcyclohexan-1-one Chemical compound CCCC1(C)CCCCC1=O XPDCYLHNNYXXFF-UHFFFAOYSA-N 0.000 description 2
- VMZYKKVDRMKAFB-UHFFFAOYSA-N 2-phenylspiro[5.5]undecan-5-one Chemical compound O=C1CCC(C=2C=CC=CC=2)CC11CCCCC1 VMZYKKVDRMKAFB-UHFFFAOYSA-N 0.000 description 2
- UPGHEUSRLZSXAE-UHFFFAOYSA-N 2-prop-2-enylcyclohexan-1-one Chemical compound C=CCC1CCCCC1=O UPGHEUSRLZSXAE-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- CGMLOUSLYNMMCC-UHFFFAOYSA-N 3,3-dimethyl-4-phenylcyclohexan-1-one Chemical compound CC1(C)CC(=O)CCC1C1=CC=CC=C1 CGMLOUSLYNMMCC-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ORIINXCHZXECLA-UHFFFAOYSA-N 3-butylcyclohexan-1-one Chemical compound CCCCC1CCCC(=O)C1 ORIINXCHZXECLA-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- GEPLRUHKORZDGH-UHFFFAOYSA-N 4-bromospiro[5.5]undecan-5-one Chemical compound O=C1C(Br)CCCC11CCCCC1 GEPLRUHKORZDGH-UHFFFAOYSA-N 0.000 description 2
- OKRGFVFQVDARGW-UHFFFAOYSA-N 5-[benzyl-(2-ethoxy-2-oxoethyl)amino]pentanoic acid Chemical compound OC(=O)CCCCN(CC(=O)OCC)CC1=CC=CC=C1 OKRGFVFQVDARGW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 208000000094 Chronic Pain Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 101001108239 Homo sapiens Pro-FMRFamide-related neuropeptide VF Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 102000028517 Neuropeptide receptor Human genes 0.000 description 2
- 108070000018 Neuropeptide receptor Proteins 0.000 description 2
- 208000026251 Opioid-Related disease Diseases 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 108010043958 Peptoids Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 102100021876 Pro-FMRFamide-related neuropeptide VF Human genes 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001413 amino acids Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 2
- 125000005116 aryl carbamoyl group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- DCGJECYGJUQGCL-UHFFFAOYSA-N benzyl 2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1C(=O)OCC1=CC=CC=C1 DCGJECYGJUQGCL-UHFFFAOYSA-N 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000012148 binding buffer Substances 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- VKCMWLOBUILIOQ-UHFFFAOYSA-N ethyl 3-bromo-2-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCCC(Br)C1=O VKCMWLOBUILIOQ-UHFFFAOYSA-N 0.000 description 2
- IGOWSOGBQMBHIY-UHFFFAOYSA-N ethyl 3-bromo-4-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCC(=O)C(Br)C1 IGOWSOGBQMBHIY-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 2
- 125000004449 heterocyclylalkenyl group Chemical group 0.000 description 2
- 125000005844 heterocyclyloxy group Chemical group 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 102000051367 mu Opioid Receptors Human genes 0.000 description 2
- YFAYZKDRBXKNLV-UHFFFAOYSA-N n-benzyl-2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C(=O)NCC1=CC=CC=C1 YFAYZKDRBXKNLV-UHFFFAOYSA-N 0.000 description 2
- RZCYPAMUJHRHHV-UHFFFAOYSA-N n-benzyl-2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1C(=S)NCC1=CC=CC=C1 RZCYPAMUJHRHHV-UHFFFAOYSA-N 0.000 description 2
- 108010060265 neuropeptide VF Proteins 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 201000005040 opiate dependence Diseases 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 238000004007 reversed phase HPLC Methods 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- NCECOCUSGFFDSY-UHFFFAOYSA-N tert-butyl n-[3-[2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-5-yl]-3-oxopropyl]carbamate Chemical compound C1N(C(=O)CCNC(=O)OC(C)(C)C)CCC2=C1SC(NC(N)=N)=N2 NCECOCUSGFFDSY-UHFFFAOYSA-N 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000004149 thio group Chemical group *S* 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000001052 transient effect Effects 0.000 description 2
- 230000000472 traumatic effect Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 108020001612 μ-opioid receptors Proteins 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- WIUOOARHSKVYCC-NKUVHBIJSA-N (2s)-n-[(2s)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2s)-1-[(2s)-5-amino-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[3-(4-hydroxyphenyl)propanoylamino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]pyrrolid Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCC(N)=O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)NC(=O)CCC=1C=CC(O)=CC=1)C1=CC=CC=C1 WIUOOARHSKVYCC-NKUVHBIJSA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- RDJUHLUBPADHNP-UHFFFAOYSA-N 1,2,3,5-tetrahydroxybenzene Chemical compound OC1=CC(O)=C(O)C(O)=C1 RDJUHLUBPADHNP-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- NOLMGELTBIIGOL-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate Chemical compound C1CC(OS(=O)(=O)C(F)(F)F)=CCC21OCCO2 NOLMGELTBIIGOL-UHFFFAOYSA-N 0.000 description 1
- VKRKCBWIVLSRBJ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-one Chemical compound C1CC(=O)CCC21OCCO2 VKRKCBWIVLSRBJ-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- IALUZFHYHBLCEE-UHFFFAOYSA-N 1-ethyl-2-oxocyclohexane-1-carboxylic acid Chemical compound CCC1(C(O)=O)CCCCC1=O IALUZFHYHBLCEE-UHFFFAOYSA-N 0.000 description 1
- BTUGGGLMQBJCBN-UHFFFAOYSA-N 1-iodo-2-methylpropane Chemical compound CC(C)CI BTUGGGLMQBJCBN-UHFFFAOYSA-N 0.000 description 1
- VRVUKQWNRPNACD-UHFFFAOYSA-N 1-isocyanatopentane Chemical compound CCCCCN=C=O VRVUKQWNRPNACD-UHFFFAOYSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- QRUYAODUCVMGQQ-UHFFFAOYSA-N 2-(2-oxocyclohexyl)acetic acid Chemical compound OC(=O)CC1CCCCC1=O QRUYAODUCVMGQQ-UHFFFAOYSA-N 0.000 description 1
- FUGBYHUCJPEPJR-UHFFFAOYSA-N 2-(4-benzyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1CC1=CC=CC=C1 FUGBYHUCJPEPJR-UHFFFAOYSA-N 0.000 description 1
- LYHXBHQXUITTHX-UHFFFAOYSA-N 2-(4-pentanoyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound CCCCC(=O)C1NCCC2=C1SC(NC(N)=N)=N2 LYHXBHQXUITTHX-UHFFFAOYSA-N 0.000 description 1
- UCXUJAFVTACPGW-UHFFFAOYSA-N 2-(4-tert-butyl-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C=2SC(NC(N)=N)=NC=2C(C(C)(C)C)CC1C1=CC=CC=C1 UCXUJAFVTACPGW-UHFFFAOYSA-N 0.000 description 1
- UAIBRYGHVVYQBK-UHFFFAOYSA-N 2-(5,6-dihydro-4h-cyclopenta[d][1,3]thiazol-2-yl)guanidine Chemical compound C1CCC2=C1N=C(NC(=N)N)S2 UAIBRYGHVVYQBK-UHFFFAOYSA-N 0.000 description 1
- FSWGIXWSQKVRBR-UHFFFAOYSA-N 2-(5-benzyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1CC1=CC=CC=C1 FSWGIXWSQKVRBR-UHFFFAOYSA-N 0.000 description 1
- UPEQOVLNRJIVEL-UHFFFAOYSA-N 2-(5-butylsulfonyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(S(=O)(=O)CCCC)CCC2=C1SC(NC(N)=N)=N2 UPEQOVLNRJIVEL-UHFFFAOYSA-N 0.000 description 1
- YFOHSVMOPDQBTG-UHFFFAOYSA-N 2-(5-ethyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(CC)CCC2=C1SC(NC(N)=N)=N2 YFOHSVMOPDQBTG-UHFFFAOYSA-N 0.000 description 1
- RHNOCHLHOYFGLC-UHFFFAOYSA-N 2-(5-methylsulfonyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(S(=O)(=O)C)CCC2=C1SC(NC(N)=N)=N2 RHNOCHLHOYFGLC-UHFFFAOYSA-N 0.000 description 1
- BQTZVYKQEGHYIG-UHFFFAOYSA-N 2-(5-pentanoyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(C(=O)CCCC)CCC2=C1SC(NC(N)=N)=N2 BQTZVYKQEGHYIG-UHFFFAOYSA-N 0.000 description 1
- SKVHXDFCKUOUHJ-UHFFFAOYSA-N 2-(5-prop-2-ynyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1CN(CC#C)CC2=C1N=C(NC(=N)N)S2 SKVHXDFCKUOUHJ-UHFFFAOYSA-N 0.000 description 1
- JWSONFTVEHCGJQ-UHFFFAOYSA-N 2-(5-propan-2-ylsulfonyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(S(=O)(=O)C(C)C)CCC2=C1SC(NC(N)=N)=N2 JWSONFTVEHCGJQ-UHFFFAOYSA-N 0.000 description 1
- FBUBOFVNIZACRW-UHFFFAOYSA-N 2-(5-propyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl)guanidine Chemical compound C1N(CCC)CCC2=C1SC(NC(N)=N)=N2 FBUBOFVNIZACRW-UHFFFAOYSA-N 0.000 description 1
- WVXCYAIRSGWGBV-UHFFFAOYSA-N 2-(6,6-diphenyl-5,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1(C=1C=CC=CC=1)C1=CC=CC=C1 WVXCYAIRSGWGBV-UHFFFAOYSA-N 0.000 description 1
- CYXYEESUXIALNC-UHFFFAOYSA-N 2-(6,7-dihydro-4h-pyrano[4,3-d][1,3]thiazol-2-yl)guanidine Chemical compound C1COCC2=C1N=C(NC(=N)N)S2 CYXYEESUXIALNC-UHFFFAOYSA-N 0.000 description 1
- MCCUUZYXCGYWIN-UHFFFAOYSA-N 2-(6-cyano-6-phenyl-5,7-dihydro-4h-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1(C#N)C1=CC=CC=C1 MCCUUZYXCGYWIN-UHFFFAOYSA-N 0.000 description 1
- XHPLIMKFVJUFOQ-UHFFFAOYSA-N 2-(6-thiophen-2-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC=CS1 XHPLIMKFVJUFOQ-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- UKBKRAWBZJVRER-UHFFFAOYSA-N 2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid formic acid Chemical compound N(C(=N)N)C=1SC2=C(N1)C(CCC2)C(=O)O.C(=O)O UKBKRAWBZJVRER-UHFFFAOYSA-N 0.000 description 1
- PEPJIWVLOVPNOI-UHFFFAOYSA-N 2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylic acid Chemical compound N(C(=N)N)C=1SC=2CN(CCC=2N=1)C(=O)O PEPJIWVLOVPNOI-UHFFFAOYSA-N 0.000 description 1
- LTLRBTVKAFNNIM-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n,n-di(propan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound CC(C)N(C(C)C)C(=O)C1CCCC2=C1N=C(NC(N)=N)S2 LTLRBTVKAFNNIM-UHFFFAOYSA-N 0.000 description 1
- VSXRAZUNVFIEQE-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n,n-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound CCCN(CCC)C(=O)C1CCCC2=C1N=C(NC(N)=N)S2 VSXRAZUNVFIEQE-UHFFFAOYSA-N 0.000 description 1
- UYKORIYFERXQTN-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound CC(C)CCNC(=O)C1CCCC2=C1N=C(NC(N)=N)S2 UYKORIYFERXQTN-UHFFFAOYSA-N 0.000 description 1
- SLQUKKCTGQRJSM-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide Chemical compound C1C(C(=O)NCCC(C)C)CCC2=C1SC(NC(N)=N)=N2 SLQUKKCTGQRJSM-UHFFFAOYSA-N 0.000 description 1
- POANLTXZHXLSIR-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-methyl-n-(2-phenylethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound C1CCC=2SC(N=C(N)N)=NC=2C1C(=O)N(C)CCC1=CC=CC=C1 POANLTXZHXLSIR-UHFFFAOYSA-N 0.000 description 1
- YHBVQQYSGAVNFE-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-pentyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide Chemical compound C1N(C(=O)NCCCCC)CCC2=C1SC(NC(N)=N)=N2 YHBVQQYSGAVNFE-UHFFFAOYSA-N 0.000 description 1
- ALIKGSQZHJPGOJ-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C(=O)NC1=CC=CC=C1 ALIKGSQZHJPGOJ-UHFFFAOYSA-N 0.000 description 1
- QMAOJYKWYMFLDP-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C(=O)NC1=CC=CC=C1 QMAOJYKWYMFLDP-UHFFFAOYSA-N 0.000 description 1
- ZCBZWGQVGHFAOB-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-propan-2-yl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide Chemical compound C1N(C(=S)NC(C)C)CCC2=C1SC(N=C(N)N)=N2 ZCBZWGQVGHFAOB-UHFFFAOYSA-N 0.000 description 1
- VMNCXUGRHQUZEF-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide Chemical compound CCCNC(=O)C1CCCC2=C1N=C(NC(N)=N)S2 VMNCXUGRHQUZEF-UHFFFAOYSA-N 0.000 description 1
- QWHJPAKVYVBKFQ-UHFFFAOYSA-N 2-(diaminomethylideneamino)-n-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide Chemical compound C1C(C(=O)NCCC)CCC2=C1SC(NC(N)=N)=N2 QWHJPAKVYVBKFQ-UHFFFAOYSA-N 0.000 description 1
- OGTKUJJFBPGIOU-UHFFFAOYSA-N 2-[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]acetic acid Chemical compound N(C(=N)N)C=1SC2=C(N=1)C(CCC2)CC(=O)O OGTKUJJFBPGIOU-UHFFFAOYSA-N 0.000 description 1
- OLDBFYAXTHRQGT-UHFFFAOYSA-N 2-[4-(2-cyanoethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound N#CCCC1CCCC2=C1N=C(NC(=N)N)S2 OLDBFYAXTHRQGT-UHFFFAOYSA-N 0.000 description 1
- PGEHXVOYKVRYKK-UHFFFAOYSA-N 2-[4-(morpholine-4-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C(=O)N1CCOCC1 PGEHXVOYKVRYKK-UHFFFAOYSA-N 0.000 description 1
- QBAXFGDLEDRYCD-UHFFFAOYSA-N 2-[4-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1CCC=2SC(NC(=N)N)=NC=2C1C(=O)N1CCCCC1 QBAXFGDLEDRYCD-UHFFFAOYSA-N 0.000 description 1
- GKIINEKRXYIBOE-UHFFFAOYSA-N 2-[5-(2-cyclohexylethyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1CCC1CCCCC1 GKIINEKRXYIBOE-UHFFFAOYSA-N 0.000 description 1
- BPPIBKABLSGTFE-UHFFFAOYSA-N 2-[5-(2-methoxyacetyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1N(C(=O)COC)CCC2=C1SC(NC(N)=N)=N2 BPPIBKABLSGTFE-UHFFFAOYSA-N 0.000 description 1
- RCNHNMAWLLOAOJ-UHFFFAOYSA-N 2-[5-(2-methylpropanoyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1N(C(=O)C(C)C)CCC2=C1SC(NC(N)=N)=N2 RCNHNMAWLLOAOJ-UHFFFAOYSA-N 0.000 description 1
- MYUICDHWHUMZEA-UHFFFAOYSA-N 2-[5-(2-phenylacetyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1C(=O)CC1=CC=CC=C1 MYUICDHWHUMZEA-UHFFFAOYSA-N 0.000 description 1
- UVLDXSZZKIUHOW-UHFFFAOYSA-N 2-[5-(2-propylpentanoyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1N(C(=O)C(CCC)CCC)CCC2=C1SC(NC(N)=N)=N2 UVLDXSZZKIUHOW-UHFFFAOYSA-N 0.000 description 1
- UKUVYTPNVLZSTP-UHFFFAOYSA-N 2-[5-(3-methylbutanoyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1N(C(=O)CC(C)C)CCC2=C1SC(NC(N)=N)=N2 UKUVYTPNVLZSTP-UHFFFAOYSA-N 0.000 description 1
- BRIXYPSRMAHGQV-UHFFFAOYSA-N 2-[5-(cyclopropanecarbonyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1C(=O)C1CC1 BRIXYPSRMAHGQV-UHFFFAOYSA-N 0.000 description 1
- WOJBUSILFWSVLQ-UHFFFAOYSA-N 2-[5-(cyclopropylmethyl)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCN1CC1CC1 WOJBUSILFWSVLQ-UHFFFAOYSA-N 0.000 description 1
- JKMOGNVHEODIIA-UHFFFAOYSA-N 2-[5-[4-(dimethylamino)butanoyl]-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-2-yl]guanidine Chemical compound C1N(C(=O)CCCN(C)C)CCC2=C1SC(NC(N)=N)=N2 JKMOGNVHEODIIA-UHFFFAOYSA-N 0.000 description 1
- RYUQUTMSWWQHDN-UHFFFAOYSA-N 2-[6-(1,3-benzodioxol-5-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1=C2OCOC2=CC(C2CCC=3N=C(SC=3C2)NC(=N)N)=C1 RYUQUTMSWWQHDN-UHFFFAOYSA-N 0.000 description 1
- CZNVBYAATSFUEC-UHFFFAOYSA-N 2-[6-(2-ethylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound CCC1=CC=CC=C1C1CC(SC(NC(N)=N)=N2)=C2CC1 CZNVBYAATSFUEC-UHFFFAOYSA-N 0.000 description 1
- KKWDSXAYVVPOSC-UHFFFAOYSA-N 2-[6-(2-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound CC1=CC=CC=C1C1CC(SC(NC(N)=N)=N2)=C2CC1 KKWDSXAYVVPOSC-UHFFFAOYSA-N 0.000 description 1
- DDDUCRJPRWKKKY-UHFFFAOYSA-N 2-[6-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound COC1=CC=CC(C2CC=3SC(NC(N)=N)=NC=3CC2)=C1 DDDUCRJPRWKKKY-UHFFFAOYSA-N 0.000 description 1
- UXEKPCNXIWZWAG-UHFFFAOYSA-N 2-[6-(3-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound CC1=CC=CC(C2CC=3SC(NC(N)=N)=NC=3CC2)=C1 UXEKPCNXIWZWAG-UHFFFAOYSA-N 0.000 description 1
- CJLNCVIOLBBNAW-UHFFFAOYSA-N 2-[6-(4-chlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC=C(Cl)C=C1 CJLNCVIOLBBNAW-UHFFFAOYSA-N 0.000 description 1
- WILQXUIJHGWVOK-UHFFFAOYSA-N 2-[6-(4-cyanophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC=C(C#N)C=C1 WILQXUIJHGWVOK-UHFFFAOYSA-N 0.000 description 1
- IRVMFCFOFBGZBJ-UHFFFAOYSA-N 2-[6-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC=C(F)C=C1 IRVMFCFOFBGZBJ-UHFFFAOYSA-N 0.000 description 1
- NYPVDISAGXPBQO-UHFFFAOYSA-N 2-[6-(4-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1=CC(C)=CC=C1C1CC(SC(NC(N)=N)=N2)=C2CC1 NYPVDISAGXPBQO-UHFFFAOYSA-N 0.000 description 1
- UFDPKDBPVLGWBZ-UHFFFAOYSA-N 2-[6-(4-phenylmethoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C(C=C1)=CC=C1OCC1=CC=CC=C1 UFDPKDBPVLGWBZ-UHFFFAOYSA-N 0.000 description 1
- HNSHINCQPQFZRS-UHFFFAOYSA-N 2-[6-[3,5-bis(trifluoromethyl)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine Chemical compound C1C=2SC(NC(=N)N)=NC=2CCC1C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 HNSHINCQPQFZRS-UHFFFAOYSA-N 0.000 description 1
- 125000000979 2-amino-2-oxoethyl group Chemical group [H]C([*])([H])C(=O)N([H])[H] 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- BCNPAUNXYDNKOU-UHFFFAOYSA-N 2-benzyl-6-chlorocyclohexan-1-one Chemical compound O=C1C(Cl)CCCC1CC1=CC=CC=C1 BCNPAUNXYDNKOU-UHFFFAOYSA-N 0.000 description 1
- CUYLPYBYCYQGCE-UHFFFAOYSA-N 2-benzylcyclohexan-1-one Chemical compound O=C1CCCCC1CC1=CC=CC=C1 CUYLPYBYCYQGCE-UHFFFAOYSA-N 0.000 description 1
- JUAKSRQOOTYMMW-UHFFFAOYSA-N 2-bromo-3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1Br JUAKSRQOOTYMMW-UHFFFAOYSA-N 0.000 description 1
- RDUXIRQZBLFPOW-UHFFFAOYSA-N 2-bromo-4,4-dimethylcyclohexan-1-one Chemical compound CC1(C)CCC(=O)C(Br)C1 RDUXIRQZBLFPOW-UHFFFAOYSA-N 0.000 description 1
- IPGQCGUVCWKFFK-UHFFFAOYSA-N 2-bromo-4,4-diphenylcyclohexan-1-one Chemical compound C1CC(=O)C(Br)CC1(C=1C=CC=CC=1)C1=CC=CC=C1 IPGQCGUVCWKFFK-UHFFFAOYSA-N 0.000 description 1
- RIGJPLUFCMBWDR-UHFFFAOYSA-N 2-bromo-5,5-dimethyl-4-phenylcyclohexan-1-one Chemical compound CC1(C)CC(=O)C(Br)CC1C1=CC=CC=C1 RIGJPLUFCMBWDR-UHFFFAOYSA-N 0.000 description 1
- XGYKCZMGYRAOPT-UHFFFAOYSA-N 2-bromo-5,5-dimethylcyclohexan-1-one Chemical compound CC1(C)CCC(Br)C(=O)C1 XGYKCZMGYRAOPT-UHFFFAOYSA-N 0.000 description 1
- DIEBEDGOEZHZSB-UHFFFAOYSA-N 2-bromo-5-butylcyclohexan-1-one Chemical compound CCCCC1CCC(Br)C(=O)C1 DIEBEDGOEZHZSB-UHFFFAOYSA-N 0.000 description 1
- IPYJGSOJTCUXNW-UHFFFAOYSA-N 2-bromo-5-ethyl-5-methylcyclohexan-1-one Chemical compound CCC1(C)CCC(Br)C(=O)C1 IPYJGSOJTCUXNW-UHFFFAOYSA-N 0.000 description 1
- RJXGPKUQWMEERF-UHFFFAOYSA-N 2-bromo-5-methyl-5-phenylcyclohexan-1-one Chemical compound C=1C=CC=CC=1C1(C)CCC(Br)C(=O)C1 RJXGPKUQWMEERF-UHFFFAOYSA-N 0.000 description 1
- CERICSCKCBQTGV-UHFFFAOYSA-N 2-bromo-6-phenylcycloheptan-1-one Chemical compound C1C(=O)C(Br)CCCC1C1=CC=CC=C1 CERICSCKCBQTGV-UHFFFAOYSA-N 0.000 description 1
- WKUWKLBEUOLWEA-UHFFFAOYSA-N 2-butan-2-yl-6-chlorocyclohexan-1-one Chemical compound CCC(C)C1CCCC(Cl)C1=O WKUWKLBEUOLWEA-UHFFFAOYSA-N 0.000 description 1
- RQXTZKGDMNIWJF-UHFFFAOYSA-N 2-butan-2-ylcyclohexan-1-one Chemical compound CCC(C)C1CCCCC1=O RQXTZKGDMNIWJF-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- HAIHXZYHTQDIGZ-UHFFFAOYSA-N 2-chloro-6-methylcyclohexan-1-one Chemical compound CC1CCCC(Cl)C1=O HAIHXZYHTQDIGZ-UHFFFAOYSA-N 0.000 description 1
- QCXZSWMQNZFHIB-UHFFFAOYSA-N 2-chloro-6-phenylcyclohexan-1-one Chemical compound O=C1C(Cl)CCCC1C1=CC=CC=C1 QCXZSWMQNZFHIB-UHFFFAOYSA-N 0.000 description 1
- 125000004791 2-fluoroethoxy group Chemical group FCCO* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- 125000006325 2-propenyl amino group Chemical group [H]C([H])=C([H])C([H])([H])N([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- SLVUSOBENQLINV-UHFFFAOYSA-N 2-tert-butyl-6-chloro-4-phenylcyclohexan-1-one Chemical compound C1C(Cl)C(=O)C(C(C)(C)C)CC1C1=CC=CC=C1 SLVUSOBENQLINV-UHFFFAOYSA-N 0.000 description 1
- ZRYDPLOWJSFQAE-UHFFFAOYSA-N 2-tert-butylcyclohexan-1-one Chemical compound CC(C)(C)C1CCCCC1=O ZRYDPLOWJSFQAE-UHFFFAOYSA-N 0.000 description 1
- SXNMUZQWTWBSBL-UHFFFAOYSA-N 2h-cyclohepta[d][1,3]thiazole Chemical compound C1=CC=CC2=NCSC2=C1 SXNMUZQWTWBSBL-UHFFFAOYSA-N 0.000 description 1
- DVNAEKRGMBNCFF-UHFFFAOYSA-N 2h-cyclopenta[d][1,3]thiazole Chemical compound C1=CC2=NCSC2=C1 DVNAEKRGMBNCFF-UHFFFAOYSA-N 0.000 description 1
- MSMLIBSQLHMWMS-UHFFFAOYSA-N 2h-pyrano[2,3-d][1,3]thiazole Chemical compound C1=COC2=NCSC2=C1 MSMLIBSQLHMWMS-UHFFFAOYSA-N 0.000 description 1
- NTIGNJOEVBTPJJ-UHFFFAOYSA-N 3,3-dibromopentane Chemical compound CCC(Br)(Br)CC NTIGNJOEVBTPJJ-UHFFFAOYSA-N 0.000 description 1
- ZVJQBBYAVPAFLX-UHFFFAOYSA-N 3,3-dimethylcyclohexan-1-one Chemical compound CC1(C)CCCC(=O)C1 ZVJQBBYAVPAFLX-UHFFFAOYSA-N 0.000 description 1
- SPTVCXKSSRBTMN-UHFFFAOYSA-N 3-(2-oxocyclohexyl)propanenitrile Chemical compound O=C1CCCCC1CCC#N SPTVCXKSSRBTMN-UHFFFAOYSA-N 0.000 description 1
- GKHLYBAJBIPWLN-UHFFFAOYSA-N 3-(3-chloro-2-oxocyclohexyl)propanenitrile Chemical compound ClC1CCCC(CCC#N)C1=O GKHLYBAJBIPWLN-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- CTVZFWLJZYXVBA-UHFFFAOYSA-N 3-bromo-4-oxo-1-phenylcyclohexane-1-carbonitrile Chemical compound C1CC(=O)C(Br)CC1(C#N)C1=CC=CC=C1 CTVZFWLJZYXVBA-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- HPFWICIZVJFFNM-UHFFFAOYSA-N 3-ethyl-3-methylcyclohexan-1-one Chemical compound CCC1(C)CCCC(=O)C1 HPFWICIZVJFFNM-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- HOIXVJDJSJNGFM-UHFFFAOYSA-N 3-methyl-3-phenylcyclohexan-1-one Chemical compound C=1C=CC=CC=1C1(C)CCCC(=O)C1 HOIXVJDJSJNGFM-UHFFFAOYSA-N 0.000 description 1
- CSCVNZBOXIYQIN-UHFFFAOYSA-N 3-methyl-4-phenylcyclohex-2-en-1-one Chemical compound CC1=CC(=O)CCC1C1=CC=CC=C1 CSCVNZBOXIYQIN-UHFFFAOYSA-N 0.000 description 1
- JLDCLDZGNYDRKX-UHFFFAOYSA-N 3-phenylcycloheptan-1-one Chemical compound C1C(=O)CCCCC1C1=CC=CC=C1 JLDCLDZGNYDRKX-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZWNKACLCRAWPMO-UHFFFAOYSA-N 3-propylheptan-2-one Chemical compound CCCCC(C(C)=O)CCC ZWNKACLCRAWPMO-UHFFFAOYSA-N 0.000 description 1
- HAUNPYVLVAIUOO-UHFFFAOYSA-N 4,4-dimethylcyclohex-2-en-1-one Chemical compound CC1(C)CCC(=O)C=C1 HAUNPYVLVAIUOO-UHFFFAOYSA-N 0.000 description 1
- ZTNXPEAVOZZOGK-UHFFFAOYSA-N 4-(1,3-benzodioxol-5-yl)cyclohexan-1-one Chemical compound C1CC(=O)CCC1C1=CC=C(OCO2)C2=C1 ZTNXPEAVOZZOGK-UHFFFAOYSA-N 0.000 description 1
- GBBVNWWMXGGWBZ-UHFFFAOYSA-N 4-(2-ethylphenyl)cyclohexan-1-one Chemical compound CCC1=CC=CC=C1C1CCC(=O)CC1 GBBVNWWMXGGWBZ-UHFFFAOYSA-N 0.000 description 1
- DXLIAYMTYKXAKB-UHFFFAOYSA-N 4-(2-methylphenyl)cyclohexan-1-one Chemical compound CC1=CC=CC=C1C1CCC(=O)CC1 DXLIAYMTYKXAKB-UHFFFAOYSA-N 0.000 description 1
- ZFNPIMGGFINZOM-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)cyclohexan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CCC(=O)CC1 ZFNPIMGGFINZOM-UHFFFAOYSA-N 0.000 description 1
- LIAPPURFKRACQO-UHFFFAOYSA-N 4-(3-fluorophenyl)cyclohexan-1-one Chemical compound FC1=CC=CC(C2CCC(=O)CC2)=C1 LIAPPURFKRACQO-UHFFFAOYSA-N 0.000 description 1
- DWBASXJXOOJROY-UHFFFAOYSA-N 4-(3-methoxyphenyl)cyclohexan-1-one Chemical compound COC1=CC=CC(C2CCC(=O)CC2)=C1 DWBASXJXOOJROY-UHFFFAOYSA-N 0.000 description 1
- QMQMFUKUEXEZSI-UHFFFAOYSA-N 4-(3-methylphenyl)cyclohexan-1-one Chemical compound CC1=CC=CC(C2CCC(=O)CC2)=C1 QMQMFUKUEXEZSI-UHFFFAOYSA-N 0.000 description 1
- JNBOVWFOTNYTES-UHFFFAOYSA-N 4-(4-chlorophenyl)cyclohexan-1-one Chemical compound C1=CC(Cl)=CC=C1C1CCC(=O)CC1 JNBOVWFOTNYTES-UHFFFAOYSA-N 0.000 description 1
- XDHMORMQXOUOHT-UHFFFAOYSA-N 4-(4-methylphenyl)cyclohexan-1-one Chemical compound C1=CC(C)=CC=C1C1CCC(=O)CC1 XDHMORMQXOUOHT-UHFFFAOYSA-N 0.000 description 1
- XFRVACCGEKPJDI-UHFFFAOYSA-N 4-(4-oxocyclohexyl)benzonitrile Chemical compound C1CC(=O)CCC1C1=CC=C(C#N)C=C1 XFRVACCGEKPJDI-UHFFFAOYSA-N 0.000 description 1
- OXOWTLDONRGYOT-UHFFFAOYSA-N 4-(dimethylamino)butanoic acid Chemical compound CN(C)CCCC(O)=O OXOWTLDONRGYOT-UHFFFAOYSA-N 0.000 description 1
- XFLMVUWRMQXZBZ-UHFFFAOYSA-N 4-[3,5-bis(trifluoromethyl)phenyl]cyclohexan-1-one Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C2CCC(=O)CC2)=C1 XFLMVUWRMQXZBZ-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- LBUNNMJLXWQQBY-UHFFFAOYSA-N 4-fluorophenylboronic acid Chemical compound OB(O)C1=CC=C(F)C=C1 LBUNNMJLXWQQBY-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- YKAYMASDSHFOGI-UHFFFAOYSA-N 4-phenylcyclohexan-1-one Chemical compound C1CC(=O)CCC1C1=CC=CC=C1 YKAYMASDSHFOGI-UHFFFAOYSA-N 0.000 description 1
- FPKISACHVIIMRA-UHFFFAOYSA-N 4-propan-2-ylcyclohexan-1-one Chemical compound CC(C)C1CCC(=O)CC1 FPKISACHVIIMRA-UHFFFAOYSA-N 0.000 description 1
- KHTYLZJZMBSTCN-UHFFFAOYSA-N 4-thiophen-2-ylcyclohexan-1-one Chemical compound C1CC(=O)CCC1C1=CC=CS1 KHTYLZJZMBSTCN-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- UZDSSCBDDNFAMZ-UHFFFAOYSA-N 5,6,7,8-tetrahydro-4h-[1,3]thiazolo[4,5-c]azepine Chemical group C1CCNCC2=C1SC=N2 UZDSSCBDDNFAMZ-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- YWLXLRUDGLRYDR-ZHPRIASZSA-N 5beta,20-epoxy-1,7beta,10beta,13alpha-tetrahydroxy-9-oxotax-11-ene-2alpha,4alpha-diyl 4-acetate 2-benzoate Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](O)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 YWLXLRUDGLRYDR-ZHPRIASZSA-N 0.000 description 1
- HCJNMIIEYLJYGH-UHFFFAOYSA-N 6,7-dihydro-4h-pyrano[4,3-d][1,3]thiazole Chemical compound C1OCCC2=C1SC=N2 HCJNMIIEYLJYGH-UHFFFAOYSA-N 0.000 description 1
- NQKPKIZHPZWYJJ-UHFFFAOYSA-N 6-bromo-2,2-dimethylcyclohexan-1-one Chemical compound CC1(C)CCCC(Br)C1=O NQKPKIZHPZWYJJ-UHFFFAOYSA-N 0.000 description 1
- SNBBQEMJLGTFAH-UHFFFAOYSA-N 6-bromo-2-ethyl-2-methylcyclohexan-1-one Chemical compound CCC1(C)CCCC(Br)C1=O SNBBQEMJLGTFAH-UHFFFAOYSA-N 0.000 description 1
- NYORKTOSGYPYRJ-UHFFFAOYSA-N 6-bromo-2-methyl-2-(2-methylpropyl)cyclohexan-1-one Chemical compound CC(C)CC1(C)CCCC(Br)C1=O NYORKTOSGYPYRJ-UHFFFAOYSA-N 0.000 description 1
- WYMTYHBTAVGDFL-UHFFFAOYSA-N 6-bromo-2-methyl-2-propylcyclohexan-1-one Chemical compound CCCC1(C)CCCC(Br)C1=O WYMTYHBTAVGDFL-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PZFNLQSLQXNSIN-UHFFFAOYSA-N 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane Chemical compound C1=CC(F)=CC=C1C1CCC2(OCCO2)CC1 PZFNLQSLQXNSIN-UHFFFAOYSA-N 0.000 description 1
- GNNFMZHECHAEGF-IHFUZBNMSA-N 99588-52-0 Chemical compound C[C@H](N)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)CC1=CC=CC=C1 GNNFMZHECHAEGF-IHFUZBNMSA-N 0.000 description 1
- 108010004276 A18Famide Proteins 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- UVTGNSWSRSCPLP-UHFFFAOYSA-N Arg-Tyr Natural products NC(CCNC(=N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O UVTGNSWSRSCPLP-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- SSWDYIISIMFHQP-UHFFFAOYSA-N C(C1=CC=CC=C1)N.C(C1=CC=CC=C1)NC(=S)N1CC2=C(CC1)N=C(S2)NC(=N)N Chemical compound C(C1=CC=CC=C1)N.C(C1=CC=CC=C1)NC(=S)N1CC2=C(CC1)N=C(S2)NC(=N)N SSWDYIISIMFHQP-UHFFFAOYSA-N 0.000 description 1
- LTMDZXQAOVHMKC-UHFFFAOYSA-N CCCCNCC.NC(NC1=NC(C(CCC2)C(O)=O)=C2S1)=N Chemical compound CCCCNCC.NC(NC1=NC(C(CCC2)C(O)=O)=C2S1)=N LTMDZXQAOVHMKC-UHFFFAOYSA-N 0.000 description 1
- HMMPDTJMDDONNU-NNJIEVJOSA-N C[C@H](N)Nc1nc(CCC(C2)c(cc3)ccc3OCc3ccccc3)c2[s]1 Chemical compound C[C@H](N)Nc1nc(CCC(C2)c(cc3)ccc3OCc3ccccc3)c2[s]1 HMMPDTJMDDONNU-NNJIEVJOSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- 101710150887 Cholecystokinin A Proteins 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-MRVPVSSYSA-N D-tyrosine Chemical compound OC(=O)[C@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-MRVPVSSYSA-N 0.000 description 1
- 206010012335 Dependence Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108091006027 G proteins Proteins 0.000 description 1
- 102000030782 GTP binding Human genes 0.000 description 1
- 108091000058 GTP-Binding Proteins 0.000 description 1
- 101001123492 Homo sapiens Prolactin-releasing peptide receptor Proteins 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010065390 Inflammatory pain Diseases 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 101150009512 NPVF gene Proteins 0.000 description 1
- 102400001094 Neuropeptide SF Human genes 0.000 description 1
- 101800001355 Neuropeptide SF Proteins 0.000 description 1
- 102000003797 Neuropeptides Human genes 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000000114 Pain Threshold Diseases 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- WFIHKLWVLPBMIQ-UHFFFAOYSA-N [1,3]thiazolo[5,4-b]pyridine Chemical compound C1=CN=C2SC=NC2=C1 WFIHKLWVLPBMIQ-UHFFFAOYSA-N 0.000 description 1
- RWOUHUFQVUBVRO-UHFFFAOYSA-N [2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1C(N=C(NC(N)=N)S2)=C2CCC1 RWOUHUFQVUBVRO-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 208000005298 acute pain Diseases 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 210000001789 adipocyte Anatomy 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005422 alkyl sulfonamido group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 125000000266 alpha-aminoacyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229940000635 beta-alanine Drugs 0.000 description 1
- KUWBXRGRMQZCSS-HSZRJFAPSA-N bibp-3226 Chemical compound N([C@H](CCCN=C(N)N)C(=O)NCC=1C=CC(O)=CC=1)C(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 KUWBXRGRMQZCSS-HSZRJFAPSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000008499 blood brain barrier function Effects 0.000 description 1
- 210000001218 blood-brain barrier Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- PVEOYINWKBTPIZ-UHFFFAOYSA-N but-3-enoic acid Chemical compound OC(=O)CC=C PVEOYINWKBTPIZ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- YULUJUFMKYQJDX-UHFFFAOYSA-N butyl 2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OCCCC)CCC2=C1SC(NC(N)=N)=N2 YULUJUFMKYQJDX-UHFFFAOYSA-N 0.000 description 1
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- JIKADBNXDMHWFV-UHFFFAOYSA-N carbamimidoylazanium;formate Chemical compound [O-]C=O.NC([NH3+])=N JIKADBNXDMHWFV-UHFFFAOYSA-N 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000006143 cell culture medium Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 210000001638 cerebellum Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 125000004651 chloromethoxy group Chemical group ClCO* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 description 1
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000000773 effect on pain Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ZZWSNYNCRUZSPR-UHFFFAOYSA-N ethyl 2-(2-oxocyclohexyl)acetate Chemical compound CCOC(=O)CC1CCCCC1=O ZZWSNYNCRUZSPR-UHFFFAOYSA-N 0.000 description 1
- YLHNRUFDGMKCRS-UHFFFAOYSA-N ethyl 2-(3-chloro-2-oxocyclohexyl)acetate Chemical compound CCOC(=O)CC1CCCC(Cl)C1=O YLHNRUFDGMKCRS-UHFFFAOYSA-N 0.000 description 1
- PEPAAOWVORGPHG-UHFFFAOYSA-N ethyl 2-(diaminomethylideneamino)-6-phenyl-5,7-dihydro-4h-1,3-benzothiazole-6-carboxylate Chemical compound C1CC=2N=C(NC(N)=N)SC=2CC1(C(=O)OCC)C1=CC=CC=C1 PEPAAOWVORGPHG-UHFFFAOYSA-N 0.000 description 1
- YVNQYNJZBSIXRW-UHFFFAOYSA-N ethyl 2-[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]acetate;formic acid Chemical compound OC=O.CCOC(=O)CC1CCCC2=C1N=C(N=C(N)N)S2 YVNQYNJZBSIXRW-UHFFFAOYSA-N 0.000 description 1
- NKJVOVNUPGWNBG-UHFFFAOYSA-N ethyl 3-[2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridin-5-yl]propanoate Chemical compound C1N(CCC(=O)OCC)CCC2=C1SC(NC(N)=N)=N2 NKJVOVNUPGWNBG-UHFFFAOYSA-N 0.000 description 1
- SFLPOCDMLNCXLK-UHFFFAOYSA-N ethyl 3-bromo-4-oxo-1-phenylcyclohexane-1-carboxylate Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCC(=O)C(Br)C1 SFLPOCDMLNCXLK-UHFFFAOYSA-N 0.000 description 1
- SYBVWVIZANWJOR-UHFFFAOYSA-N ethyl 4-oxo-1-phenylcyclohexane-1-carboxylate Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCC(=O)CC1 SYBVWVIZANWJOR-UHFFFAOYSA-N 0.000 description 1
- ZXYAWONOWHSQRU-UHFFFAOYSA-N ethyl 4-oxocyclohexanecarboxylate Chemical compound CCOC(=O)C1CCC(=O)CC1 ZXYAWONOWHSQRU-UHFFFAOYSA-N 0.000 description 1
- AFRWBGJRWRHQOV-UHFFFAOYSA-N ethyl 5-bromopentanoate Chemical compound CCOC(=O)CCCCBr AFRWBGJRWRHQOV-UHFFFAOYSA-N 0.000 description 1
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- FATAVLOOLIRUNA-UHFFFAOYSA-N formylmethyl Chemical group [CH2]C=O FATAVLOOLIRUNA-UHFFFAOYSA-N 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005241 heteroarylamino group Chemical group 0.000 description 1
- 125000005222 heteroarylaminocarbonyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 102000050049 human PRLHR Human genes 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- QWMUDOFWQWBHFI-UHFFFAOYSA-N hydroxy-imino-diphenoxy-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1OP(=O)(N)OC1=CC=CC=C1 QWMUDOFWQWBHFI-UHFFFAOYSA-N 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000004129 indan-1-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])([H])C2([H])* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000003914 insulin secretion Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000000185 intracerebroventricular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000005990 isobenzothienyl group Chemical group 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 238000011551 log transformation method Methods 0.000 description 1
- 238000011866 long-term treatment Methods 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 208000008013 morphine dependence Diseases 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- OYDVACUZLCNVEJ-UHFFFAOYSA-N n-[[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]methyl]acetamide Chemical compound C1C(CNC(=O)C)CCC2=C1SC(NC(N)=N)=N2 OYDVACUZLCNVEJ-UHFFFAOYSA-N 0.000 description 1
- 125000006257 n-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])OC(*)=O 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- JBJBBZBOTYKFOC-UHFFFAOYSA-N n-tert-butyl-2-(diaminomethylideneamino)-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide Chemical compound C1N(C(=O)NC(C)(C)C)CCC2=C1SC(NC(N)=N)=N2 JBJBBZBOTYKFOC-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 1
- BPGXUIVWLQTVLZ-OFGSCBOVSA-N neuropeptide y(npy) Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 BPGXUIVWLQTVLZ-OFGSCBOVSA-N 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000003399 opiate peptide Substances 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000008533 pain sensitivity Effects 0.000 description 1
- 230000037040 pain threshold Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 1
- DRINJBFRTLBHNF-UHFFFAOYSA-N propane-2-sulfonyl chloride Chemical compound CC(C)S(Cl)(=O)=O DRINJBFRTLBHNF-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 230000029865 regulation of blood pressure Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- RYGPRFLEQUUOFG-UHFFFAOYSA-N spiro[4.5]dec-8-en-8-yl trifluoromethanesulfonate Chemical compound C1CC(OS(=O)(=O)C(F)(F)F)=CCC11CCCC1 RYGPRFLEQUUOFG-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RGWGRRBHQUREDE-UHFFFAOYSA-N tert-butyl 3-bromo-4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)C(Br)C1 RGWGRRBHQUREDE-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005289 uranyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/428—Thiazoles condensed with carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/429—Thiazoles condensed with heterocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/437—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a five-membered ring having nitrogen as a ring hetero atom, e.g. indolizine, beta-carboline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/30—Drugs for disorders of the nervous system for treating abuse or dependence
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/30—Drugs for disorders of the nervous system for treating abuse or dependence
- A61P25/32—Alcohol-abuse
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/30—Drugs for disorders of the nervous system for treating abuse or dependence
- A61P25/34—Tobacco-abuse
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/30—Drugs for disorders of the nervous system for treating abuse or dependence
- A61P25/36—Opioid-abuse
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/48—Drugs for disorders of the endocrine system of the pancreatic hormones
- A61P5/50—Drugs for disorders of the endocrine system of the pancreatic hormones for increasing or potentiating the activity of insulin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Biomedical Technology (AREA)
- Addiction (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Diabetes (AREA)
- Psychiatry (AREA)
- Endocrinology (AREA)
- Pain & Pain Management (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Heart & Thoracic Surgery (AREA)
- Rheumatology (AREA)
- Hospice & Palliative Care (AREA)
- Emergency Medicine (AREA)
- Cardiology (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Peptides Or Proteins (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH4662003 | 2003-03-20 | ||
| CH466/03 | 2003-03-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2005132308A RU2005132308A (ru) | 2006-03-20 |
| RU2337911C2 true RU2337911C2 (ru) | 2008-11-10 |
Family
ID=32996985
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2005132308/04A RU2337911C2 (ru) | 2003-03-20 | 2004-03-22 | Производные гуанидина и их применение в качестве антагонистов рецептора нейропептида ff |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US7727979B2 (https=) |
| EP (1) | EP1608662A1 (https=) |
| JP (1) | JP2006520330A (https=) |
| KR (1) | KR20050107611A (https=) |
| CN (1) | CN100355758C (https=) |
| AR (1) | AR043662A1 (https=) |
| AU (1) | AU2004222224A1 (https=) |
| BR (1) | BRPI0408357A (https=) |
| CA (1) | CA2518679A1 (https=) |
| CL (1) | CL2004000553A1 (https=) |
| MX (1) | MXPA05009855A (https=) |
| NO (1) | NO20054743L (https=) |
| RU (1) | RU2337911C2 (https=) |
| TW (1) | TW200510434A (https=) |
| WO (1) | WO2004083218A1 (https=) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CL2004000553A1 (es) | 2003-03-20 | 2005-02-04 | Actelion Pharmaceuticals Ltd | Uso de compuestos derivados de guanidina como antagonistas del receptor de neuropeptido ff; compuestos derivados de guanidina; procedimientos de preparacion; y composicion farmaceutica que los comprende. |
| ATE496036T1 (de) * | 2004-03-19 | 2011-02-15 | Dipharma Francis Srl | Zwischenprodukte für die herstellung von pramipexol |
| EP2049110B1 (en) | 2006-07-14 | 2014-08-20 | Merck Sharp & Dohme Corp. | Bridged diazepan orexin receptor antagonists |
| PE20081229A1 (es) | 2006-12-01 | 2008-08-28 | Merck & Co Inc | Antagonistas de receptor de orexina de diazepam sustituido |
| JP2010527924A (ja) | 2007-05-18 | 2010-08-19 | メルク・シャープ・エンド・ドーム・コーポレイション | オキソ架橋ジアゼパンオレキシン受容体アンタゴニスト |
| AU2008260647A1 (en) | 2007-05-23 | 2008-12-11 | Merck Sharp & Dohme Corp. | Cyclopropyl pyrrolidine orexin receptor antagonists |
| NZ580887A (en) | 2007-05-23 | 2012-03-30 | Merck Sharp & Dohme | Pyridyl piperidine orexin receptor antagonists |
| EP2348857B1 (en) | 2008-10-22 | 2016-02-24 | Merck Sharp & Dohme Corp. | Novel cyclic benzimidazole derivatives useful anti-diabetic agents |
| US8329914B2 (en) | 2008-10-31 | 2012-12-11 | Merck Sharp & Dohme Corp | Cyclic benzimidazole derivatives useful as anti-diabetic agents |
| JP2013520502A (ja) | 2010-02-25 | 2013-06-06 | メルク・シャープ・エンド・ドーム・コーポレイション | 有用な抗糖尿病薬である新規な環状ベンズイミダゾール誘導体 |
| SG192941A1 (en) | 2011-02-25 | 2013-09-30 | Merck Sharp & Dohme | Novel cyclic azabenzimidazole derivatives useful as anti-diabetic agents |
| AR088352A1 (es) | 2011-10-19 | 2014-05-28 | Merck Sharp & Dohme | Antagonistas del receptor de 2-piridiloxi-4-nitrilo orexina |
| RU2015106909A (ru) | 2012-08-02 | 2016-09-27 | Мерк Шарп И Доум Корп. | Антидиабетические трициклические соединения |
| KR20150118158A (ko) | 2013-02-22 | 2015-10-21 | 머크 샤프 앤드 돔 코포레이션 | 항당뇨병 비시클릭 화합물 |
| WO2014139388A1 (en) | 2013-03-14 | 2014-09-18 | Merck Sharp & Dohme Corp. | Novel indole derivatives useful as anti-diabetic agents |
| WO2015051496A1 (en) | 2013-10-08 | 2015-04-16 | Merck Sharp & Dohme Corp. | Antidiabetic tricyclic compounds |
| US10344002B2 (en) | 2016-09-26 | 2019-07-09 | Nusirt Sciences, Inc. | Compositions and methods for treating metabolic disorders |
| US11072602B2 (en) | 2016-12-06 | 2021-07-27 | Merck Sharp & Dohme Corp. | Antidiabetic heterocyclic compounds |
| EP3558298B1 (en) | 2016-12-20 | 2026-03-11 | Merck Sharp & Dohme LLC | Antidiabetic spirochroman compounds |
| US11491136B2 (en) | 2017-02-14 | 2022-11-08 | Research Triangle Institute | Proline-based neuropeptide FF receptor modulators |
| EP3762008A1 (en) * | 2018-03-09 | 2021-01-13 | Centre National de la Recherche Scientifique | Hybrid mu opioid receptor and neuropeptide ff receptor binding molecules, their methods of preparation and applications in therapeutic treatment |
| CN110093348B (zh) * | 2018-12-05 | 2022-11-29 | 西北工业大学 | 增强小鼠NPFFR2基因表达的shRNA |
| KR20220044721A (ko) | 2019-08-06 | 2022-04-11 | 도메인 테라퓨틱스 | 신경펩타이드 ff 수용체 길항제로서의 5-헤테로아릴-피리딘-2-아민 화합물 |
| CN112341404B (zh) * | 2019-08-09 | 2023-05-23 | 成都苑东生物制药股份有限公司 | 噻唑类衍生物或盐、异构体、其制备方法及用途 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1140387A (en) * | 1965-07-23 | 1969-01-15 | Thomae Gmbh Dr K | 4,5,6,7-tetrahydro-thiazolo-[5,4-c]pyridines |
| SU664965A1 (ru) * | 1977-02-01 | 1979-05-30 | Уральский ордена Трудового Красного Знамени политехнический институт им.С.М.Кирова | 3-Замещенные пиридо /2,3-е/-1,2,4тиадиазин-1,1-диоксиды,обладающие анальгетическим действием |
| US4624956A (en) * | 1983-12-16 | 1986-11-25 | Farmitalia Carlo Erba | Ulcer and gastric secretion inhibiting 4,5,6,7-tetrahydrothiazole[5,4-c]pyridine derivatives |
| US4716228A (en) * | 1985-03-23 | 1987-12-29 | Farmitalia Carlo Erba S.P.A. | Condensed 2-substituted thiazole derivatives |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795257A (fr) | 1972-02-10 | 1973-08-09 | Thomae Gmbh Dr K | Nouveaux oxazols |
| JPS60226810A (ja) | 1984-04-25 | 1985-11-12 | Ikeda Mohandou:Kk | 抗潰瘍剤 |
| JPS6233158A (ja) | 1985-08-02 | 1987-02-13 | Shionogi & Co Ltd | ベンズイミダゾ−ル誘導体および抗潰瘍剤 |
| WO1989005643A1 (en) * | 1987-12-18 | 1989-06-29 | Pfizer Inc. | Heterocyclic-substituted quinoline-carboxylic acids |
| KR0168978B1 (ko) * | 1995-07-12 | 1999-01-15 | 김종인 | 헤테로고리 접합 티아졸 유도체 |
| JPH0959258A (ja) * | 1995-08-11 | 1997-03-04 | Ono Pharmaceut Co Ltd | グアニジル誘導体 |
| FR2814367B1 (fr) * | 2000-09-25 | 2008-12-26 | Inst Nat Sante Rech Med | Ligands du recepteur npff pour le traitement de la douleur et des hyperalgies |
| CL2004000553A1 (es) | 2003-03-20 | 2005-02-04 | Actelion Pharmaceuticals Ltd | Uso de compuestos derivados de guanidina como antagonistas del receptor de neuropeptido ff; compuestos derivados de guanidina; procedimientos de preparacion; y composicion farmaceutica que los comprende. |
-
2004
- 2004-03-17 CL CL200400553A patent/CL2004000553A1/es unknown
- 2004-03-19 TW TW093107426A patent/TW200510434A/zh unknown
- 2004-03-19 AR ARP040100923A patent/AR043662A1/es unknown
- 2004-03-22 AU AU2004222224A patent/AU2004222224A1/en not_active Abandoned
- 2004-03-22 CA CA002518679A patent/CA2518679A1/en not_active Abandoned
- 2004-03-22 JP JP2006504158A patent/JP2006520330A/ja active Pending
- 2004-03-22 MX MXPA05009855A patent/MXPA05009855A/es unknown
- 2004-03-22 WO PCT/CH2004/000175 patent/WO2004083218A1/de not_active Ceased
- 2004-03-22 US US10/549,685 patent/US7727979B2/en not_active Expired - Fee Related
- 2004-03-22 CN CNB2004800074476A patent/CN100355758C/zh not_active Expired - Fee Related
- 2004-03-22 KR KR1020057016769A patent/KR20050107611A/ko not_active Withdrawn
- 2004-03-22 RU RU2005132308/04A patent/RU2337911C2/ru not_active IP Right Cessation
- 2004-03-22 BR BRPI0408357-1A patent/BRPI0408357A/pt not_active IP Right Cessation
- 2004-03-22 EP EP04722212A patent/EP1608662A1/de not_active Withdrawn
-
2005
- 2005-10-14 NO NO20054743A patent/NO20054743L/no unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1140387A (en) * | 1965-07-23 | 1969-01-15 | Thomae Gmbh Dr K | 4,5,6,7-tetrahydro-thiazolo-[5,4-c]pyridines |
| SU664965A1 (ru) * | 1977-02-01 | 1979-05-30 | Уральский ордена Трудового Красного Знамени политехнический институт им.С.М.Кирова | 3-Замещенные пиридо /2,3-е/-1,2,4тиадиазин-1,1-диоксиды,обладающие анальгетическим действием |
| US4624956A (en) * | 1983-12-16 | 1986-11-25 | Farmitalia Carlo Erba | Ulcer and gastric secretion inhibiting 4,5,6,7-tetrahydrothiazole[5,4-c]pyridine derivatives |
| US4716228A (en) * | 1985-03-23 | 1987-12-29 | Farmitalia Carlo Erba S.P.A. | Condensed 2-substituted thiazole derivatives |
Non-Patent Citations (1)
| Title |
|---|
| Marinko P et al "A convenient synthesis of 4-aminomethyl-4,5,6,7-tetrahydro-1,3-benzothiazole arginine side-chain mimitics", Tetrahedron letters, v.42, no 50, 10.12.2001, p.8911-8913. * |
Also Published As
| Publication number | Publication date |
|---|---|
| BRPI0408357A (pt) | 2006-03-21 |
| JP2006520330A (ja) | 2006-09-07 |
| AU2004222224A1 (en) | 2004-09-30 |
| US20060194788A1 (en) | 2006-08-31 |
| CA2518679A1 (en) | 2004-09-30 |
| KR20050107611A (ko) | 2005-11-14 |
| NO20054743L (no) | 2005-10-14 |
| WO2004083218A1 (de) | 2004-09-30 |
| EP1608662A1 (de) | 2005-12-28 |
| US7727979B2 (en) | 2010-06-01 |
| CL2004000553A1 (es) | 2005-02-04 |
| AR043662A1 (es) | 2005-08-03 |
| TW200510434A (en) | 2005-03-16 |
| CN1761673A (zh) | 2006-04-19 |
| CN100355758C (zh) | 2007-12-19 |
| MXPA05009855A (es) | 2005-12-06 |
| RU2005132308A (ru) | 2006-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2337911C2 (ru) | Производные гуанидина и их применение в качестве антагонистов рецептора нейропептида ff | |
| TWI465452B (zh) | 螺-吲哚酮化合物之鏡像異構物及其作為治療劑之用途 | |
| JP6626454B2 (ja) | Trpa1モジュレーター | |
| JP2010522690A (ja) | 三環式スピロオキシインドール誘導体および治療薬としてのその使用 | |
| US20250115576A1 (en) | Therapeutic compounds and methods of use thereof | |
| US20250042917A1 (en) | Therapeutic compounds and methods of use thereof | |
| CN108137477A (zh) | 治疗化合物及其使用方法 | |
| CN105492430B (zh) | 取代的苯并噁唑及其使用方法 | |
| JP2007504176A (ja) | グアニジン誘導体 | |
| ZA200508486B (en) | Guanidine derivatives and use thereof as neuropeptide FF receptor antagonists | |
| TW202000651A (zh) | 治療性組成物及其使用方法 | |
| AU2015224493A1 (en) | Enantiomers of spiro-oxindole compounds and their uses as therapeutic agents | |
| HK1168854B (en) | Enantiomers of spiro-oxindole compounds and their uses as therapeutic agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20090323 |