PL96854B1 - Sposob wytwarzania nowych pochodnych indolochinolizydyny - Google Patents
Sposob wytwarzania nowych pochodnych indolochinolizydyny Download PDFInfo
- Publication number
- PL96854B1 PL96854B1 PL1975183604A PL18360475A PL96854B1 PL 96854 B1 PL96854 B1 PL 96854B1 PL 1975183604 A PL1975183604 A PL 1975183604A PL 18360475 A PL18360475 A PL 18360475A PL 96854 B1 PL96854 B1 PL 96854B1
- Authority
- PL
- Poland
- Prior art keywords
- general formula
- base
- salt
- pattern
- acrylonitrile
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 12
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 10
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- -1 perchlorate anion Chemical class 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000001450 anions Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 238000011065 in-situ storage Methods 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- 239000002585 base Substances 0.000 description 14
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000013078 crystal Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical group C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- LLYCMZGLHLKPPU-UHFFFAOYSA-M perbromate Chemical compound [O-]Br(=O)(=O)=O LLYCMZGLHLKPPU-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- NMDQVCDFLXXRTG-UHFFFAOYSA-N 1,2,3,4,6,7,8,12c-octahydroindolo[3,2-a]quinolizine Chemical class N1C2=CC=CC=C2C2=C1CCN1CCCCC12 NMDQVCDFLXXRTG-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- AUSSBLHFRIDLMK-UHFFFAOYSA-N 1-ethyl-2,3,4,5,6,7-hexahydroindole Chemical compound C(C)N1CCC=2CCCCC1=2 AUSSBLHFRIDLMK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SYHCXSQXKZKYIW-UHFFFAOYSA-N 5-bromo-2-ethylpentanoic acid Chemical compound CCC(C(O)=O)CCCBr SYHCXSQXKZKYIW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- ZXOAGXKNGQDYKS-UHFFFAOYSA-N C1CCCN2CCCCC12.N1C=CC2=CC=CC=C12 Chemical class C1CCCN2CCCCC12.N1C=CC2=CC=CC=C12 ZXOAGXKNGQDYKS-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- ZNJPKZMTMAYNGM-UHFFFAOYSA-N diethyl 2-(3-bromopropyl)-2-ethylpropanedioate Chemical compound CCOC(=O)C(CC)(CCCBr)C(=O)OCC ZNJPKZMTMAYNGM-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZDAZUJBASMCUAK-UHFFFAOYSA-N n-[2-(1h-indol-3-yl)ethyl]pyridine-3-carboxamide Chemical compound C=1NC2=CC=CC=C2C=1CCNC(=O)C1=CC=CN=C1 ZDAZUJBASMCUAK-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005609 naphthenate group Chemical group 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI544A HU170205B (show.php) | 1974-09-27 | 1974-09-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL96854B1 true PL96854B1 (pl) | 1978-01-31 |
Family
ID=11000955
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975183604A PL96854B1 (pl) | 1974-09-27 | 1975-09-26 | Sposob wytwarzania nowych pochodnych indolochinolizydyny |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5159897A (show.php) |
| AT (1) | AT345994B (show.php) |
| AU (1) | AU497150B2 (show.php) |
| BE (1) | BE833894A (show.php) |
| BG (1) | BG30777A3 (show.php) |
| CA (1) | CA1067496A (show.php) |
| CH (1) | CH623585A5 (show.php) |
| CS (1) | CS186720B2 (show.php) |
| DD (1) | DD122820A5 (show.php) |
| DE (1) | DE2541485C3 (show.php) |
| DK (1) | DK138328B (show.php) |
| FR (1) | FR2286139A1 (show.php) |
| GB (1) | GB1473484A (show.php) |
| HU (1) | HU170205B (show.php) |
| IL (1) | IL48144A (show.php) |
| NL (1) | NL7511284A (show.php) |
| PL (1) | PL96854B1 (show.php) |
| SE (1) | SE421207B (show.php) |
| SU (1) | SU619106A3 (show.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU174502B (hu) * | 1976-12-30 | 1980-01-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh oktagidro-indolo/2,3-a/-khinolizina |
-
1974
- 1974-09-27 HU HURI544A patent/HU170205B/hu unknown
-
1975
- 1975-09-12 CH CH1208475A patent/CH623585A5/de not_active IP Right Cessation
- 1975-09-17 DE DE2541485A patent/DE2541485C3/de not_active Expired
- 1975-09-17 AT AT711275A patent/AT345994B/de not_active IP Right Cessation
- 1975-09-19 IL IL48144A patent/IL48144A/xx unknown
- 1975-09-19 AU AU85018/75A patent/AU497150B2/en not_active Expired
- 1975-09-23 FR FR7529073A patent/FR2286139A1/fr active Granted
- 1975-09-23 CS CS7500006410A patent/CS186720B2/cs unknown
- 1975-09-25 GB GB3931375A patent/GB1473484A/en not_active Expired
- 1975-09-25 NL NL7511284A patent/NL7511284A/xx not_active Application Discontinuation
- 1975-09-25 BG BG031071A patent/BG30777A3/xx unknown
- 1975-09-25 CA CA236,327A patent/CA1067496A/en not_active Expired
- 1975-09-25 SE SE7510784A patent/SE421207B/xx not_active IP Right Cessation
- 1975-09-25 DD DD188550A patent/DD122820A5/xx unknown
- 1975-09-26 BE BE160438A patent/BE833894A/xx not_active IP Right Cessation
- 1975-09-26 SU SU752176207A patent/SU619106A3/ru active
- 1975-09-26 PL PL1975183604A patent/PL96854B1/pl unknown
- 1975-09-26 JP JP50117084A patent/JPS5159897A/ja active Pending
- 1975-09-26 DK DK433175AA patent/DK138328B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SU619106A3 (ru) | 1978-08-05 |
| BG30777A3 (en) | 1981-08-14 |
| FR2286139B3 (show.php) | 1978-05-05 |
| DE2541485B2 (de) | 1981-08-06 |
| CA1067496A (en) | 1979-12-04 |
| CS186720B2 (en) | 1978-12-29 |
| CH623585A5 (en) | 1981-06-15 |
| DE2541485C3 (de) | 1982-05-13 |
| SE7510784L (sv) | 1976-03-29 |
| DD122820A5 (show.php) | 1976-11-05 |
| SE421207B (sv) | 1981-12-07 |
| AT345994B (de) | 1978-10-10 |
| DE2541485A1 (de) | 1976-04-15 |
| JPS5159897A (show.php) | 1976-05-25 |
| AU8501875A (en) | 1977-03-24 |
| IL48144A0 (en) | 1975-11-25 |
| DK433175A (show.php) | 1976-03-28 |
| AU497150B2 (en) | 1978-12-07 |
| DK138328B (da) | 1978-08-14 |
| GB1473484A (en) | 1977-05-11 |
| DK138328C (show.php) | 1979-01-22 |
| HU170205B (show.php) | 1977-04-28 |
| IL48144A (en) | 1979-07-25 |
| ATA711275A (de) | 1978-02-15 |
| FR2286139A1 (fr) | 1976-04-23 |
| BE833894A (fr) | 1976-01-16 |
| NL7511284A (nl) | 1976-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS582935B2 (ja) | 5↓−アロイルピロ−ル誘導体の製造法 | |
| JPH0255422B2 (show.php) | ||
| CZ301563B6 (cs) | Zpusob prípravy pyrrolopyrimidinových derivátu | |
| JPH0742290B2 (ja) | 1,2−ジヒドロ−3H−ピロロ〔1,2−α〕ピロール−1−カルボン酸エステルの5位のアロイル化方法 | |
| SU719499A3 (ru) | Способ получени производных 1,2,3,4,6,7-гексагидро-11 в н-бензо( )-хинолизина или их солей | |
| US4220774A (en) | Vincadifformine synthesis process | |
| Zaderenko et al. | Synthesis and regioselective hydrolysis of 2-(imidazol-1-yl) succinic esters | |
| PL96854B1 (pl) | Sposob wytwarzania nowych pochodnych indolochinolizydyny | |
| Odijk et al. | Fluorescent nucleoside analogues: synthesis of fluorescent pyrido [2, 1-i] purines, and their corresponding ribosides | |
| GB2106504A (en) | 9-bromo-indoloquinolisine derivatives and processes for their preparation | |
| JPH07121944B2 (ja) | N▲下1▼‐メチル‐10α‐メトキシルミリセルゴールの製造方法 | |
| IL38023A (en) | Isoindoline derivatives and process for their preparation | |
| US4036841A (en) | Indolo[2,3α]quinolizine derivatives | |
| US4022780A (en) | Process for the manufacture of indole derivatives | |
| JPH03220194A (ja) | スタウロスポリンカルボン酸誘導体 | |
| SU971099A3 (ru) | Способ получени производных октагидроиндоло /2,3-а/ хинолизина или их солей | |
| JPS6054340A (ja) | 置換安息香酸エステル化合物の製造方法 | |
| US4044012A (en) | Indolo-quinolizidine derivatives | |
| SU1189348A3 (ru) | Способ получени сложных эфиров алкоксивинкаминовой кислоты и/или сложных эфиров алкоксиаповинкаминовой кислоты или их эпимеров,рацематов,оптически активных изомеров или их кислотных физиологически приемлемых солей | |
| Dumitrascu et al. | New pyrrolo [1, 2-a][1, 10] phenanthrolines with helical chirality | |
| US4054571A (en) | Nitrogen-containing polycyclic compounds and a process for the preparation thereof | |
| SU1227633A1 (ru) | Способ получени производных имидазо [4,5- @ ] индолов | |
| SU1402264A3 (ru) | Способ получени производных пиримидоизохинолина | |
| US4118395A (en) | Method for the production of indolyl lactones | |
| KR850000430B1 (ko) | 6-치환 피라논 화합물의 제조방법 |