PL92462B1 - - Google Patents
Download PDFInfo
- Publication number
- PL92462B1 PL92462B1 PL1971181166A PL18116671A PL92462B1 PL 92462 B1 PL92462 B1 PL 92462B1 PL 1971181166 A PL1971181166 A PL 1971181166A PL 18116671 A PL18116671 A PL 18116671A PL 92462 B1 PL92462 B1 PL 92462B1
- Authority
- PL
- Poland
- Prior art keywords
- yield
- tetrahydro
- azepine
- amino
- melting point
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 15
- -1 hexahydrobenzyl Chemical group 0.000 claims description 13
- 238000009835 boiling Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 150000001538 azepines Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 238000002844 melting Methods 0.000 description 55
- 230000008018 melting Effects 0.000 description 55
- 238000000354 decomposition reaction Methods 0.000 description 39
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 12
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 11
- 239000004202 carbamide Substances 0.000 description 10
- PJHKXESPJOFGOA-UHFFFAOYSA-N 1h-azepine;dihydrochloride Chemical compound Cl.Cl.N1C=CC=CC=C1 PJHKXESPJOFGOA-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 7
- 230000001914 calming effect Effects 0.000 description 6
- FVTYXGRQEGSJTH-UHFFFAOYSA-N azepan-2-one;hydrochloride Chemical compound Cl.O=C1CCCCCN1 FVTYXGRQEGSJTH-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 206010011224 Cough Diseases 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000003110 anti-inflammatory effect Effects 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- DJGIITKNTHQYPX-UHFFFAOYSA-N 1-benzylazepan-2-one Chemical compound O=C1CCCCCN1CC1=CC=CC=C1 DJGIITKNTHQYPX-UHFFFAOYSA-N 0.000 description 3
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 2
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 2
- RCHRZZVXKQKIQH-UHFFFAOYSA-N 6-ethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CN(CC)CCC2=C1SC(N)=N2 RCHRZZVXKQKIQH-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- GMEHFXXZSWDEDB-UHFFFAOYSA-N N-ethylthiourea Chemical compound CCNC(N)=S GMEHFXXZSWDEDB-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 230000004531 blood pressure lowering effect Effects 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- POXAIQSXNOEQGM-UHFFFAOYSA-N propan-2-ylthiourea Chemical compound CC(C)NC(N)=S POXAIQSXNOEQGM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ONOBXDPYDHTSBQ-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-diazepine Chemical compound C1CC=CCNN1 ONOBXDPYDHTSBQ-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000006280 2-bromobenzyl group Chemical group [H]C1=C([H])C(Br)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- QSCVJEBRANBOEL-UHFFFAOYSA-N 5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine dihydrochloride Chemical compound Cl.Cl.C1CNCCC2=C1SC=N2 QSCVJEBRANBOEL-UHFFFAOYSA-N 0.000 description 1
- CEUCVLQJAZKIJP-UHFFFAOYSA-N 6-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC(C)C CEUCVLQJAZKIJP-UHFFFAOYSA-N 0.000 description 1
- VWXJHCIEEKARTG-UHFFFAOYSA-N 6-[(3-bromophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Br VWXJHCIEEKARTG-UHFFFAOYSA-N 0.000 description 1
- QHNGFZZXGOFXPN-UHFFFAOYSA-N 6-[(4-chlorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CC=2SC(N)=NC=2CCN1CC1=CC=C(Cl)C=C1 QHNGFZZXGOFXPN-UHFFFAOYSA-N 0.000 description 1
- GJPGAKKPKZEVGZ-UHFFFAOYSA-N 6-[(4-chlorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine;dihydrochloride Chemical compound Cl.Cl.C1CC=2SC(N)=NC=2CCN1CC1=CC=C(Cl)C=C1 GJPGAKKPKZEVGZ-UHFFFAOYSA-N 0.000 description 1
- GBQLRACMWOCCOY-UHFFFAOYSA-N 6-[(4-methylphenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C GBQLRACMWOCCOY-UHFFFAOYSA-N 0.000 description 1
- HERPWIXOKVOUMO-UHFFFAOYSA-N 6-[[3-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F HERPWIXOKVOUMO-UHFFFAOYSA-N 0.000 description 1
- MUXSAUXLYSCZLI-UHFFFAOYSA-N 6-[[4-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C(F)(F)F MUXSAUXLYSCZLI-UHFFFAOYSA-N 0.000 description 1
- QZNXRXDPYHWXAF-UHFFFAOYSA-N 6-benzyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1OC=2CCN(CCC2N1)CC1=CC=CC=C1 QZNXRXDPYHWXAF-UHFFFAOYSA-N 0.000 description 1
- ZXYTWCOGVQEDAT-UHFFFAOYSA-N 6-benzyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CC=2SC(N)=NC=2CCN1CC1=CC=CC=C1 ZXYTWCOGVQEDAT-UHFFFAOYSA-N 0.000 description 1
- DYAVCPODANMGPD-UHFFFAOYSA-N 6-benzyl-N-methyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound CNC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 DYAVCPODANMGPD-UHFFFAOYSA-N 0.000 description 1
- AGQSUEFQXOKJMY-UHFFFAOYSA-N 6-butyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CCCC AGQSUEFQXOKJMY-UHFFFAOYSA-N 0.000 description 1
- ZNXAJGZPUQOEDZ-UHFFFAOYSA-N 6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine Chemical compound C1CN(CC)CCC2=C1OC(N)=N2 ZNXAJGZPUQOEDZ-UHFFFAOYSA-N 0.000 description 1
- WDLILJPUTYYQMM-UHFFFAOYSA-N 6-methyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)C WDLILJPUTYYQMM-UHFFFAOYSA-N 0.000 description 1
- KIFFPFKVDOQZPY-UHFFFAOYSA-N 6-phenyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)C1=CC=CC=C1 KIFFPFKVDOQZPY-UHFFFAOYSA-N 0.000 description 1
- SBORZAVOKSPZHY-UHFFFAOYSA-N 6-propan-2-yl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine Chemical compound NC=1OC=2CCN(CCC2N1)C(C)C SBORZAVOKSPZHY-UHFFFAOYSA-N 0.000 description 1
- QSIJHQVUCDVWPC-UHFFFAOYSA-N 6-propan-2-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)C(C)C QSIJHQVUCDVWPC-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- DLLLWCJNDAJMBI-UHFFFAOYSA-N Cl.Cl.NC=1OC=2CCN(CCC2N1)CC(C)C Chemical compound Cl.Cl.NC=1OC=2CCN(CCC2N1)CC(C)C DLLLWCJNDAJMBI-UHFFFAOYSA-N 0.000 description 1
- UACDEVWISPJYPZ-UHFFFAOYSA-N Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F UACDEVWISPJYPZ-UHFFFAOYSA-N 0.000 description 1
- RGJLKBLEPHQHBX-UHFFFAOYSA-N Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Cl Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Cl RGJLKBLEPHQHBX-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- JCADVWLAEVQLCG-UHFFFAOYSA-N NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Br Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)Br JCADVWLAEVQLCG-UHFFFAOYSA-N 0.000 description 1
- SNLDSSYNIVAHDX-UHFFFAOYSA-N NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F SNLDSSYNIVAHDX-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- UHGKYJXJYJWDAM-UHFFFAOYSA-N Propylthiourea Chemical compound CCCNC(N)=S UHGKYJXJYJWDAM-UHFFFAOYSA-N 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- 208000032140 Sleepiness Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 206010041349 Somnolence Diseases 0.000 description 1
- 208000010513 Stupor Diseases 0.000 description 1
- HTKFORQRBXIQHD-UHFFFAOYSA-N allylthiourea Chemical compound NC(=S)NCC=C HTKFORQRBXIQHD-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000002322 anti-exudative effect Effects 0.000 description 1
- DXZDEAJXVCLRLE-UHFFFAOYSA-N azepin-2-one Chemical class O=C1C=CC=CC=N1 DXZDEAJXVCLRLE-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- LEEHHPPLIOFGSC-UHFFFAOYSA-N cyclohexylthiourea Chemical compound NC(=S)NC1CCCCC1 LEEHHPPLIOFGSC-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- KIYXXKTUEPCNLC-UHFFFAOYSA-N pentylthiourea Chemical compound CCCCCNC(N)=S KIYXXKTUEPCNLC-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical group [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000037321 sleepiness Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Chemical group 0.000 description 1
- 229910000104 sodium hydride Chemical group 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2040510A DE2040510C3 (de) | 1970-08-14 | 1970-08-14 | Oxazole- und Thiazole eckige Klammer auf 5,4-d] azepin- Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL92462B1 true PL92462B1 (show.php) | 1977-04-30 |
Family
ID=5779804
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181165A PL92461B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181166A PL92462B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181167A PL92463B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181164A PL92460B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181163A PL92458B1 (show.php) | 1970-08-14 | 1971-08-13 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181165A PL92461B1 (show.php) | 1970-08-14 | 1971-08-13 |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181167A PL92463B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181164A PL92460B1 (show.php) | 1970-08-14 | 1971-08-13 | |
| PL1971181163A PL92458B1 (show.php) | 1970-08-14 | 1971-08-13 |
Country Status (8)
| Country | Link |
|---|---|
| AT (5) | AT310182B (show.php) |
| CH (4) | CH562829A5 (show.php) |
| DE (1) | DE2040510C3 (show.php) |
| ES (2) | ES396451A1 (show.php) |
| PL (5) | PL92461B1 (show.php) |
| RO (1) | RO59322A (show.php) |
| SU (4) | SU474151A3 (show.php) |
| ZA (1) | ZA715393B (show.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795257A (fr) * | 1972-02-10 | 1973-08-09 | Thomae Gmbh Dr K | Nouveaux oxazols |
| GB2173187B (en) * | 1985-03-23 | 1988-05-18 | Erba Farmitalia | Condensed 2-substituted thiazole derivatives |
| US4826686A (en) * | 1985-12-14 | 1989-05-02 | Boehringer Ingelheim Kg | Therapeutic system |
| DE3610388A1 (de) * | 1986-03-27 | 1987-10-01 | Bernhard Dr Wessling | Stabile elektroden auf basis makromolekularer werkstoffe und verfahren zu ihrer verwendung |
| US7091181B2 (en) | 1994-12-12 | 2006-08-15 | Omeros Corporation | Method of inhibition of pain and inflammation during surgery comprising administration of soluble TNF receptors |
| HK1048259B (en) * | 1998-10-20 | 2005-06-03 | Omeros Corporation | Irrigation solution and method for inhibition of pain and inflammation |
| US20030087962A1 (en) | 1998-10-20 | 2003-05-08 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| US7973068B2 (en) | 1998-10-20 | 2011-07-05 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| EP2935284A4 (en) * | 2012-12-21 | 2016-04-27 | Abbvie Inc | HETEROCYCLIC MODULATORS OF HORMONE NUCLEAR RECEPTORS |
-
1970
- 1970-08-14 DE DE2040510A patent/DE2040510C3/de not_active Expired
-
1971
- 1971-08-04 RO RO70459A patent/RO59322A/ro unknown
- 1971-08-05 SU SU1896328A patent/SU474151A3/ru active
- 1971-08-05 SU SU1896327A patent/SU461508A3/ru active
- 1971-08-05 SU SU1896325A patent/SU461507A3/ru active
- 1971-08-11 CH CH160075A patent/CH562829A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160175A patent/CH571009A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH159975A patent/CH561730A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160275A patent/CH562830A5/xx not_active IP Right Cessation
- 1971-08-12 ZA ZA715393A patent/ZA715393B/xx unknown
- 1971-08-13 AT AT899472A patent/AT310182B/de active
- 1971-08-13 PL PL1971181165A patent/PL92461B1/pl unknown
- 1971-08-13 PL PL1971181166A patent/PL92462B1/pl unknown
- 1971-08-13 AT AT899372A patent/AT310764B/de not_active IP Right Cessation
- 1971-08-13 PL PL1971181167A patent/PL92463B1/pl unknown
- 1971-08-13 PL PL1971181164A patent/PL92460B1/pl unknown
- 1971-08-13 AT AT899072A patent/AT310179B/de active
- 1971-08-13 AT AT899272A patent/AT310181B/de active
- 1971-08-13 PL PL1971181163A patent/PL92458B1/pl unknown
- 1971-08-13 AT AT899172A patent/AT310180B/de active
- 1971-10-28 ES ES396451A patent/ES396451A1/es not_active Expired
- 1971-10-28 ES ES396452A patent/ES396452A1/es not_active Expired
-
1973
- 1973-03-20 SU SU1896326A patent/SU503526A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CH571009A5 (show.php) | 1975-12-31 |
| CH562830A5 (show.php) | 1975-06-13 |
| ES396451A1 (es) | 1974-05-16 |
| ZA715393B (en) | 1972-05-31 |
| PL92461B1 (show.php) | 1977-04-30 |
| AT310180B (de) | 1973-09-25 |
| SU461507A3 (ru) | 1975-02-25 |
| AT310179B (de) | 1973-09-25 |
| AT310181B (de) | 1973-09-25 |
| PL92460B1 (show.php) | 1977-04-30 |
| CH562829A5 (show.php) | 1975-06-13 |
| RO59322A (show.php) | 1976-02-15 |
| PL92458B1 (show.php) | 1977-04-30 |
| CH561730A5 (show.php) | 1975-05-15 |
| ES396452A1 (es) | 1974-05-16 |
| DE2040510B2 (de) | 1979-07-05 |
| AT310182B (de) | 1973-09-25 |
| SU503526A3 (ru) | 1976-02-15 |
| SU474151A3 (ru) | 1975-06-14 |
| DE2040510C3 (de) | 1980-03-06 |
| DE2040510A1 (de) | 1972-02-17 |
| SU442601A3 (ru) | 1974-09-05 |
| SU461508A3 (ru) | 1975-02-25 |
| PL92463B1 (show.php) | 1977-04-30 |
| AT310764B (de) | 1973-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5314884A (en) | 2-pyrimidinyl-1-piperazine derivatives processes for their preparation and medicaments containing them | |
| EP0260817B1 (en) | Quinazolinediones and pyridopyrimidinediones | |
| US3538097A (en) | Substituted piperazino-bis-benzimid-azoles having anthelmintic and bacteriostatic activity | |
| FI71148C (fi) | Foerfarande foer framstaellning av nya antihypertensiva 4h-1,2,4-triazolo(4,3-a)kinoxalin-4-oner | |
| EP0000490A1 (en) | Substituted naphthyridinones, processes for their preparations and therapeutical applications | |
| CA1079739A (en) | Basically substituted indole derivatives and process for their manufacture | |
| PL92462B1 (show.php) | ||
| DE1620508A1 (de) | Verfahren zur Herstellung neuer 4,5,6,7-Tetrahydrothiazolo-[5,4-c]-pyridine | |
| HU200337B (en) | Process for producing substituted 6-phenyldihydro-3/2h/-pyridazinone derivatives and pharmaceutical compositions comprising such compounds | |
| LV10716B (en) | Novel derivatives of triazolopyridine and triazoloquinoline aminoalkylthio compounds, methods for preparation thereof, medicinal preparations containing same, their use as analgetics | |
| US4585773A (en) | Isoindolinyl-alkyl-piperazines | |
| US3798226A (en) | 3-acylamino-4-phenylquinolines carrying a substituent on the benzene ring | |
| CA2368815A1 (en) | Novel synthesis and crystallization of piperazine ring-containing compounds | |
| DE3016647A1 (de) | Pyrazinobenzodiazepine, ihre herstellung und verwendung | |
| CA1238045A (en) | Imidazo¬1,5-a|pyrimidine derivatives and process for their preparation | |
| CA1156656A (en) | Process for the preparation of pyrimidyl-chinazolines | |
| DE3346575A1 (de) | Neue benzimidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0594883A1 (en) | Imidazo(1,2-c) quinazoline derivatives as antihypertensives and anti dysurics | |
| HU182070B (en) | Process for producing phenyl-piperazine derivatives | |
| US4246260A (en) | Substituted omicron-phenylenediamine derivatives, process for their preparation and their use as medicaments | |
| US6545149B2 (en) | Synthesis and crystallization of piperazine ring-containing compounds | |
| CH664564A5 (de) | Iminothiazolidinderivate. | |
| US5672604A (en) | 1-phenylmethyl benzimidazole piperazine derivative | |
| EP0138034B1 (de) | Substituierte Pyrido(1,2-c)imidazo((1,2-a)benzimidazole, Verfahren zu ihrer Herstellung, ihre Verwendung sowie pharmazeutische Präparate auf Basis dieser Verbindungen | |
| DE2746550A1 (de) | Im benzolring gegebenenfalls substituierte eckige klammer auf (5-phenyl- 2-oxyzolyl)-methylenamino eckige klammer zu -imidazolin-2,4-dione |