PL80283B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80283B1 PL80283B1 PL1969136215A PL13621569A PL80283B1 PL 80283 B1 PL80283 B1 PL 80283B1 PL 1969136215 A PL1969136215 A PL 1969136215A PL 13621569 A PL13621569 A PL 13621569A PL 80283 B1 PL80283 B1 PL 80283B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- parts
- pattern
- compounds
- halogen atom
- Prior art date
Links
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 5
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical class O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000428 dust Substances 0.000 claims description 4
- 244000005700 microbiome Species 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 claims description 3
- 238000009472 formulation Methods 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 229910052736 halogen Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000007921 spray Substances 0.000 claims description 2
- 239000004563 wettable powder Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 48
- 241000196324 Embryophyta Species 0.000 description 17
- -1 alkyl radical Chemical class 0.000 description 10
- 150000003949 imides Chemical class 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 241000233866 Fungi Species 0.000 description 5
- 238000010410 dusting Methods 0.000 description 5
- 230000000855 fungicidal effect Effects 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000013543 active substance Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000004927 clay Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 2
- 241000228245 Aspergillus niger Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241000813090 Rhizoctonia solani Species 0.000 description 2
- 241001617088 Thanatephorus sasakii Species 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 2
- CXNPLSGKWMLZPZ-GIFSMMMISA-N (2r,3r,6s)-3-[[(3s)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2h-pyran-2-carboxylic acid Chemical compound O1[C@@H](C(O)=O)[C@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-GIFSMMMISA-N 0.000 description 1
- OSSFTHGZMNLASE-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)pyrrole-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C=CC2=O)=O)=C1 OSSFTHGZMNLASE-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000266327 Alternaria alternariae Species 0.000 description 1
- 241001530056 Athelia rolfsii Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- IXQIZOSNOSPFLT-UHFFFAOYSA-N CC1=C(C=CC(=C1)SP(=S)(O)O)[N+](=O)[O-] Chemical compound CC1=C(C=CC(=C1)SP(=S)(O)O)[N+](=O)[O-] IXQIZOSNOSPFLT-UHFFFAOYSA-N 0.000 description 1
- 241000252229 Carassius auratus Species 0.000 description 1
- 241000228437 Cochliobolus Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 235000009852 Cucurbita pepo Nutrition 0.000 description 1
- 241000219104 Cucurbitaceae Species 0.000 description 1
- 241000508192 Fusarium oxysporum f. sp. niveum Species 0.000 description 1
- 241001620302 Glomerella <beetle> Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical group O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 229930182764 Polyoxin Natural products 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000589652 Xanthomonas oryzae Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- CXNPLSGKWMLZPZ-UHFFFAOYSA-N blasticidin-S Natural products O1C(C(O)=O)C(NC(=O)CC(N)CCN(C)C(N)=N)C=CC1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-UHFFFAOYSA-N 0.000 description 1
- 239000007767 bonding agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- QYPPRTNMGCREIM-UHFFFAOYSA-M methylarsonate(1-) Chemical compound C[As](O)([O-])=O QYPPRTNMGCREIM-UHFFFAOYSA-M 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- CGPPXVAUDMUIPK-UHFFFAOYSA-N phosphoric acid trihydroxy(sulfanylidene)-lambda5-phosphane Chemical compound OP(O)(O)=O.OP(O)(O)=S CGPPXVAUDMUIPK-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/456—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7380068 | 1968-10-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80283B1 true PL80283B1 (ref) | 1975-08-30 |
Family
ID=13528597
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969138858A PL80867B1 (ref) | 1968-10-09 | 1969-10-08 | |
| PL1969136215A PL80283B1 (ref) | 1968-10-09 | 1969-10-08 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969138858A PL80867B1 (ref) | 1968-10-09 | 1969-10-08 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3743654A (ref) |
| BE (1) | BE739960A (ref) |
| CH (1) | CH514283A (ref) |
| CS (1) | CS181654B2 (ref) |
| DE (1) | DE1949435C3 (ref) |
| DK (1) | DK127478B (ref) |
| ES (1) | ES371932A1 (ref) |
| FR (1) | FR2020206A1 (ref) |
| GB (1) | GB1238123A (ref) |
| IL (1) | IL33040A (ref) |
| NL (1) | NL143919B (ref) |
| PL (2) | PL80867B1 (ref) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179444A (en) * | 1976-02-11 | 1979-12-18 | Ciba-Geigy Corporation | Process for the manufacture of iso-imides or mixtures of iso-imides and imides |
| JPS6017764B2 (ja) * | 1976-07-10 | 1985-05-07 | イハラケミカル工業株式会社 | 水中生物忌避剤 |
| CN111316986B (zh) * | 2019-12-31 | 2021-10-15 | 浙江工业大学 | 顺丁烯二酰亚胺类化合物作为几丁质合成酶抑制剂的应用 |
-
1969
- 1969-09-11 US US00857217A patent/US3743654A/en not_active Expired - Lifetime
- 1969-09-19 DK DK501969AA patent/DK127478B/da unknown
- 1969-09-21 IL IL33040A patent/IL33040A/en unknown
- 1969-09-26 GB GB1238123D patent/GB1238123A/en not_active Expired
- 1969-09-26 ES ES371932A patent/ES371932A1/es not_active Expired
- 1969-09-30 DE DE1949435A patent/DE1949435C3/de not_active Expired
- 1969-10-02 CS CS6900006622A patent/CS181654B2/cs unknown
- 1969-10-06 FR FR6934028A patent/FR2020206A1/fr not_active Withdrawn
- 1969-10-08 PL PL1969138858A patent/PL80867B1/pl unknown
- 1969-10-08 CH CH1512369A patent/CH514283A/fr not_active IP Right Cessation
- 1969-10-08 NL NL696915212A patent/NL143919B/xx not_active IP Right Cessation
- 1969-10-08 PL PL1969136215A patent/PL80283B1/pl unknown
- 1969-10-08 BE BE739960D patent/BE739960A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL33040A (en) | 1973-01-30 |
| GB1238123A (ref) | 1971-07-07 |
| FR2020206A1 (ref) | 1970-07-10 |
| NL143919B (nl) | 1974-11-15 |
| BE739960A (ref) | 1970-03-16 |
| CS181654B2 (en) | 1978-03-31 |
| PL80867B1 (ref) | 1975-08-30 |
| ES371932A1 (es) | 1972-04-01 |
| DE1949435C3 (de) | 1974-01-24 |
| DK127478B (da) | 1973-11-12 |
| CH514283A (fr) | 1971-10-31 |
| IL33040A0 (en) | 1969-11-30 |
| DE1949435B2 (de) | 1973-06-28 |
| DE1949435A1 (de) | 1970-04-23 |
| NL6915212A (ref) | 1970-04-13 |
| US3743654A (en) | 1973-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR0131326B1 (ko) | 치환된 퀴놀린, 이의 제조방법, 이를 포함하는 살진균성 조성물 및 이를 사용하여 진균을 박멸하는 방법 | |
| EP0236272B1 (de) | Fungizide Verwendung eines Cyanopyrrol-Derivates | |
| PL184514B1 (pl) | Komozycja agrochemiczna do ochrony roślin środek agrochemiczny do ochrony roślin sposób traktowania roślin sposób traktowania gleby i zaprawiony produkt do rozmnażania roślin | |
| HUT62756A (en) | Fungicidal and insecticidal composition comprising several active ingredients | |
| PL125938B1 (en) | Fungicide and/or bactericide | |
| PL80290B1 (ref) | ||
| SK464589A3 (en) | Plants protecting agent | |
| US3636214A (en) | Certain substituted 1 3 diketones as soil fungicides | |
| PL80283B1 (ref) | ||
| PL144332B1 (en) | Fungicide | |
| KR950009516B1 (ko) | 종자 소독제 | |
| PL83258B1 (en) | Substituted amino diazinyl compounds and pesticidal compositions thereof[gb1394816a] | |
| JPS58185504A (ja) | 農園芸用殺菌組成物 | |
| US4670429A (en) | Synergistic fungicidal compositions | |
| CA1241274A (en) | Synergistic fungicidal compositions | |
| PL82801B1 (en) | N-(3,5-dihalogenophenyl)-oxazolidine compounds and preparation thereof[us3743651a] | |
| GB2072507A (en) | Herbicidal composition and process | |
| JPH05155718A (ja) | 種子消毒剤 | |
| JPH0256324B2 (ref) | ||
| US3260644A (en) | Polymethyl-1, 4-benzoquinone monoximes as fungicides | |
| US3683081A (en) | Synergistic fungicide composition containing phosphorodithiolate derivatives | |
| DE2260763B2 (de) | Bekämpfung von schädlichen Organismen mit Dihalogenpropansulfonsäureesterderivaten | |
| SU296304A1 (ref) | ||
| JPS6363524B2 (ref) | ||
| US3266983A (en) | 4-halo-1-methoxynaphthalenes as soil fungicides |