PL49372B1 - - Google Patents
Download PDFInfo
- Publication number
- PL49372B1 PL49372B1 PL101878A PL10187863A PL49372B1 PL 49372 B1 PL49372 B1 PL 49372B1 PL 101878 A PL101878 A PL 101878A PL 10187863 A PL10187863 A PL 10187863A PL 49372 B1 PL49372 B1 PL 49372B1
- Authority
- PL
- Poland
- Prior art keywords
- sodium
- acid
- measure according
- instead
- ammonium fluoride
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 15
- 235000008331 Pinus X rigitaeda Nutrition 0.000 claims description 7
- 235000011613 Pinus brutia Nutrition 0.000 claims description 7
- 241000018646 Pinus brutia Species 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 230000000855 fungicidal effect Effects 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- 239000011347 resin Substances 0.000 claims description 4
- 229920005989 resin Polymers 0.000 claims description 4
- 208000034656 Contusions Diseases 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- KSQXVLVXUFHGJQ-UHFFFAOYSA-M Sodium ortho-phenylphenate Chemical compound [Na+].[O-]C1=CC=CC=C1C1=CC=CC=C1 KSQXVLVXUFHGJQ-UHFFFAOYSA-M 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 150000004673 fluoride salts Chemical class 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- HCJLVWUMMKIQIM-UHFFFAOYSA-M sodium;2,3,4,5,6-pentachlorophenolate Chemical compound [Na+].[O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl HCJLVWUMMKIQIM-UHFFFAOYSA-M 0.000 claims description 2
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- KVBCYCWRDBDGBG-UHFFFAOYSA-N azane;dihydrofluoride Chemical compound [NH4+].F.[F-] KVBCYCWRDBDGBG-UHFFFAOYSA-N 0.000 claims 2
- 239000005995 Aluminium silicate Substances 0.000 claims 1
- 235000012211 aluminium silicate Nutrition 0.000 claims 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims 1
- 241000233866 Fungi Species 0.000 description 4
- 239000002023 wood Substances 0.000 description 4
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 230000000622 irritating effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- FLWCIIGMVIPYOY-UHFFFAOYSA-N fluoro(trihydroxy)silane Chemical compound O[Si](O)(O)F FLWCIIGMVIPYOY-UHFFFAOYSA-N 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 239000002973 irritant agent Substances 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- VVOTZBSJOXPCKO-UHFFFAOYSA-M sodium;2,3-dinitrophenolate Chemical compound [Na+].[O-]C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O VVOTZBSJOXPCKO-UHFFFAOYSA-M 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL49372B1 true PL49372B1 (https=) | 1965-02-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO149752B (no) | Apparat for tilveiebringelse av en straale med stor fluks av i det vesentlige bare ultrafiolett lys mot et substrat | |
| CA1300319C (en) | Agent for preserving wood or wood-based materials and method for preparation and use thereof | |
| PL49372B1 (https=) | ||
| JPS57156405A (en) | Fungicide for industrial purpose | |
| EP0278515B1 (de) | Mittel zur Eliminierung von Chloramin | |
| DE1492509C3 (de) | Holzschutzmittel | |
| DE872864C (de) | Holzschutzmittel | |
| DE2132701C3 (de) | Verwendung eines wasserlöslichen Schutzmittelgemisches zur Verhinderung eines Befalls von feuchtem Holz, insbesondere Stamm- und Schnittholz, durch holzverfärbende Pilze | |
| SU954228A1 (ru) | Состав дл пропитки древесины | |
| DE672300C (de) | Verfahren zur Konservierung von Stallduenger und Jauche | |
| JPS56133202A (en) | Minor element mixed agricultural chemical | |
| DE883335C (de) | Holzschutzmittel | |
| US3083138A (en) | Wood impregnating compositions and process | |
| DE436923C (de) | Verfahren zur Bekaempfung schaedlicher Pilze | |
| DE942892C (de) | Holzschutzmittel | |
| DE2852756A1 (de) | Flussmittel fuer die trockenverzinkung | |
| AT121349B (de) | Saatgutbeize. | |
| DE529575C (de) | Spritzmittel zum Bekaempfen tierischer Schaedlinge an Pflanzen | |
| DE369199C (de) | Mittel zur Bekaempfung pflanzlicher und tierischer Schaedlinge | |
| DE545254C (de) | Trockenbeize | |
| DE531509C (de) | Verfahren zum Beizen von Saatgut | |
| AT123417B (de) | Verfahren zum Beizen von Saatgut. | |
| DE553612C (de) | Pflanzenvertilgungsmittel | |
| DE478466C (de) | Verfahren zum Trockenlegen feuchter Mauern | |
| AT119968B (de) | Trockenbeize. |