PL117326B1 - Method of manufacture of halogens by means of electrolysis of water solutions of hydrogen halidesastvorov galogenidov vodoroda - Google Patents
Method of manufacture of halogens by means of electrolysis of water solutions of hydrogen halidesastvorov galogenidov vodoroda Download PDFInfo
- Publication number
- PL117326B1 PL117326B1 PL1978211561A PL21156178A PL117326B1 PL 117326 B1 PL117326 B1 PL 117326B1 PL 1978211561 A PL1978211561 A PL 1978211561A PL 21156178 A PL21156178 A PL 21156178A PL 117326 B1 PL117326 B1 PL 117326B1
- Authority
- PL
- Poland
- Prior art keywords
- oxides
- reduced
- diaphragm
- platinum group
- particles
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 57
- 238000005868 electrolysis reaction Methods 0.000 title claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 title claims description 23
- 239000001257 hydrogen Substances 0.000 title claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 title claims description 21
- 229910052736 halogen Inorganic materials 0.000 title claims description 14
- 150000002367 halogens Chemical class 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 42
- 229910052751 metal Inorganic materials 0.000 claims description 39
- 239000002184 metal Substances 0.000 claims description 39
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 34
- 229910002804 graphite Inorganic materials 0.000 claims description 34
- 239000010439 graphite Substances 0.000 claims description 34
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 32
- 239000000460 chlorine Substances 0.000 claims description 32
- 229910052801 chlorine Inorganic materials 0.000 claims description 32
- 239000002245 particle Substances 0.000 claims description 26
- 229910052741 iridium Inorganic materials 0.000 claims description 22
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 21
- -1 platinum group metal oxide Chemical class 0.000 claims description 21
- 230000008569 process Effects 0.000 claims description 21
- 229910052719 titanium Inorganic materials 0.000 claims description 19
- 239000010936 titanium Substances 0.000 claims description 19
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 18
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 18
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 17
- 150000002739 metals Chemical class 0.000 claims description 15
- 239000003792 electrolyte Substances 0.000 claims description 12
- 229910052715 tantalum Inorganic materials 0.000 claims description 12
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 12
- 150000002500 ions Chemical class 0.000 claims description 11
- 239000000243 solution Substances 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 10
- 229910044991 metal oxide Inorganic materials 0.000 claims description 10
- 239000010955 niobium Substances 0.000 claims description 10
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 10
- ROZSPJBPUVWBHW-UHFFFAOYSA-N [Ru]=O Chemical class [Ru]=O ROZSPJBPUVWBHW-UHFFFAOYSA-N 0.000 claims description 9
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 9
- 239000012433 hydrogen halide Substances 0.000 claims description 9
- 229910052758 niobium Inorganic materials 0.000 claims description 9
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 6
- YJZATOSJMRIRIW-UHFFFAOYSA-N [Ir]=O Chemical class [Ir]=O YJZATOSJMRIRIW-UHFFFAOYSA-N 0.000 claims description 5
- 229910000457 iridium oxide Inorganic materials 0.000 claims description 5
- 150000004706 metal oxides Chemical class 0.000 claims description 5
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 claims description 4
- 229920002313 fluoropolymer Polymers 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 72
- 229910052707 ruthenium Inorganic materials 0.000 description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 14
- 239000001301 oxygen Substances 0.000 description 14
- 229910052760 oxygen Inorganic materials 0.000 description 14
- 239000007789 gas Substances 0.000 description 12
- 239000012528 membrane Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 229910052697 platinum Inorganic materials 0.000 description 11
- 239000004809 Teflon Substances 0.000 description 10
- 229920006362 Teflon® Polymers 0.000 description 10
- 239000000956 alloy Substances 0.000 description 8
- 229910045601 alloy Inorganic materials 0.000 description 8
- 150000001768 cations Chemical class 0.000 description 7
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 238000005342 ion exchange Methods 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 229910000510 noble metal Inorganic materials 0.000 description 4
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 4
- 239000004810 polytetrafluoroethylene Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000557 Nafion® Polymers 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 229940023913 cation exchange resins Drugs 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 229910052735 hafnium Inorganic materials 0.000 description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 2
- VRIVJOXICYMTAG-IYEMJOQQSA-L iron(ii) gluconate Chemical compound [Fe+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O VRIVJOXICYMTAG-IYEMJOQQSA-L 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- HTXDPTMKBJXEOW-UHFFFAOYSA-N dioxoiridium Chemical compound O=[Ir]=O HTXDPTMKBJXEOW-UHFFFAOYSA-N 0.000 description 1
- 239000010411 electrocatalyst Substances 0.000 description 1
- 238000002848 electrochemical method Methods 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 238000007731 hot pressing Methods 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical class [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- DPGAAOUOSQHIJH-UHFFFAOYSA-N ruthenium titanium Chemical compound [Ti].[Ru] DPGAAOUOSQHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910001936 tantalum oxide Inorganic materials 0.000 description 1
- 229910002058 ternary alloy Inorganic materials 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/17—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof
- C25B9/19—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms
- C25B9/23—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms comprising ion-exchange membranes in or on which electrode material is embedded
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
- C25B11/095—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds at least one of the compounds being organic
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US85894277A | 1977-12-09 | 1977-12-09 | |
| US05/922,287 US4210501A (en) | 1977-12-09 | 1978-07-06 | Generation of halogens by electrolysis of hydrogen halides in a cell having catalytic electrodes bonded to a solid polymer electrolyte |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL211561A1 PL211561A1 (env) | 1980-02-25 |
| PL117326B1 true PL117326B1 (en) | 1981-07-31 |
Family
ID=27127488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1978211561A PL117326B1 (en) | 1977-12-09 | 1978-12-08 | Method of manufacture of halogens by means of electrolysis of water solutions of hydrogen halidesastvorov galogenidov vodoroda |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4210501A (env) |
| JP (1) | JPS5495996A (env) |
| CA (1) | CA1125697A (env) |
| DD (1) | DD143932A5 (env) |
| DE (1) | DE2844499C2 (env) |
| ES (2) | ES475786A1 (env) |
| FR (1) | FR2411248A1 (env) |
| GB (1) | GB2009792B (env) |
| IN (1) | IN150899B (env) |
| IT (1) | IT1104585B (env) |
| MX (1) | MX148462A (env) |
| NL (1) | NL7811996A (env) |
| PL (1) | PL117326B1 (env) |
| SE (1) | SE7812641L (env) |
Families Citing this family (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2007260B (en) * | 1977-09-22 | 1982-02-24 | Kanegafuchi Chemical Ind | Method of electrolysis of alkai metal chloride |
| IT1118243B (it) * | 1978-07-27 | 1986-02-24 | Elche Ltd | Cella di elettrolisi monopolare |
| US4323435A (en) * | 1979-02-23 | 1982-04-06 | Ppg Industries, Inc. | Method of operating a solid polymer electrolyte chlor-alkali cell |
| US4356068A (en) * | 1979-02-23 | 1982-10-26 | Ppg Industries, Inc. | Permionic membrane |
| JPS55148777A (en) * | 1979-05-04 | 1980-11-19 | Asahi Glass Co Ltd | Manufacture of caustic alkali |
| JPS55161081A (en) * | 1979-06-01 | 1980-12-15 | Asahi Glass Co Ltd | Electrolytic cell |
| GB2051870B (en) * | 1979-06-07 | 1983-04-20 | Asahi Chemical Ind | Method for electrolysis of aqueous alkali metal chloride solution |
| US4340452A (en) * | 1979-08-03 | 1982-07-20 | Oronzio deNora Elettrochimici S.p.A. | Novel electrolysis cell |
| US4315805A (en) * | 1979-11-08 | 1982-02-16 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process |
| US4342629A (en) * | 1979-11-08 | 1982-08-03 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process |
| US4364815A (en) * | 1979-11-08 | 1982-12-21 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process and electrolytic cell |
| US4364813A (en) * | 1979-12-19 | 1982-12-21 | Ppg Industries, Inc. | Solid polymer electrolyte cell and electrode for same |
| JPS5693883A (en) * | 1979-12-27 | 1981-07-29 | Permelec Electrode Ltd | Electrolytic apparatus using solid polymer electrolyte diaphragm and preparation thereof |
| US4369103A (en) * | 1980-02-11 | 1983-01-18 | Ppg Industries, Inc. | Solid polymer electrolyte cell |
| US4289591A (en) * | 1980-05-02 | 1981-09-15 | General Electric Company | Oxygen evolution with improved Mn stabilized catalyst |
| JPS57500514A (env) * | 1980-05-02 | 1982-03-25 | ||
| DE3036066A1 (de) * | 1980-09-25 | 1982-05-06 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung eines elektroden-membran-verbundsystems |
| DE3040470A1 (de) * | 1980-10-27 | 1982-06-03 | Siemens AG, 1000 Berlin und 8000 München | Verfahren und vorrichtung zur indirekten oxidation von harnstoff |
| US4386987A (en) * | 1981-06-26 | 1983-06-07 | Diamond Shamrock Corporation | Electrolytic cell membrane/SPE formation by solution coating |
| US4421579A (en) * | 1981-06-26 | 1983-12-20 | Diamond Shamrock Corporation | Method of making solid polymer electrolytes and electrode bonded with hydrophyllic fluorocopolymers |
| US4434116A (en) | 1981-06-26 | 1984-02-28 | Diamond Shamrock Corporation | Method for making a porous fluorinated polymer structure |
| US4457815A (en) * | 1981-12-09 | 1984-07-03 | Ppg Industries, Inc. | Electrolytic cell, permionic membrane, and method of electrolysis |
| JPS58176221A (ja) * | 1982-04-09 | 1983-10-15 | Permelec Electrode Ltd | 被覆を有する電解用イオン交換膜の製造方法 |
| JPS6022072B2 (ja) * | 1982-06-30 | 1985-05-30 | ペルメレツク電極株式会社 | 酸性溶液電解用陰極及びその製造方法 |
| US4465533A (en) * | 1983-01-13 | 1984-08-14 | Eltech Systems Limited | Method for making polymer bonded electrodes |
| US4648955A (en) * | 1985-04-19 | 1987-03-10 | Ivac Corporation | Planar multi-junction electrochemical cell |
| US4826554A (en) * | 1985-12-09 | 1989-05-02 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a binder |
| US4654104A (en) * | 1985-12-09 | 1987-03-31 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a fluorocarbon membrane in a thermoplastic state |
| US4824508A (en) * | 1985-12-09 | 1989-04-25 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a liquid or solvent |
| DE3602683A1 (de) * | 1986-01-30 | 1987-08-06 | Bayer Ag | Verfahren zur durchfuehrung der hcl-membranelektrolyse |
| EP0388990A3 (en) | 1986-02-20 | 1993-03-31 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| US5007989A (en) * | 1986-02-20 | 1991-04-16 | Raychem Corporation | Method and articles employing ion exchange material |
| US4888098A (en) * | 1986-02-20 | 1989-12-19 | Raychem Corporation | Method and articles employing ion exchange material |
| US5045163A (en) * | 1986-02-20 | 1991-09-03 | Raychem Corporation | Electrochemical method for measuring chemical species employing ion exchange material |
| US5074988A (en) * | 1986-02-20 | 1991-12-24 | Raychem Corporation | Apparatus for monitoring an electrolyte |
| US5019235A (en) * | 1986-02-20 | 1991-05-28 | Raychem Corporation | Method and articles employing ion exchange material |
| JP2520266B2 (ja) * | 1987-10-02 | 1996-07-31 | 玲子 能登谷 | 酸素電極反応用電極 |
| US5186794A (en) * | 1990-09-26 | 1993-02-16 | Solar Reactor Technologies, Inc. | Alkali metal hydroxide generation system and the method therefor |
| US5314760A (en) * | 1991-01-09 | 1994-05-24 | The Dow Chemical Company | Electrochemical cell electrode |
| US5171644A (en) * | 1991-01-09 | 1992-12-15 | The Dow Chemical Company | Electrochemical cell electrode |
| DE4241150C1 (de) * | 1992-12-07 | 1994-06-01 | Fraunhofer Ges Forschung | Elektrodenmembran-Verbund, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| US6042702A (en) * | 1993-11-22 | 2000-03-28 | E.I. Du Pont De Nemours And Company | Electrochemical cell having a current distributor comprising a conductive polymer composite material |
| US5824199A (en) * | 1993-11-22 | 1998-10-20 | E. I. Du Pont De Nemours And Company | Electrochemical cell having an inflatable member |
| US6180163B1 (en) | 1993-11-22 | 2001-01-30 | E. I. Du Pont De Nemours And Company | Method of making a membrane-electrode assembly |
| USRE37433E1 (en) | 1993-11-22 | 2001-11-06 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a membrane-electrode assembly or gas diffusion electrodes |
| US5863395A (en) * | 1993-11-22 | 1999-01-26 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a self-regulating gas diffusion layer |
| US5961795A (en) * | 1993-11-22 | 1999-10-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a resilient flow field |
| US5868912A (en) * | 1993-11-22 | 1999-02-09 | E. I. Du Pont De Nemours And Company | Electrochemical cell having an oxide growth resistant current distributor |
| US5798036A (en) * | 1993-11-22 | 1998-08-25 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogens gas using a membrane-electrode assembly or gas diffusion electrodes |
| US5411641A (en) * | 1993-11-22 | 1995-05-02 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane |
| US5855748A (en) * | 1993-11-22 | 1999-01-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a mass flow field made of glassy carbon |
| US5976346A (en) * | 1993-11-22 | 1999-11-02 | E. I. Du Pont De Nemours And Company | Membrane hydration in electrochemical conversion of anhydrous hydrogen halide to halogen gas |
| US5855759A (en) * | 1993-11-22 | 1999-01-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell and process for splitting a sulfate solution and producing a hyroxide solution sulfuric acid and a halogen gas |
| US5523177A (en) * | 1994-10-12 | 1996-06-04 | Giner, Inc. | Membrane-electrode assembly for a direct methanol fuel cell |
| DE19624024A1 (de) * | 1996-06-17 | 1997-12-18 | Verein Fuer Kernverfahrenstech | Verfahren zur Herstellung von Halogenen, Oxoverbindungen der Halogene sowie zur Herstellung von Peroxyverbindungen durch Elektrolyse |
| RU2138580C1 (ru) * | 1998-02-16 | 1999-09-27 | Орловский государственный технический университет | Способ получения солевого расплава, содержащего низшие галогениды металлов |
| EP1112229A4 (en) | 1998-05-29 | 2004-06-16 | Proton Energy Systems | LIQUID CONTROL SYSTEM FOR VAN WATER ELECTROLYSIS |
| US6010317A (en) * | 1998-09-01 | 2000-01-04 | Baxter International Inc. | Electrochemical cell module having an inner and an outer shell with a nested arrangement |
| US6368472B1 (en) | 1998-11-04 | 2002-04-09 | Mcguire Byron Duvon | Electrolytic chemical generator |
| JP2003515237A (ja) * | 1999-11-18 | 2003-04-22 | プロトン エネルギー システムズ,インク. | 高差圧電気化学電池 |
| US20050250003A1 (en) * | 2002-08-09 | 2005-11-10 | Proton Energy Systems, Inc. | Electrochemical cell support structure |
| DE10152275A1 (de) * | 2001-10-23 | 2003-04-30 | Bayer Ag | Verfahren zur Elektrolyse von wässrigen Lösungen aus Chlorwasserstoff |
| US7513980B2 (en) * | 2004-11-25 | 2009-04-07 | Honda Motor Co., Ltd. | Electrolytic cell for electrolyzed water generator |
| JP4249693B2 (ja) * | 2004-11-25 | 2009-04-02 | 本田技研工業株式会社 | 電解水生成装置の電解槽 |
| GB2449655A (en) * | 2007-05-30 | 2008-12-03 | Jlj Engineering Sercices Ltd | An electrochemical reactor for aqueous solutions with high electrical resistance |
| DE102007044171A1 (de) * | 2007-09-15 | 2009-03-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von Graphitelektroden für elektrolytische Prozesse |
| DE102009035546A1 (de) * | 2009-07-31 | 2011-02-03 | Bayer Materialscience Ag | Elektrode und Elektrodenbeschichtung |
| US20110198232A1 (en) * | 2010-02-15 | 2011-08-18 | Hamilton Sundstrand Corporation | High-differential-pressure water electrolysis cell and method of operation |
| DE102013009230A1 (de) | 2013-05-31 | 2014-12-04 | Otto-von-Guericke-Universität | Verfahren und Membranreaktor zur Herstellung von Chlor aus Chlorwasserstoffgas |
| GB201322494D0 (en) * | 2013-12-19 | 2014-02-05 | Johnson Matthey Fuel Cells Ltd | Catalyst layer |
| US9909223B1 (en) | 2014-08-04 | 2018-03-06 | Byron Duvon McGuire | Expanded metal with unified margins and applications thereof |
| EP3402752B1 (en) * | 2016-01-15 | 2020-12-02 | Axine Water Technologies Inc. | Electrochemical cell for wastewater treatment with increased removal rates of pollutants |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA604415A (en) * | 1957-04-09 | 1960-08-30 | B. Beer Henri | Anode having a core of a base metal provided with a coating of a precious metal or another resistant material |
| NL278149A (env) * | 1961-05-08 | 1900-01-01 | ||
| DE1546717C3 (de) * | 1964-05-14 | 1974-06-27 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Elektrochemische Zelle |
| US3291708A (en) * | 1964-12-31 | 1966-12-13 | Ionics | Electrolytic process for producing a halogen from its respective acid and the apparatus therefor |
| US3532556A (en) * | 1966-09-01 | 1970-10-06 | Matthey Bishop Inc | Process for forming platinum coated electrode |
| GB1163479A (en) * | 1967-03-17 | 1969-09-04 | Engelhard Min & Chem | Fuel Electrodes |
| DE1667225A1 (de) * | 1967-09-27 | 1971-08-12 | Pfrengle Otto Dr Ing | Vorrichtung zum Aufspruehen von Fluessigkeiten auf Pulverstoffe |
| US3528858A (en) * | 1968-12-04 | 1970-09-15 | Gen Electric | Sulfonated aryl-substituted polyphenylene ether ion exchange membranes |
| BE788557A (fr) * | 1971-09-09 | 1973-03-08 | Ppg Industries Inc | Diaphragmes pour cellules electrolytiques |
| US3992271A (en) * | 1973-02-21 | 1976-11-16 | General Electric Company | Method for gas generation |
| US3857737A (en) * | 1973-09-18 | 1974-12-31 | United Aircraft Corp | Sequential catalyzation of fuel cell supported platinum catalyst |
| US4100050A (en) * | 1973-11-29 | 1978-07-11 | Hooker Chemicals & Plastics Corp. | Coating metal anodes to decrease consumption rates |
| US4017663A (en) * | 1974-02-15 | 1977-04-12 | United Technologies Corporation | Electrodes for electrochemical cells |
| JPS526374A (en) * | 1975-07-07 | 1977-01-18 | Tokuyama Soda Co Ltd | Anode structure for electrolysis |
| US4039409A (en) * | 1975-12-04 | 1977-08-02 | General Electric Company | Method for gas generation utilizing platinum metal electrocatalyst containing 5 to 60% ruthenium |
| US4057479A (en) * | 1976-02-26 | 1977-11-08 | Billings Energy Research Corporation | Solid polymer electrolyte cell construction |
| US4043933A (en) * | 1976-06-15 | 1977-08-23 | United Technologies Corporation | Method of fabricating a fuel cell electrode |
| DE2802257C2 (de) * | 1977-01-21 | 1986-01-02 | Studiecentrum voor Kernenergie, S.C.K., Brüssel/Bruxelles | Membran für eine elektrochemische Zelle und ihre Verwendung in einer Elektrolysevorrichtung |
-
1978
- 1978-07-06 US US05/922,287 patent/US4210501A/en not_active Expired - Lifetime
- 1978-10-12 DE DE2844499A patent/DE2844499C2/de not_active Expired
- 1978-10-27 GB GB7842326A patent/GB2009792B/en not_active Expired
- 1978-10-31 CA CA315,521A patent/CA1125697A/en not_active Expired
- 1978-11-06 IN IN1200/CAL/78A patent/IN150899B/en unknown
- 1978-12-01 IT IT30453/78A patent/IT1104585B/it active
- 1978-12-04 DD DD78209499A patent/DD143932A5/de unknown
- 1978-12-06 ES ES475786A patent/ES475786A1/es not_active Expired
- 1978-12-08 NL NL7811996A patent/NL7811996A/xx not_active Application Discontinuation
- 1978-12-08 FR FR7834643A patent/FR2411248A1/fr active Granted
- 1978-12-08 JP JP15117478A patent/JPS5495996A/ja active Granted
- 1978-12-08 SE SE7812641A patent/SE7812641L/xx unknown
- 1978-12-08 PL PL1978211561A patent/PL117326B1/pl unknown
- 1978-12-08 MX MX175932A patent/MX148462A/es unknown
-
1979
- 1979-06-04 ES ES481257A patent/ES481257A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2844499A1 (de) | 1979-06-13 |
| IN150899B (env) | 1983-01-08 |
| DE2844499C2 (de) | 1984-01-05 |
| IT1104585B (it) | 1985-10-21 |
| NL7811996A (nl) | 1979-06-12 |
| JPS5495996A (en) | 1979-07-28 |
| SE7812641L (sv) | 1979-06-10 |
| GB2009792B (en) | 1982-08-04 |
| PL211561A1 (env) | 1980-02-25 |
| JPS6127472B2 (env) | 1986-06-25 |
| US4210501A (en) | 1980-07-01 |
| CA1125697A (en) | 1982-06-15 |
| FR2411248B1 (env) | 1983-01-28 |
| ES475786A1 (es) | 1980-01-16 |
| ES481257A1 (es) | 1980-02-16 |
| IT7830453A0 (it) | 1978-12-01 |
| MX148462A (es) | 1983-04-25 |
| DD143932A5 (de) | 1980-09-17 |
| GB2009792A (en) | 1979-06-20 |
| FR2411248A1 (fr) | 1979-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL117326B1 (en) | Method of manufacture of halogens by means of electrolysis of water solutions of hydrogen halidesastvorov galogenidov vodoroda | |
| US4333805A (en) | Halogen evolution with improved anode catalyst | |
| US4224121A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US4197178A (en) | Bipolar separator for electrochemical cells and method of preparation thereof | |
| JP4209777B2 (ja) | ガス拡散電極を備えた電解セル | |
| US4311569A (en) | Device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| US4528083A (en) | Device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| US4289591A (en) | Oxygen evolution with improved Mn stabilized catalyst | |
| US4457824A (en) | Method and device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| JP2000104189A (ja) | 過酸化水素の製造方法及び製造用電解槽 | |
| EP0255099B1 (en) | Cathode bonded to ion exchange membrane for use in electrolyzers for electrochemical processes and relevant method for conducting electrolysis | |
| SE453518B (sv) | Elektrokatalytiskt partikelformigt material, elektrod innehallande sadant material och anvendningen av elektroden vid elektrolys | |
| CA2868281A1 (en) | Electrolysis cell with multiple membranes for cucl/hcl electrolysis in hydrogen production | |
| US4956061A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US4772364A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| O’Brien et al. | History of the chlor-alkali industry | |
| US20190226098A1 (en) | Methods And Systems For Production Of Chlorine And Caustic Using Oxygen Depolarized Cathode | |
| JPS6053115B2 (ja) | 電解槽 | |
| US4360416A (en) | Anode catalysts for electrolysis of brine | |
| EP0039608B1 (en) | Halogen evolution with improved anode catalyst | |
| US4488947A (en) | Process of operation of catholyteless membrane electrolytic cell | |
| SU1584752A3 (ru) | Способ получени хлора и гидроокиси натри | |
| HU180463B (hu) | Eljárás halogének és alkálifém-hidroxidok előállítására alkálifém-halogenidek elektrolízise útján | |
| US4569735A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| HU180464B (hu) | Eljárás halogén folyamatos előállítására halogénhidrogén elektrolízise útján |