NZ536182A - Bicyclic 6-alkylidene-penems as beta-lactamase inhibitors - Google Patents
Bicyclic 6-alkylidene-penems as beta-lactamase inhibitorsInfo
- Publication number
- NZ536182A NZ536182A NZ536182A NZ53618203A NZ536182A NZ 536182 A NZ536182 A NZ 536182A NZ 536182 A NZ536182 A NZ 536182A NZ 53618203 A NZ53618203 A NZ 53618203A NZ 536182 A NZ536182 A NZ 536182A
- Authority
- NZ
- New Zealand
- Prior art keywords
- optionally substituted
- thia
- oxo
- ene
- carboxylic acid
- Prior art date
Links
- 125000002619 bicyclic group Chemical group 0.000 title claims abstract description 17
- 239000003781 beta lactamase inhibitor Substances 0.000 title abstract 2
- 229940126813 beta-lactamase inhibitor Drugs 0.000 title abstract 2
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 6
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract 2
- 239000000203 mixture Substances 0.000 claims description 231
- 150000001875 compounds Chemical class 0.000 claims description 162
- 238000005160 1H NMR spectroscopy Methods 0.000 claims description 124
- 229910052799 carbon Inorganic materials 0.000 claims description 107
- 229910052717 sulfur Inorganic materials 0.000 claims description 106
- 239000002253 acid Substances 0.000 claims description 100
- 159000000000 sodium salts Chemical class 0.000 claims description 90
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 89
- -1 {[(4-nitrobenzyl)oxy]carbonyl}-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-6-yl Chemical group 0.000 claims description 86
- 229910052760 oxygen Inorganic materials 0.000 claims description 81
- 238000002360 preparation method Methods 0.000 claims description 75
- 229910052757 nitrogen Inorganic materials 0.000 claims description 51
- 125000001072 heteroaryl group Chemical group 0.000 claims description 40
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 38
- 125000003118 aryl group Chemical group 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 25
- 150000002148 esters Chemical class 0.000 claims description 20
- 125000005842 heteroatom Chemical group 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 19
- 230000003115 biocidal effect Effects 0.000 claims description 16
- 125000004122 cyclic group Chemical group 0.000 claims description 15
- 239000003782 beta lactam antibiotic agent Substances 0.000 claims description 14
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 13
- 150000001721 carbon Chemical group 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000003107 substituted aryl group Chemical group 0.000 claims description 12
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 11
- 125000000304 alkynyl group Chemical group 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 229960002292 piperacillin Drugs 0.000 claims description 9
- WCMIIGXFCMNQDS-IDYPWDAWSA-M piperacillin sodium Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N2[C@@H](C([O-])=O)C(C)(C)S[C@@H]21 WCMIIGXFCMNQDS-IDYPWDAWSA-M 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 9
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 8
- 125000005326 heteroaryloxy alkyl group Chemical group 0.000 claims description 8
- 125000003003 spiro group Chemical group 0.000 claims description 8
- 229960003022 amoxicillin Drugs 0.000 claims description 7
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 5
- 229930186147 Cephalosporin Natural products 0.000 claims description 5
- 229930182555 Penicillin Natural products 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 5
- 125000005325 aryloxy aryl group Chemical group 0.000 claims description 5
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- 229940124587 cephalosporin Drugs 0.000 claims description 5
- 150000001780 cephalosporins Chemical class 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 238000001990 intravenous administration Methods 0.000 claims description 5
- 125000002950 monocyclic group Chemical group 0.000 claims description 5
- 238000006894 reductive elimination reaction Methods 0.000 claims description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 4
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 4
- 238000006664 bond formation reaction Methods 0.000 claims description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 4
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 4
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 3
- JWCSIUVGFCSJCK-CAVRMKNVSA-N Disodium Moxalactam Chemical compound N([C@]1(OC)C(N2C(=C(CSC=3N(N=NN=3)C)CO[C@@H]21)C(O)=O)=O)C(=O)C(C(O)=O)C1=CC=C(O)C=C1 JWCSIUVGFCSJCK-CAVRMKNVSA-N 0.000 claims description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 229960000723 ampicillin Drugs 0.000 claims description 3
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 claims description 3
- 125000005226 heteroaryloxycarbonyl group Chemical group 0.000 claims description 3
- 229960000433 latamoxef Drugs 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 3
- OHKOGUYZJXTSFX-KZFFXBSXSA-N ticarcillin Chemical compound C=1([C@@H](C(O)=O)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)C=CSC=1 OHKOGUYZJXTSFX-KZFFXBSXSA-N 0.000 claims description 3
- 229960004659 ticarcillin Drugs 0.000 claims description 3
- QQDDJIUJAPMCCX-SIBGDRKGSA-N (5r,6z)-6-[(5-benzyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound N1([C@@H]2SC=C1C(=O)O)C(=O)\C2=C\C(SC=1CC2)=CC=1CN2CC1=CC=CC=C1 QQDDJIUJAPMCCX-SIBGDRKGSA-N 0.000 claims description 2
- DMEYZPJEFHGESJ-BAQGIRSFSA-N (6z)-6-(6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1COCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 DMEYZPJEFHGESJ-BAQGIRSFSA-N 0.000 claims description 2
- UAILHDKDBBFHDN-BAQGIRSFSA-N (6z)-6-(6,8-dihydro-5h-imidazo[2,1-c][1,4]thiazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CSCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 UAILHDKDBBFHDN-BAQGIRSFSA-N 0.000 claims description 2
- SZEAVITUDYBJGA-BAQGIRSFSA-N (6z)-7-oxo-6-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CNCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 SZEAVITUDYBJGA-BAQGIRSFSA-N 0.000 claims description 2
- FYZUENZXIZCLAZ-UHFFFAOYSA-N 2-methylhept-2-enoic acid Chemical compound CCCCC=C(C)C(O)=O FYZUENZXIZCLAZ-UHFFFAOYSA-N 0.000 claims description 2
- GEBFRXZPTJKYPE-UHFFFAOYSA-N 6-[(5-ethoxycarbonyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1N(C(=O)OCC)CCC2=C1C=C(C=C1C(N3C(=CSC31)C(O)=O)=O)S2 GEBFRXZPTJKYPE-UHFFFAOYSA-N 0.000 claims description 2
- WZPBZJONDBGPKJ-UHFFFAOYSA-N Antibiotic SQ 26917 Natural products O=C1N(S(O)(=O)=O)C(C)C1NC(=O)C(=NOC(C)(C)C(O)=O)C1=CSC(N)=N1 WZPBZJONDBGPKJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 2
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 2
- WZPBZJONDBGPKJ-VEHQQRBSSA-N aztreonam Chemical compound O=C1N(S([O-])(=O)=O)[C@@H](C)[C@@H]1NC(=O)C(=N/OC(C)(C)C(O)=O)\C1=CSC([NH3+])=N1 WZPBZJONDBGPKJ-VEHQQRBSSA-N 0.000 claims description 2
- 229960003644 aztreonam Drugs 0.000 claims description 2
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 claims description 2
- 229960003866 cefaloridine Drugs 0.000 claims description 2
- 229960000603 cefalotin Drugs 0.000 claims description 2
- 229960002420 cefatrizine Drugs 0.000 claims description 2
- 229960001139 cefazolin Drugs 0.000 claims description 2
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 claims description 2
- 229960002588 cefradine Drugs 0.000 claims description 2
- 229940106164 cephalexin Drugs 0.000 claims description 2
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 claims description 2
- RDLPVSKMFDYCOR-UEKVPHQBSA-N cephradine Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CCC=CC1 RDLPVSKMFDYCOR-UEKVPHQBSA-N 0.000 claims description 2
- 238000011260 co-administration Methods 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 2
- 229940049954 penicillin Drugs 0.000 claims description 2
- 235000019371 penicillin G benzathine Nutrition 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000002132 β-lactam antibiotic Substances 0.000 claims 7
- 229940124586 β-lactam antibiotics Drugs 0.000 claims 7
- HUGCXBGSKYVVDN-JTMRULEUSA-N (5R,6Z)-6-[(5,5-dimethyl-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S([C@@H]1\2)C=C(C(O)=O)N1C(=O)C/2=C/C1=NN(CC(C)(C)C2)C2=C1 HUGCXBGSKYVVDN-JTMRULEUSA-N 0.000 claims 1
- WCZPETISIDPRLB-KGHNQEBZSA-N (5r,6z)-6-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-6-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2OCCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O WCZPETISIDPRLB-KGHNQEBZSA-N 0.000 claims 1
- BHGUWNPCJQAETH-KGHNQEBZSA-N (5r,6z)-6-(2,3-dihydropyrazolo[5,1-b][1,3]thiazol-6-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2SCCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O BHGUWNPCJQAETH-KGHNQEBZSA-N 0.000 claims 1
- PIQJFYXOGLAPEL-GPWUBDCCSA-N (5r,6z)-6-(4,6-dihydropyrazolo[1,5-c][1,3]thiazol-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2CSCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O PIQJFYXOGLAPEL-GPWUBDCCSA-N 0.000 claims 1
- IKNPDLCLBOGEQM-TWLAMCEISA-N (5r,6z)-6-(5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2CCSCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O IKNPDLCLBOGEQM-TWLAMCEISA-N 0.000 claims 1
- XTADYNGCKRLHLU-AGEOTTOMSA-N (5r,6z)-7-oxo-6-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2CCCCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O XTADYNGCKRLHLU-AGEOTTOMSA-N 0.000 claims 1
- TZHYRIOYHMAWIJ-KGHNQEBZSA-N (5r,6z)-7-oxo-6-[(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methylidene]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2C(=O)OCCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O TZHYRIOYHMAWIJ-KGHNQEBZSA-N 0.000 claims 1
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 claims 1
- VAEBCNPDQMGFNE-UHFFFAOYSA-N 6-(6,7-dihydro-4h-thieno[3,2-c]pyran-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1OCCC(S2)=C1C=C2C=C1C(=O)N2C1SC=C2C(=O)O VAEBCNPDQMGFNE-UHFFFAOYSA-N 0.000 claims 1
- YKGCKZGARDHVBE-UHFFFAOYSA-N 6-(6,7-dihydro-4h-thieno[3,2-c]thiopyran-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1SCCC(S2)=C1C=C2C=C1C(=O)N2C1SC=C2C(=O)O YKGCKZGARDHVBE-UHFFFAOYSA-N 0.000 claims 1
- KIRMAXVJPRFBQQ-UHFFFAOYSA-N 6-[(5-methyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1N(C)CCC2=C1C=C(C=C1C(N3C(=CSC31)C(O)=O)=O)S2 KIRMAXVJPRFBQQ-UHFFFAOYSA-N 0.000 claims 1
- VLVRGEYTLMKACY-UHFFFAOYSA-N 7-oxo-6-(6,7,8,9-tetrahydro-5h-imidazo[1,2-a]azepin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CCCCC2=NC(C=C3C(=O)N4C3SC=C4C(=O)O)=CN21 VLVRGEYTLMKACY-UHFFFAOYSA-N 0.000 claims 1
- SNAJDOSOLZFUIK-UHFFFAOYSA-N CC1(CCC(NC1)=O)C.[Na] Chemical compound CC1(CCC(NC1)=O)C.[Na] SNAJDOSOLZFUIK-UHFFFAOYSA-N 0.000 claims 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 claims 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 367
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 279
- 239000000243 solution Substances 0.000 description 276
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 258
- 239000011541 reaction mixture Substances 0.000 description 203
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 176
- 229910001868 water Inorganic materials 0.000 description 141
- 230000002829 reductive effect Effects 0.000 description 135
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 127
- 239000007787 solid Substances 0.000 description 127
- 229940093499 ethyl acetate Drugs 0.000 description 118
- 235000019439 ethyl acetate Nutrition 0.000 description 118
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 117
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 117
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 111
- 239000000706 filtrate Substances 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 105
- 239000012044 organic layer Substances 0.000 description 102
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 99
- 238000006243 chemical reaction Methods 0.000 description 88
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 87
- 239000010410 layer Substances 0.000 description 86
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 85
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 74
- 239000012299 nitrogen atmosphere Substances 0.000 description 70
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 60
- 239000007864 aqueous solution Substances 0.000 description 60
- 238000010898 silica gel chromatography Methods 0.000 description 57
- 239000011888 foil Substances 0.000 description 56
- 239000000047 product Substances 0.000 description 56
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 51
- 239000012267 brine Substances 0.000 description 50
- 239000008363 phosphate buffer Substances 0.000 description 46
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 42
- 238000004440 column chromatography Methods 0.000 description 42
- 239000013078 crystal Substances 0.000 description 41
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 37
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 35
- 229910001623 magnesium bromide Inorganic materials 0.000 description 35
- 229910000027 potassium carbonate Inorganic materials 0.000 description 34
- 238000010992 reflux Methods 0.000 description 33
- 229920005989 resin Polymers 0.000 description 32
- 239000011347 resin Substances 0.000 description 32
- 125000001424 substituent group Chemical group 0.000 description 32
- 229940086542 triethylamine Drugs 0.000 description 31
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- 239000012141 concentrate Substances 0.000 description 29
- 235000008504 concentrate Nutrition 0.000 description 29
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 28
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 28
- 239000011701 zinc Substances 0.000 description 28
- 239000003921 oil Substances 0.000 description 27
- 235000019198 oils Nutrition 0.000 description 27
- 239000000428 dust Substances 0.000 description 26
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 21
- BCQLGSCBQKKBIM-CMPLNLGQSA-N (4-nitrophenyl)methyl (5r,6s)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CS[C@H]2N1C(=O)[C@@H]2Br BCQLGSCBQKKBIM-CMPLNLGQSA-N 0.000 description 20
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 19
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 239000000725 suspension Substances 0.000 description 15
- 241000699670 Mus sp. Species 0.000 description 14
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 14
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 14
- 125000000623 heterocyclic group Chemical group 0.000 description 14
- 208000015181 infectious disease Diseases 0.000 description 14
- 229940078552 o-xylene Drugs 0.000 description 14
- 239000000741 silica gel Substances 0.000 description 14
- 229910002027 silica gel Inorganic materials 0.000 description 14
- 229960001866 silicon dioxide Drugs 0.000 description 14
- 239000003112 inhibitor Substances 0.000 description 13
- 125000002217 penem group Chemical group 0.000 description 13
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 239000003242 anti bacterial agent Substances 0.000 description 12
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 11
- 235000011181 potassium carbonates Nutrition 0.000 description 11
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- 229940088710 antibiotic agent Drugs 0.000 description 10
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 description 10
- 239000012448 Lithium borohydride Substances 0.000 description 9
- 239000012300 argon atmosphere Substances 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 8
- 108090000790 Enzymes Proteins 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 239000012429 reaction media Substances 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- YFUNNTKEYQOTKY-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-(hydroxymethyl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazine-5-carboxylate Chemical compound C1CN2N=C(CO)C=C2CN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 YFUNNTKEYQOTKY-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- 230000000844 anti-bacterial effect Effects 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 6
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 6
- 230000002441 reversible effect Effects 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- GRSYTAZHKXFUII-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-formyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-7-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC2=NC(C=O)=CN2CC1 GRSYTAZHKXFUII-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 101000740462 Escherichia coli Beta-lactamase TEM Proteins 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000004007 reversed phase HPLC Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- BCQLGSCBQKKBIM-UHFFFAOYSA-N (4-nitrophenyl)methyl 6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CSC2N1C(=O)C2Br BCQLGSCBQKKBIM-UHFFFAOYSA-N 0.000 description 4
- LBJIORYARIDXKA-IWQZZHSRSA-N (z)-2-bromo-3-hydroxyprop-2-enal Chemical compound O\C=C(/Br)C=O LBJIORYARIDXKA-IWQZZHSRSA-N 0.000 description 4
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229940123930 Lactamase inhibitor Drugs 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 239000002054 inoculum Substances 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- JGZKUKYUQJUUNE-UHFFFAOYSA-L magnesium;ethoxyethane;dibromide Chemical compound [Mg+2].[Br-].[Br-].CCOCC JGZKUKYUQJUUNE-UHFFFAOYSA-L 0.000 description 4
- 150000003385 sodium Chemical class 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- HNRFPWBGIROIJB-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=C(Br)SC2N1C(=O)C2 HNRFPWBGIROIJB-UHFFFAOYSA-N 0.000 description 3
- UCDIXJKWUCLMJK-XQRVVYSFSA-N (z)-2-bromo-3-propan-2-yloxyprop-2-enal Chemical compound CC(C)O\C=C(/Br)C=O UCDIXJKWUCLMJK-XQRVVYSFSA-N 0.000 description 3
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 3
- KMZYCZWDCPQIAR-UHFFFAOYSA-N 2,5-dihydro-1,3-thiazol-4-amine Chemical compound N=C1CSCN1 KMZYCZWDCPQIAR-UHFFFAOYSA-N 0.000 description 3
- AFYFINMBQAGTFW-UHFFFAOYSA-N 7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1C(=O)N(C)CC2=NC(C=O)=CN21 AFYFINMBQAGTFW-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 206010034133 Pathogen resistance Diseases 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 239000004599 antimicrobial Substances 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- YTYJZXFCWYHVPG-UHFFFAOYSA-N ethyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1CNCC2=NC(C(=O)OCC)=CN21 YTYJZXFCWYHVPG-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical compound S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000008055 phosphate buffer solution Substances 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 238000002953 preparative HPLC Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- ZDBZERHPDYWTBK-UHFFFAOYSA-N tert-butyl 2-(hydroxymethyl)-6,7-dihydro-4h-thieno[3,2-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2=C1C=C(CO)S2 ZDBZERHPDYWTBK-UHFFFAOYSA-N 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- OVRJVKCZJCNSOW-UHFFFAOYSA-N thian-4-one Chemical class O=C1CCSCC1 OVRJVKCZJCNSOW-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- ZWSZQIGAYDIYDM-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-oxopiperazine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC(=O)NCC1 ZWSZQIGAYDIYDM-UHFFFAOYSA-N 0.000 description 2
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 2
- LGLMHMRNPVACGS-VKHMYHEASA-N (4r)-3-nitroso-1,3-thiazolidine-4-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCN1N=O LGLMHMRNPVACGS-VKHMYHEASA-N 0.000 description 2
- LHNIIDJCEODSHA-OQRUQETBSA-N (6r,7r)-3-[(e)-2-(2,4-dinitrophenyl)ethenyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)\C=C\C=1C(=CC(=CC=1)[N+]([O-])=O)[N+]([O-])=O)C(=O)CC1=CC=CS1 LHNIIDJCEODSHA-OQRUQETBSA-N 0.000 description 2
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 2
- ZGTFNNUASMWGTM-UHFFFAOYSA-N 1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC=CS1 ZGTFNNUASMWGTM-UHFFFAOYSA-N 0.000 description 2
- NOLHRFLIXVQPSZ-UHFFFAOYSA-N 1,3-thiazolidin-4-one Chemical compound O=C1CSCN1 NOLHRFLIXVQPSZ-UHFFFAOYSA-N 0.000 description 2
- QFPFAMXSPHDRJE-UHFFFAOYSA-N 1,3-thiazolidine-4-thione Chemical compound S=C1CSCN1 QFPFAMXSPHDRJE-UHFFFAOYSA-N 0.000 description 2
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 2
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 2
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 2
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 2
- STHMLYNOSSMXOM-UHFFFAOYSA-N 3,6-dihydro-2h-1,4-thiazin-5-amine;hydrochloride Chemical compound Cl.N=C1CSCCN1 STHMLYNOSSMXOM-UHFFFAOYSA-N 0.000 description 2
- JGRLFNQZUOIYAX-UHFFFAOYSA-N 3-chloro-5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CNC(=O)C(Cl)C1 JGRLFNQZUOIYAX-UHFFFAOYSA-N 0.000 description 2
- HSJKGGMUJITCBW-UHFFFAOYSA-N 3-hydroxybutanal Chemical compound CC(O)CC=O HSJKGGMUJITCBW-UHFFFAOYSA-N 0.000 description 2
- JXDVFMZFOWYFPQ-UHFFFAOYSA-N 3-nitroso-1,3-thiazinane-4-carboxylic acid Chemical compound OC(=O)C1CCSCN1N=O JXDVFMZFOWYFPQ-UHFFFAOYSA-N 0.000 description 2
- VFCRDXGXUQGTHT-UHFFFAOYSA-N 3-nitroso-1,3-thiazolidine-2-carboxylic acid Chemical compound OC(=O)C1SCCN1N=O VFCRDXGXUQGTHT-UHFFFAOYSA-N 0.000 description 2
- BDNWSJQJILLEBS-UHFFFAOYSA-N 4,4-dimethylpyrrolidine-2-carboxylic acid Chemical compound CC1(C)CNC(C(O)=O)C1 BDNWSJQJILLEBS-UHFFFAOYSA-N 0.000 description 2
- OOGKXAWZILGOBA-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine Chemical compound C1NCCN2N=CC=C21 OOGKXAWZILGOBA-UHFFFAOYSA-N 0.000 description 2
- CTPCVHKGQTXRLH-UHFFFAOYSA-N 4,6-dihydropyrazolo[1,5-c][1,3]thiazole Chemical compound N1=CC=C2CSCN21 CTPCVHKGQTXRLH-UHFFFAOYSA-N 0.000 description 2
- GKZAWEWCKOOIQV-UHFFFAOYSA-N 4-[(4-nitrophenyl)methoxycarbonyl]-1-nitrosopiperazine-2-carboxylic acid Chemical compound C1CN(N=O)C(C(=O)O)CN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 GKZAWEWCKOOIQV-UHFFFAOYSA-N 0.000 description 2
- NFSOPDQHRACHRD-UHFFFAOYSA-N 4-methylsulfanyl-2,5-dihydro-1,3-thiazole Chemical compound CSC1=NCSC1 NFSOPDQHRACHRD-UHFFFAOYSA-N 0.000 description 2
- QJNLUNBGDFUULX-UHFFFAOYSA-N 4-n,4-n'-dimethyl-3h-pyridine-4,4-diamine Chemical compound CNC1(NC)CC=NC=C1 QJNLUNBGDFUULX-UHFFFAOYSA-N 0.000 description 2
- LRGULUNPYYHYMY-UHFFFAOYSA-N 4-nitrosomorpholin-4-ium-3-carboxylate Chemical compound OC(=O)C1COCCN1N=O LRGULUNPYYHYMY-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- LZDUSDGRALPEID-UHFFFAOYSA-N 5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CCC(=O)NC1 LZDUSDGRALPEID-UHFFFAOYSA-N 0.000 description 2
- SEOMGBFEZSRSQR-UHFFFAOYSA-N 6,6-dimethyl-7,8-dihydro-5h-imidazo[1,2-a]pyridine-2-carbaldehyde Chemical compound C1C(C)(C)CCC2=NC(C=O)=CN21 SEOMGBFEZSRSQR-UHFFFAOYSA-N 0.000 description 2
- IFOAVNDPIZTQMU-UHFFFAOYSA-N 6,7-dihydro-5h-pyrrolo[1,2-a]imidazole-2-carbaldehyde Chemical compound C1CCC2=NC(C=O)=CN21 IFOAVNDPIZTQMU-UHFFFAOYSA-N 0.000 description 2
- JVGNWLWFTHSDOM-UHFFFAOYSA-N 6-amino-4-methyl-2,5-dihydropyrazin-3-one;hydrochloride Chemical compound Cl.CN1CC(N)=NCC1=O JVGNWLWFTHSDOM-UHFFFAOYSA-N 0.000 description 2
- GXWNSJYVSIJRLS-UHFFFAOYSA-N 6-bromo-8-methylimidazo[1,2-a]pyrazine Chemical compound CC1=NC(Br)=CN2C=CN=C12 GXWNSJYVSIJRLS-UHFFFAOYSA-N 0.000 description 2
- IMLXOMJBYPJJOI-UHFFFAOYSA-N 7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1N(C)CCN2C=C(C=O)N=C21 IMLXOMJBYPJJOI-UHFFFAOYSA-N 0.000 description 2
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 2
- 241000588697 Enterobacter cloacae Species 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- HDJLSECJEQSPKW-UHFFFAOYSA-N Methyl 2-Furancarboxylate Chemical compound COC(=O)C1=CC=CO1 HDJLSECJEQSPKW-UHFFFAOYSA-N 0.000 description 2
- UQFQONCQIQEYPJ-UHFFFAOYSA-N N-methylpyrazole Chemical compound CN1C=CC=N1 UQFQONCQIQEYPJ-UHFFFAOYSA-N 0.000 description 2
- 241000588652 Neisseria gonorrhoeae Species 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 101100391171 Schizosaccharomyces pombe (strain 972 / ATCC 24843) for3 gene Proteins 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 2
- WREOTYWODABZMH-DTZQCDIJSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-[2-oxo-4-(2-phenylethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N(C=C\1)C(=O)NC/1=N\OCCC1=CC=CC=C1 WREOTYWODABZMH-DTZQCDIJSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001336 alkenes Chemical group 0.000 description 2
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 125000004069 aziridinyl group Chemical group 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 2
- 229960003324 clavulanic acid Drugs 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 229940125758 compound 15 Drugs 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000005047 dihydroimidazolyl group Chemical group N1(CNC=C1)* 0.000 description 2
- MSPOSRHJXMILNK-UHFFFAOYSA-N ethyl 1h-pyrazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=NN1 MSPOSRHJXMILNK-UHFFFAOYSA-N 0.000 description 2
- XJRGUTARDWMARO-UHFFFAOYSA-N ethyl 4,6-dihydropyrazolo[1,5-c][1,3]thiazole-3-carboxylate Chemical compound C1SCC2=C(C(=O)OCC)C=NN21 XJRGUTARDWMARO-UHFFFAOYSA-N 0.000 description 2
- MTPPMSVRBRLEQF-UHFFFAOYSA-N ethyl 5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazine-2-carboxylate Chemical compound C1CSCN2N=C(C(=O)OCC)C=C21 MTPPMSVRBRLEQF-UHFFFAOYSA-N 0.000 description 2
- FGCPAXRNQIOISG-UHFFFAOYSA-N ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(O)NN=1 FGCPAXRNQIOISG-UHFFFAOYSA-N 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000004634 hexahydroazepinyl group Chemical group N1(CCCCCC1)* 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- LTAFRIZVOKDEMU-UHFFFAOYSA-N morpholine-3-thione Chemical compound S=C1COCCN1 LTAFRIZVOKDEMU-UHFFFAOYSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 2
- 235000011837 pasties Nutrition 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 2
- JSSXHAMIXJGYCS-UHFFFAOYSA-N piperazin-4-ium-2-carboxylate Chemical compound OC(=O)C1CNCCN1 JSSXHAMIXJGYCS-UHFFFAOYSA-N 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- XFTQRUTUGRCSGO-UHFFFAOYSA-N pyrazin-2-amine Chemical compound NC1=CN=CC=N1 XFTQRUTUGRCSGO-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000011369 resultant mixture Substances 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical compound O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 description 2
- 229960005256 sulbactam Drugs 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- LPQZKKCYTLCDGQ-WEDXCCLWSA-N tazobactam Chemical compound C([C@]1(C)S([C@H]2N(C(C2)=O)[C@H]1C(O)=O)(=O)=O)N1C=CN=N1 LPQZKKCYTLCDGQ-WEDXCCLWSA-N 0.000 description 2
- 229960003865 tazobactam Drugs 0.000 description 2
- LEONLAFPFCQRNM-UHFFFAOYSA-N tert-butyl 2-formyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2=C1C=C(C=O)S2 LEONLAFPFCQRNM-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 2
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- AQWOIRBQLOOZGX-UHFFFAOYSA-N triazolo[1,5-a]pyridine Chemical compound C1=CC=CC2=CN=NN21 AQWOIRBQLOOZGX-UHFFFAOYSA-N 0.000 description 2
- JETQIUPBHQNHNZ-NJBDSQKTSA-N (2s,5r,6r)-3,3-dimethyl-7-oxo-6-[[(2r)-2-phenyl-2-sulfoacetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H](C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)S(O)(=O)=O)=CC=CC=C1 JETQIUPBHQNHNZ-NJBDSQKTSA-N 0.000 description 1
- LMWRIZCWHDQLQP-BYPYZUCNSA-N (3r)-4-nitrosothiomorpholine-3-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCCN1N=O LMWRIZCWHDQLQP-BYPYZUCNSA-N 0.000 description 1
- GZHNHTROMFQDSA-TWMPVWRBSA-N (4-nitrophenyl)methyl (5r)-6-[acetyloxy(4,6-dihydropyrazolo[1,5-c][1,3]thiazol-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)(Br)C(C2=NN3CSCC3=C2)OC(=O)C)C=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 GZHNHTROMFQDSA-TWMPVWRBSA-N 0.000 description 1
- LCTZQVNTKLMQSJ-NFOQDIRWSA-N (4-nitrophenyl)methyl (5r)-6-[acetyloxy(5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)(Br)C(C2=NN3CSCCC3=C2)OC(=O)C)C=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 LCTZQVNTKLMQSJ-NFOQDIRWSA-N 0.000 description 1
- AGSPXMNLSOIYKW-NFOQDIRWSA-N (4-nitrophenyl)methyl (5r)-6-[acetyloxy(6,7-dihydro-4h-pyrazolo[5,1-c][1,4]oxazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)(Br)C(C2=NN3CCOCC3=C2)OC(=O)C)C=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 AGSPXMNLSOIYKW-NFOQDIRWSA-N 0.000 description 1
- FKYSZGVJCAKVSA-JKJRPBHFSA-N (4-nitrophenyl)methyl (5r)-6-[acetyloxy-(6,6-dimethyl-7,8-dihydro-5h-imidazo[1,2-a]pyridin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)(Br)C(C=2N=C3CCC(C)(C)CN3C=2)OC(=O)C)C=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 FKYSZGVJCAKVSA-JKJRPBHFSA-N 0.000 description 1
- OXCFVSBTPWFBBV-JKJRPBHFSA-N (4-nitrophenyl)methyl (5r)-6-[acetyloxy-[5-(4,5-dihydro-1,3-thiazol-2-yl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazin-2-yl]methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]12)C=C(C(=O)OCC=3C=CC(=CC=3)[N+]([O-])=O)N1C(=O)C2(Br)C(OC(=O)C)C(=NN1CC2)C=C1CN2C1=NCCS1 OXCFVSBTPWFBBV-JKJRPBHFSA-N 0.000 description 1
- BCQLGSCBQKKBIM-TVKKRMFBSA-N (4-nitrophenyl)methyl (5r)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CS[C@H]2N1C(=O)C2Br BCQLGSCBQKKBIM-TVKKRMFBSA-N 0.000 description 1
- KQBDNQQUBREETF-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-methoxypiperazine-1-carboxylate Chemical compound COC1CNCCN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 KQBDNQQUBREETF-UHFFFAOYSA-N 0.000 description 1
- ZHLRTNSBMCLQMM-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-formyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-7-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC2=NC=C(C=O)N2CC1 ZHLRTNSBMCLQMM-UHFFFAOYSA-N 0.000 description 1
- NHKGBUFCOREANA-UHFFFAOYSA-N (4-nitrophenyl)methyl 6-amino-3,5-dihydro-2h-pyrazine-4-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC(=N)NCC1 NHKGBUFCOREANA-UHFFFAOYSA-N 0.000 description 1
- WBHDXHVQGLQFDC-UHFFFAOYSA-N (4-nitrophenyl)methyl bicyclo[3.2.0]hept-3-ene-4-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CCC2C1CC2 WBHDXHVQGLQFDC-UHFFFAOYSA-N 0.000 description 1
- IMPOWBGVGHJTHS-UHFFFAOYSA-N (5,5-dimethyl-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl)methanol Chemical compound OCC1=NN2CC(C)(C)CC2=C1 IMPOWBGVGHJTHS-UHFFFAOYSA-N 0.000 description 1
- UMBIJIPNILTCBR-UHFFFAOYSA-N (5-benzyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methanol Chemical compound C1CC=2SC(CO)=CC=2CN1CC1=CC=CC=C1 UMBIJIPNILTCBR-UHFFFAOYSA-N 0.000 description 1
- GHKOEXXIUYMVMX-UHFFFAOYSA-N (5-methyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methanol Chemical compound C1N(C)CCC2=C1C=C(CO)S2 GHKOEXXIUYMVMX-UHFFFAOYSA-N 0.000 description 1
- BJDTWVQNEWIULP-RXMQYKEDSA-N (5R)-3-bromo-4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one Chemical class BrC=1S[C@H]2N(C=1)C(C2)=O BJDTWVQNEWIULP-RXMQYKEDSA-N 0.000 description 1
- SDGCXMDTXHFBPH-SDMSXHDGSA-N (5r)-6-bromo-4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one Chemical class S1C=CN2C(=O)C(Br)[C@H]21 SDGCXMDTXHFBPH-SDMSXHDGSA-N 0.000 description 1
- SFVSKJYLOIWSMM-YWEYNIOJSA-N (6z)-6-(6,7-dihydro-5h-pyrrolo[1,2-a]imidazol-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 SFVSKJYLOIWSMM-YWEYNIOJSA-N 0.000 description 1
- 125000006828 (C2-C7) alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- IDFPQEHZYBXIFO-GFCCVEGCSA-N (R)-(4-fluoro-2-propylphenyl)-(1H-imidazol-2-yl)methanol Chemical compound CCCc1cc(F)ccc1[C@@H](O)c1ncc[nH]1 IDFPQEHZYBXIFO-GFCCVEGCSA-N 0.000 description 1
- JOKIQGQOKXGHDV-BYPYZUCNSA-N (R)-thiomorpholine-3-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCCN1 JOKIQGQOKXGHDV-BYPYZUCNSA-N 0.000 description 1
- FDAJRYGTXDAQOJ-UHFFFAOYSA-N 1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazine-2-carbaldehyde Chemical compound N1C(CC2N1C=CN=C2)C=O FDAJRYGTXDAQOJ-UHFFFAOYSA-N 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- JVZZMANDNMZDTQ-UHFFFAOYSA-N 1,3a,4,5,6,7-hexahydrooxadiazolo[3,4-a]pyridin-3-one Chemical compound C1CCCC2C(=O)ONN21 JVZZMANDNMZDTQ-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- NZAXGZYPZGEVBD-UHFFFAOYSA-N 1-benzoylpiperidin-4-one Chemical compound C=1C=CC=CC=1C(=O)N1CCC(=O)CC1 NZAXGZYPZGEVBD-UHFFFAOYSA-N 0.000 description 1
- MWZDIEIXRBWPLG-UHFFFAOYSA-N 1-methyl-1,2,4-triazole Chemical compound CN1C=NC=N1 MWZDIEIXRBWPLG-UHFFFAOYSA-N 0.000 description 1
- FGYADSCZTQOAFK-UHFFFAOYSA-N 1-methylbenzimidazole Chemical compound C1=CC=C2N(C)C=NC2=C1 FGYADSCZTQOAFK-UHFFFAOYSA-N 0.000 description 1
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 1
- DSGKTUVITPQPRT-UHFFFAOYSA-N 1-nitrosopiperidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CCCCN1N=O DSGKTUVITPQPRT-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- ZKAMEFMDQNTDFK-UHFFFAOYSA-N 1h-imidazo[4,5-b]pyrazine Chemical class C1=CN=C2NC=NC2=N1 ZKAMEFMDQNTDFK-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- CUXKNQDOYULMKG-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]oxazol-6-ylmethanol Chemical compound O1CCN2N=C(CO)C=C21 CUXKNQDOYULMKG-UHFFFAOYSA-N 0.000 description 1
- HRWUBJRFWUWTLF-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carbaldehyde Chemical compound O1CCN2N=C(C=O)C=C21 HRWUBJRFWUWTLF-UHFFFAOYSA-N 0.000 description 1
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 1
- UPUWMQZUXFAUCJ-UHFFFAOYSA-N 2,5-dihydro-1,2-thiazole Chemical compound C1SNC=C1 UPUWMQZUXFAUCJ-UHFFFAOYSA-N 0.000 description 1
- QYJVLVPLSMGDOW-UHFFFAOYSA-N 2-bromo-3-propoxyprop-2-enal Chemical compound CCCOC=C(Br)C=O QYJVLVPLSMGDOW-UHFFFAOYSA-N 0.000 description 1
- JBKINHFZTVLNEM-UHFFFAOYSA-N 2-bromoethoxy-tert-butyl-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)OCCBr JBKINHFZTVLNEM-UHFFFAOYSA-N 0.000 description 1
- LUBCTTDWFZRWJL-UHFFFAOYSA-N 2-ethoxycarbonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid Chemical compound C1N(C(O)=O)CCN2N=C(C(=O)OCC)C=C21 LUBCTTDWFZRWJL-UHFFFAOYSA-N 0.000 description 1
- QFGRBBWYHIYNIB-UHFFFAOYSA-N 2-methylsulfanyl-4,5-dihydro-1,3-thiazole Chemical compound CSC1=NCCS1 QFGRBBWYHIYNIB-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YDLAHBBJAGGIJZ-UHFFFAOYSA-N 2-sulfanylethyl acetate Chemical compound CC(=O)OCCS YDLAHBBJAGGIJZ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- ZAKYENDYKUVXTA-UHFFFAOYSA-N 3,3-dichloro-5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CNC(=O)C(Cl)(Cl)C1 ZAKYENDYKUVXTA-UHFFFAOYSA-N 0.000 description 1
- VWNDYNSRQHQQPH-UHFFFAOYSA-N 3,3-dimethyl-4,5-dihydro-2h-pyridin-6-amine;hydrochloride Chemical compound Cl.CC1(C)CCC(=N)NC1 VWNDYNSRQHQQPH-UHFFFAOYSA-N 0.000 description 1
- JEBHLIYFPKISBI-UHFFFAOYSA-N 3,4-dihydro-2h-pyrrol-5-amine;hydrochloride Chemical compound Cl.NC1=NCCC1 JEBHLIYFPKISBI-UHFFFAOYSA-N 0.000 description 1
- DHDKXNIINMVSNZ-UHFFFAOYSA-N 3,6-dihydro-2h-1,4-oxazin-5-amine;hydrochloride Chemical compound Cl.N=C1COCCN1 DHDKXNIINMVSNZ-UHFFFAOYSA-N 0.000 description 1
- UZGLOGCJCWBBIV-UHFFFAOYSA-N 3-(chloromethyl)pyridin-1-ium;chloride Chemical compound Cl.ClCC1=CC=CN=C1 UZGLOGCJCWBBIV-UHFFFAOYSA-N 0.000 description 1
- PRRZDZJYSJLDBS-UHFFFAOYSA-N 3-bromo-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CBr PRRZDZJYSJLDBS-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PAAUAUMOQQSLGB-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethanol Chemical compound C1NCCN2N=C(CO)C=C21 PAAUAUMOQQSLGB-UHFFFAOYSA-N 0.000 description 1
- ZHAXPVWSJMLLDM-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanol Chemical compound C1CCCN2N=C(CO)C=C21 ZHAXPVWSJMLLDM-UHFFFAOYSA-N 0.000 description 1
- OGUWOLDNYOTRBO-UHFFFAOYSA-N 4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1NCCC2=C1C=CS2 OGUWOLDNYOTRBO-UHFFFAOYSA-N 0.000 description 1
- ONBXVZOJAXVSCT-UHFFFAOYSA-N 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carbaldehyde;hydrochloride Chemical compound Cl.C1NCCC2=C1C=C(C=O)S2 ONBXVZOJAXVSCT-UHFFFAOYSA-N 0.000 description 1
- ZGNPNZPUBIEHFT-UHFFFAOYSA-N 4,6-dihydropyrazolo[1,5-c][1,3]thiazol-2-ylmethanol Chemical compound C1SCN2N=C(CO)C=C21 ZGNPNZPUBIEHFT-UHFFFAOYSA-N 0.000 description 1
- NDOHWOMEMPKTKU-UHFFFAOYSA-N 4-[(4-nitrophenyl)methoxycarbonyl]piperazine-2-carboxylic acid Chemical compound C1CNC(C(=O)O)CN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 NDOHWOMEMPKTKU-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- NRUNMQZDNPWLDF-UHFFFAOYSA-N 5,5-dimethyl-4,6-dihydropyrrolo[1,2-b]pyrazole-2-carbaldehyde Chemical compound O=CC1=NN2CC(C)(C)CC2=C1 NRUNMQZDNPWLDF-UHFFFAOYSA-N 0.000 description 1
- ZKHIBEUBGKQKJZ-UHFFFAOYSA-N 5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazin-2-ylmethanol Chemical compound C1CSCN2N=C(CO)C=C21 ZKHIBEUBGKQKJZ-UHFFFAOYSA-N 0.000 description 1
- KUDJZMGGBPRAOO-UHFFFAOYSA-N 5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazine-2-carbaldehyde Chemical compound C1CSCN2N=C(C=O)C=C21 KUDJZMGGBPRAOO-UHFFFAOYSA-N 0.000 description 1
- GUPPGBJHJWFJCP-UHFFFAOYSA-N 5-benzyl-6,7-dihydro-4h-thieno[3,2-c]pyridine Chemical compound C1CC=2SC=CC=2CN1CC1=CC=CC=C1 GUPPGBJHJWFJCP-UHFFFAOYSA-N 0.000 description 1
- PZKFSRWSQOQYNR-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC=NN1 PZKFSRWSQOQYNR-UHFFFAOYSA-N 0.000 description 1
- GXQPVPNALQNROT-UHFFFAOYSA-N 5-methylsulfanyl-3,6-dihydro-2h-1,4-oxazine Chemical compound CSC1=NCCOC1 GXQPVPNALQNROT-UHFFFAOYSA-N 0.000 description 1
- RNEKDGQEFWGWFA-UHFFFAOYSA-N 5-o-tert-butyl 2-o-ethyl 6,7-dihydro-4h-thieno[3,2-c]pyridine-2,5-dicarboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2=C1C=C(C(=O)OCC)S2 RNEKDGQEFWGWFA-UHFFFAOYSA-N 0.000 description 1
- HELXKSLPDNIOAQ-UHFFFAOYSA-N 6,6-dimethyl-7,8-dihydro-5h-imidazo[1,2-a]pyridine-3-carbaldehyde Chemical compound C1C(C)(C)CCC2=NC=C(C=O)N21 HELXKSLPDNIOAQ-UHFFFAOYSA-N 0.000 description 1
- MBVCARRYXQUTLF-UHFFFAOYSA-N 6,7,8,9-tetrahydro-5h-imidazo[1,2-a]azepine Chemical compound C1CCCCC2=NC=CN21 MBVCARRYXQUTLF-UHFFFAOYSA-N 0.000 description 1
- OGVQBBOERFBNJI-UHFFFAOYSA-N 6,7,8,9-tetrahydro-5h-imidazo[1,2-a]azepine-2-carbaldehyde Chemical compound C1CCCCC2=NC(C=O)=CN21 OGVQBBOERFBNJI-UHFFFAOYSA-N 0.000 description 1
- CQWIABLKKCDQJH-UHFFFAOYSA-N 6,7-dihydro-4h-oxadiazolo[4,3-c][1,4]oxazin-8-ium-3-olate Chemical compound C1COCC2=C([O-])ON=[N+]21 CQWIABLKKCDQJH-UHFFFAOYSA-N 0.000 description 1
- SPVPTQCGJTYMIB-UHFFFAOYSA-N 6,7-dihydro-4h-pyrazolo[5,1-c][1,4]thiazin-2-ylmethanol Chemical compound C1SCCN2N=C(CO)C=C21 SPVPTQCGJTYMIB-UHFFFAOYSA-N 0.000 description 1
- JKVQRPWUDNCFBD-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]pyran Chemical compound C1OCCC2=C1C=CS2 JKVQRPWUDNCFBD-UHFFFAOYSA-N 0.000 description 1
- DONVCZPIYCTGFE-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]pyran-2-carbaldehyde Chemical compound C1OCCC2=C1C=C(C=O)S2 DONVCZPIYCTGFE-UHFFFAOYSA-N 0.000 description 1
- DOHDEBNRWREKDJ-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]thiopyran Chemical compound C1SCCC2=C1C=CS2 DOHDEBNRWREKDJ-UHFFFAOYSA-N 0.000 description 1
- YWBIDCRPUQBUBQ-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]thiopyran-2-carbaldehyde Chemical compound C1SCCC2=C1C=C(C=O)S2 YWBIDCRPUQBUBQ-UHFFFAOYSA-N 0.000 description 1
- GNFCYTBCYXABDO-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]thiopyran-2-carboxylic acid Chemical compound C1SCCC2=C1C=C(C(=O)O)S2 GNFCYTBCYXABDO-UHFFFAOYSA-N 0.000 description 1
- HRVCHPXADXEUPW-UHFFFAOYSA-N 6,7-dihydro-5h-pyrazolo[5,1-b][1,3]oxazine-2-carbaldehyde Chemical compound O1CCCN2N=C(C=O)C=C21 HRVCHPXADXEUPW-UHFFFAOYSA-N 0.000 description 1
- YFZDKAJETNSREY-UHFFFAOYSA-N 6,7-dihydro-5h-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid Chemical compound O1CCCN2N=C(C(=O)O)C=C21 YFZDKAJETNSREY-UHFFFAOYSA-N 0.000 description 1
- IDSKFBBXAJGOBQ-UHFFFAOYSA-N 6,7-dihydropyrazolo[5,1-c][1,4]oxazin-4-one Chemical compound O=C1OCCN2N=CC=C12 IDSKFBBXAJGOBQ-UHFFFAOYSA-N 0.000 description 1
- NPZPGTSNVCBMIM-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazine Chemical compound C1OCCN2C=CN=C21 NPZPGTSNVCBMIM-UHFFFAOYSA-N 0.000 description 1
- BQGZMWAWDNEWGS-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazine-2-carbaldehyde Chemical compound C1COCC2=NC(C=O)=CN21 BQGZMWAWDNEWGS-UHFFFAOYSA-N 0.000 description 1
- BPFBPFRIVNHIHS-UHFFFAOYSA-N 6-amino-4-methyl-2,5-dihydropyrazin-3-one Chemical compound CN1CC(N)=NCC1=O BPFBPFRIVNHIHS-UHFFFAOYSA-N 0.000 description 1
- VQWYSTGIQKLGAL-UHFFFAOYSA-N 6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CSC2C(Br)C(=O)N12 VQWYSTGIQKLGAL-UHFFFAOYSA-N 0.000 description 1
- ABWQHWRGXRBYHL-UHFFFAOYSA-N 6-methoxy-3,3-dimethyl-4,5-dihydro-2h-pyridine Chemical compound COC1=NCC(C)(C)CC1 ABWQHWRGXRBYHL-UHFFFAOYSA-N 0.000 description 1
- XFSYYHJOKSQNIA-UHFFFAOYSA-N 6-methoxy-4-methyl-2,5-dihydropyrazin-3-one Chemical compound COC1=NCC(=O)N(C)C1 XFSYYHJOKSQNIA-UHFFFAOYSA-N 0.000 description 1
- SQDAAERVOICMTB-UHFFFAOYSA-N 7-benzyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1C2=NC(C=O)=CN2CCN1CC1=CC=CC=C1 SQDAAERVOICMTB-UHFFFAOYSA-N 0.000 description 1
- QXNWYWSBNOEZJQ-UHFFFAOYSA-N 7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carboxylic acid Chemical compound C1N(C)CCN2C=C(C(O)=O)N=C21 QXNWYWSBNOEZJQ-UHFFFAOYSA-N 0.000 description 1
- UVVPVKHUHFPIHV-UHFFFAOYSA-N 7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazine-3-carbaldehyde Chemical compound C1C(=O)N(C)CC2=NC=C(C=O)N21 UVVPVKHUHFPIHV-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000606124 Bacteroides fragilis Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- DOQSLWRCIAYBEF-UHFFFAOYSA-N C1C=CC=C2N1CC(N2)C=O Chemical compound C1C=CC=C2N1CC(N2)C=O DOQSLWRCIAYBEF-UHFFFAOYSA-N 0.000 description 1
- 241000588919 Citrobacter freundii Species 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- YCAGGFXSFQFVQL-UHFFFAOYSA-N Endothion Chemical compound COC1=COC(CSP(=O)(OC)OC)=CC1=O YCAGGFXSFQFVQL-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 102000009338 Gastric Mucins Human genes 0.000 description 1
- 108010009066 Gastric Mucins Proteins 0.000 description 1
- 238000007164 Haack reaction Methods 0.000 description 1
- 102000001554 Hemoglobins Human genes 0.000 description 1
- 108010054147 Hemoglobins Proteins 0.000 description 1
- DZLNHFMRPBPULJ-VKHMYHEASA-N L-thioproline Chemical compound OC(=O)[C@@H]1CSCN1 DZLNHFMRPBPULJ-VKHMYHEASA-N 0.000 description 1
- PQMWYJDJHJQZDE-UHFFFAOYSA-M Methantheline bromide Chemical compound [Br-].C1=CC=C2C(C(=O)OCC[N+](C)(CC)CC)C3=CC=CC=C3OC2=C1 PQMWYJDJHJQZDE-UHFFFAOYSA-M 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- NRBSWXQHBZJRPW-UHFFFAOYSA-N N(=O)N1CC(CC1)(C)C Chemical compound N(=O)N1CC(CC1)(C)C NRBSWXQHBZJRPW-UHFFFAOYSA-N 0.000 description 1
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 1
- 150000004008 N-nitroso compounds Chemical class 0.000 description 1
- 125000000520 N-substituted aminocarbonyl group Chemical group [*]NC(=O)* 0.000 description 1
- QRIRTAMFMKJIQG-UHFFFAOYSA-N N1C(COCC1)=O.N1C(COCC1)=O Chemical compound N1C(COCC1)=O.N1C(COCC1)=O QRIRTAMFMKJIQG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- CVQUWLDCFXOXEN-UHFFFAOYSA-N Pyran-4-one Chemical compound O=C1C=COC=C1 CVQUWLDCFXOXEN-UHFFFAOYSA-N 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- OEYGCDBNOJGMCS-UHFFFAOYSA-N [2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)pyrazol-3-yl]methanol Chemical compound CC(C)(C)[Si](C)(C)OCCN1N=C(CO)C=C1CO OEYGCDBNOJGMCS-UHFFFAOYSA-N 0.000 description 1
- KRMFJYDCIDDHGN-UHFFFAOYSA-N [5-(4,5-dihydro-1,3-thiazol-2-yl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazin-2-yl]methanol Chemical compound C1CN2N=C(CO)C=C2CN1C1=NCCS1 KRMFJYDCIDDHGN-UHFFFAOYSA-N 0.000 description 1
- 125000004062 acenaphthenyl group Chemical group C1(CC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- ZAECPIUOQZITLG-UHFFFAOYSA-N acetic acid 4H-thieno[3,2-c]thiopyran-2-carbaldehyde Chemical compound C(C)(=O)O.S1C(=CC=2CSC=CC21)C=O ZAECPIUOQZITLG-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001345 alkine derivatives Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000005324 aryloxy alkyloxy group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- APLHDUWNMGJBFD-UHFFFAOYSA-N azepane-2-thione Chemical compound S=C1CCCCCN1 APLHDUWNMGJBFD-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- ALMBWARXLHLNTP-UHFFFAOYSA-N bicyclo[3.2.0]hept-3-ene-4-carboxylic acid Chemical compound OC(=O)C1=CCC2CCC12 ALMBWARXLHLNTP-UHFFFAOYSA-N 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- ACXMTAJLYQCRGF-PBFPGSCMSA-N cefatrizine Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC1=CN=N[N]1 ACXMTAJLYQCRGF-PBFPGSCMSA-N 0.000 description 1
- AVGYWQBCYZHHPN-CYJZLJNKSA-N cephalexin monohydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 AVGYWQBCYZHHPN-CYJZLJNKSA-N 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 210000003555 cloaca Anatomy 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 229910000009 copper(II) carbonate Inorganic materials 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical class ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- MBWXLICVQZUJOW-UHFFFAOYSA-N diethyl 1h-pyrazole-3,5-dicarboxylate Chemical compound CCOC(=O)C=1C=C(C(=O)OCC)NN=1 MBWXLICVQZUJOW-UHFFFAOYSA-N 0.000 description 1
- RSHJDGWVQSUSTR-UHFFFAOYSA-N diethyl 6,7-dihydro-4h-thieno[3,2-c]pyridine-2,5-dicarboxylate Chemical compound C1N(C(=O)OCC)CCC2=C1C=C(C(=O)OCC)S2 RSHJDGWVQSUSTR-UHFFFAOYSA-N 0.000 description 1
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000004582 dihydrobenzothienyl group Chemical group S1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000005435 dihydrobenzoxazolyl group Chemical group O1C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000005049 dihydrooxadiazolyl group Chemical group O1N(NC=C1)* 0.000 description 1
- 125000005050 dihydrooxazolyl group Chemical group O1C(NC=C1)* 0.000 description 1
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005053 dihydropyrimidinyl group Chemical group N1(CN=CC=C1)* 0.000 description 1
- 125000005054 dihydropyrrolyl group Chemical group [H]C1=C([H])C([H])([H])C([H])([H])N1* 0.000 description 1
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 125000005058 dihydrotriazolyl group Chemical group N1(NNC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- FZWVFMXBFCGKDG-UHFFFAOYSA-N ethyl 2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylate Chemical compound O1CCN2N=C(C(=O)OCC)C=C21 FZWVFMXBFCGKDG-UHFFFAOYSA-N 0.000 description 1
- BFWQGQXCGLKWIO-UHFFFAOYSA-N ethyl 2,3-dihydropyrazolo[5,1-b][1,3]thiazole-6-carboxylate Chemical compound S1CCN2N=C(C(=O)OCC)C=C21 BFWQGQXCGLKWIO-UHFFFAOYSA-N 0.000 description 1
- LWNKDHFFBDEAEU-UHFFFAOYSA-N ethyl 2-formyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OCC)CCC2=C1C=C(C=O)S2 LWNKDHFFBDEAEU-UHFFFAOYSA-N 0.000 description 1
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 1
- VICYTAYPKBLQFB-UHFFFAOYSA-N ethyl 3-bromo-2-oxopropanoate Chemical compound CCOC(=O)C(=O)CBr VICYTAYPKBLQFB-UHFFFAOYSA-N 0.000 description 1
- RLYRMESNENRMHE-UHFFFAOYSA-N ethyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxylate Chemical compound C1CCCN2N=C(C(=O)OCC)C=C21 RLYRMESNENRMHE-UHFFFAOYSA-N 0.000 description 1
- UYYNSVHJHJUZRY-UHFFFAOYSA-N ethyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxylate Chemical compound C1CCCC2=C(C(=O)OCC)C=NN21 UYYNSVHJHJUZRY-UHFFFAOYSA-N 0.000 description 1
- LHPDOGQJGFQFFQ-UHFFFAOYSA-N ethyl 4,6-dihydropyrazolo[1,5-c][1,3]thiazole-2-carboxylate Chemical compound C1SCN2N=C(C(=O)OCC)C=C21 LHPDOGQJGFQFFQ-UHFFFAOYSA-N 0.000 description 1
- TURPMJWIXJNODP-UHFFFAOYSA-N ethyl 5,7-dihydro-4h-pyrazolo[1,5-c][1,3]thiazine-3-carboxylate Chemical compound C1SCCC2=C(C(=O)OCC)C=NN21 TURPMJWIXJNODP-UHFFFAOYSA-N 0.000 description 1
- TTXMGIMDAFVKPD-UHFFFAOYSA-N ethyl 5-benzoyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-2-carboxylate Chemical compound C1CC=2SC(C(=O)OCC)=CC=2CN1C(=O)C1=CC=CC=C1 TTXMGIMDAFVKPD-UHFFFAOYSA-N 0.000 description 1
- XCDXZBOCFHTGBZ-UHFFFAOYSA-N ethyl 6,7-dihydro-4h-pyrazolo[5,1-c][1,4]thiazine-2-carboxylate Chemical compound C1SCCN2N=C(C(=O)OCC)C=C21 XCDXZBOCFHTGBZ-UHFFFAOYSA-N 0.000 description 1
- DEQZHPHBXYMRRM-UHFFFAOYSA-N ethyl 7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1CN(C)CC2=NC(C(=O)OCC)=CN21 DEQZHPHBXYMRRM-UHFFFAOYSA-N 0.000 description 1
- SWABYVXORFBBAT-UHFFFAOYSA-N ethyl imidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1=CN=CC2=NC(C(=O)OCC)=CN21 SWABYVXORFBBAT-UHFFFAOYSA-N 0.000 description 1
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- HYBBIBNJHNGZAN-AZXPZELESA-N furan-2-carbaldehyde Chemical compound O=[13CH]C1=CC=CO1 HYBBIBNJHNGZAN-AZXPZELESA-N 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 244000000058 gram-negative pathogen Species 0.000 description 1
- 244000000059 gram-positive pathogen Species 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005367 heteroarylalkylthio group Chemical group 0.000 description 1
- 125000005368 heteroarylthio group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 1
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- AVCKMGVFKDWJML-UHFFFAOYSA-M lithium;2,6-ditert-butyl-4-methylphenolate Chemical compound [Li+].CC1=CC(C(C)(C)C)=C([O-])C(C(C)(C)C)=C1 AVCKMGVFKDWJML-UHFFFAOYSA-M 0.000 description 1
- DMJNNHOOLUXYBV-PQTSNVLCSA-N meropenem Chemical compound C=1([C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)S[C@@H]1CN[C@H](C(=O)N(C)C)C1 DMJNNHOOLUXYBV-PQTSNVLCSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000005142 microbroth dilution method Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- VSEAAEQOQBMPQF-UHFFFAOYSA-N morpholin-3-one Chemical compound O=C1COCCN1 VSEAAEQOQBMPQF-UHFFFAOYSA-N 0.000 description 1
- JUNOWSHJELIDQP-UHFFFAOYSA-N morpholin-4-ium-3-carboxylate Chemical compound OC(=O)C1COCCN1 JUNOWSHJELIDQP-UHFFFAOYSA-N 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- AUNFUDYEFLJJKP-UHFFFAOYSA-N oxazine-2-carbaldehyde Chemical compound O=CN1OC=CC=C1 AUNFUDYEFLJJKP-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 150000002961 penems Chemical class 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 description 1
- SUDYQKKBKMGXKU-UHFFFAOYSA-N piperazine-1,3-dicarboxylic acid Chemical compound OC(=O)C1CN(C(O)=O)CCN1 SUDYQKKBKMGXKU-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- SDCRQNYCXVKQEY-UHFFFAOYSA-M sodium 6-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].O=C1C2SC=C(N2C1)C(=O)[O-] SDCRQNYCXVKQEY-UHFFFAOYSA-M 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229960004932 sulbenicillin Drugs 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- RQCNHUCCQJMSRG-UHFFFAOYSA-N tert-butyl piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC1 RQCNHUCCQJMSRG-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- DRWRVYYFKKNYRK-UHFFFAOYSA-N thiazine-2-carbaldehyde Chemical compound O=CN1SC=CC=C1 DRWRVYYFKKNYRK-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/881—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with a hydrogen atom or an unsubstituted hydrocarbon radical, attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/86—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with only atoms other than nitrogen atoms directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/861—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with only atoms other than nitrogen atoms directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with a hydrocarbon radical or a substituted hydrocarbon radical, directly attached in position 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D503/00—Heterocyclic compounds containing 4-oxa-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxapenicillins, clavulanic acid derivatives; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37705202P | 2002-05-01 | 2002-05-01 | |
| PCT/US2003/013428 WO2003093279A1 (en) | 2002-05-01 | 2003-04-30 | BICYCLIC 6-ALKYLIDENE-PENEMS AS ß-LACTAMASES INHIBITORS |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ536182A true NZ536182A (en) | 2006-10-27 |
Family
ID=29401437
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ536182A NZ536182A (en) | 2002-05-01 | 2003-04-30 | Bicyclic 6-alkylidene-penems as beta-lactamase inhibitors |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US7112582B2 (https=) |
| EP (2) | EP1988093A1 (https=) |
| JP (2) | JP4602759B2 (https=) |
| KR (1) | KR20050007368A (https=) |
| CN (2) | CN101570545A (https=) |
| AR (1) | AR039774A1 (https=) |
| AU (1) | AU2003231205A1 (https=) |
| BR (1) | BR0309757A (https=) |
| CA (1) | CA2483538A1 (https=) |
| CR (3) | CR7508A (https=) |
| EC (1) | ECSP045397A (https=) |
| IL (1) | IL164899A0 (https=) |
| MX (1) | MXPA04010663A (https=) |
| NO (1) | NO20044549L (https=) |
| NZ (1) | NZ536182A (https=) |
| RU (1) | RU2339640C2 (https=) |
| SG (1) | SG162614A1 (https=) |
| TW (1) | TW200307687A (https=) |
| UA (1) | UA79117C2 (https=) |
| WO (1) | WO2003093279A1 (https=) |
| ZA (1) | ZA200409686B (https=) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR039476A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039774A1 (es) * | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR039475A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| MXPA06002125A (es) * | 2003-08-25 | 2006-05-31 | Revaax Pharmaceuticals Llc | Composiciones orales de cefazolin neuroterapeutico. |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| BRPI0613928A2 (pt) * | 2005-07-27 | 2011-02-15 | Wyeth Corp | método para o tratamento de uma infecção ou doença bacteriana; composição; produto; e uso de cefepima ou de um sal farmaceuticamente aceitável da mesma e um composto de fórmula i ou um sal farmaceuticamente aceitável ou éster hidrolisável in vivo do mesmo |
| TW200727897A (en) * | 2005-07-27 | 2007-08-01 | Wyeth Corp | Bicyclic 6-alkylidene-penem β-lactamase inhibitors and β-lactam antibiotic combination: a broad spectrum antibiotic |
| GT200600380A (es) * | 2005-08-24 | 2007-03-29 | Proceso para la preparacion de inhibidores de beta-lactamasa | |
| US20090018332A1 (en) * | 2007-06-28 | 2009-01-15 | Wyeth | Processes For Preparing Bicyclic Oxazine Carboxaldehyde and Beta-Lactamase Inhibitors |
| CN104119857A (zh) * | 2013-04-27 | 2014-10-29 | 海洋王照明科技股份有限公司 | 一种铱金属配合物有机电致磷光材料及其制备方法和有机电致发光器件 |
| CN104119858A (zh) * | 2013-04-27 | 2014-10-29 | 海洋王照明科技股份有限公司 | 一种铱金属配合物有机电致磷光材料及其制备方法和有机电致发光器件 |
| CN113332292A (zh) | 2016-02-23 | 2021-09-03 | 辉瑞公司 | 6,7-二氢-5H-吡唑并[5,1-b][1,3]噁嗪-2-甲酰胺化合物 |
| JP6983813B2 (ja) * | 2016-04-28 | 2021-12-17 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | 2−ピラゾロ[1,5−a]ピラジン−2−イルピリド[1,2−a]ピリミジン−4−オンの調製のためのプロセス |
| MX2019001918A (es) | 2016-08-15 | 2019-09-06 | Bayer Cropscience Ag | Derivados del heterociclo biciclico condensado como agentes de control de plagas. |
| CN114957258A (zh) * | 2021-02-25 | 2022-08-30 | 华东理工大学 | 基于碳青霉烯结构的广谱丝氨酸β-内酰胺酶抑制剂的合成及其在耐药细菌抑制中的应用 |
| KR20240012534A (ko) * | 2021-05-21 | 2024-01-29 | 청두 바이위 파머수티컬 씨오., 엘티디 | 피페라진 유도체 및 이의 의학적 용도 |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2004A (en) * | 1841-03-12 | Improvement in the manner of constructing and propelling steam-vessels | ||
| US4206067A (en) * | 1978-10-02 | 1980-06-03 | Chevron Research Company | Thermally stabilized erosion-inhibited functional fluids containing perhalometal compounds and an organic base |
| EP0041768B1 (en) | 1980-04-24 | 1987-11-11 | Beecham Group Plc | Beta-lactam compounds, their preparation and use |
| EP0120613A1 (en) | 1983-03-02 | 1984-10-03 | Beecham Group Plc | Penem derivatives and precursors |
| GB8402086D0 (en) | 1984-01-26 | 1984-02-29 | Beecham Group Plc | Compounds |
| FI82471C (fi) | 1984-01-26 | 1991-03-11 | Beecham Group Plc | Foerfarande foer framstaellning av farmakologiskt aktiva 6-metylenpenemderivater. |
| EP0150984B1 (en) | 1984-01-30 | 1991-09-11 | Pfizer Inc. | 6-(substituted) methylenepenicillanic and 6-(substituted) hydroxymethylpenicillanic acids and derivatives thereof |
| EP0167050A1 (en) * | 1984-06-21 | 1986-01-08 | Beecham Group Plc | Clavulanate compounds, their preparation and use and intermediates thereof |
| GB8518416D0 (en) * | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518421D0 (en) | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518422D0 (en) | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| ATE159021T1 (de) | 1986-01-17 | 1997-10-15 | Beecham Group Plc | Verfahren zur herstellung von penem derivaten und zwischenprodukte zu dieser herstellung |
| US4891369A (en) * | 1986-12-03 | 1990-01-02 | Taiho Pharmaceutical Company, Limited | 2β-Substituted-methylpenicillanic acid derivatives, and salts and esters thereof |
| DE3725375A1 (de) * | 1987-07-31 | 1989-02-09 | Bayer Ag | Stabile oxapenem-3-carbonsaeuren |
| GB8724566D0 (en) | 1987-10-20 | 1987-11-25 | Roussel Lab Ltd | Chemical compounds |
| GB8729614D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| GB8729613D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| NZ237202A (en) | 1990-02-23 | 1994-01-26 | Bristol Myers Squibb Co | Composition containing beta-lactam antibiotic and cationic oligopeptide |
| EP0447704A1 (en) | 1990-03-21 | 1991-09-25 | Smithkline Beecham Farmaceutici S.p.A. | N-Acylated azacyclic compounds, processes for their preparations and their use as medications |
| GB9116236D0 (en) | 1991-07-27 | 1991-09-11 | Smithkline Beecham Plc | Novel compounds |
| GB9222700D0 (en) * | 1992-10-29 | 1992-12-09 | Smithkline Beecham Plc | Chemical compounds |
| US5349045A (en) | 1993-01-26 | 1994-09-20 | United States Surgical Corporation | Polymer derived from cyclic amide and medical devices manufactured therefrom |
| GB9326248D0 (en) | 1993-12-23 | 1994-02-23 | Smithkline Beecham Plc | Pharmaceutical formulations |
| ATE252906T1 (de) | 1994-04-25 | 2003-11-15 | Smithkline Beecham Plc | Pharmazeutische formulierung, die ein beta- lactamase hemmendes penem in kombination mit einem beta-laktam-antibiotikum enthalten und ihre verwendung zur behandlung von bakteriellen infektionen |
| US5629322A (en) | 1994-11-15 | 1997-05-13 | Merck & Co., Inc. | Cyclic amidine analogs as inhibitors of nitric oxide synthase |
| AU1705400A (en) * | 1998-10-15 | 2000-05-01 | Sarawak Medichem Pharmaceuticals, Inc. | Method and composition for treating and preventing tuberculosis |
| GB9928290D0 (en) * | 1999-12-01 | 2000-01-26 | Univ Belfast | Process for preparing ambient temperature ionic liquids |
| EP1199077A1 (en) * | 2000-10-19 | 2002-04-24 | Amura Limited | Stable compositions of oxapenem-3-carboxylic acids by Co-lyophilisation with pharmaceutical carriers |
| GB0106428D0 (en) * | 2001-03-15 | 2001-05-02 | Amura Ltd | Antibacterial composition |
| AR039476A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039475A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| AR039774A1 (es) | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR046041A1 (es) * | 2003-10-03 | 2005-11-23 | Aventis Pharma Inc | Procedimiento para la preparacion de compuestos heterociclicos n-amino sustituidos |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200727897A (en) * | 2005-07-27 | 2007-08-01 | Wyeth Corp | Bicyclic 6-alkylidene-penem β-lactamase inhibitors and β-lactam antibiotic combination: a broad spectrum antibiotic |
-
2003
- 2003-04-28 AR ARP030101471A patent/AR039774A1/es unknown
- 2003-04-29 TW TW092110033A patent/TW200307687A/zh unknown
- 2003-04-30 CN CNA2009101331547A patent/CN101570545A/zh active Pending
- 2003-04-30 EP EP08004917A patent/EP1988093A1/en not_active Withdrawn
- 2003-04-30 SG SG200607462-9A patent/SG162614A1/en unknown
- 2003-04-30 BR BR0309757-9A patent/BR0309757A/pt not_active IP Right Cessation
- 2003-04-30 CN CN038097338A patent/CN1649883B/zh not_active Expired - Fee Related
- 2003-04-30 WO PCT/US2003/013428 patent/WO2003093279A1/en not_active Ceased
- 2003-04-30 MX MXPA04010663A patent/MXPA04010663A/es active IP Right Grant
- 2003-04-30 KR KR10-2004-7017597A patent/KR20050007368A/ko not_active Ceased
- 2003-04-30 JP JP2004501418A patent/JP4602759B2/ja not_active Expired - Fee Related
- 2003-04-30 EP EP03724340A patent/EP1499621A1/en not_active Ceased
- 2003-04-30 UA UA20041109833A patent/UA79117C2/uk unknown
- 2003-04-30 NZ NZ536182A patent/NZ536182A/en not_active IP Right Cessation
- 2003-04-30 CA CA002483538A patent/CA2483538A1/en not_active Abandoned
- 2003-04-30 RU RU2004135082/04A patent/RU2339640C2/ru not_active IP Right Cessation
- 2003-04-30 AU AU2003231205A patent/AU2003231205A1/en not_active Abandoned
- 2003-05-01 US US10/427,380 patent/US7112582B2/en not_active Expired - Fee Related
-
2004
- 2004-10-06 CR CR7508A patent/CR7508A/es not_active Application Discontinuation
- 2004-10-22 NO NO20044549A patent/NO20044549L/no not_active Application Discontinuation
- 2004-10-28 IL IL16489904A patent/IL164899A0/xx unknown
- 2004-10-29 EC EC2004005397A patent/ECSP045397A/es unknown
- 2004-11-30 ZA ZA200409686A patent/ZA200409686B/xx unknown
-
2006
- 2006-06-06 US US11/447,814 patent/US20060217361A1/en not_active Abandoned
-
2008
- 2008-08-21 US US12/195,706 patent/US7812014B2/en not_active Expired - Fee Related
-
2009
- 2009-08-21 CR CR10986A patent/CR10986A/es not_active Application Discontinuation
- 2009-08-21 CR CR10983A patent/CR10983A/es not_active Application Discontinuation
-
2010
- 2010-06-02 JP JP2010127126A patent/JP2010215652A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JP4602759B2 (ja) | 2010-12-22 |
| UA79117C2 (en) | 2007-05-25 |
| SG162614A1 (en) | 2010-07-29 |
| US20040077622A1 (en) | 2004-04-22 |
| AR039774A1 (es) | 2005-03-02 |
| TW200307687A (en) | 2003-12-16 |
| CN1649883A (zh) | 2005-08-03 |
| US20060217361A1 (en) | 2006-09-28 |
| JP2010215652A (ja) | 2010-09-30 |
| MXPA04010663A (es) | 2005-04-20 |
| US7812014B2 (en) | 2010-10-12 |
| RU2339640C2 (ru) | 2008-11-27 |
| CR10986A (es) | 2009-09-09 |
| IL164899A0 (en) | 2005-12-18 |
| EP1499621A1 (en) | 2005-01-26 |
| CN101570545A (zh) | 2009-11-04 |
| BR0309757A (pt) | 2005-03-08 |
| CR7508A (es) | 2005-01-05 |
| AU2003231205A1 (en) | 2003-11-17 |
| US7112582B2 (en) | 2006-09-26 |
| CA2483538A1 (en) | 2003-11-13 |
| CR10983A (es) | 2009-09-09 |
| CN1649883B (zh) | 2010-05-26 |
| KR20050007368A (ko) | 2005-01-17 |
| EP1988093A1 (en) | 2008-11-05 |
| US20080312203A1 (en) | 2008-12-18 |
| NO20044549L (no) | 2005-01-25 |
| ZA200409686B (en) | 2007-09-26 |
| ECSP045397A (es) | 2005-01-03 |
| RU2004135082A (ru) | 2006-01-20 |
| WO2003093279A1 (en) | 2003-11-13 |
| JP2005533017A (ja) | 2005-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7812014B2 (en) | Bicyclic 6-alkylidene-penems as β-lactamase inhibitors | |
| AU2010200930A1 (en) | Process for preparing 6-alkylidene penem derivatives | |
| US20040132708A1 (en) | Process for preparing 6-alkylidene penem derivatives | |
| US20060276445A1 (en) | Bicyclic 6-alkylidene-penems as class-D beta-lactamases inhibitors | |
| JP4472515B2 (ja) | ベータ−ラクタマーゼ阻害剤としてのヘテロトリサイクリル−6−アルキリデン−ペネム | |
| HK1124064A (en) | Bicyclic 6-alkylidene-penems as beta-lactamases inhibitors | |
| US20070232582A1 (en) | 4-substituted or unsubtituted-7-hydro-1,4-thiazepine-7-[bicyclic or tricyclic heteroaryl] substituted-3,6-dicarboxylic acid derivatives as beta-lactamase inhibitors | |
| US7229983B2 (en) | 4-substituted or unsubstituted-7-hydro-1,4-thiazepine-7-[bicyclic or tricyclic heteroaryl] substituted-3,6-dicarboxylic acid derivatives as β-lactamase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PSEA | Patent sealed | ||
| RENW | Renewal (renewal fees accepted) | ||
| RENW | Renewal (renewal fees accepted) | ||
| LAPS | Patent lapsed |