NO853575L - Fremgangsmaate til fremstilling av alkalisk- eller noeytrallimt papir eller kartong med anioniske, hydrofobe lim og kationiske retensjonsmidler. - Google Patents
Fremgangsmaate til fremstilling av alkalisk- eller noeytrallimt papir eller kartong med anioniske, hydrofobe lim og kationiske retensjonsmidler.Info
- Publication number
- NO853575L NO853575L NO853575A NO853575A NO853575L NO 853575 L NO853575 L NO 853575L NO 853575 A NO853575 A NO 853575A NO 853575 A NO853575 A NO 853575A NO 853575 L NO853575 L NO 853575L
- Authority
- NO
- Norway
- Prior art keywords
- glue
- formula
- paper
- carbon atoms
- salt
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 58
- 239000003292 glue Substances 0.000 title claims description 56
- 239000003795 chemical substances by application Substances 0.000 title claims description 49
- 230000014759 maintenance of location Effects 0.000 title claims description 48
- 125000002091 cationic group Chemical group 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000000835 fiber Substances 0.000 claims description 46
- 239000000725 suspension Substances 0.000 claims description 44
- 239000000853 adhesive Substances 0.000 claims description 41
- 230000001070 adhesive effect Effects 0.000 claims description 41
- 239000000123 paper Substances 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 238000004026 adhesive bonding Methods 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 239000007795 chemical reaction product Substances 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 16
- -1 tetrahydrophenylene Chemical group 0.000 claims description 16
- 230000002378 acidificating effect Effects 0.000 claims description 15
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 239000000654 additive Substances 0.000 claims description 14
- 239000000047 product Substances 0.000 claims description 14
- 239000011111 cardboard Substances 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 12
- 125000000129 anionic group Chemical group 0.000 claims description 12
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims description 12
- 239000011087 paperboard Substances 0.000 claims description 12
- 239000000945 filler Substances 0.000 claims description 11
- 230000002209 hydrophobic effect Effects 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 229920000768 polyamine Polymers 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 6
- 229920001281 polyalkylene Polymers 0.000 claims description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 6
- 229920000881 Modified starch Polymers 0.000 claims description 5
- 235000019426 modified starch Nutrition 0.000 claims description 5
- 235000014633 carbohydrates Nutrition 0.000 claims description 4
- 150000001720 carbohydrates Chemical class 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 4
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 claims description 3
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 claims description 3
- 240000008886 Ceratonia siliqua Species 0.000 claims description 3
- 235000013912 Ceratonia siliqua Nutrition 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000003368 amide group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 235000013312 flour Nutrition 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 3
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000005263 alkylenediamine group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical group 0.000 claims description 2
- 125000004956 cyclohexylene group Chemical group 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000004962 sulfoxyl group Chemical group 0.000 claims description 2
- 150000003628 tricarboxylic acids Chemical class 0.000 claims description 2
- 244000007835 Cyamopsis tetragonoloba Species 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- HKUFIYBZNQSHQS-UHFFFAOYSA-N n-octadecyloctadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCCCNCCCCCCCCCCCCCCCCCC HKUFIYBZNQSHQS-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 150000003335 secondary amines Chemical class 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 238000004513 sizing Methods 0.000 description 4
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 239000011436 cob Substances 0.000 description 3
- 239000007859 condensation product Chemical class 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 3
- 229910021653 sulphate ion Inorganic materials 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 2
- ACGQRMRFZCXYHQ-UHFFFAOYSA-N 3-[2-(2-aminoethylamino)ethyl-(dimethylamino)amino]propan-1-ol Chemical compound OCCCN(N(C)C)CCNCCN ACGQRMRFZCXYHQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000004368 Modified starch Substances 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- XXUJMEYKYHETBZ-UHFFFAOYSA-N ethyl 4-nitrophenyl ethylphosphonate Chemical compound CCOP(=O)(CC)OC1=CC=C([N+]([O-])=O)C=C1 XXUJMEYKYHETBZ-UHFFFAOYSA-N 0.000 description 2
- 239000011121 hardwood Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 239000012764 mineral filler Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000012766 organic filler Substances 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 238000004537 pulping Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- 239000001195 (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid Substances 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GHCVXTFBVDVFGE-UHFFFAOYSA-N 4-amino-6-chloro-1,3,5-triazin-2-ol Chemical compound NC1=NC(O)=NC(Cl)=N1 GHCVXTFBVDVFGE-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 102100031260 Acyl-coenzyme A thioesterase THEM4 Human genes 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000021357 Behenic acid Nutrition 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000605626 Clupanodon Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 244000303965 Cyamopsis psoralioides Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 240000000731 Fagus sylvatica Species 0.000 description 1
- 235000010099 Fagus sylvatica Nutrition 0.000 description 1
- 101000638510 Homo sapiens Acyl-coenzyme A thioesterase THEM4 Proteins 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 240000008299 Pinus lambertiana Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- MKHVZQXYWACUQC-UHFFFAOYSA-N bis(2-hydroxyethyl)azanium;dodecyl sulfate Chemical compound OCCNCCO.CCCCCCCCCCCCOS(O)(=O)=O MKHVZQXYWACUQC-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 229960002303 citric acid monohydrate Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000008406 cosmetic ingredient Substances 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- LAWOZCWGWDVVSG-UHFFFAOYSA-N dioctylamine Chemical compound CCCCCCCCNCCCCCCCC LAWOZCWGWDVVSG-UHFFFAOYSA-N 0.000 description 1
- UKMSUNONTOPOIO-UHFFFAOYSA-N docosanoic acid Chemical class CCCCCCCCCCCCCCCCCCCCCC(O)=O UKMSUNONTOPOIO-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- WGESLFUSXZBFQF-UHFFFAOYSA-N n-methyl-n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCN(C)CC=C WGESLFUSXZBFQF-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000001040 synthetic pigment Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- PUVAFTRIIUSGLK-UHFFFAOYSA-M trimethyl(oxiran-2-ylmethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1CO1 PUVAFTRIIUSGLK-UHFFFAOYSA-M 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/03—Non-macromolecular organic compounds
- D21H17/05—Non-macromolecular organic compounds containing elements other than carbon and hydrogen only
- D21H17/07—Nitrogen-containing compounds
Landscapes
- Paper (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH437784 | 1984-09-13 |
Publications (1)
Publication Number | Publication Date |
---|---|
NO853575L true NO853575L (no) | 1986-03-14 |
Family
ID=4274979
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO853575A NO853575L (no) | 1984-09-13 | 1985-09-12 | Fremgangsmaate til fremstilling av alkalisk- eller noeytrallimt papir eller kartong med anioniske, hydrofobe lim og kationiske retensjonsmidler. |
Country Status (10)
Country | Link |
---|---|
US (1) | US4737239A (ja) |
EP (1) | EP0174911A1 (ja) |
JP (2) | JPH0830315B2 (ja) |
AU (1) | AU4739385A (ja) |
BR (1) | BR8504417A (ja) |
DK (1) | DK414985A (ja) |
ES (1) | ES8700361A1 (ja) |
FI (1) | FI853475L (ja) |
NO (1) | NO853575L (ja) |
ZA (1) | ZA856981B (ja) |
Families Citing this family (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5425789A (en) * | 1986-12-22 | 1995-06-20 | Exxon Chemical Patents Inc. | Chemical compositions and their use as fuel additives |
GB8630594D0 (en) * | 1986-12-22 | 1987-02-04 | Exxon Chemical Patents Inc | Chemical compositions |
US6027611A (en) * | 1996-04-26 | 2000-02-22 | Kimberly-Clark Worldwide, Inc. | Facial tissue with reduced moisture penetration |
JP4010590B2 (ja) * | 1997-02-17 | 2007-11-21 | 株式会社リコー | インクジェット記録用水性インク組成物およびそれを用いた記録方法 |
US7241508B2 (en) * | 2005-10-12 | 2007-07-10 | West Linn Paper Company | Fragrance release paper |
US20120125231A1 (en) * | 2010-11-15 | 2012-05-24 | Penford Products Co. | Coating Formulation |
CN110499668A (zh) * | 2019-07-30 | 2019-11-26 | 湖北金庄科技再生资源有限公司 | 用于蔬菜包装的高抗水瓦楞原纸的制备工艺 |
Family Cites Families (26)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2272466A (en) * | 1937-11-22 | 1942-02-10 | Gen Aniline & Film Corp | Production of waxlike substances |
US2693490A (en) * | 1952-06-20 | 1954-11-02 | Gen Mills Inc | Mono-n-fattycitramides |
NL231136A (ja) * | 1957-09-05 | |||
US3173945A (en) * | 1958-10-06 | 1965-03-16 | Socony Mobil Oil Co Inc | Itaconamic acids |
US3396121A (en) * | 1960-11-16 | 1968-08-06 | Benckiser Gmbh Joh A | Compositions containing citric acid esters and their preparation |
US3231607A (en) * | 1962-03-29 | 1966-01-25 | Chevron Res | Partial amides of benzene polycarboxylic acids |
US3262955A (en) * | 1962-06-01 | 1966-07-26 | Socony Mobil Oil Co Inc | Metal salts of citramic acids |
NL134523C (ja) * | 1963-08-23 | |||
CH451513A (de) * | 1965-03-26 | 1968-05-15 | Ciba Geigy | Verfahren zur Herstellung von neuen härtbaren stickstoffhaltigen Kondensationsprodukten |
DE1292860B (de) * | 1965-06-26 | 1969-04-17 | Pfersee Chem Fab | Verfahren zur Herstellung wasserloeslicher, stickstoffhaltiger Kondensationsprodukte |
DE1670263A1 (de) * | 1967-08-09 | 1971-01-28 | Basf Ag | Verfahren zur Herstellung von Ureidopropionsaeuren |
US3857879A (en) * | 1967-12-04 | 1974-12-31 | W Abramitis | Amine salts of substituted succinamic acids |
BE756256A (fr) * | 1969-09-18 | 1971-03-17 | Ciba Geigy | Procede pour la preparation de substances solides poreuses constituees par des produits de polycondensation reticules a base d'uree-formaldehyde |
US3700623A (en) * | 1970-04-22 | 1972-10-24 | Hercules Inc | Reaction products of epihalohydrin and polymers of diallylamine and their use in paper |
US4034040A (en) * | 1971-05-24 | 1977-07-05 | Pfizer Inc. | Xylene-diamines as antiviral agents |
US3821075A (en) * | 1972-05-18 | 1974-06-28 | Westvaco Corp | C21-dicarboxylic acid anhydride and size agents and sizing process |
US3931063A (en) * | 1973-07-30 | 1976-01-06 | Ciba-Geigy Ag | Process for the manufacture of porous solids consisting of crosslinked urea-formaldehyde polycondensation products |
DE2459165A1 (de) * | 1974-12-14 | 1976-06-24 | Basf Ag | Leimungsmittel fuer papier |
JPS52107303A (en) * | 1976-03-05 | 1977-09-08 | Arakawa Rinsan Kagaku Kogyo | Sizing agent for paper making |
GB1533434A (en) * | 1976-03-10 | 1978-11-22 | Hercules Inc | Sizing method and a sizing composition for use therein |
CA1101158A (en) * | 1976-10-26 | 1981-05-19 | John A. Sedlak | Strengthening agents |
US4065349A (en) * | 1977-02-28 | 1977-12-27 | Standard Oil Company (Indiana) | Paper sizing process |
US4279794A (en) * | 1979-04-26 | 1981-07-21 | Hercules Incorporated | Sizing method and sizing composition for use therein |
JPS575997A (en) * | 1980-06-11 | 1982-01-12 | Kao Corp | Papermaking size agent |
US4402708A (en) * | 1980-11-18 | 1983-09-06 | Exxon Research & Engineering Co. | Dialkyl amine derivatives of phthalic acid |
EP0096654B1 (de) * | 1982-05-28 | 1987-10-28 | Ciba-Geigy Ag | Verfahren zum Leimen von Papier mit anionischen, hydrophoben Leimungsmitteln und kationischen Retentionsmitteln |
-
1985
- 1985-09-09 EP EP85810407A patent/EP0174911A1/de not_active Withdrawn
- 1985-09-09 US US06/773,708 patent/US4737239A/en not_active Expired - Fee Related
- 1985-09-11 FI FI853475A patent/FI853475L/fi not_active IP Right Cessation
- 1985-09-12 ZA ZA856981A patent/ZA856981B/xx unknown
- 1985-09-12 NO NO853575A patent/NO853575L/no unknown
- 1985-09-12 ES ES546900A patent/ES8700361A1/es not_active Expired
- 1985-09-12 AU AU47393/85A patent/AU4739385A/en not_active Abandoned
- 1985-09-12 BR BR8504417A patent/BR8504417A/pt unknown
- 1985-09-12 DK DK414985A patent/DK414985A/da not_active Application Discontinuation
- 1985-09-13 JP JP60203241A patent/JPH0830315B2/ja not_active Expired - Lifetime
-
1995
- 1995-03-08 JP JP7047983A patent/JP2559570B2/ja not_active Expired - Lifetime
Also Published As
Publication number | Publication date |
---|---|
ES546900A0 (es) | 1986-10-01 |
ES8700361A1 (es) | 1986-10-01 |
FI853475A0 (fi) | 1985-09-11 |
US4737239A (en) | 1988-04-12 |
JPH0830315B2 (ja) | 1996-03-27 |
JPH0820565A (ja) | 1996-01-23 |
ZA856981B (en) | 1986-04-30 |
AU4739385A (en) | 1986-03-20 |
EP0174911A1 (de) | 1986-03-19 |
BR8504417A (pt) | 1986-07-15 |
DK414985D0 (da) | 1985-09-12 |
DK414985A (da) | 1986-03-14 |
FI853475L (fi) | 1986-03-14 |
JP2559570B2 (ja) | 1996-12-04 |
JPS6170094A (ja) | 1986-04-10 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4956049A (en) | Process for sizing paper with anionic hydrophobic sizing agents and cationic retention aids | |
FI72133B (fi) | Vattendispersion av foerstaerkt kolofonium | |
US20060124264A1 (en) | Wet strength and softness enhancement of paper products | |
JP4799424B2 (ja) | 抄紙方法のためのてん料 | |
FI72332B (fi) | Stabila vattendispersioner av foerstaerkt kolofonium | |
NO853575L (no) | Fremgangsmaate til fremstilling av alkalisk- eller noeytrallimt papir eller kartong med anioniske, hydrofobe lim og kationiske retensjonsmidler. | |
US4627889A (en) | Process for sizing paper with anionic hydrophobic sizing agents and cationic retention aids | |
JPH0756119B2 (ja) | 陰イオン疎水性サイズ剤と陽イオン保持剤とを用いる紙のサイジング方法 | |
US4735685A (en) | Process for sizing paper or cardboard with anionic hydrophobic sizing agents and cationic retention aids | |
EP0105028B1 (de) | Verfahren zum Leimen von Papier mit anionischen, hydrophoben Leimungsmitteln und kationischen Retentionsmitteln | |
US4623428A (en) | Process for sizing paper with anionic hydrophobic sizing agents and cationic retention aids | |
NO853576L (no) | Fremgangsmaate til fremstilling av alkalisk- eller noeytrallimt papir eller kartong med anioniske, hydrofobe lim og kationiske retensjonsmidler. | |
DE3706435A1 (de) | Verfahren zum leimen von papier mit nicht-ionogenen, hydrophoben leimungsmitteln und gegebenenfalls kationischen retentionsmitteln | |
US4499153A (en) | Sizes | |
JPS60246896A (ja) | 製紙用サイズ剤組成物 | |
TW593839B (en) | Sizing dispersion | |
NO865157L (no) | Fremgangsmaate til liming av papir med anioniske, hydrofobe limingsmidler, og polymeriserte monoallylaminer som retensjonsmidler. | |
DE3742679A1 (de) | Verfahren zum leimen von papier mit gegenbenenfalls anionischen, hydrophoben leimungsmitteln und gegebenenfalls kationischen retentionsmitteln |