NO760401L - - Google Patents
Info
- Publication number
- NO760401L NO760401L NO760401A NO760401A NO760401L NO 760401 L NO760401 L NO 760401L NO 760401 A NO760401 A NO 760401A NO 760401 A NO760401 A NO 760401A NO 760401 L NO760401 L NO 760401L
- Authority
- NO
- Norway
- Prior art keywords
- compounds
- formula
- carbon atoms
- straight
- chain alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- GWBFDPNIAYWVFE-UHFFFAOYSA-N 2-(1,2-oxazol-3-yl)benzamide Chemical class NC(=O)C1=CC=CC=C1C1=NOC=C1 GWBFDPNIAYWVFE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims description 2
- 230000007017 scission Effects 0.000 claims description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 5
- 229920000137 polyphosphoric acid Polymers 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- -1 methoxy, ethoxy, n-propoxy Chemical group 0.000 description 3
- 230000002936 tranquilizing effect Effects 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 239000003158 myorelaxant agent Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000003204 tranquilizing agent Substances 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229960004279 formaldehyde Drugs 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940035363 muscle relaxants Drugs 0.000 description 1
- JHNRZXQVBKRYKN-UHFFFAOYSA-N n-(1-phenylethylidene)hydroxylamine Chemical class ON=C(C)C1=CC=CC=C1 JHNRZXQVBKRYKN-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HSYAEFRDQRNICN-UHFFFAOYSA-N n-methyl-2-(3-phenyl-1,2-oxazol-5-yl)benzamide Chemical compound CNC(=O)C1=CC=CC=C1C1=CC(C=2C=CC=CC=2)=NO1 HSYAEFRDQRNICN-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229940125725 tranquilizer Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/549,934 US3987179A (en) | 1975-02-14 | 1975-02-14 | Isoxazolyl benzamides as pharmacological agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO760401L true NO760401L (enFirst) | 1976-08-17 |
Family
ID=24194993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO760401A NO760401L (enFirst) | 1975-02-14 | 1976-02-06 |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3987179A (enFirst) |
| JP (1) | JPS51105055A (enFirst) |
| AU (1) | AU1106076A (enFirst) |
| BE (1) | BE838509A (enFirst) |
| DE (1) | DE2604119A1 (enFirst) |
| DK (1) | DK48276A (enFirst) |
| ES (1) | ES445177A1 (enFirst) |
| FI (1) | FI760275A7 (enFirst) |
| FR (2) | FR2300560A1 (enFirst) |
| IL (1) | IL49022A0 (enFirst) |
| NL (1) | NL7601318A (enFirst) |
| NO (1) | NO760401L (enFirst) |
| PT (1) | PT64789B (enFirst) |
| SE (1) | SE7601274L (enFirst) |
| YU (1) | YU33476A (enFirst) |
| ZA (1) | ZA76859B (enFirst) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4112108A (en) * | 1976-12-06 | 1978-09-05 | Sandoz, Inc. | Isoxazolyl benzamides |
| US4140515A (en) * | 1977-05-12 | 1979-02-20 | Monsanto Company | Aryl-3-isoxazole benzoates as plant growth regulants and herbicides |
| US4135910A (en) * | 1977-05-12 | 1979-01-23 | Monsanto Company | Oxadiazol-3-yl-benzoates as plant growth regulants |
| US4268299A (en) * | 1978-08-17 | 1981-05-19 | Monsanto Company | Method and composition for plant growth regulation containing trifluoromethyl 1,3,4 oxadiazol benzoates |
| US4210762A (en) * | 1978-08-17 | 1980-07-01 | Monsanto Company | 2[5-(3-Trifluoromethylphenyl)-1,3,4-oxadiazol-2-yl] benzoates |
| US4229204A (en) * | 1978-12-04 | 1980-10-21 | Monsanto Company | Trifluoromethylphenyl isoxazolyl benzoates |
| US4727157A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-1,2,4-triazol-1-yl)methyl-2-methyl-5-[(substituted phenoxy)methyl]isoxazolidine derivatives |
| US4723021A (en) * | 1986-08-27 | 1988-02-02 | Pennwalt Corporation | Substituted 5-(phenoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769471A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-1,2,4-triazol-1-yl-methyl)-2-methylisoxazolidines |
| US4719306A (en) * | 1986-08-27 | 1988-01-12 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4831154A (en) * | 1987-04-10 | 1989-05-16 | Pennwalt Corporation | 5-alkyl(or alkenyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769468A (en) * | 1987-04-10 | 1988-09-06 | Penwalt Corporation | 5-(acyloxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4767867A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 5-(alkoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4727156A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-{[(substituted phenyl)thio]me}isoxazolidine derivatives |
| US4767866A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-1,2,4-triazol-1-ylmethyl)-2-methyl-5-alkylisoxazolidines |
| US4767868A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-[(phenylamino)methyl]isoxazolidines |
| US4769469A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-furanyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769470A (en) * | 1987-10-02 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-thienyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4777262A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-(substituted thiomethyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidine derivatives |
| US4777263A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-substituted-3-(2-naphthalenyl)-3-((1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl))-2-methylisoxazolidines |
| US4749793A (en) * | 1987-10-02 | 1988-06-07 | Pennwalt Corporation | 5-substituted-3-phenyl-3-[1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl]-2-benzylisoxazolidines (ir 3011) |
| US4785117A (en) * | 1987-10-02 | 1988-11-15 | Pennwalt Corporation | 5,5-disubstituted-3-phenyl-3-phenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2-methylisoxazolidine derivatives (IR 3012) |
| US4754042A (en) * | 1987-10-02 | 1988-06-28 | Pennwalt Corporation | 5-{[naphthyl(or 2-oxo-1,3-benzoxathiol-6-yl)oxy]methyl}-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4777264A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-carbonyl derivatives of 3-phenyl-3-(1H-imadazol-1-ylmethyl)-2-methylisoxazolidines and related compounds thereof |
| US4835283A (en) * | 1988-03-07 | 1989-05-30 | Pennwalt Corporation | 3,5-diphenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2 |
| JP2019526617A (ja) * | 2016-06-20 | 2019-09-19 | ラトガース ザ ステイト ユニバーシティー オブ ニュージャージー | 治療用化合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB974894A (en) * | 1961-04-06 | 1964-11-11 | Parke Davis & Co | Process for the production of amine compounds |
| US3772284A (en) * | 1966-12-20 | 1973-11-13 | American Cyanamid Co | Azirine compounds |
-
1975
- 1975-02-14 US US05/549,934 patent/US3987179A/en not_active Expired - Lifetime
-
1976
- 1976-02-04 DE DE2604119A patent/DE2604119A1/de active Pending
- 1976-02-05 FI FI760275A patent/FI760275A7/fi not_active Application Discontinuation
- 1976-02-05 SE SE7601274A patent/SE7601274L/xx unknown
- 1976-02-05 DK DK48276*#A patent/DK48276A/da unknown
- 1976-02-06 NO NO760401A patent/NO760401L/no unknown
- 1976-02-10 NL NL7601318A patent/NL7601318A/xx unknown
- 1976-02-11 FR FR7603746A patent/FR2300560A1/fr not_active Withdrawn
- 1976-02-12 JP JP51013340A patent/JPS51105055A/ja active Pending
- 1976-02-12 YU YU00334/76A patent/YU33476A/xx unknown
- 1976-02-12 BE BE164283A patent/BE838509A/xx unknown
- 1976-02-12 IL IL49022A patent/IL49022A0/xx unknown
- 1976-02-12 AU AU11060/76A patent/AU1106076A/en not_active Expired
- 1976-02-12 PT PT64789A patent/PT64789B/pt unknown
- 1976-02-13 ES ES445177A patent/ES445177A1/es not_active Expired
- 1976-02-13 ZA ZA760859A patent/ZA76859B/xx unknown
- 1976-07-22 US US05/707,681 patent/US4086243A/en not_active Expired - Lifetime
- 1976-07-23 FR FR7622493A patent/FR2326420A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| BE838509A (fr) | 1976-08-12 |
| FR2326420A1 (fr) | 1977-04-29 |
| FI760275A7 (enFirst) | 1976-08-15 |
| JPS51105055A (enFirst) | 1976-09-17 |
| IL49022A0 (en) | 1976-04-30 |
| US3987179A (en) | 1976-10-19 |
| ES445177A1 (es) | 1977-08-16 |
| FR2300560A1 (fr) | 1976-09-10 |
| AU1106076A (en) | 1977-08-18 |
| ZA76859B (en) | 1977-09-28 |
| PT64789A (fr) | 1976-03-01 |
| PT64789B (fr) | 1977-09-06 |
| NL7601318A (nl) | 1976-08-17 |
| SE7601274L (sv) | 1976-08-16 |
| DE2604119A1 (de) | 1976-08-26 |
| US4086243A (en) | 1978-04-25 |
| DK48276A (da) | 1976-08-15 |
| YU33476A (en) | 1982-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO760401L (enFirst) | ||
| NO148290B (no) | Analogifremgangsmaate ved fremstilling av nye terapeutisk aktive polyenforbindelser | |
| WO1994014777A1 (en) | Heterocyclic carbonic acid derivatives which bind to retinoid receptors (rar) | |
| NO142865B (no) | Analogifremgangsmaate ved fremstilling av nye terapeutisk aktive karbazoler | |
| NO148455B (no) | Fremgangsmaate ved fremstilling av diazepin-derivater | |
| NO146096B (no) | Analogifremgangsmaate ved fremstilling av thienothiazinderivater | |
| NO752493L (enFirst) | ||
| CA1217187A (en) | Thiazine derivatives | |
| EP0001601A1 (en) | Lactam compounds and methods for their preparation | |
| EP0090275B1 (en) | Isoxazole (5,4-b) pyridines | |
| NO157782B (no) | Analogifremgangsmte for fremstilling av terapeutisk aktive kondenserte as-triazinderivater med et pyridoringsystem hvor de to ringsystemer har et felles n-atom. | |
| HU182436B (en) | Process for producing 2,3,4,5-tetrahydro-1-benzoxepine-3,5-dion derivatives | |
| EP0396613A1 (en) | Cyano-dienes, halopyridines, intermediates and a process for their preparation | |
| NO830877L (no) | Tricykliske derivater av 5,6-dihydro-11h-dibenzo-(b,e)azepin-6-on med farmakologisk aktivitet og fremgangsmaate for deres fremstilling | |
| GB1561521A (en) | 3,4 - dihydro - 3 - oxo - 4-carbamoyl - 2h - thieno (2,3 - e) - 1 - 2-thiazine 1,1 - dioxide derivatives | |
| NO750278L (enFirst) | ||
| US2820031A (en) | Phenothiazinyl-alkanoic acid-alkyl amides | |
| US5290947A (en) | Process for the preparation of pyrrole derivates | |
| HU214086B (en) | Process for producing 3-isoxazolecarboxylic acid and intermediates thereof | |
| US3196161A (en) | Process for preparing alkyl 3-alkyl-isoxazole-5-carboxylate | |
| EP0454871B1 (en) | Alpha, beta-unsaturated ketone and ketoxime derivative | |
| NO855210L (no) | Fremgangsmaate ved fremstilling av n-substituerte aziridin-2-carboxylsyrederivater. | |
| HUT55372A (en) | Process for producing substituted isoxazole and isothiazole derivatives | |
| NO120733B (enFirst) | ||
| NO144099B (no) | Dyse for maskinell flammehoevling av enkelte defekter paa overflaten til et metallegeme |