NO325347B1 - Fremgangsmate for fremstilling av vinylacetat - Google Patents
Fremgangsmate for fremstilling av vinylacetat Download PDFInfo
- Publication number
- NO325347B1 NO325347B1 NO19995951A NO995951A NO325347B1 NO 325347 B1 NO325347 B1 NO 325347B1 NO 19995951 A NO19995951 A NO 19995951A NO 995951 A NO995951 A NO 995951A NO 325347 B1 NO325347 B1 NO 325347B1
- Authority
- NO
- Norway
- Prior art keywords
- reactor
- oxygen
- stream
- outlet stream
- oxygen concentration
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 39
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 title claims abstract description 24
- 230000008569 process Effects 0.000 title claims abstract description 10
- 238000002360 preparation method Methods 0.000 title description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 97
- 239000001301 oxygen Substances 0.000 claims abstract description 97
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 97
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 78
- 239000007789 gas Substances 0.000 claims abstract description 26
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000005977 Ethylene Substances 0.000 claims abstract description 20
- 239000003054 catalyst Substances 0.000 claims description 44
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 30
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 16
- 239000001569 carbon dioxide Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 11
- 238000000926 separation method Methods 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 238000006640 acetylation reaction Methods 0.000 claims description 7
- 238000004064 recycling Methods 0.000 claims description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- 230000021736 acetylation Effects 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 8
- 229910052751 metal Inorganic materials 0.000 description 8
- 239000002184 metal Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 238000004880 explosion Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 238000006137 acetoxylation reaction Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 3
- 229910052737 gold Inorganic materials 0.000 description 3
- 239000010931 gold Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- GPNDARIEYHPYAY-UHFFFAOYSA-N palladium(ii) nitrate Chemical compound [Pd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O GPNDARIEYHPYAY-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- 239000006200 vaporizer Substances 0.000 description 2
- WDJSTKACSQOTNH-UHFFFAOYSA-M C[Au+]C.CC([O-])=O Chemical compound C[Au+]C.CC([O-])=O WDJSTKACSQOTNH-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910003244 Na2PdCl4 Inorganic materials 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- FDWREHZXQUYJFJ-UHFFFAOYSA-M gold monochloride Chemical compound [Cl-].[Au+] FDWREHZXQUYJFJ-UHFFFAOYSA-M 0.000 description 1
- OTCKNHQTLOBDDD-UHFFFAOYSA-K gold(3+);triacetate Chemical compound [Au+3].CC([O-])=O.CC([O-])=O.CC([O-])=O OTCKNHQTLOBDDD-UHFFFAOYSA-K 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 238000001307 laser spectroscopy Methods 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- RFLFDJSIZCCYIP-UHFFFAOYSA-L palladium(2+);sulfate Chemical compound [Pd+2].[O-]S([O-])(=O)=O RFLFDJSIZCCYIP-UHFFFAOYSA-L 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 229910000364 palladium(II) sulfate Inorganic materials 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 230000005408 paramagnetism Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Substances [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910002093 potassium tetrachloropalladate(II) Inorganic materials 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/02—Esters of acyclic saturated monocarboxylic acids having the carboxyl group bound to an acyclic carbon atom or to hydrogen
- C07C69/12—Acetic acid esters
- C07C69/14—Acetic acid esters of monohydroxylic compounds
- C07C69/145—Acetic acid esters of monohydroxylic compounds of unsaturated alcohols
- C07C69/15—Vinyl acetate
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB9826754.5A GB9826754D0 (en) | 1998-12-04 | 1998-12-04 | Process for the production of vinyl acetate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO995951D0 NO995951D0 (no) | 1999-12-03 |
| NO995951L NO995951L (no) | 2000-06-05 |
| NO325347B1 true NO325347B1 (no) | 2008-04-07 |
Family
ID=10843702
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO19995951A NO325347B1 (no) | 1998-12-04 | 1999-12-03 | Fremgangsmate for fremstilling av vinylacetat |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US6258978B1 (ru) |
| EP (2) | EP1006100A1 (ru) |
| JP (1) | JP4614484B2 (ru) |
| KR (1) | KR100683460B1 (ru) |
| CN (1) | CN1173923C (ru) |
| BR (1) | BR9905772A (ru) |
| GB (1) | GB9826754D0 (ru) |
| ID (1) | ID23963A (ru) |
| MY (1) | MY122190A (ru) |
| NO (1) | NO325347B1 (ru) |
| RU (1) | RU2223941C2 (ru) |
| SA (1) | SA00200910B1 (ru) |
| SG (1) | SG88763A1 (ru) |
| TR (1) | TR199903032A3 (ru) |
| TW (1) | TW505628B (ru) |
| UA (1) | UA65568C2 (ru) |
| YU (1) | YU49281B (ru) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0014584D0 (en) * | 2000-06-14 | 2000-08-09 | Bp Chem Int Ltd | Apparatus and process |
| GB0014583D0 (en) * | 2000-06-14 | 2000-08-09 | Bp Chem Int Ltd | Process |
| GB0025081D0 (en) * | 2000-10-13 | 2000-11-29 | Bp Chem Int Ltd | Process for monitoring loss of reaction |
| DE10105528A1 (de) * | 2001-02-07 | 2002-08-08 | Basf Ag | Verfahren zur Online-Bestimmung von Wasserstoffperoxid |
| KR100887001B1 (ko) | 2001-03-30 | 2009-03-04 | 셀 인터나쵸나아레 레사아치 마아츠샤피 비이부이 | 8족 금속을 함유한 촉매의 제조방법과 알케닐카르복실레이트 제조 시의 용도 |
| JP4421201B2 (ja) | 2002-03-27 | 2010-02-24 | シエル・インターナシヨナル・リサーチ・マートスハツペイ・ベー・ヴエー | 触媒を調製する方法、触媒、および触媒の使用 |
| GB0223215D0 (en) * | 2002-10-07 | 2002-11-13 | Bp Chem Int Ltd | Processs |
| US6927393B2 (en) * | 2002-12-16 | 2005-08-09 | International Business Machines Corporation | Method of in situ monitoring of supercritical fluid process conditions |
| WO2004078698A1 (en) * | 2003-03-07 | 2004-09-16 | Showa Denko K.K. | Processes for the production of alkenyl esters of lower carboxylic acids and process for the production of alkenyl alcohols |
| TW201236755A (en) * | 2003-12-19 | 2012-09-16 | Celanese Int Corp | Halide free precursors for catalysts |
| KR100932575B1 (ko) * | 2004-12-20 | 2009-12-17 | 셀라니즈 인터내셔날 코포레이션 | 촉매용 개질된 지지체 물질 |
| US8227369B2 (en) | 2005-05-25 | 2012-07-24 | Celanese International Corp. | Layered composition and processes for preparing and using the composition |
| FR2886406B1 (fr) | 2005-05-31 | 2007-07-20 | Air Liquide | Procede de controle des risques d'explosion |
| DE102005054411A1 (de) * | 2005-11-15 | 2007-05-16 | Wacker Chemie Ag | Verfahren zur Herstellung von Vinylacetat unter Nutzung der dabei freiwerdenden Reaktionswärme |
| RU2009111878A (ru) * | 2006-09-01 | 2010-10-10 | Дау Глобал Текнолоджиз Инк. (Us) | Усовершенствованное управление и оптимизация процесса производства окиси этилена |
| DE102008001366A1 (de) * | 2008-04-24 | 2009-10-29 | Wacker Chemie Ag | Verfahren zur Herstellung von ungesättigten Carbonsäureestern |
| WO2009150208A1 (en) * | 2008-06-13 | 2009-12-17 | Shell Internationale Research Maatschappij B.V. | Method for measuring the selectivity of a process for the production of ethylene oxide |
| DE102009002666A1 (de) * | 2009-04-27 | 2010-10-28 | Wacker Chemie Ag | Verfahren zur Herstellung von Vinylacetat |
| US9352270B2 (en) | 2011-04-11 | 2016-05-31 | ADA-ES, Inc. | Fluidized bed and method and system for gas component capture |
| CN103121957B (zh) * | 2011-11-18 | 2015-07-08 | 中国石油化工股份有限公司 | 丙烯气相氧化法醋酸烯丙酯的制备方法 |
| SG11201501463QA (en) | 2012-09-06 | 2015-03-30 | Celanese Int Corp | Processes for producing vinyl acetate |
| IN2015DN02082A (ru) | 2012-09-20 | 2015-08-14 | Ada Es Inc | |
| DE102013225114A1 (de) * | 2013-12-06 | 2015-06-11 | Wacker Chemie Ag | Verfahren zur Herstellung von Vinylacetat mit inhibierter Nebenproduktbildung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2135006T3 (es) | 1994-06-02 | 1999-10-16 | Standard Oil Co Ohio | Procedimiento en lecho fluido para la acetoxilacion de etileno en la produccion de acetato de vinilo. |
| US5550281A (en) | 1994-06-02 | 1996-08-27 | Cirjak; Larry M. | Fluid bed process for the acetoxylation of ethylene in the production of vinyl acetate |
| GB9625599D0 (en) | 1996-12-10 | 1997-01-29 | Bp Chem Int Ltd | Process |
| EP0845453A3 (en) * | 1997-05-13 | 1998-09-09 | Celanese International Corporation | Safety system |
-
1998
- 1998-12-04 GB GBGB9826754.5A patent/GB9826754D0/en not_active Ceased
-
1999
- 1999-10-14 ID IDP991118A patent/ID23963A/id unknown
- 1999-11-04 EP EP99308800A patent/EP1006100A1/en not_active Ceased
- 1999-11-04 EP EP05077416A patent/EP1642882A3/en not_active Ceased
- 1999-11-05 US US09/434,180 patent/US6258978B1/en not_active Expired - Lifetime
- 1999-11-11 TW TW088119755A patent/TW505628B/zh not_active IP Right Cessation
- 1999-11-16 SG SG9905755A patent/SG88763A1/en unknown
- 1999-11-24 YU YU61099A patent/YU49281B/sh unknown
- 1999-12-01 BR BR9905772-7A patent/BR9905772A/pt not_active Application Discontinuation
- 1999-12-03 TR TR1999/03032A patent/TR199903032A3/tr unknown
- 1999-12-03 MY MYPI99005276A patent/MY122190A/en unknown
- 1999-12-03 NO NO19995951A patent/NO325347B1/no unknown
- 1999-12-03 KR KR1019990054800A patent/KR100683460B1/ko not_active IP Right Cessation
- 1999-12-03 JP JP34544599A patent/JP4614484B2/ja not_active Expired - Fee Related
- 1999-12-03 RU RU99125551/04A patent/RU2223941C2/ru not_active IP Right Cessation
- 1999-12-04 CN CNB991277880A patent/CN1173923C/zh not_active Expired - Fee Related
- 1999-12-06 UA UA99126624A patent/UA65568C2/ru unknown
-
2000
- 2000-01-31 SA SA00200910A patent/SA00200910B1/ar unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SG88763A1 (en) | 2002-05-21 |
| EP1006100A1 (en) | 2000-06-07 |
| EP1642882A2 (en) | 2006-04-05 |
| EP1642882A3 (en) | 2007-07-25 |
| KR100683460B1 (ko) | 2007-02-20 |
| TR199903032A2 (xx) | 2000-07-21 |
| UA65568A (en) | 2001-03-15 |
| TR199903032A3 (tr) | 2000-07-21 |
| GB9826754D0 (en) | 1999-01-27 |
| KR20000047904A (ko) | 2000-07-25 |
| CN1173923C (zh) | 2004-11-03 |
| US6258978B1 (en) | 2001-07-10 |
| ID23963A (id) | 1999-12-03 |
| BR9905772A (pt) | 2000-08-15 |
| TW505628B (en) | 2002-10-11 |
| UA65568C2 (ru) | 2004-04-15 |
| NO995951L (no) | 2000-06-05 |
| YU61099A (sh) | 2001-03-07 |
| NO995951D0 (no) | 1999-12-03 |
| MY122190A (en) | 2006-03-31 |
| RU2223941C2 (ru) | 2004-02-20 |
| JP2000169430A (ja) | 2000-06-20 |
| JP4614484B2 (ja) | 2011-01-19 |
| SA00200910B1 (ar) | 2006-11-11 |
| YU49281B (sh) | 2005-03-15 |
| CN1266051A (zh) | 2000-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO325347B1 (no) | Fremgangsmate for fremstilling av vinylacetat | |
| RU2276127C2 (ru) | Способ окисления с получением алкенов и карбоновых кислот | |
| AU615561B2 (en) | A process for producing ethylene oxide | |
| KR20080114746A (ko) | 아세트산 제조 방법 | |
| RU2275351C2 (ru) | Способ окисления с получением алкенов и карбоновых кислот | |
| KR20160065993A (ko) | 비닐 아세테이트 제조 방법 | |
| US20230312453A1 (en) | Methods and systems of monitoring flammability of various streams during vinyl acetate production | |
| EP4055066A1 (en) | Olefin polymerization processes | |
| RU2326106C2 (ru) | Способ получения монохлоруксусной кислоты | |
| EP0927712A1 (en) | Method for producing vinyl acetate | |
| RU2432350C2 (ru) | Способ получения винилацетата с использованием выделяющейся при этом теплоты реакции | |
| KR101131028B1 (ko) | 알케닐 카르복실레이트의 제조 방법 | |
| CA2349806A1 (en) | Process for the production of vinyl acetate | |
| WO2003076383A1 (en) | Process for vinyl acetate | |
| WO2024030439A1 (en) | Catalyst for olefin acetoxylation | |
| WO2024030440A1 (en) | Zone catalyst loading and processes for the acetoxylation of olefins using the same | |
| CN116897146A (zh) | 用于苯酚氢化的制程控制 | |
| NO303628B1 (no) | FremgangsmÕte for katalytisk omvandling i medstr°ms fluidisert sjikt av en sats som inneholder minst Ún oksygenert forbindelse | |
| CA2160180A1 (en) | Co-feed carboxylic acids for production of vinyl esters |