NO129574B - - Google Patents
Download PDFInfo
- Publication number
- NO129574B NO129574B NO04949/70A NO494970A NO129574B NO 129574 B NO129574 B NO 129574B NO 04949/70 A NO04949/70 A NO 04949/70A NO 494970 A NO494970 A NO 494970A NO 129574 B NO129574 B NO 129574B
- Authority
- NO
- Norway
- Prior art keywords
- imidazole
- methoxyphenyl
- general formula
- mol
- methoxy
- Prior art date
Links
- 150000002460 imidazoles Chemical class 0.000 claims description 38
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 35
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 26
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 16
- -1 methoxy, methyl Chemical group 0.000 claims description 15
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical class C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 claims description 14
- 229910021529 ammonia Inorganic materials 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 244000028419 Styrax benzoin Species 0.000 claims description 11
- 235000000126 Styrax benzoin Nutrition 0.000 claims description 11
- 235000008411 Sumatra benzointree Nutrition 0.000 claims description 11
- 235000019382 gum benzoic Nutrition 0.000 claims description 11
- 150000001408 amides Chemical class 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 8
- 150000007522 mineralic acids Chemical class 0.000 claims description 8
- 150000007524 organic acids Chemical class 0.000 claims description 8
- 229960002130 benzoin Drugs 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000001409 amidines Chemical class 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 140
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 90
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 69
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 63
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 47
- 239000000243 solution Substances 0.000 description 44
- FJJYHTVHBVXEEQ-UHFFFAOYSA-N 2,2-dimethylpropanal Chemical compound CC(C)(C)C=O FJJYHTVHBVXEEQ-UHFFFAOYSA-N 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 25
- 239000012074 organic phase Substances 0.000 description 21
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 229910052938 sodium sulfate Inorganic materials 0.000 description 17
- 235000011152 sodium sulphate Nutrition 0.000 description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 16
- LRRQSCPPOIUNGX-UHFFFAOYSA-N 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(O)C(=O)C1=CC=C(OC)C=C1 LRRQSCPPOIUNGX-UHFFFAOYSA-N 0.000 description 14
- 239000012362 glacial acetic acid Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000013078 crystal Substances 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 10
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 10
- 239000005695 Ammonium acetate Substances 0.000 description 10
- 235000019257 ammonium acetate Nutrition 0.000 description 10
- 229940043376 ammonium acetate Drugs 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 150000001299 aldehydes Chemical class 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- DHJPQGYNAQBXPM-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(C(C)C)=N1 DHJPQGYNAQBXPM-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- JGZFIOBCSICKSY-UHFFFAOYSA-N 2-ethyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound N1C(CC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 JGZFIOBCSICKSY-UHFFFAOYSA-N 0.000 description 7
- PVSFIFPJPUEHPO-UHFFFAOYSA-N 2-hydroxy-1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(O)C1=CC=CC=C1 PVSFIFPJPUEHPO-UHFFFAOYSA-N 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- YNANGXWUZWWFKX-UHFFFAOYSA-N 1,2-bis(4-methoxyphenyl)ethane-1,2-dione Chemical compound C1=CC(OC)=CC=C1C(=O)C(=O)C1=CC=C(OC)C=C1 YNANGXWUZWWFKX-UHFFFAOYSA-N 0.000 description 6
- NVZNVKJTLUTUAJ-UHFFFAOYSA-N 2-cyclopropyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(C2CC2)=N1 NVZNVKJTLUTUAJ-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 6
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- GUMFQJXMUNOZEP-UHFFFAOYSA-N 2-hexyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound N1C(CCCCCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 GUMFQJXMUNOZEP-UHFFFAOYSA-N 0.000 description 4
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 4
- ISONGNDTFFCHMJ-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-(2-methylpropyl)-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(CC(C)C)=N1 ISONGNDTFFCHMJ-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 4
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 4
- JARKCYVAAOWBJS-UHFFFAOYSA-N hexanal Chemical compound CCCCCC=O JARKCYVAAOWBJS-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000002916 oxazoles Chemical class 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- ARDGQYVTLGUJII-UHFFFAOYSA-N 2,2-dimethylpropanimidamide;hydrochloride Chemical compound Cl.CC(C)(C)C(N)=N ARDGQYVTLGUJII-UHFFFAOYSA-N 0.000 description 3
- TTYCODKHNAOVFU-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1CC(=O)C1=CC=C(S(C)(=O)=O)C=C1 TTYCODKHNAOVFU-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- BDASDVHPHQTGMG-UHFFFAOYSA-N 2-amino-1,2-bis(4-methoxyphenyl)ethanone;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C(N)C(=O)C1=CC=C(OC)C=C1 BDASDVHPHQTGMG-UHFFFAOYSA-N 0.000 description 3
- YGWYVIRARCVRET-UHFFFAOYSA-N 2-bromo-1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(Br)C1=CC=CC=C1 YGWYVIRARCVRET-UHFFFAOYSA-N 0.000 description 3
- DDSJFCSLUWYVTM-UHFFFAOYSA-N 2-butyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound N1C(CCCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 DDSJFCSLUWYVTM-UHFFFAOYSA-N 0.000 description 3
- GLWJDOUCFQNMER-UHFFFAOYSA-N 2-hydroxy-1-(4-methylsulfonylphenyl)-2-phenylethanone Chemical compound CS(=O)(=O)C1=CC=C(C=C1)C(=O)C(O)C1=CC=CC=C1 GLWJDOUCFQNMER-UHFFFAOYSA-N 0.000 description 3
- GZVUWANWWQXKQR-UHFFFAOYSA-N 2-methylpropanamide;hydrochloride Chemical compound Cl.CC(C)C(N)=O GZVUWANWWQXKQR-UHFFFAOYSA-N 0.000 description 3
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 description 3
- JMYVMOUINOAAPA-UHFFFAOYSA-N cyclopropanecarbaldehyde Chemical compound O=CC1CC1 JMYVMOUINOAAPA-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229940047889 isobutyramide Drugs 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- 229940080818 propionamide Drugs 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- NEQLCGUSTOFEFD-UHFFFAOYSA-N 2,2-dimethylpropanoylazanium;chloride Chemical compound Cl.CC(C)(C)C(N)=O NEQLCGUSTOFEFD-UHFFFAOYSA-N 0.000 description 2
- CCXHUQKDHUGOEZ-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-hydroxy-1-(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(O)C1=CC=C(Cl)C=C1 CCXHUQKDHUGOEZ-UHFFFAOYSA-N 0.000 description 2
- RSAXRWHPIVEYMZ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1CC(=O)C1=CC=C(SC)C=C1 RSAXRWHPIVEYMZ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- ZWTYFTZFNQFMOR-UHFFFAOYSA-N 2-cyclohexyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(C2CCCCC2)=N1 ZWTYFTZFNQFMOR-UHFFFAOYSA-N 0.000 description 2
- WZTKAOVLCWIEIR-UHFFFAOYSA-N 2-ethyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole Chemical compound O1C(CC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 WZTKAOVLCWIEIR-UHFFFAOYSA-N 0.000 description 2
- KUGQNTNSWGDRSB-UHFFFAOYSA-N 2-hexyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole Chemical compound O1C(CCCCCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 KUGQNTNSWGDRSB-UHFFFAOYSA-N 0.000 description 2
- MFJQOCLRVOJEER-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-(2-methylpentan-2-yl)-1h-imidazole Chemical compound N1C(C(C)(C)CCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 MFJQOCLRVOJEER-UHFFFAOYSA-N 0.000 description 2
- NYDMSYUOPYUSAH-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-pentyl-1h-imidazole Chemical compound N1C(CCCCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 NYDMSYUOPYUSAH-UHFFFAOYSA-N 0.000 description 2
- CIHBHXQBPOVNBT-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-propyl-1h-imidazole Chemical compound N1C(CCC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 CIHBHXQBPOVNBT-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- VYWQTJWGWLKBQA-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;chloride Chemical compound Cl.NC(N)=O VYWQTJWGWLKBQA-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000001741 anti-phlogistic effect Effects 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000004803 chlorobenzyl group Chemical group 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- JRYOZJIRAVZGMV-UHFFFAOYSA-N cyclopropanecarboximidamide;hydron;chloride Chemical compound Cl.NC(=N)C1CC1 JRYOZJIRAVZGMV-UHFFFAOYSA-N 0.000 description 2
- 229950001902 dimevamide Drugs 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- ZONYXWQDUYMKFB-UHFFFAOYSA-N flavanone Chemical compound O1C2=CC=CC=C2C(=O)CC1C1=CC=CC=C1 ZONYXWQDUYMKFB-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000006178 methyl benzyl group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VQZHHGTXTKDMEJ-UHFFFAOYSA-N 1,2-bis(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1CC(=O)C1=CC=C(C)C=C1 VQZHHGTXTKDMEJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JUNHDSMSCIIFNF-UHFFFAOYSA-N 1-(4-methylsulfonylphenyl)-2-phenylethanone Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C(=O)CC1=CC=CC=C1 JUNHDSMSCIIFNF-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- SEULWJSKCVACTH-UHFFFAOYSA-N 1-phenylimidazole Chemical compound C1=NC=CN1C1=CC=CC=C1 SEULWJSKCVACTH-UHFFFAOYSA-N 0.000 description 1
- YMXAGOUPXPGFLB-UHFFFAOYSA-N 2,2-dimethylpentanal Chemical compound CCCC(C)(C)C=O YMXAGOUPXPGFLB-UHFFFAOYSA-N 0.000 description 1
- NUBKYCCXDNYHLQ-UHFFFAOYSA-N 2,2-dimethylpentanoyl chloride Chemical compound CCCC(C)(C)C(Cl)=O NUBKYCCXDNYHLQ-UHFFFAOYSA-N 0.000 description 1
- FNHMJTUQUPQWJN-UHFFFAOYSA-N 2,2-dimethylpropanimidamide Chemical compound CC(C)(C)C(N)=N FNHMJTUQUPQWJN-UHFFFAOYSA-N 0.000 description 1
- FKMIBYMTHOJWCY-UHFFFAOYSA-N 2-(2-methylphenyl)acetyl chloride Chemical compound CC1=CC=CC=C1CC(Cl)=O FKMIBYMTHOJWCY-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- BGGKEDDFKBVTDK-UHFFFAOYSA-N 2-(3-methylphenyl)acetyl chloride Chemical compound CC1=CC=CC(CC(Cl)=O)=C1 BGGKEDDFKBVTDK-UHFFFAOYSA-N 0.000 description 1
- RXWOHFUULDINMC-UHFFFAOYSA-N 2-(3-nitrothiophen-2-yl)acetic acid Chemical compound OC(=O)CC=1SC=CC=1[N+]([O-])=O RXWOHFUULDINMC-UHFFFAOYSA-N 0.000 description 1
- CXJOONIFSVSFAD-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetyl chloride Chemical compound COC1=CC=C(CC(Cl)=O)C=C1 CXJOONIFSVSFAD-UHFFFAOYSA-N 0.000 description 1
- ANJBVUMIHGMCEW-UHFFFAOYSA-N 2-amino-1,2-bis(4-methylphenyl)ethanone hydrochloride Chemical compound Cl.NC(C(=O)C1=CC=C(C=C1)C)C1=CC=C(C=C1)C ANJBVUMIHGMCEW-UHFFFAOYSA-N 0.000 description 1
- LKPGGRAYFGWREN-UHFFFAOYSA-N 2-amino-1,2-diphenylethanone Chemical class C=1C=CC=CC=1C(N)C(=O)C1=CC=CC=C1 LKPGGRAYFGWREN-UHFFFAOYSA-N 0.000 description 1
- FXDIHYAWBSJIBD-UHFFFAOYSA-N 2-amino-1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(N)C1=CC=CC=C1 FXDIHYAWBSJIBD-UHFFFAOYSA-N 0.000 description 1
- BJCIJTYQFAOPCE-UHFFFAOYSA-N 2-bromo-1,2-bis(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(Br)C(=O)C1=CC=C(OC)C=C1 BJCIJTYQFAOPCE-UHFFFAOYSA-N 0.000 description 1
- XAJMXHOITUWTHR-UHFFFAOYSA-N 2-bromo-1,2-bis(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1C(Br)C(=O)C1=CC=C(C)C=C1 XAJMXHOITUWTHR-UHFFFAOYSA-N 0.000 description 1
- YEIJOVUUFJDUTH-UHFFFAOYSA-N 2-bromo-1-(4-hydroxyphenyl)-2-phenylethanone Chemical compound C1=CC(O)=CC=C1C(=O)C(Br)C1=CC=CC=C1 YEIJOVUUFJDUTH-UHFFFAOYSA-N 0.000 description 1
- JOSXNLMCTDEMRB-UHFFFAOYSA-N 2-bromo-1-(4-methylsulfonylphenyl)-2-phenylethanone Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C(=O)C(Br)C1=CC=CC=C1 JOSXNLMCTDEMRB-UHFFFAOYSA-N 0.000 description 1
- UWLWRHFQQNLQAQ-UHFFFAOYSA-N 2-bromo-2-(3-chlorophenyl)-1-(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(Br)C1=CC=CC(Cl)=C1 UWLWRHFQQNLQAQ-UHFFFAOYSA-N 0.000 description 1
- ZOZPMNXPSIOPIK-UHFFFAOYSA-N 2-bromo-2-(4-methoxyphenyl)-1-(4-methylsulfonylphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(Br)C(=O)C1=CC=C(S(C)(=O)=O)C=C1 ZOZPMNXPSIOPIK-UHFFFAOYSA-N 0.000 description 1
- CMUKLFHIVXQAQK-UHFFFAOYSA-N 2-bromo-2-(4-methoxyphenyl)-1-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(Br)C(=O)C1=CC=CC=C1 CMUKLFHIVXQAQK-UHFFFAOYSA-N 0.000 description 1
- UQZISIQJQLGQOD-UHFFFAOYSA-N 2-butan-2-yl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound N1C(C(C)CC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 UQZISIQJQLGQOD-UHFFFAOYSA-N 0.000 description 1
- NNLSZLIKQWMSNT-UHFFFAOYSA-N 2-chloro-1,2-bis(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1C(Cl)C(=O)C1=CC=C(C)C=C1 NNLSZLIKQWMSNT-UHFFFAOYSA-N 0.000 description 1
- OWEGHJZHCKGHFI-UHFFFAOYSA-N 2-chloro-1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(Cl)C1=CC=CC=C1 OWEGHJZHCKGHFI-UHFFFAOYSA-N 0.000 description 1
- KWONVZJFNURCKC-UHFFFAOYSA-N 2-chloro-1-(4-methylphenyl)-2-phenylethanone Chemical compound C1=CC(C)=CC=C1C(=O)C(Cl)C1=CC=CC=C1 KWONVZJFNURCKC-UHFFFAOYSA-N 0.000 description 1
- LYTGKNLOWWFYMR-UHFFFAOYSA-N 2-chloro-2-(4-methoxyphenyl)-1-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(Cl)C(=O)C1=CC=CC=C1 LYTGKNLOWWFYMR-UHFFFAOYSA-N 0.000 description 1
- KZGKXPYVHJQULV-UHFFFAOYSA-N 2-chloro-2-(4-methylphenyl)-1-phenylethanone Chemical compound C1=CC(C)=CC=C1C(Cl)C(=O)C1=CC=CC=C1 KZGKXPYVHJQULV-UHFFFAOYSA-N 0.000 description 1
- ORVCOWAYUJQKNM-UHFFFAOYSA-N 2-cyclobutyl-4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(C2CCC2)=N1 ORVCOWAYUJQKNM-UHFFFAOYSA-N 0.000 description 1
- VFMURISCPIJGJZ-UHFFFAOYSA-N 2-cyclopropyl-4,5-bis(4-methoxyphenyl)-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)OC(C2CC2)=N1 VFMURISCPIJGJZ-UHFFFAOYSA-N 0.000 description 1
- BKJGIMONRMAFOF-UHFFFAOYSA-N 2-cyclopropyl-4-(4-methoxyphenyl)-5-phenyl-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(C2CC2)=N1 BKJGIMONRMAFOF-UHFFFAOYSA-N 0.000 description 1
- FHIATTMLFDJJKY-UHFFFAOYSA-N 2-hydroxy-1-(4-hydroxyphenyl)-2-phenylethanone Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=C(O)C=C1 FHIATTMLFDJJKY-UHFFFAOYSA-N 0.000 description 1
- WMCVFMKPQZDWLA-UHFFFAOYSA-N 2-hydroxyimino-1,2-bis(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1C(=O)C(=NO)C1=CC=C(C)C=C1 WMCVFMKPQZDWLA-UHFFFAOYSA-N 0.000 description 1
- SDDQJPHXDSRUQR-UHFFFAOYSA-N 2-hydroxyimino-1-(4-methoxyphenyl)-2-phenylethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C(=NO)C1=CC=CC=C1 SDDQJPHXDSRUQR-UHFFFAOYSA-N 0.000 description 1
- BQZJOQXSCSZQPS-UHFFFAOYSA-N 2-methoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC)C(=O)C1=CC=CC=C1 BQZJOQXSCSZQPS-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PFCHFHIRKBAQGU-UHFFFAOYSA-N 3-hexanone Chemical compound CCCC(=O)CC PFCHFHIRKBAQGU-UHFFFAOYSA-N 0.000 description 1
- SYMBJSDZFDGMCY-UHFFFAOYSA-N 3-methylbutanimidamide;hydrochloride Chemical compound Cl.CC(C)CC(N)=N SYMBJSDZFDGMCY-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- FSCGNGGWXWAOQH-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-(2-methylpropyl)-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)OC(CC(C)C)=N1 FSCGNGGWXWAOQH-UHFFFAOYSA-N 0.000 description 1
- DVXGPBVVFIKFTJ-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-pentan-3-yl-1h-imidazole Chemical compound N1C(C(CC)CC)=NC(C=2C=CC(OC)=CC=2)=C1C1=CC=C(OC)C=C1 DVXGPBVVFIKFTJ-UHFFFAOYSA-N 0.000 description 1
- YQKGGVPUOMENQF-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)OC(C(C)C)=N1 YQKGGVPUOMENQF-UHFFFAOYSA-N 0.000 description 1
- DIBXSCRTXGVRFD-UHFFFAOYSA-N 4-(1H-imidazol-2-yl)phenol Chemical compound C1=CC(O)=CC=C1C1=NC=CN1 DIBXSCRTXGVRFD-UHFFFAOYSA-N 0.000 description 1
- GXHPWLWFNCEJGM-UHFFFAOYSA-N 4-(4-methoxyphenyl)-5-phenyl-2-propan-2-yl-1,3-oxazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)OC(C(C)C)=N1 GXHPWLWFNCEJGM-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- FCPUUXYTTKEDAO-UHFFFAOYSA-N CCC(CS(O)(=O)=O)(N=C1C(C=C2)=CC=C2OC)N=C1C(C=C1)=CC=C1OC Chemical compound CCC(CS(O)(=O)=O)(N=C1C(C=C2)=CC=C2OC)N=C1C(C=C1)=CC=C1OC FCPUUXYTTKEDAO-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- SKQJHRFYAAZVGT-UHFFFAOYSA-N Cl.C(C)(C)C=1NC(=C(N1)C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC Chemical compound Cl.C(C)(C)C=1NC(=C(N1)C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC SKQJHRFYAAZVGT-UHFFFAOYSA-N 0.000 description 1
- HFWJRHLHOJUFPE-UHFFFAOYSA-N Cl.NC(C(=O)C1=CC=C(C=C1)S(=O)(=O)C)C1=CC=CC=C1 Chemical compound Cl.NC(C(=O)C1=CC=C(C=C1)S(=O)(=O)C)C1=CC=CC=C1 HFWJRHLHOJUFPE-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001262 acyl bromides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- BWFPGXWASODCHM-UHFFFAOYSA-N copper monosulfide Chemical compound [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- VELDYOPRLMJFIK-UHFFFAOYSA-N cyclopentanecarbaldehyde Chemical compound O=CC1CCCC1 VELDYOPRLMJFIK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- AEDIXYWIVPYNBI-UHFFFAOYSA-N heptanamide Chemical compound CCCCCCC(N)=O AEDIXYWIVPYNBI-UHFFFAOYSA-N 0.000 description 1
- NKYHMYSXBKNXTL-UHFFFAOYSA-N heptanimidamide;hydrochloride Chemical compound Cl.CCCCCCC(N)=N NKYHMYSXBKNXTL-UHFFFAOYSA-N 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- DFWRZHZPJJAJMX-UHFFFAOYSA-N propanimidamide;hydrochloride Chemical compound Cl.CCC(N)=N DFWRZHZPJJAJMX-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical class Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1940169A CH523257A (de) | 1969-12-31 | 1969-12-31 | Verfahren zur Herstellung von neuen Imidazolderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO129574B true NO129574B (nl) | 1974-04-29 |
Family
ID=4439206
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO04949/70A NO129574B (nl) | 1969-12-31 | 1970-12-23 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3784691A (nl) |
| JP (1) | JPS5123506B1 (nl) |
| BE (1) | BE761053A (nl) |
| CA (1) | CA960679A (nl) |
| CH (5) | CH523257A (nl) |
| DE (1) | DE2064520C3 (nl) |
| DK (1) | DK129346B (nl) |
| GB (1) | GB1328550A (nl) |
| IL (1) | IL35935A (nl) |
| NL (1) | NL167691C (nl) |
| NO (1) | NO129574B (nl) |
| SE (1) | SE368574B (nl) |
| ZA (1) | ZA708741B (nl) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2430978A1 (de) * | 1973-06-28 | 1975-01-23 | Dumex Ltd As | Neue imidazolderivate, deren salze und verfahren zu deren herstellung |
| JPS51144315A (en) * | 1975-06-09 | 1976-12-11 | Nippon Steel Corp | A method of installation of water cooling pipe for heating furnaces |
| FR2350839A1 (fr) * | 1976-05-13 | 1977-12-09 | Farmatis Srl | Nouveau compose imidazolique, procede pour sa preparation et compositions therapeutiques qui les contiennent |
| EP0085756A1 (en) * | 1982-02-10 | 1983-08-17 | American Cyanamid Company | Process for preparing 1-substituted-6-n-propyl-8-methylimidazo(1,5-d)-as-triazin-4(3H)-ones |
| US4503065A (en) * | 1982-08-03 | 1985-03-05 | E. I. Du Pont De Nemours And Company | Antiinflammatory 4,5-diaryl 1-2-halo imidazoles |
| TW587079B (en) * | 1998-09-25 | 2004-05-11 | Almirall Prodesfarma Ag | 2-phenylpyran-4-one derivatives |
| PE20011333A1 (es) | 2000-03-16 | 2002-01-16 | Almirall Prodesfarma Ag | Derivados de 2-fenilpiran-4-ona como inhibidores de ciclooxigenasa 2 |
| DE102014214682A1 (de) * | 2014-07-25 | 2016-01-28 | Evonik Degussa Gmbh | Vereinfachtes Verfahren zur Synthese von Heterozyklen |
-
1969
- 1969-12-31 CH CH1940169A patent/CH523257A/de not_active IP Right Cessation
- 1969-12-31 CH CH593472A patent/CH524612A/de not_active IP Right Cessation
- 1969-12-31 CH CH593572A patent/CH524613A/de not_active IP Right Cessation
- 1969-12-31 CH CH593372A patent/CH524611A/de not_active IP Right Cessation
- 1969-12-31 CH CH593672A patent/CH524614A/de not_active IP Right Cessation
-
1970
- 1970-12-17 GB GB5983870A patent/GB1328550A/en not_active Expired
- 1970-12-23 SE SE17498/70A patent/SE368574B/xx unknown
- 1970-12-23 NL NL7018745A patent/NL167691C/nl not_active IP Right Cessation
- 1970-12-23 DK DK655470AA patent/DK129346B/da unknown
- 1970-12-23 NO NO04949/70A patent/NO129574B/no unknown
- 1970-12-30 CA CA101,707A patent/CA960679A/en not_active Expired
- 1970-12-30 JP JP45123140A patent/JPS5123506B1/ja active Pending
- 1970-12-30 ZA ZA708741A patent/ZA708741B/xx unknown
- 1970-12-30 IL IL35935A patent/IL35935A/en unknown
- 1970-12-30 BE BE761053A patent/BE761053A/xx unknown
- 1970-12-30 DE DE2064520A patent/DE2064520C3/de not_active Expired
-
1972
- 1972-08-23 US US00283135A patent/US3784691A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH524611A (de) | 1972-06-30 |
| CH524614A (de) | 1972-06-30 |
| DE2064520A1 (de) | 1971-07-08 |
| IL35935A (en) | 1974-11-29 |
| ZA708741B (en) | 1971-10-27 |
| US3784691A (en) | 1974-01-08 |
| DE2064520C3 (de) | 1980-05-22 |
| NL7018745A (nl) | 1971-07-02 |
| CH523257A (de) | 1972-05-31 |
| SE368574B (nl) | 1974-07-08 |
| CA960679A (en) | 1975-01-07 |
| BE761053A (fr) | 1971-06-30 |
| CH524613A (de) | 1972-06-30 |
| DK129346C (nl) | 1975-02-17 |
| DK129346B (da) | 1974-09-30 |
| IL35935A0 (en) | 1971-02-25 |
| NL167691B (nl) | 1981-08-17 |
| DE2064520B2 (de) | 1979-08-30 |
| CH524612A (de) | 1972-06-30 |
| NL167691C (nl) | 1982-01-18 |
| JPS5123506B1 (nl) | 1976-07-17 |
| GB1328550A (en) | 1973-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3901908A (en) | 2-alkyl- and 2-cycloalkyl-4,5-bis-phenyl-imidazoles | |
| US4351841A (en) | Pharmaceutical preparation and method of treatment | |
| AU626863B2 (en) | Known and selected novel arylmethylenyl derivatives of thiazolidinones, imidazolidinones and oxazolidinones useful as antiallergy agents and antiinflammatory agents | |
| US4355040A (en) | Hypotensive imidazole-5-acetic acid derivatives | |
| DE69116909T2 (de) | 3,5-Di-tertiärbutyl-4-hydroxyphenylmethylenderivate von 2-substituierten Thiazolidinonen, Oxazolidinonen und Imidazolidinonen als antientzündlich wirkende Mittel | |
| US3679698A (en) | 2-nitroimidazoles | |
| NO172236B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive diaryl-3-substituerte pyrazoler | |
| Toja et al. | 3-Alkyl-2-aryl-3H-naphth [1, 2-d] imidazoles, a novel class of nonacidic antiinflammatory agents | |
| DD148773A5 (de) | Verfahren zur herstellung von imidazol-derivaten | |
| EP1091943A1 (en) | Non-peptidyl inhibitors of vla-4 dependent cell binding useful in treating inflammatory, autoimmune, and respiratory diseases | |
| PT78195B (en) | Process for the preparation of imidazolines and related compounds | |
| NO129574B (nl) | ||
| DE1946370A1 (de) | Pyrazolderivate und Verfahren zu ihrer Herstellung | |
| US4556671A (en) | Pharmaceutical formulations | |
| US3966966A (en) | Pharmaceutical compositions and method of treatment employing 1,3-dioxo-2,2-disubstituted indanyloxy alkanoic acids | |
| IL30426A (en) | 5-aroyl-pyrrole derivatives,their preparation and pharmaceutical preparations containing them | |
| US3250761A (en) | New sulfonamides | |
| IL44311A (en) | Alpha-(5-oxo-10,11-dihydrodibenzo (a,d) cyclohepten-2-yl)-alkanoic acid derivatives processes for their preparation and pharmaceutical compositions containing them | |
| IE47784B1 (en) | 4-pyridone-3-carboxylic acid derivatives | |
| US3976681A (en) | [1,3-Dioxo-2-substituted and 2,2-disubstituted- indanyloxy (or thio] alkanoic acids | |
| US4940790A (en) | 5-(3-alkyl-5-tert.butyl-4-hydroxyphenyl)-2-amino-6H-1,3,4-thiadiazines | |
| HU189296B (en) | Process for producing oxazole-4-acetic acid derivatives | |
| JPH01242577A (ja) | 抗関節炎性イソキサゾール―４―カルボキシアミド | |
| US3676463A (en) | Oxobenzofuran carboxamides | |
| US3657229A (en) | 1 3-diaza-2 3-cycloalkene derivatives |