NO118487B - - Google Patents
Download PDFInfo
- Publication number
- NO118487B NO118487B NO149701A NO14970163A NO118487B NO 118487 B NO118487 B NO 118487B NO 149701 A NO149701 A NO 149701A NO 14970163 A NO14970163 A NO 14970163A NO 118487 B NO118487 B NO 118487B
- Authority
- NO
- Norway
- Prior art keywords
- dibenzo
- compounds
- alkyl
- cycloheptene
- general formulas
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 22
- -1 1-piperidyl - Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 230000001430 anti-depressive effect Effects 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical class C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 150000004795 grignard reagents Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- HYKKSGGCBKGVQG-UHFFFAOYSA-N 2-bromo-5,6-dihydrodibenzo[3,1-[7]annulen-11-one Chemical compound C1CC2=CC=CC=C2C(=O)C2=CC(Br)=CC=C21 HYKKSGGCBKGVQG-UHFFFAOYSA-N 0.000 description 3
- RYMQWZPAZBQXMX-UHFFFAOYSA-N 2-bromodibenzo[1,3-e:1',2'-f][7]annulen-11-one Chemical compound C1=CC2=CC=CC=C2C(=O)C2=CC(Br)=CC=C21 RYMQWZPAZBQXMX-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- UZURNLLVSHDOKL-UHFFFAOYSA-N n,n-dimethyl-3-(2-methylsulfonyldibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene)propan-1-amine Chemical compound C1=CC2=CC=C(S(C)(=O)=O)C=C2C(=CCCN(C)C)C2=CC=CC=C21 UZURNLLVSHDOKL-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- SUKICQALNDPAMM-UHFFFAOYSA-N 2-chlorodibenzo[1,3-e:1',2'-f][7]annulen-11-one Chemical compound C1=CC2=CC=CC=C2C(=O)C2=CC(Cl)=CC=C21 SUKICQALNDPAMM-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JURKNVYFZMSNLP-UHFFFAOYSA-N cyclobenzaprine Chemical compound C1=CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 JURKNVYFZMSNLP-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/25—Sulfonic acids having sulfo groups bound to carbon atoms of rings other than six-membered aromatic rings of a carbon skeleton
- C07C309/26—Sulfonic acids having sulfo groups bound to carbon atoms of rings other than six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/25—Sulfonic acids having sulfo groups bound to carbon atoms of rings other than six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/20—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a ring other than a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21633962A | 1962-08-13 | 1962-08-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118487B true NO118487B (enExample) | 1970-01-05 |
Family
ID=22806658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO149701A NO118487B (enExample) | 1962-08-13 | 1963-08-12 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3275689A (enExample) |
| AT (1) | AT254165B (enExample) |
| CH (1) | CH444850A (enExample) |
| DE (1) | DE1668387C3 (enExample) |
| DK (2) | DK107160C (enExample) |
| ES (1) | ES291114A1 (enExample) |
| FI (1) | FI41392B (enExample) |
| FR (1) | FR3072M (enExample) |
| NL (1) | NL139181B (enExample) |
| NO (1) | NO118487B (enExample) |
| SE (2) | SE315585B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3981917A (en) * | 1963-07-25 | 1976-09-21 | Merck & Co., Inc. | Chemical compounds |
| US3478048A (en) * | 1965-01-08 | 1969-11-11 | Hoffmann La Roche | 2,3;3a,12b - tetrahydro - 8h - dibenzo (3,4;6,7)cyclohept(1,2-d)oxazoles and derivatives |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB646048A (en) * | 1943-10-07 | 1950-11-15 | Searle & Co | Dialkylaminoalkyl ethers of certain polynuclear compounds |
| US2557520A (en) * | 1949-02-18 | 1951-06-19 | Union Oil Co | Pesticidal compositions comprising an alkyl aryl sulfide |
| BE519805A (enExample) * | 1952-05-08 | |||
| US2761873A (en) * | 1953-11-04 | 1956-09-04 | Du Pont | Preparation of 4-substituted mercaptophenyl aldehydes and ketones |
| FR1186155A (fr) * | 1956-04-07 | 1959-08-17 | Rhone Poulenc Sa | Nouveaux dérivés de la méthanesulfonyl-3 phénothiazine et leur procédé de préparation |
| FR1186182A (fr) * | 1957-01-15 | 1959-08-17 | Rhone Poulenc Sa | Nouveaux dérivés nu-pipéraziniques substitués de la substituée-3 phénothiazine et leurs procédés de préparation |
| FR1212723A (fr) * | 1958-01-09 | 1960-03-25 | Rhone Poulenc Sa | Nouveaux dérivés de la phénothiazine à chaîne carbamoylpipérazine et leur préparation |
| GB858187A (en) * | 1958-04-03 | 1961-01-11 | Hoffmann La Roche | Novel dibenzocycloheptaenes and salts thereof and a process for the manufacture of same |
| GB858186A (en) * | 1958-04-03 | 1961-01-11 | Hoffmann La Roche | Novel dibenzoheptaenes and salts thereof and a process for the manufacture of same |
| US2944054A (en) * | 1958-09-30 | 1960-07-05 | Smith Kline French Lab | Substituted phenothiazinylalkyl aminosulfonylpiperazines |
| AT215424B (de) * | 1958-12-04 | 1961-06-12 | Kefalas As | Verfahren zur Herstellung von Xanthenen bzw. Thiaxanthenen |
| US3019266A (en) * | 1959-12-08 | 1962-01-30 | Gen Aniline & Film Corp | Nitrobenzylsulfonylethanol compounds |
| NL260070A (enExample) * | 1960-02-25 | |||
| US3121103A (en) * | 1961-10-20 | 1964-02-11 | Hoffmann La Roche | Aminobenzophenones |
| US3100802A (en) * | 1962-06-27 | 1963-08-13 | Dow Chemical Co | Aralkyl polythioethers |
| US3114777A (en) * | 1962-06-27 | 1963-12-17 | Dow Chemical Co | Tolyl bis thioethers |
| DE2649247C2 (de) * | 1976-10-29 | 1983-10-06 | Maschinenfabrik Reinhausen Gebrueder Scheubeck Gmbh & Co Kg, 8400 Regensburg | Lastwähler für Stufentransformatoren |
-
1963
- 1963-07-30 FI FI148463A patent/FI41392B/fi active
- 1963-08-01 DE DE1668387*CA patent/DE1668387C3/de not_active Expired
- 1963-08-06 AT AT633363A patent/AT254165B/de active
- 1963-08-12 NO NO149701A patent/NO118487B/no unknown
- 1963-08-13 DK DK386763A patent/DK107160C/da active
- 1963-08-13 CH CH1000763A patent/CH444850A/de unknown
- 1963-08-13 NL NL296584A patent/NL139181B/xx unknown
- 1963-08-13 ES ES0291114A patent/ES291114A1/es not_active Expired
- 1963-08-13 SE SE886063A patent/SE315585B/xx unknown
- 1963-11-08 US US32249863 patent/US3275689A/en not_active Expired - Lifetime
- 1963-11-09 FR FR953273A patent/FR3072M/fr not_active Expired
-
1964
- 1964-12-28 DK DK637264A patent/DK113993B/da unknown
-
1965
- 1965-06-29 SE SE859865A patent/SE315586B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE315585B (enExample) | 1969-10-06 |
| FR3072M (fr) | 1965-01-18 |
| SE315586B (enExample) | 1969-10-06 |
| NL139181B (nl) | 1973-06-15 |
| FI41392B (enExample) | 1969-07-31 |
| US3275689A (en) | 1966-09-27 |
| ES291114A1 (es) | 1964-01-01 |
| DE1668387C3 (de) | 1975-11-06 |
| DE1668387B2 (de) | 1975-03-13 |
| AT254165B (de) | 1967-05-10 |
| CH444850A (de) | 1967-10-15 |
| DE1668387A1 (de) | 1971-09-02 |
| DK113993B (da) | 1969-05-19 |
| DK107160C (da) | 1967-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3014911A (en) | Derivatives of dibenzo[a, e]cycloheptatriene | |
| NO141487B (no) | Traadloest informasjonstransmisjonssystem | |
| US3912743A (en) | 4-Phenylpiperidine compounds | |
| US3420851A (en) | Novel dibenzoxepines | |
| NO177590B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive cykliske aminforbindelser | |
| DE2814556A1 (de) | Substituierte phenylessigsaeurederivate und verfahren zu deren herstellung | |
| NO168795B (no) | Fiberoptisk undervannsledning for telekommunikasjonsformaal | |
| JPH0153671B2 (enExample) | ||
| NO178399B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 3-piperidino-4-hydroksykromanderivater og analoger derav | |
| US3309404A (en) | Derivatives of dibenzocycloheptenes and a process for their preparation | |
| US3491103A (en) | Certain 4h-benzo(4,5)cyclohepta-(1,2-b) thiophenes | |
| DE2257310A1 (de) | 3-substituierte alkenylenamine | |
| NO761304L (enExample) | ||
| IL40861A (en) | History of theapine and oxapine and their preparation | |
| NO118487B (enExample) | ||
| US3227716A (en) | Therapeutically-active dibenzocycloheptane derivatives | |
| FR2803593A1 (fr) | Nouvelles tetrahydropyridines, procede pour leur preparation et compositions pharmaceutiques les contenant | |
| GB2056435A (en) | Novel Tetrahydropyridine and Piperidine Substituted Benzofuranes and Related Compounds | |
| AT391865B (de) | Verfahren zur herstellung neuer benzothiophenderivate | |
| CH419172A (de) | Verfahren zur Herstellung basischer Dibenzooxepin- bzw. Dibenzo-thiepin-Derivate | |
| DK153843B (da) | Analogifremgangsmaade til fremstilling af 5-substituerede 10,11-dihydro-5h-dibenzooea,daacyclohepten-5,10-iminer eller salte deraf | |
| DK159110B (da) | 4h-benzo(4,5)cyclohepta(1,2-b)thiophenderivater, fremgangsmaade til fremstilling deraf samt farmaceutiske praeparater indeholdende derivaterne | |
| NO127447B (enExample) | ||
| US3428677A (en) | Chemical compounds and methods of preparing same | |
| US3306934A (en) | 5-(aminopropylidene)-and 5-hydroxy-5-(aminopropyl)-3-dialkylsulfamoyl-5h-dibenzo[a,d] cycloheptenes |