NO117362B - - Google Patents
Download PDFInfo
- Publication number
- NO117362B NO117362B NO154850A NO15485064A NO117362B NO 117362 B NO117362 B NO 117362B NO 154850 A NO154850 A NO 154850A NO 15485064 A NO15485064 A NO 15485064A NO 117362 B NO117362 B NO 117362B
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- benzenesulfonyl
- urea
- atoms
- melting point
- Prior art date
Links
- -1 cyclohexylethyl residue Chemical group 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 11
- 239000008280 blood Substances 0.000 claims description 9
- 210000004369 blood Anatomy 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 4
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- 238000002844 melting Methods 0.000 description 39
- 230000008018 melting Effects 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000004202 carbamide Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 235000013877 carbamide Nutrition 0.000 description 11
- SWSXEZOUBBVKCO-UHFFFAOYSA-N 1-isocyanato-4-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1 SWSXEZOUBBVKCO-UHFFFAOYSA-N 0.000 description 8
- QYKPRMWZTPVYJC-UHFFFAOYSA-N isocyanatocyclooctane Chemical compound O=C=NC1CCCCCCC1 QYKPRMWZTPVYJC-UHFFFAOYSA-N 0.000 description 8
- 239000000155 melt Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 150000003672 ureas Chemical class 0.000 description 4
- JSWGFMIENIJRKM-UHFFFAOYSA-N N-cyclohexyl-2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]acetamide Chemical compound C1(CCCCC1)NC(=O)CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 JSWGFMIENIJRKM-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical class NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000008331 benzenesulfonamides Chemical class 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001714 carbamic acid halides Chemical class 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- BSLKDFOQGDCAKJ-UHFFFAOYSA-N n,n-diethyl-4-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(S(N)(=O)=O)C=C1 BSLKDFOQGDCAKJ-UHFFFAOYSA-N 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- LZULGYKMZVTUJA-UHFFFAOYSA-N 3-(4-methylcyclohexyl)-1,1-diphenylurea Chemical compound C1(=CC=CC=C1)N(C(=O)NC1CCC(CC1)C)C1=CC=CC=C1 LZULGYKMZVTUJA-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 1
- JOMVGRRCEIJQFK-UHFFFAOYSA-N benzenesulfonylcarbamothioic s-acid Chemical class OC(=S)NS(=O)(=O)C1=CC=CC=C1 JOMVGRRCEIJQFK-UHFFFAOYSA-N 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical compound NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- XDMMMGGRRNTWML-UHFFFAOYSA-N cyclohexylazanium;acetate Chemical compound CC(O)=O.NC1CCCCC1 XDMMMGGRRNTWML-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VHJIYQBTRVEPQR-UHFFFAOYSA-N methyl n-cyclooctylcarbamate Chemical compound COC(=O)NC1CCCCCCC1 VHJIYQBTRVEPQR-UHFFFAOYSA-N 0.000 description 1
- QAXZWHGWYSJAEI-UHFFFAOYSA-N n,n-dimethylformamide;ethanol Chemical compound CCO.CN(C)C=O QAXZWHGWYSJAEI-UHFFFAOYSA-N 0.000 description 1
- FOZLEFALTUHOLA-UHFFFAOYSA-N n-cyclohexylcarbamoyl chloride Chemical compound ClC(=O)NC1CCCCC1 FOZLEFALTUHOLA-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003538 oral antidiabetic agent Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Seats For Vehicles (AREA)
- Load-Engaging Elements For Cranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF40828A DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117362B true NO117362B (Direct) | 1969-08-04 |
Family
ID=7098406
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO154850A NO117362B (Direct) | 1963-09-25 | 1964-09-22 | |
| NO154884A NO118547B (Direct) | 1963-09-25 | 1964-09-24 | |
| NO154883A NO117744B (Direct) | 1963-09-25 | 1964-09-24 | |
| NO154882A NO117851B (Direct) | 1963-09-25 | 1964-09-24 |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO154884A NO118547B (Direct) | 1963-09-25 | 1964-09-24 | |
| NO154883A NO117744B (Direct) | 1963-09-25 | 1964-09-24 | |
| NO154882A NO117851B (Direct) | 1963-09-25 | 1964-09-24 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3336322A (Direct) |
| AT (4) | AT254892B (Direct) |
| BE (2) | BE653586A (Direct) |
| BR (1) | BR6462883D0 (Direct) |
| CH (5) | CH444840A (Direct) |
| DE (1) | DE1198354B (Direct) |
| DK (4) | DK119104B (Direct) |
| FI (1) | FI41023B (Direct) |
| FR (2) | FR1431690A (Direct) |
| GB (1) | GB1054758A (Direct) |
| IL (1) | IL22148A (Direct) |
| NO (4) | NO117362B (Direct) |
| SE (1) | SE310665B (Direct) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL141381B (nl) * | 1963-09-25 | 1974-03-15 | Hoechst Ag | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende werkzaamheid. |
| US3424749A (en) * | 1965-06-23 | 1969-01-28 | Heinz A Pfenninger | Certain n-(benzenesulfonyl) pipecolinic acids and lower alkyl esters thereof |
| DE2951135A1 (de) * | 1979-12-19 | 1981-06-25 | Hoechst Ag, 6230 Frankfurt | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
| DE19505397A1 (de) * | 1995-02-17 | 1996-08-22 | Hoechst Ag | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament oder Diagnostikum sowie sie enthaltendes Medikament |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
| ZA961314B (en) * | 1995-02-21 | 1996-08-27 | Hoechst Ag | Substituted benzenesulfonylureas and -thioreas processes for their preparation their use for the production of pharmaceutical preparations and medicaments containing them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR919464A (fr) * | 1944-12-28 | 1947-03-10 | Geigy Ag J R | Urées substituées et procédé de préparation de ces produits |
| US2964560A (en) * | 1955-11-28 | 1960-12-13 | Boehringer & Soehne Gmbh | Orally effective compounds for treating diabetes and a process of making same |
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| GB831044A (en) * | 1959-03-05 | 1960-03-23 | Boehringer & Soehne Gmbh | Benzene sulphonyl ureas |
-
1963
- 1963-09-25 DE DEF40828A patent/DE1198354B/de active Pending
-
1964
- 1964-03-31 GB GB1316564A patent/GB1054758A/en not_active Expired
- 1964-09-21 US US398106A patent/US3336322A/en not_active Expired - Lifetime
- 1964-09-22 NO NO154850A patent/NO117362B/no unknown
- 1964-09-23 CH CH1235664A patent/CH444840A/de unknown
- 1964-09-23 CH CH1558367A patent/CH451911A/de unknown
- 1964-09-23 CH CH1235364A patent/CH448052A/de unknown
- 1964-09-23 AT AT812964A patent/AT254892B/de active
- 1964-09-23 CH CH1235564A patent/CH448053A/de unknown
- 1964-09-23 AT AT813064A patent/AT253522B/de active
- 1964-09-23 CH CH1235464A patent/CH451111A/de unknown
- 1964-09-23 AT AT813164A patent/AT253523B/de active
- 1964-09-23 AT AT813264A patent/AT252934B/de active
- 1964-09-24 FI FI2028/64A patent/FI41023B/fi active
- 1964-09-24 DK DK470264AA patent/DK119104B/da unknown
- 1964-09-24 BR BR162883/64A patent/BR6462883D0/pt unknown
- 1964-09-24 DK DK470464AA patent/DK106793C/da active
- 1964-09-24 DK DK470564AA patent/DK109675C/da active
- 1964-09-24 DK DK470364AA patent/DK105642C/da active
- 1964-09-24 IL IL22148A patent/IL22148A/en unknown
- 1964-09-24 NO NO154884A patent/NO118547B/no unknown
- 1964-09-24 NO NO154883A patent/NO117744B/no unknown
- 1964-09-24 NO NO154882A patent/NO117851B/no unknown
- 1964-09-25 SE SE11511/64A patent/SE310665B/xx unknown
- 1964-09-25 FR FR989291A patent/FR1431690A/fr not_active Expired
- 1964-12-24 FR FR999884A patent/FR3940M/fr not_active Expired
-
1965
- 1965-03-25 BE BE653586A patent/BE653586A/xx unknown
- 1965-11-18 BE BE672496A patent/BE672496R/fr active
Also Published As
| Publication number | Publication date |
|---|---|
| SE310665B (Direct) | 1969-05-12 |
| AT253522B (de) | 1967-04-10 |
| BR6462883D0 (pt) | 1973-08-07 |
| DE1198354B (de) | 1965-08-12 |
| DK119104B (da) | 1970-11-16 |
| CH448052A (de) | 1967-12-15 |
| CH451911A (de) | 1968-05-15 |
| GB1054758A (Direct) | 1967-01-11 |
| NO117744B (Direct) | 1969-09-22 |
| BE653586A (Direct) | 1965-03-25 |
| BE672496R (fr) | 1966-03-16 |
| US3336322A (en) | 1967-08-15 |
| CH451111A (de) | 1968-05-15 |
| NO117851B (Direct) | 1969-10-06 |
| DK109675C (da) | 1968-06-04 |
| CH444840A (de) | 1967-10-15 |
| AT252934B (de) | 1967-03-10 |
| DK106793C (da) | 1967-03-20 |
| AT254892B (de) | 1967-06-12 |
| CH448053A (de) | 1967-12-15 |
| FR1431690A (fr) | 1966-03-18 |
| NO118547B (Direct) | 1970-01-12 |
| FR3940M (Direct) | 1966-03-28 |
| FI41023B (Direct) | 1969-04-30 |
| AT253523B (de) | 1967-04-10 |
| DK105642C (da) | 1966-10-24 |
| IL22148A (en) | 1968-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3507961A (en) | Benzenesulfonyl ureas as anti-diabetic agents | |
| NO159166B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive benzoazepinderivater. | |
| NO155188B (no) | Bevegelig fottrinn for et kjoeretoey. | |
| US3507954A (en) | Benzenesulfonyl-ureas as anti-diabetic agents | |
| NO162257B (no) | Fremgangm te for flytendegjoering av naturgass samtur dertil. | |
| NO155290B (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme sulfonylurinstoffderivater. | |
| NO159754B (no) | Fremgangsmaate for bestemmelse av karsinoembryonalt antigen (cea). | |
| NO151837B (no) | Anordning ved fagverk for bruk under bygging av bygninger og andre konstruksjoner | |
| NO171025B (no) | Takplate | |
| NO145805B (no) | Tannhjulsdrev. | |
| NO154882B (no) | Fremgangsmaate for fremstilling av 2-(2-(1,4-benzodioksanyl)) -2-imidazolin. | |
| NO163432B (no) | Fremgangsmaate for fremstilling av frisk ost. | |
| NO159998B (no) | Analogifremgangsmaate ved fremstilling av et nytt terapeutisk aktivtsulfonamidderivat. | |
| NO171182B (no) | Vandig geldannende blanding egnet for selektiv permeabilitetsmodifikasjon av underjordiske lag ved hydrokarbonutvinning | |
| NO163506B (no) | Montering av senkbar tildekning ved lysarmatur. | |
| NO122920B (Direct) | ||
| US3336322A (en) | Benzenesulfonyl ureas and process for their manufacture | |
| US3435116A (en) | The treatment of diabetes mellitus with benzenesulfonyl ureas | |
| US3705151A (en) | Benzene-sulfonyl semicarbazides and process for preparing them | |
| US3546234A (en) | Benzene-sulfonyl-semicarbazides | |
| NO168334B (no) | Leddet kopling med styrt bevegelse for understoettelse av boelgeleder og kabling | |
| NO165846B (no) | Vinylkloridmateriale, samt fremgangsmaate for fremstillingav et slikt. | |
| NO122417B (Direct) | ||
| US3510496A (en) | Benzenesulfonyl-ureas with hypoglycemic activity | |
| IL25534A (en) | Benzene-sulfonyl semicarbazides and process for preparing them |