KR20170135938A - 브로모도메인 억제제 - Google Patents
브로모도메인 억제제 Download PDFInfo
- Publication number
- KR20170135938A KR20170135938A KR1020177032364A KR20177032364A KR20170135938A KR 20170135938 A KR20170135938 A KR 20170135938A KR 1020177032364 A KR1020177032364 A KR 1020177032364A KR 20177032364 A KR20177032364 A KR 20177032364A KR 20170135938 A KR20170135938 A KR 20170135938A
- Authority
- KR
- South Korea
- Prior art keywords
- alkyl
- hydrogen
- formula
- heterocyclyl
- heteroaryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 102000001805 Bromodomains Human genes 0.000 title abstract description 43
- 108050009021 Bromodomains Proteins 0.000 title abstract description 27
- 239000003112 inhibitor Substances 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 506
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 192
- 239000000203 mixture Substances 0.000 claims abstract description 152
- 238000000034 method Methods 0.000 claims abstract description 83
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 34
- 201000011510 cancer Diseases 0.000 claims abstract description 33
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 30
- 108010033040 Histones Proteins 0.000 claims abstract description 23
- 201000010099 disease Diseases 0.000 claims abstract description 21
- 230000001613 neoplastic effect Effects 0.000 claims abstract description 10
- -1 2-ethyl-5- (methylsulfonyl) benzofuran-7-yl Chemical group 0.000 claims description 316
- 125000000217 alkyl group Chemical group 0.000 claims description 315
- 229910052739 hydrogen Inorganic materials 0.000 claims description 228
- 239000001257 hydrogen Substances 0.000 claims description 227
- 229910052736 halogen Inorganic materials 0.000 claims description 205
- 150000002367 halogens Chemical class 0.000 claims description 204
- 150000003839 salts Chemical class 0.000 claims description 203
- 125000001072 heteroaryl group Chemical group 0.000 claims description 155
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 146
- 125000003118 aryl group Chemical group 0.000 claims description 139
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 135
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 131
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 131
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 126
- 125000003545 alkoxy group Chemical group 0.000 claims description 99
- 229910052757 nitrogen Inorganic materials 0.000 claims description 94
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 56
- 239000008194 pharmaceutical composition Substances 0.000 claims description 50
- 125000004434 sulfur atom Chemical group 0.000 claims description 45
- 229910052717 sulfur Inorganic materials 0.000 claims description 40
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 38
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 38
- 125000000304 alkynyl group Chemical group 0.000 claims description 37
- 125000003342 alkenyl group Chemical group 0.000 claims description 33
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 31
- 125000005357 cycloalkylalkynyl group Chemical group 0.000 claims description 29
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 25
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 13
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 13
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 12
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 12
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 10
- 230000002401 inhibitory effect Effects 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 125000005114 heteroarylalkoxy group Chemical group 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 6
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 6
- 125000004104 aryloxy group Chemical group 0.000 claims description 6
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 claims description 6
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 6
- 125000005605 benzo group Chemical group 0.000 claims description 5
- 102000004190 Enzymes Human genes 0.000 claims description 3
- 108090000790 Enzymes Proteins 0.000 claims description 3
- PYHQYFBCYJDDIJ-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-methoxybenzimidazol-4-yl]methanesulfonamide Chemical compound COC1=NC2=C(NS(C)(=O)=O)C=C(C=C2N1CC1CC1)C1=CN(C)C(=O)C(C)=C1 PYHQYFBCYJDDIJ-UHFFFAOYSA-N 0.000 claims description 3
- BEARFMQOFNAZGQ-UHFFFAOYSA-N N-[1-benzyl-6-(2-methyl-1-oxoisoquinolin-4-yl)indol-4-yl]methanesulfonamide Chemical compound CN1C=C(C2=CC(NS(C)(=O)=O)=C3C=CN(CC4=CC=CC=C4)C3=C2)C2=C(C=CC=C2)C1=O BEARFMQOFNAZGQ-UHFFFAOYSA-N 0.000 claims description 3
- IPDVTHZWXBGFMH-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-methyl-1-(1-phenylethyl)benzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C(=N2)C)C(C)C2=CC=CC=C2)C=1)NS(=O)(=O)C IPDVTHZWXBGFMH-UHFFFAOYSA-N 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 claims description 3
- JTBBWRKSUYCPFY-UHFFFAOYSA-N 2,3-dihydro-1h-pyrimidin-4-one Chemical compound O=C1NCNC=C1 JTBBWRKSUYCPFY-UHFFFAOYSA-N 0.000 claims description 2
- NUFBGWIIBRJOFR-UHFFFAOYSA-N 2-methyl-4-(2-oxo-1,3-dihydroindol-6-yl)isoquinolin-1-one Chemical compound Cn1cc(-c2ccc3CC(=O)Nc3c2)c2ccccc2c1=O NUFBGWIIBRJOFR-UHFFFAOYSA-N 0.000 claims description 2
- AVRQZBKJBDYYDC-UHFFFAOYSA-N 4-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-2-methylisoquinolin-1-one Chemical compound Cn1cc(-c2ccc3OCCNc3c2)c2ccccc2c1=O AVRQZBKJBDYYDC-UHFFFAOYSA-N 0.000 claims description 2
- QLSPIGUYWQJFOU-UHFFFAOYSA-N 4-[5-(cyclopropylmethoxy)-2-ethyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC=1C(=CC2=C(CN(S2(=O)=O)CC)C=1)C1=CN(C(C2=CC=CC=C12)=O)C QLSPIGUYWQJFOU-UHFFFAOYSA-N 0.000 claims description 2
- PVWHOYFZJDGCRS-UHFFFAOYSA-N 4-[7-(cyclopropylmethoxy)-4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC1=CC2=C(N(CCO2)S(=O)(=O)CC)C=C1C1=CN(C(C2=CC=CC=C12)=O)C PVWHOYFZJDGCRS-UHFFFAOYSA-N 0.000 claims description 2
- AVKXANCJOSSNOQ-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-ethoxybenzimidazol-4-yl]methanesulfonamide Chemical compound CCOC1=NC2=C(NS(C)(=O)=O)C=C(C=C2N1CC1CC1)C1=CN(C)C(=O)C(C)=C1 AVKXANCJOSSNOQ-UHFFFAOYSA-N 0.000 claims description 2
- BYLPHHUERWNQGX-UHFFFAOYSA-N N-[1-benzyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)indol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(NS(C)(=O)=O)=C2C=CN(CC3=CC=CC=C3)C2=C1 BYLPHHUERWNQGX-UHFFFAOYSA-N 0.000 claims description 2
- PGDPQXDDOAIUHI-UHFFFAOYSA-N N-[1-benzyl-6-(2-methyl-1-oxoisoquinolin-4-yl)-2,3-dihydroindol-4-yl]methanesulfonamide Chemical compound C(C1=CC=CC=C1)N1CCC2=C(C=C(C=C12)C1=CN(C(C2=CC=CC=C12)=O)C)NS(=O)(=O)C PGDPQXDDOAIUHI-UHFFFAOYSA-N 0.000 claims description 2
- HVDXROCUEUZELK-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(3-fluorophenyl)methyl]benzimidazol-4-yl]ethanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C=N2)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)CC HVDXROCUEUZELK-UHFFFAOYSA-N 0.000 claims description 2
- 230000001973 epigenetic effect Effects 0.000 claims description 2
- 239000006186 oral dosage form Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 66
- BMVGRYYCVHUNTL-UHFFFAOYSA-N 4-(2-cyclopropyl-5-methylsulfonyl-1-benzofuran-7-yl)-2-methylisoquinolin-1-one Chemical compound CN1C=C(C2=C3OC(=CC3=CC(=C2)S(C)(=O)=O)C2CC2)C2=C(C=CC=C2)C1=O BMVGRYYCVHUNTL-UHFFFAOYSA-N 0.000 claims 2
- 230000001335 demethylating effect Effects 0.000 claims 2
- 239000003814 drug Substances 0.000 claims 2
- ADKKKJSPASMXOK-UHFFFAOYSA-N 2-methyl-4-(5-methylsulfonyl-2-phenyl-1-benzofuran-7-yl)isoquinolin-1-one Chemical compound CN1C(C2=CC=CC=C2C(=C1)C1=CC(=CC=2C=C(OC=21)C1=CC=CC=C1)S(=O)(=O)C)=O ADKKKJSPASMXOK-UHFFFAOYSA-N 0.000 claims 1
- BJRHTEAWPQRZIN-UHFFFAOYSA-N 4-[5-(cyclopropylmethoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC=1C=C2CCN(C2=CC=1C1=CN(C(C2=CC=CC=C12)=O)C)S(=O)(=O)CC BJRHTEAWPQRZIN-UHFFFAOYSA-N 0.000 claims 1
- DQJOEVBOJLGCJO-UHFFFAOYSA-N 4-[5-(cyclopropylmethoxy)-1-methylsulfonyl-2,3-dihydroindol-6-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC=1C=C2CCN(C2=CC=1C1=CN(C(C2=CC=CC=C12)=O)C)S(=O)(=O)C DQJOEVBOJLGCJO-UHFFFAOYSA-N 0.000 claims 1
- MSZYABAQZIIOQC-UHFFFAOYSA-N 4-[6-(cyclopropylmethoxy)-1-methyl-3-methylsulfonylindazol-5-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC1=C(C=C2C(=NN(C2=C1)C)S(=O)(=O)C)C1=CN(C(C2=CC=CC=C12)=O)C MSZYABAQZIIOQC-UHFFFAOYSA-N 0.000 claims 1
- AWTVHDWTTKQFKP-UHFFFAOYSA-N 4-[6-(cyclopropylmethoxy)-3-ethylsulfonyl-1-methylindazol-5-yl]-2-methylisoquinolin-1-one Chemical compound C1(CC1)COC1=C(C=C2C(=NN(C2=C1)C)S(=O)(=O)CC)C1=CN(C(C2=CC=CC=C12)=O)C AWTVHDWTTKQFKP-UHFFFAOYSA-N 0.000 claims 1
- ZKFVJZHIQVBDKB-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-(trifluoromethyl)benzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(NS(C)(=O)=O)=C2N=C(N(CC3CC3)C2=C1)C(F)(F)F ZKFVJZHIQVBDKB-UHFFFAOYSA-N 0.000 claims 1
- XTWBBCAPENQMBM-UHFFFAOYSA-N N-[1-[(2,4-difluorophenyl)methyl]-6-(1,5-dimethyl-6-oxopyridin-3-yl)benzimidazol-4-yl]ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=C2N=CN(CC3=C(F)C=C(F)C=C3)C2=CC(=C1)C1=CN(C)C(=O)C(C)=C1 XTWBBCAPENQMBM-UHFFFAOYSA-N 0.000 claims 1
- GTJDSWUDLHLJSK-UHFFFAOYSA-N N-[1-benzyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2,3-dihydroindol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(NS(C)(=O)=O)=C2CCN(CC3=CC=CC=C3)C2=C1 GTJDSWUDLHLJSK-UHFFFAOYSA-N 0.000 claims 1
- SLUYSJBXHORYBA-UHFFFAOYSA-N N-[1-benzyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)benzotriazol-4-yl]ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=C2N=NN(CC3=CC=CC=C3)C2=CC(=C1)C1=CN(C)C(=O)C(C)=C1 SLUYSJBXHORYBA-UHFFFAOYSA-N 0.000 claims 1
- GTCDPVRVAVIHAL-UHFFFAOYSA-N N-[1-benzyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)indazol-4-yl]ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=C2C=NN(CC3=CC=CC=C3)C2=CC(=C1)C1=CN(C)C(=O)C(C)=C1 GTCDPVRVAVIHAL-UHFFFAOYSA-N 0.000 claims 1
- KJHPMWOBWCOZDS-UHFFFAOYSA-N N-[2-cyclopropyl-7-(1,5-dimethyl-6-oxopyridin-3-yl)-1-benzofuran-5-yl]ethanesulfonamide Chemical compound CCS(=O)(=O)Nc1cc(-c2cc(C)c(=O)n(C)c2)c2oc(cc2c1)C1CC1 KJHPMWOBWCOZDS-UHFFFAOYSA-N 0.000 claims 1
- LHEMTKPEUZEKNE-UHFFFAOYSA-N N-[2-cyclopropyl-7-(1,5-dimethyl-6-oxopyridin-3-yl)-1-benzofuran-5-yl]methanesulfonamide Chemical compound C1(CC1)C=1OC2=C(C=1)C=C(C=C2C1=CN(C(C(=C1)C)=O)C)NS(=O)(=O)C LHEMTKPEUZEKNE-UHFFFAOYSA-N 0.000 claims 1
- QOFZCQYGEZDEJL-UHFFFAOYSA-N N-[2-cyclopropyl-7-(2-methyl-1-oxoisoquinolin-4-yl)-1,3-benzoxazol-5-yl]ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=CC2=C(OC(=N2)C2CC2)C(=C1)C1=CN(C)C(=O)C2=C1C=CC=C2 QOFZCQYGEZDEJL-UHFFFAOYSA-N 0.000 claims 1
- MGBSZFGNAZOLFQ-UHFFFAOYSA-N N-[2-cyclopropyl-7-(2-methyl-1-oxoisoquinolin-4-yl)-1-benzofuran-5-yl]ethanesulfonamide Chemical compound C1(CC1)C=1OC2=C(C=1)C=C(C=C2C1=CN(C(C2=CC=CC=C12)=O)C)NS(=O)(=O)CC MGBSZFGNAZOLFQ-UHFFFAOYSA-N 0.000 claims 1
- HCJSMLKOUNMWAY-UHFFFAOYSA-N N-[2-cyclopropyl-7-(2-methyl-1-oxoisoquinolin-4-yl)-1-benzofuran-5-yl]methanesulfonamide Chemical compound C1(CC1)C=1OC2=C(C=1)C=C(C=C2C1=CN(C(C2=CC=CC=C12)=O)C)NS(=O)(=O)C HCJSMLKOUNMWAY-UHFFFAOYSA-N 0.000 claims 1
- CRGKRTPUIKQWDP-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(3-fluorophenyl)methyl]-2-methylbenzimidazol-4-yl]ethanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C(=N2)C)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)CC CRGKRTPUIKQWDP-UHFFFAOYSA-N 0.000 claims 1
- KLMMBPFCSXLQIN-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(3-fluorophenyl)methyl]-2-methylbenzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C(=N2)C)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)C KLMMBPFCSXLQIN-UHFFFAOYSA-N 0.000 claims 1
- KUEYACBOLWXVBE-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(4-fluorophenyl)methyl]-2-methylbenzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C(=N2)C)CC2=CC=C(C=C2)F)C=1)NS(=O)(=O)C KUEYACBOLWXVBE-UHFFFAOYSA-N 0.000 claims 1
- OMWHACUOQZLKAH-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(4-fluorophenyl)methyl]benzotriazol-4-yl]ethanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(N=N2)CC2=CC=C(C=C2)F)C=1)NS(=O)(=O)CC OMWHACUOQZLKAH-UHFFFAOYSA-N 0.000 claims 1
- UPRXDQXRQLZTBQ-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(4-fluorophenyl)methyl]indazol-4-yl]ethanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C1=CC(=C2C=NN(C2=C1)CC1=CC=C(C=C1)F)NS(=O)(=O)CC UPRXDQXRQLZTBQ-UHFFFAOYSA-N 0.000 claims 1
- YBIFRFJARITXLY-UHFFFAOYSA-N N-[7-(2-methyl-1-oxoisoquinolin-4-yl)-2-phenyl-1-benzofuran-5-yl]methanesulfonamide Chemical compound CN1C(C2=CC=CC=C2C(=C1)C1=CC(=CC=2C=C(OC=21)C1=CC=CC=C1)NS(=O)(=O)C)=O YBIFRFJARITXLY-UHFFFAOYSA-N 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 abstract description 38
- 102000004169 proteins and genes Human genes 0.000 abstract description 22
- 102000006947 Histones Human genes 0.000 abstract description 12
- 230000001404 mediated effect Effects 0.000 abstract description 9
- 230000005764 inhibitory process Effects 0.000 abstract description 8
- 230000002062 proliferating effect Effects 0.000 abstract description 7
- 230000002068 genetic effect Effects 0.000 abstract description 4
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical group CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 abstract description 2
- 229960004373 acetylcholine Drugs 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 155
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 147
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 130
- 238000005481 NMR spectroscopy Methods 0.000 description 125
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 120
- 239000007787 solid Substances 0.000 description 110
- 239000000243 solution Substances 0.000 description 87
- 235000019439 ethyl acetate Nutrition 0.000 description 77
- 239000012044 organic layer Substances 0.000 description 76
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 75
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 72
- 239000011734 sodium Substances 0.000 description 71
- 238000003786 synthesis reaction Methods 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- 125000002947 alkylene group Chemical group 0.000 description 50
- 230000015572 biosynthetic process Effects 0.000 description 48
- 238000002360 preparation method Methods 0.000 description 48
- 238000010898 silica gel chromatography Methods 0.000 description 44
- 125000004432 carbon atom Chemical group C* 0.000 description 42
- 239000012267 brine Substances 0.000 description 39
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 39
- 230000002829 reductive effect Effects 0.000 description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- 150000003254 radicals Chemical class 0.000 description 34
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 30
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 29
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 29
- 239000000706 filtrate Substances 0.000 description 26
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 26
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 24
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 22
- 102100029895 Bromodomain-containing protein 4 Human genes 0.000 description 22
- 210000004027 cell Anatomy 0.000 description 22
- 108091005625 BRD4 Proteins 0.000 description 21
- 125000004419 alkynylene group Chemical group 0.000 description 21
- 235000018102 proteins Nutrition 0.000 description 21
- 239000000126 substance Substances 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- 238000001816 cooling Methods 0.000 description 19
- 108010077544 Chromatin Proteins 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 210000003483 chromatin Anatomy 0.000 description 18
- 238000000746 purification Methods 0.000 description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- 108091005575 Bromodomain-containing proteins Proteins 0.000 description 16
- 125000004452 carbocyclyl group Chemical group 0.000 description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 15
- 125000001424 substituent group Chemical group 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 229910052799 carbon Inorganic materials 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 238000010651 palladium-catalyzed cross coupling reaction Methods 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- 238000004809 thin layer chromatography Methods 0.000 description 13
- 125000004450 alkenylene group Chemical group 0.000 description 12
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 12
- 239000005457 ice water Substances 0.000 description 12
- 238000002953 preparative HPLC Methods 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 238000001914 filtration Methods 0.000 description 11
- 239000000651 prodrug Substances 0.000 description 11
- 229940002612 prodrug Drugs 0.000 description 11
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 11
- 238000013518 transcription Methods 0.000 description 11
- 230000035897 transcription Effects 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 10
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 10
- 125000004122 cyclic group Chemical group 0.000 description 10
- 229910052805 deuterium Inorganic materials 0.000 description 10
- 238000000605 extraction Methods 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- 230000001105 regulatory effect Effects 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 9
- 102100033641 Bromodomain-containing protein 2 Human genes 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 9
- 101000871850 Homo sapiens Bromodomain-containing protein 2 Proteins 0.000 description 9
- 208000035475 disorder Diseases 0.000 description 9
- PHPYXVIHDRDPDI-UHFFFAOYSA-N 2-bromo-1h-benzimidazole Chemical class C1=CC=C2NC(Br)=NC2=C1 PHPYXVIHDRDPDI-UHFFFAOYSA-N 0.000 description 8
- HDXJMVRIBKRHIJ-UHFFFAOYSA-N 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyridin-2-one Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CNC1=O HDXJMVRIBKRHIJ-UHFFFAOYSA-N 0.000 description 8
- 102100033642 Bromodomain-containing protein 3 Human genes 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 101000871851 Homo sapiens Bromodomain-containing protein 3 Proteins 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 125000003107 substituted aryl group Chemical group 0.000 description 8
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 7
- 102100021574 Bromodomain adjacent to zinc finger domain protein 2B Human genes 0.000 description 7
- 102100029894 Bromodomain testis-specific protein Human genes 0.000 description 7
- 101000971143 Homo sapiens Bromodomain adjacent to zinc finger domain protein 2B Proteins 0.000 description 7
- 101000794028 Homo sapiens Bromodomain testis-specific protein Proteins 0.000 description 7
- DTERQYGMUDWYAZ-ZETCQYMHSA-N N(6)-acetyl-L-lysine Chemical compound CC(=O)NCCCC[C@H]([NH3+])C([O-])=O DTERQYGMUDWYAZ-ZETCQYMHSA-N 0.000 description 7
- 125000004429 atom Chemical group 0.000 description 7
- 125000004431 deuterium atom Chemical group 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 230000014509 gene expression Effects 0.000 description 7
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical compound C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 7
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 6
- 230000008901 benefit Effects 0.000 description 6
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 6
- 125000005884 carbocyclylalkyl group Chemical group 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000001727 in vivo Methods 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 108020004414 DNA Proteins 0.000 description 5
- 102100022846 Histone acetyltransferase KAT2B Human genes 0.000 description 5
- 101001047006 Homo sapiens Histone acetyltransferase KAT2B Proteins 0.000 description 5
- 101000934489 Homo sapiens Nucleosome-remodeling factor subunit BPTF Proteins 0.000 description 5
- 101000896765 Homo sapiens Peregrin Proteins 0.000 description 5
- 101000596093 Homo sapiens Transcription initiation factor TFIID subunit 1 Proteins 0.000 description 5
- 241000701806 Human papillomavirus Species 0.000 description 5
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 5
- 102100025062 Nucleosome-remodeling factor subunit BPTF Human genes 0.000 description 5
- 108010047956 Nucleosomes Proteins 0.000 description 5
- 102100021698 Peregrin Human genes 0.000 description 5
- 102100035222 Transcription initiation factor TFIID subunit 1 Human genes 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 210000000349 chromosome Anatomy 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000006870 function Effects 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 210000001623 nucleosome Anatomy 0.000 description 5
- 238000012746 preparative thin layer chromatography Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- 230000003612 virological effect Effects 0.000 description 5
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 4
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 4
- ABAGKHWCTWMUDH-UHFFFAOYSA-N 5-bromo-1,3-difluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=C(F)C=C(Br)C=C1F ABAGKHWCTWMUDH-UHFFFAOYSA-N 0.000 description 4
- VEFNVMSUKDCQDF-UHFFFAOYSA-N 6-bromo-2-methyl-4-nitro-1h-benzimidazole Chemical compound BrC1=CC([N+]([O-])=O)=C2NC(C)=NC2=C1 VEFNVMSUKDCQDF-UHFFFAOYSA-N 0.000 description 4
- XWALISSRSGMCSU-UHFFFAOYSA-N 6-bromo-2-methylisoquinolin-1-one Chemical compound BrC1=CC=C2C(=O)N(C)C=CC2=C1 XWALISSRSGMCSU-UHFFFAOYSA-N 0.000 description 4
- 108091052242 Bromo- and Extra-Terminal domain (BET) family Proteins 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 201000009030 Carcinoma Diseases 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 4
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 4
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000010189 synthetic method Methods 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- WYLZKEAKTKRGKT-UHFFFAOYSA-N 1,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one Chemical compound CN1C(=O)C(C)=CC(B2OC(C)(C)C(C)(C)O2)=C1 WYLZKEAKTKRGKT-UHFFFAOYSA-N 0.000 description 3
- ZJRDSZHMYRWFLF-UHFFFAOYSA-N 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2h-isoquinolin-1-one Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC2=CC=CC=C2C(=O)N1 ZJRDSZHMYRWFLF-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- QZUVRYVLPPNUJK-UHFFFAOYSA-N 6-bromo-1-[(3-fluorophenyl)methyl]-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C=N2)CC2=CC(=CC=C2)F)C=1)[N+](=O)[O-] QZUVRYVLPPNUJK-UHFFFAOYSA-N 0.000 description 3
- XDXHAOHQUBLABA-UHFFFAOYSA-N 6-bromo-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CN1CC2=C(C=C(Br)C=C2)S1(=O)=O XDXHAOHQUBLABA-UHFFFAOYSA-N 0.000 description 3
- IRYJFUNUDRADTJ-UHFFFAOYSA-N 6-bromo-4-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC(Br)=CC2=C1N=CN2 IRYJFUNUDRADTJ-UHFFFAOYSA-N 0.000 description 3
- UJIFFABXLVUUCV-UHFFFAOYSA-N 7-chloro-2-cyclopropyl-5-nitro-1,3-benzoxazole Chemical compound [O-][N+](=O)C1=CC2=C(OC(=N2)C2CC2)C(Cl)=C1 UJIFFABXLVUUCV-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 206010005003 Bladder cancer Diseases 0.000 description 3
- 206010006187 Breast cancer Diseases 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- 102100024457 Cyclin-dependent kinase 9 Human genes 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- 101001122114 Homo sapiens NUT family member 1 Proteins 0.000 description 3
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 3
- YOKCYMDRMSFFGC-UHFFFAOYSA-N N-(1-benzyl-6-bromoindol-4-yl)methanesulfonamide Chemical compound C(C1=CC=CC=C1)N1C=CC2=C(C=C(C=C12)Br)NS(=O)(=O)C YOKCYMDRMSFFGC-UHFFFAOYSA-N 0.000 description 3
- FUNLQTMNCWNLCT-UHFFFAOYSA-N N-(3-chloro-2-hydroxy-5-nitrophenyl)cyclopropanecarboxamide Chemical compound ClC=1C(=C(C=C(C=1)[N+](=O)[O-])NC(=O)C1CC1)O FUNLQTMNCWNLCT-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 206010060862 Prostate cancer Diseases 0.000 description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 125000003709 fluoroalkyl group Chemical group 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 230000006195 histone acetylation Effects 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 3
- 201000005202 lung cancer Diseases 0.000 description 3
- 208000020816 lung neoplasm Diseases 0.000 description 3
- 201000001441 melanoma Diseases 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 239000001301 oxygen Chemical group 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical group C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- 201000005112 urinary bladder cancer Diseases 0.000 description 3
- OWIJBXQCAIHIAB-UHFFFAOYSA-N (7-bromo-2-cyclopropyl-1,3-benzoxazol-5-yl)methanol Chemical compound OCC1=CC2=C(OC(=N2)C2CC2)C(Br)=C1 OWIJBXQCAIHIAB-UHFFFAOYSA-N 0.000 description 2
- LHOPDIPOMHVFAD-UHFFFAOYSA-N 1,3-dimethylpyridin-2-one Chemical compound CC1=CC=CN(C)C1=O LHOPDIPOMHVFAD-UHFFFAOYSA-N 0.000 description 2
- IBLMYGXJKQIGSN-UHFFFAOYSA-N 1-(bromomethyl)-2,4-difluorobenzene Chemical group FC1=CC=C(CBr)C(F)=C1 IBLMYGXJKQIGSN-UHFFFAOYSA-N 0.000 description 2
- SCBZBMXPJYMXRC-UHFFFAOYSA-N 1-(bromomethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CBr)=C1 SCBZBMXPJYMXRC-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- PIXKFJWPIFDQHY-UHFFFAOYSA-N 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoquinoline Chemical compound CN1CC2=CC=CC=C2C(=C1)B1OC(C(O1)(C)C)(C)C PIXKFJWPIFDQHY-UHFFFAOYSA-N 0.000 description 2
- HMVOWYNRRUSKJE-UHFFFAOYSA-N 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one Chemical compound Cn1cc(B2OC(C)(C)C(C)(C)O2)c2ccccc2c1=O HMVOWYNRRUSKJE-UHFFFAOYSA-N 0.000 description 2
- YMXIIVIQLHYKOT-UHFFFAOYSA-N 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline Chemical group O1C(C)(C)C(C)(C)OB1C1=CC=CC(N)=C1 YMXIIVIQLHYKOT-UHFFFAOYSA-N 0.000 description 2
- KHKZYKMSKSWHBO-UHFFFAOYSA-N 3-bromo-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound BrC1N(S(C2=C1C=CC=C2)(=O)=O)C KHKZYKMSKSWHBO-UHFFFAOYSA-N 0.000 description 2
- GLKHLBAXHLAQBJ-UHFFFAOYSA-N 3-bromo-2-nitroaniline Chemical compound NC1=CC=CC(Br)=C1[N+]([O-])=O GLKHLBAXHLAQBJ-UHFFFAOYSA-N 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- SWDKXKCCRWCYCR-UHFFFAOYSA-N 3-methoxy-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound COC1N(S(C2=C1C=CC=C2)(=O)=O)C SWDKXKCCRWCYCR-UHFFFAOYSA-N 0.000 description 2
- DZHYUSLXUNIDCN-UHFFFAOYSA-N 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one Chemical compound CC=1NC(C2=CC=CC=C2C=1B1OC(C(O1)(C)C)(C)C)=O DZHYUSLXUNIDCN-UHFFFAOYSA-N 0.000 description 2
- LOMKRPABAXIQJL-UHFFFAOYSA-N 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN=CC2=CC=CC=C12 LOMKRPABAXIQJL-UHFFFAOYSA-N 0.000 description 2
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 2
- URNIHZBROXBYKD-UHFFFAOYSA-N 6-bromo-1-butyl-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C=N2)CCCC)C=1)[N+](=O)[O-] URNIHZBROXBYKD-UHFFFAOYSA-N 0.000 description 2
- YXFNRAURNMHQQR-UHFFFAOYSA-N 6-bromo-5-fluoro-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CN1CC2=C(C=C(Br)C(F)=C2)S1(=O)=O YXFNRAURNMHQQR-UHFFFAOYSA-N 0.000 description 2
- CYUMCVZVYBFYOK-UHFFFAOYSA-N 6-bromo-7-(cyclopropylmethoxy)-4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazine Chemical compound CCS(=O)(=O)N1CCOC2=C1C=C(Br)C(OCC1CC1)=C2 CYUMCVZVYBFYOK-UHFFFAOYSA-N 0.000 description 2
- IJGBRBSORRYVFY-UHFFFAOYSA-N 6-bromo-7-hydroxy-4H-1,4-benzoxazin-3-one Chemical compound OC1=CC2=C(NC(=O)CO2)C=C1Br IJGBRBSORRYVFY-UHFFFAOYSA-N 0.000 description 2
- TWLMSPNQBKSXOP-UHFFFAOYSA-N 6358-09-4 Chemical compound NC1=CC([N+]([O-])=O)=CC(Cl)=C1O TWLMSPNQBKSXOP-UHFFFAOYSA-N 0.000 description 2
- CAXBXKCEYIPRRP-UHFFFAOYSA-N 7-bromo-2-cyclopropyl-3-methylbenzimidazol-5-amine Chemical compound BrC1=CC(=CC2=C1N=C(N2C)C1CC1)N CAXBXKCEYIPRRP-UHFFFAOYSA-N 0.000 description 2
- LGHSRAMGJFIEDF-UHFFFAOYSA-N 7-bromo-2-cyclopropyl-5-(methylsulfonylmethyl)-1,3-benzoxazole Chemical compound CS(=O)(=O)CC1=CC2=C(OC(=N2)C2CC2)C(Br)=C1 LGHSRAMGJFIEDF-UHFFFAOYSA-N 0.000 description 2
- JSUZPUSWOCAFMP-UHFFFAOYSA-N 7-bromo-5-(bromomethyl)-2-cyclopropyl-1,3-benzoxazole Chemical compound BrCC1=CC2=C(OC(=N2)C2CC2)C(Br)=C1 JSUZPUSWOCAFMP-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 102100025064 Cellular tumor antigen p53 Human genes 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical compound C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- 102100039869 Histone H2B type F-S Human genes 0.000 description 2
- 101000980930 Homo sapiens Cyclin-dependent kinase 9 Proteins 0.000 description 2
- 101001035372 Homo sapiens Histone H2B type F-S Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- QCNKLRMBWRWEPG-UHFFFAOYSA-N N-(1-benzyl-6-bromobenzimidazol-4-yl)methanesulfonamide Chemical compound C(C1=CC=CC=C1)N1C=NC2=C1C=C(C=C2NS(=O)(=O)C)Br QCNKLRMBWRWEPG-UHFFFAOYSA-N 0.000 description 2
- NKOHIYKZXLNJJV-UHFFFAOYSA-N N-(7-bromo-2-cyclopropyl-3-methylbenzimidazol-5-yl)ethanesulfonamide Chemical compound BrC1=CC(=CC2=C1N=C(N2C)C1CC1)NS(=O)(=O)CC NKOHIYKZXLNJJV-UHFFFAOYSA-N 0.000 description 2
- MJDHWWHBNNBJJP-UHFFFAOYSA-N N-[6-(1,5-dimethyl-6-oxopyridin-3-yl)-1-[(3-fluorophenyl)methyl]benzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C=1C=C(C2=C(N(C=N2)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)C MJDHWWHBNNBJJP-UHFFFAOYSA-N 0.000 description 2
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 2
- 239000007832 Na2SO4 Substances 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- 208000036142 Viral infection Diseases 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- AGEZXYOZHKGVCM-PTQBSOBMSA-N bromomethylbenzene Chemical group Br[13CH2]C1=CC=CC=C1 AGEZXYOZHKGVCM-PTQBSOBMSA-N 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000022131 cell cycle Effects 0.000 description 2
- 230000024245 cell differentiation Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000006718 epigenetic regulation Effects 0.000 description 2
- 230000008029 eradication Effects 0.000 description 2
- 229940012017 ethylenediamine Drugs 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical group C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- HIXMULHJNNPDMH-UHFFFAOYSA-N methyl 3-bromo-5-(cyclopropanecarbonylamino)-4-hydroxybenzoate Chemical compound BrC=1C=C(C(=O)OC)C=C(C=1O)NC(=O)C1CC1 HIXMULHJNNPDMH-UHFFFAOYSA-N 0.000 description 2
- FQAYILYUDUWGQK-UHFFFAOYSA-N methyl 7-bromo-2-cyclopropyl-1,3-benzoxazole-5-carboxylate Chemical compound COC(=O)C1=CC2=C(OC(=N2)C2CC2)C(Br)=C1 FQAYILYUDUWGQK-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 210000004940 nucleus Anatomy 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000000466 oxiranyl group Chemical group 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000004481 post-translational protein modification Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 235000004252 protein component Nutrition 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical compound COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- UIYOVVYZPVVUMJ-UHFFFAOYSA-N tert-butyl carbamoyl carbonate Chemical compound CC(C)(C)OC(=O)OC(N)=O UIYOVVYZPVVUMJ-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- 230000009385 viral infection Effects 0.000 description 2
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- NXMXETCTWNXSFG-SCSAIBSYSA-N (2r)-1-methoxypropan-2-amine Chemical compound COC[C@@H](C)N NXMXETCTWNXSFG-SCSAIBSYSA-N 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- FSJSYDFBTIVUFD-SUKNRPLKSA-N (z)-4-hydroxypent-3-en-2-one;oxovanadium Chemical compound [V]=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O FSJSYDFBTIVUFD-SUKNRPLKSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- BTNAZHHYONIOIV-UHFFFAOYSA-N 1,2-benzothiazole 1,1-dioxide Chemical compound C1=CC=C2S(=O)(=O)N=CC2=C1 BTNAZHHYONIOIV-UHFFFAOYSA-N 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- MLBJWYFYMHNZSA-UHFFFAOYSA-N 1,3-dimethyl-5-[2-methyl-1,1-dioxo-5-(2,2,2-trifluoroethoxy)-3H-1,2-benzothiazol-6-yl]pyridin-2-one Chemical compound CN1C(C(=CC(=C1)C1=CC2=C(CN(S2(=O)=O)C)C=C1OCC(F)(F)F)C)=O MLBJWYFYMHNZSA-UHFFFAOYSA-N 0.000 description 1
- AXTPKYQMUDUCFW-UHFFFAOYSA-N 1,3-thiazole 1,1-dioxide Chemical group O=S1(=O)C=CN=C1 AXTPKYQMUDUCFW-UHFFFAOYSA-N 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- RNTCWULFNYNFGI-UHFFFAOYSA-N 1-(2,3-dihydroindol-1-yl)ethanone Chemical compound C1=CC=C2N(C(=O)C)CCC2=C1 RNTCWULFNYNFGI-UHFFFAOYSA-N 0.000 description 1
- WSDUFDGEYKOQRT-UHFFFAOYSA-N 1-(5-amino-2,3-dihydroindol-1-yl)ethanone Chemical compound NC1=CC=C2N(C(=O)C)CCC2=C1 WSDUFDGEYKOQRT-UHFFFAOYSA-N 0.000 description 1
- YGWPWLRFBWRAMA-UHFFFAOYSA-N 1-(5-hydroxy-2,3-dihydroindol-1-yl)ethanone Chemical compound OC1=CC=C2N(C(=O)C)CCC2=C1 YGWPWLRFBWRAMA-UHFFFAOYSA-N 0.000 description 1
- OJKKTNFCWMBYMT-UHFFFAOYSA-N 1-(5-nitro-2,3-dihydroindol-1-yl)ethanone Chemical compound [O-][N+](=O)C1=CC=C2N(C(=O)C)CCC2=C1 OJKKTNFCWMBYMT-UHFFFAOYSA-N 0.000 description 1
- VREDQSGDTTXDFT-UHFFFAOYSA-N 1-(benzenesulfonyl)-2-bromo-4-methylsulfanylindole Chemical compound C1(=CC=CC=C1)S(=O)(=O)N1C(=CC2=C(C=CC=C12)SC)Br VREDQSGDTTXDFT-UHFFFAOYSA-N 0.000 description 1
- VFCJDYXYTGRPSS-UHFFFAOYSA-N 1-(benzenesulfonyl)-4-methylsulfanylindole Chemical compound C1=CC=2C(SC)=CC=CC=2N1S(=O)(=O)C1=CC=CC=C1 VFCJDYXYTGRPSS-UHFFFAOYSA-N 0.000 description 1
- SGVFZKNHVOAEPL-UHFFFAOYSA-N 1-benzyl-6-bromo-2-methyl-4-methylsulfonylbenzimidazole Chemical compound C(C1=CC=CC=C1)N1C(=NC2=C1C=C(C=C2S(=O)(=O)C)Br)C SGVFZKNHVOAEPL-UHFFFAOYSA-N 0.000 description 1
- TXNLLRPKJYARHD-UHFFFAOYSA-N 1-benzyl-6-bromo-4-nitrobenzotriazole Chemical compound [O-][N+](=O)C1=C2N=NN(CC3=CC=CC=C3)C2=CC(Br)=C1 TXNLLRPKJYARHD-UHFFFAOYSA-N 0.000 description 1
- OEZQLYAQVANSGW-UHFFFAOYSA-N 1-benzyl-6-bromo-4-nitroindazole Chemical compound [O-][N+](=O)C1=C2C=NN(CC3=CC=CC=C3)C2=CC(Br)=C1 OEZQLYAQVANSGW-UHFFFAOYSA-N 0.000 description 1
- AJKAJQHWAUAMAN-UHFFFAOYSA-N 1-benzyl-6-bromobenzimidazol-4-amine Chemical compound C(C1=CC=CC=C1)N1C=NC2=C1C=C(C=C2N)Br AJKAJQHWAUAMAN-UHFFFAOYSA-N 0.000 description 1
- SLFNGVGRINFJLK-UHFFFAOYSA-N 1-bromo-2-fluoro-4-methylbenzene Chemical compound CC1=CC=C(Br)C(F)=C1 SLFNGVGRINFJLK-UHFFFAOYSA-N 0.000 description 1
- QINKWPYJYRVKNO-UHFFFAOYSA-N 1-bromo-4-nitrobenzimidazole Chemical group BrN1C=NC2=C1C=CC=C2[N+](=O)[O-] QINKWPYJYRVKNO-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CRRUGYDDEMGVDY-UHFFFAOYSA-N 1-bromoethylbenzene Chemical compound CC(Br)C1=CC=CC=C1 CRRUGYDDEMGVDY-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000005987 1-oxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical group OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- OKYAPKJJKHBWIO-UHFFFAOYSA-N 2,6-dichloro-8-methyl-7h-purine Chemical compound ClC1=NC(Cl)=C2NC(C)=NC2=N1 OKYAPKJJKHBWIO-UHFFFAOYSA-N 0.000 description 1
- DIZJZNFEAZFPOJ-UHFFFAOYSA-N 2,6-dichloro-9-[(4-fluorophenyl)methyl]-8-methylpurine Chemical compound ClC1=NC(=C2N=C(N(C2=N1)CC1=CC=C(C=C1)F)C)Cl DIZJZNFEAZFPOJ-UHFFFAOYSA-N 0.000 description 1
- FTIFVUFZYLYABI-UHFFFAOYSA-N 2,6-diiodo-4-methylsulfonylphenol Chemical compound CS(=O)(=O)C1=CC(I)=C(O)C(I)=C1 FTIFVUFZYLYABI-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- ZFEYMRDQUMPQAW-UHFFFAOYSA-N 2-bromo-1-[(3-fluorophenyl)methyl]-4-nitrobenzimidazole Chemical group BrC1=NC2=C(N1CC1=CC(=CC=C1)F)C=CC=C2[N+](=O)[O-] ZFEYMRDQUMPQAW-UHFFFAOYSA-N 0.000 description 1
- WVDMTEVJIPPPGV-UHFFFAOYSA-N 2-cyclopropyl-7-(2-methyl-1H-isoquinolin-4-yl)-5-nitro-1,3-benzoxazole Chemical compound C1(CC1)C=1OC2=C(N=1)C=C(C=C2C1=CN(CC2=CC=CC=C12)C)[N+](=O)[O-] WVDMTEVJIPPPGV-UHFFFAOYSA-N 0.000 description 1
- CKCLPOILRDWKGF-UHFFFAOYSA-N 2-cyclopropyl-7-(3-methoxy-1-methyl-2H-pyridin-5-yl)-5-(methylsulfonylmethyl)-1,3-benzoxazole Chemical compound C1(CC1)C=1OC2=C(N=1)C=C(C=C2C=1C=C(CN(C=1)C)OC)CS(=O)(=O)C CKCLPOILRDWKGF-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- UDUOAJHWQKMKHR-UHFFFAOYSA-N 2-ethyl-7-iodo-5-methylsulfonyl-1-benzofuran Chemical compound CCc1cc2cc(cc(I)c2o1)S(C)(=O)=O UDUOAJHWQKMKHR-UHFFFAOYSA-N 0.000 description 1
- GGDYAKVUZMZKRV-UHFFFAOYSA-N 2-fluoroethanol Chemical compound OCCF GGDYAKVUZMZKRV-UHFFFAOYSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- BZAIGHMMVCRGKE-UHFFFAOYSA-N 2-methyl-4-(5-methylsulfonyl-2-phenyl-1-benzofuran-7-yl)-1H-isoquinoline Chemical compound CN1CC2=CC=CC=C2C(=C1)C1=CC(=CC=2C=C(OC=21)C1=CC=CC=C1)S(=O)(=O)C BZAIGHMMVCRGKE-UHFFFAOYSA-N 0.000 description 1
- YJRMHIKEMDTYDR-UHFFFAOYSA-N 2-methylisoquinolin-1-one Chemical compound C1=CC=C2C(=O)N(C)C=CC2=C1 YJRMHIKEMDTYDR-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- KJFYQQHJMMWTPL-UHFFFAOYSA-N 3,4-dimethyl-1h-pyridin-2-one Chemical group CC1=CC=NC(O)=C1C KJFYQQHJMMWTPL-UHFFFAOYSA-N 0.000 description 1
- GRNHLFULJDXJKR-UHFFFAOYSA-N 3-(2-sulfanylethyl)-1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)N(CCS)C(=O)NC2=C1 GRNHLFULJDXJKR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ISNKQLNIOAHLIG-UHFFFAOYSA-N 3-methoxy-1-methylpyridin-2-one Chemical compound COC1=CC=CN(C)C1=O ISNKQLNIOAHLIG-UHFFFAOYSA-N 0.000 description 1
- QHRSYFJOKOPACI-UHFFFAOYSA-N 3-methoxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one Chemical compound COC=1C(NC=C(C=1C)B1OC(C(O1)(C)C)(C)C)=O QHRSYFJOKOPACI-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UCFSYHMCKWNKAH-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound CC1(C)OBOC1(C)C UCFSYHMCKWNKAH-UHFFFAOYSA-N 0.000 description 1
- VKZMCSBHZXZRGN-UHFFFAOYSA-N 4,6-dichloro-1-[(4-fluorophenyl)methyl]-2-methylimidazo[4,5-c]pyridine Chemical compound ClC1=NC(=CC2=C1N=C(N2CC1=CC=C(C=C1)F)C)Cl VKZMCSBHZXZRGN-UHFFFAOYSA-N 0.000 description 1
- YHYSBBNQVGEIDZ-UHFFFAOYSA-N 4-(2-cyclopropyl-5-methylsulfonyl-1-benzofuran-7-yl)-2-methyl-1H-isoquinoline Chemical compound C1(CC1)C=1OC2=C(C=1)C=C(C=C2C1=CN(CC2=CC=CC=C12)C)S(=O)(=O)C YHYSBBNQVGEIDZ-UHFFFAOYSA-N 0.000 description 1
- MJESFBWLZNLWBH-UHFFFAOYSA-N 4-(2-ethyl-5-methylsulfonyl-1-benzofuran-7-yl)-2-methylisoquinolin-1-one Chemical compound CCc1cc2cc(cc(-c3cn(C)c(=O)c4ccccc34)c2o1)S(C)(=O)=O MJESFBWLZNLWBH-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GRJZJFUBQYULKL-UHFFFAOYSA-N 4-bromo-1h-indole Chemical compound BrC1=CC=CC2=C1C=CN2 GRJZJFUBQYULKL-UHFFFAOYSA-N 0.000 description 1
- JLKWMAYFEUYJLV-UHFFFAOYSA-N 4-bromo-2-cyclopropyl-1-methyl-6-nitrobenzimidazole Chemical compound BrC1=CC(=CC=2N(C(=NC=21)C1CC1)C)[N+](=O)[O-] JLKWMAYFEUYJLV-UHFFFAOYSA-N 0.000 description 1
- BGLBYDIQQBLPCI-UHFFFAOYSA-N 4-bromo-2-cyclopropyl-6-nitro-1h-benzimidazole Chemical compound N1C2=CC([N+](=O)[O-])=CC(Br)=C2N=C1C1CC1 BGLBYDIQQBLPCI-UHFFFAOYSA-N 0.000 description 1
- QRAOZQGIUIDZQZ-UHFFFAOYSA-N 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound C=1C=C2N(C)CCOC2=CC=1B1OC(C)(C)C(C)(C)O1 QRAOZQGIUIDZQZ-UHFFFAOYSA-N 0.000 description 1
- ZVVSPJZIPZPMPS-UHFFFAOYSA-N 4-methylsulfanyl-1h-indole Chemical compound CSC1=CC=CC2=C1C=CN2 ZVVSPJZIPZPMPS-UHFFFAOYSA-N 0.000 description 1
- KECCFSZFXLAGJS-UHFFFAOYSA-N 4-methylsulfonylphenol Chemical compound CS(=O)(=O)C1=CC=C(O)C=C1 KECCFSZFXLAGJS-UHFFFAOYSA-N 0.000 description 1
- NEJMFSBXFBFELK-UHFFFAOYSA-N 4-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=CC2=C1N=CN2 NEJMFSBXFBFELK-UHFFFAOYSA-N 0.000 description 1
- OSYUPIGIXBGDCP-UHFFFAOYSA-N 5-(2-cyclopropyl-5-nitro-1,3-benzoxazol-7-yl)-1,3-dimethylpyridin-2-one Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(=CC2=C1OC(=N2)C1CC1)[N+]([O-])=O OSYUPIGIXBGDCP-UHFFFAOYSA-N 0.000 description 1
- CDDDTMBETSIWPH-UHFFFAOYSA-N 5-[5-(cyclopropylmethoxy)-2-ethyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]-1,3-dimethylpyridin-2-one Chemical compound CCN1CC2=C(C=C(C(OCC3CC3)=C2)C2=CN(C)C(=O)C(C)=C2)S1(=O)=O CDDDTMBETSIWPH-UHFFFAOYSA-N 0.000 description 1
- JVQRZWYJOCYTAM-UHFFFAOYSA-N 5-[5-(cyclopropylmethoxy)-2-methyl-1,1-dioxo-3H-1,2-benzothiazol-6-yl]-1,3-dimethylpyridin-2-one Chemical compound CN1CC2=C(C=C(C(OCC3CC3)=C2)C2=CN(C)C(=O)C(C)=C2)S1(=O)=O JVQRZWYJOCYTAM-UHFFFAOYSA-N 0.000 description 1
- RVHNMXXUOCOCJW-UHFFFAOYSA-N 5-[7-(cyclopropylmethoxy)-4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]-1,3-dimethylpyridin-2-one Chemical compound CCS(=O)(=O)N1CCOC2=C1C=C(C(OCC1CC1)=C2)C1=CN(C)C(=O)C(C)=C1 RVHNMXXUOCOCJW-UHFFFAOYSA-N 0.000 description 1
- WKEBGKQAFQXFOI-UHFFFAOYSA-N 5-bromo-1-methyl-2h-pyridine Chemical compound CN1CC=CC(Br)=C1 WKEBGKQAFQXFOI-UHFFFAOYSA-N 0.000 description 1
- QYIALAPJGCJIOY-UHFFFAOYSA-N 5-bromo-2-(bromomethyl)-4-fluorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=C(CBr)C=C(F)C(Br)=C1 QYIALAPJGCJIOY-UHFFFAOYSA-N 0.000 description 1
- UOGCLPDKGPPDHM-UHFFFAOYSA-N 5-bromo-2-methyl-1,3-dinitrobenzene Chemical compound CC1=C([N+]([O-])=O)C=C(Br)C=C1[N+]([O-])=O UOGCLPDKGPPDHM-UHFFFAOYSA-N 0.000 description 1
- FBPCXPVYWUQREV-UHFFFAOYSA-N 5-bromo-3-nitrobenzene-1,2-diamine Chemical compound NC1=CC(Br)=CC([N+]([O-])=O)=C1N FBPCXPVYWUQREV-UHFFFAOYSA-N 0.000 description 1
- UZJJWMNVEVZGIR-UHFFFAOYSA-N 5-bromo-4-fluoro-2-methylbenzenesulfonamide Chemical compound CC1=CC(F)=C(Br)C=C1S(N)(=O)=O UZJJWMNVEVZGIR-UHFFFAOYSA-N 0.000 description 1
- KHORHAKUKQFFDV-UHFFFAOYSA-N 5-bromo-4-fluoro-2-methylbenzenesulfonyl chloride Chemical compound CC1=CC(F)=C(Br)C=C1S(Cl)(=O)=O KHORHAKUKQFFDV-UHFFFAOYSA-N 0.000 description 1
- VUOPNOSXWFKWSG-UHFFFAOYSA-N 5-bromo-6-(cyclopropylmethoxy)-1-methyl-3-methylsulfanylindazole Chemical compound BrC=1C=C2C(=NN(C2=CC=1OCC1CC1)C)SC VUOPNOSXWFKWSG-UHFFFAOYSA-N 0.000 description 1
- ABVMJFDPQXIFHA-UHFFFAOYSA-N 5-bromo-6-(cyclopropylmethoxy)-1-methyl-3-methylsulfonylindazole Chemical compound BrC=1C=C2C(=NN(C2=CC=1OCC1CC1)C)S(=O)(=O)C ABVMJFDPQXIFHA-UHFFFAOYSA-N 0.000 description 1
- IOROASKVSHIDFC-UHFFFAOYSA-N 5-bromo-6-(cyclopropylmethoxy)-3-ethylsulfanyl-1-methylindazole Chemical compound BrC=1C=C2C(=NN(C2=CC=1OCC1CC1)C)SCC IOROASKVSHIDFC-UHFFFAOYSA-N 0.000 description 1
- DXJCLCJEIMZWMQ-UHFFFAOYSA-N 5-bromo-6-(cyclopropylmethoxy)-3-ethylsulfonyl-1-methylindazole Chemical compound BrC=1C=C2C(=NN(C2=CC=1OCC1CC1)C)S(=O)(=O)CC DXJCLCJEIMZWMQ-UHFFFAOYSA-N 0.000 description 1
- LBMZUBINNWFOSO-UHFFFAOYSA-N 5-bromo-N-(cyclopropylmethyl)-3-fluoro-2-nitroaniline Chemical compound BrC=1C=C(C(=C(NCC2CC2)C=1)[N+](=O)[O-])F LBMZUBINNWFOSO-UHFFFAOYSA-N 0.000 description 1
- IZSHZLKNFQAAKX-UHFFFAOYSA-N 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene Chemical group C1=CC=CC1C1C=CC=C1 IZSHZLKNFQAAKX-UHFFFAOYSA-N 0.000 description 1
- WZRZMNNEUSUHLU-UHFFFAOYSA-N 6-bromo-1-(cyclopropylmethyl)-2-methyl-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C(=N2)C)CC2CC2)C=1)[N+](=O)[O-] WZRZMNNEUSUHLU-UHFFFAOYSA-N 0.000 description 1
- BEWHYUKLJGITMH-UHFFFAOYSA-N 6-bromo-1-[(2,4-difluorophenyl)methyl]-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C=N2)CC2=C(C=C(C=C2)F)F)C=1)[N+](=O)[O-] BEWHYUKLJGITMH-UHFFFAOYSA-N 0.000 description 1
- KQIKASSCGNRBBG-UHFFFAOYSA-N 6-bromo-1-[(3-fluorophenyl)methyl]-2-methyl-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C(=N2)C)CC2=CC(=CC=C2)F)C=1)[N+](=O)[O-] KQIKASSCGNRBBG-UHFFFAOYSA-N 0.000 description 1
- IOEPHHZNUXROET-UHFFFAOYSA-N 6-bromo-1-[(3-fluorophenyl)methyl]benzimidazole Chemical compound FC1=CC=CC(CN2C3=CC(Br)=CC=C3N=C2)=C1 IOEPHHZNUXROET-UHFFFAOYSA-N 0.000 description 1
- QDFMHNRIMHJRMV-UHFFFAOYSA-N 6-bromo-1-[(4-fluorophenyl)methyl]-2-methyl-4-nitrobenzimidazole Chemical compound BrC=1C=C(C2=C(N(C(=N2)C)CC2=CC=C(C=C2)F)C=1)[N+](=O)[O-] QDFMHNRIMHJRMV-UHFFFAOYSA-N 0.000 description 1
- KLQFZHDLYGMBCX-UHFFFAOYSA-N 6-bromo-1h-indol-4-amine Chemical compound NC1=CC(Br)=CC2=C1C=CN2 KLQFZHDLYGMBCX-UHFFFAOYSA-N 0.000 description 1
- DGGJJLFEMYWPIT-UHFFFAOYSA-N 6-bromo-2,3-dihydro-1,2-benzothiazole 1,1-dioxide Chemical compound BrC1=CC=C2CNS(=O)(=O)C2=C1 DGGJJLFEMYWPIT-UHFFFAOYSA-N 0.000 description 1
- GVVFWUYJQOBRPF-UHFFFAOYSA-N 6-bromo-2-methyl-5-(2,2,2-trifluoroethoxy)-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CN1CC2=C(C=C(Br)C(OCC(F)(F)F)=C2)S1(=O)=O GVVFWUYJQOBRPF-UHFFFAOYSA-N 0.000 description 1
- KXGOWIVFALPLCD-UHFFFAOYSA-N 6-bromo-3-fluoro-4-nitro-2h-indazole Chemical compound [O-][N+](=O)C1=CC(Br)=CC2=C1C(F)=NN2 KXGOWIVFALPLCD-UHFFFAOYSA-N 0.000 description 1
- AHEMYGJJCOXPSP-UHFFFAOYSA-N 6-bromo-4-nitro-1h-indazole Chemical compound [O-][N+](=O)C1=CC(Br)=CC2=C1C=NN2 AHEMYGJJCOXPSP-UHFFFAOYSA-N 0.000 description 1
- PSGXWGDHVPEELF-UHFFFAOYSA-N 6-bromo-4-nitro-2h-benzotriazole Chemical compound [O-][N+](=O)C1=CC(Br)=CC2=NNN=C12 PSGXWGDHVPEELF-UHFFFAOYSA-N 0.000 description 1
- PIBRNODGTQAHPV-UHFFFAOYSA-N 6-bromo-5-(2,4-difluorophenoxy)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CN1CC2=C(C=C(Br)C(OC3=C(F)C=C(F)C=C3)=C2)S1(=O)=O PIBRNODGTQAHPV-UHFFFAOYSA-N 0.000 description 1
- UAVONVLWAIDNKW-UHFFFAOYSA-N 6-bromo-5-(cyclopropylmethoxy)-1-methylsulfonyl-2,3-dihydroindole Chemical compound BrC1=C(C=C2CCN(C2=C1)S(=O)(=O)C)OCC1CC1 UAVONVLWAIDNKW-UHFFFAOYSA-N 0.000 description 1
- BESFFAITDMWYLV-UHFFFAOYSA-N 6-bromo-5-(cyclopropylmethoxy)-2,3-dihydro-1H-indole Chemical compound BrC1=C(C=C2CCNC2=C1)OCC1CC1 BESFFAITDMWYLV-UHFFFAOYSA-N 0.000 description 1
- VPJDJIZIXXAKRO-UHFFFAOYSA-N 6-bromo-5-(cyclopropylmethoxy)-2-ethyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CCN1CC2=C(C=C(Br)C(OCC3CC3)=C2)S1(=O)=O VPJDJIZIXXAKRO-UHFFFAOYSA-N 0.000 description 1
- MHKGVEVYGACYSK-UHFFFAOYSA-N 6-bromo-5-(cyclopropylmethoxy)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound CN1CC2=C(C=C(Br)C(OCC3CC3)=C2)S1(=O)=O MHKGVEVYGACYSK-UHFFFAOYSA-N 0.000 description 1
- BPZFSVJSHGNBOR-UHFFFAOYSA-N 6-bromo-5-methoxy-2-methyl-3H-1,2-benzothiazole 1,1-dioxide Chemical compound COC1=CC2=C(C=C1Br)S(=O)(=O)N(C)C2 BPZFSVJSHGNBOR-UHFFFAOYSA-N 0.000 description 1
- RFTBAWBQPRMGGH-UHFFFAOYSA-N 6-bromo-7-(cyclopropylmethoxy)-3,4-dihydro-2H-1,4-benzoxazine Chemical compound BrC=1C(=CC2=C(NCCO2)C=1)OCC1CC1 RFTBAWBQPRMGGH-UHFFFAOYSA-N 0.000 description 1
- WEPYSPPOJDASCK-UHFFFAOYSA-N 6-bromo-7-(cyclopropylmethoxy)-4H-1,4-benzoxazin-3-one Chemical compound BrC1=CC2=C(OCC(=O)N2)C=C1OCC1CC1 WEPYSPPOJDASCK-UHFFFAOYSA-N 0.000 description 1
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 1
- CIIOWTUCFCDGAA-UHFFFAOYSA-N 7-(cyclopropylmethoxy)-4-ethylsulfonyl-6-(2-methyl-1H-isoquinolin-4-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound CCS(=O)(=O)N1CCOC2=C1C=C(C(OCC1CC1)=C2)C1=CN(C)CC2=C1C=CC=C2 CIIOWTUCFCDGAA-UHFFFAOYSA-N 0.000 description 1
- GAHMCUIGTHMIFD-UHFFFAOYSA-N 7-hydroxy-4h-1,4-benzoxazin-3-one Chemical compound N1C(=O)COC2=CC(O)=CC=C21 GAHMCUIGTHMIFD-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- PWJXTSSQVFCSQT-UHFFFAOYSA-N B1CCOC1 Chemical compound B1CCOC1 PWJXTSSQVFCSQT-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 102100027310 Bromodomain adjacent to zinc finger domain protein 1A Human genes 0.000 description 1
- DBAMUTGXJAWDEA-UHFFFAOYSA-N Butynol Chemical compound CCC#CO DBAMUTGXJAWDEA-UHFFFAOYSA-N 0.000 description 1
- LIGJFRSGZLGPFA-UHFFFAOYSA-N CC1=CC(=CN(C1)C)C2=C3C(=CC(=C2)[N+](=O)[O-])N=C(O3)C4CC4 Chemical compound CC1=CC(=CN(C1)C)C2=C3C(=CC(=C2)[N+](=O)[O-])N=C(O3)C4CC4 LIGJFRSGZLGPFA-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 108010040163 CREB-Binding Protein Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical class [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 108050006400 Cyclin Proteins 0.000 description 1
- 102000016736 Cyclin Human genes 0.000 description 1
- 102000002435 Cyclin T Human genes 0.000 description 1
- 108010068106 Cyclin T Proteins 0.000 description 1
- 108010025461 Cyclin-Dependent Kinase 9 Proteins 0.000 description 1
- 102100036876 Cyclin-K Human genes 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical class OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- 230000005778 DNA damage Effects 0.000 description 1
- 231100000277 DNA damage Toxicity 0.000 description 1
- 230000007067 DNA methylation Effects 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000034951 Genetic Translocation Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102000017286 Histone H2A Human genes 0.000 description 1
- 108050005231 Histone H2A Proteins 0.000 description 1
- 101000937778 Homo sapiens Bromodomain adjacent to zinc finger domain protein 1A Proteins 0.000 description 1
- 101000713127 Homo sapiens Cyclin-K Proteins 0.000 description 1
- 241000701044 Human gammaherpesvirus 4 Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010027406 Mesothelioma Diseases 0.000 description 1
- 102100038895 Myc proto-oncogene protein Human genes 0.000 description 1
- 101710135898 Myc proto-oncogene protein Proteins 0.000 description 1
- 241000872931 Myoporum sandwicense Species 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- HJLIXUCSBRDSOY-UHFFFAOYSA-N N-(1-benzyl-6-bromo-2,3-dihydroindol-4-yl)methanesulfonamide Chemical compound C(C1=CC=CC=C1)N1CCC2=C(C=C(C=C12)Br)NS(=O)(=O)C HJLIXUCSBRDSOY-UHFFFAOYSA-N 0.000 description 1
- FJHIMXMEXSHHSV-UHFFFAOYSA-N N-(1-benzyl-6-bromobenzotriazol-4-yl)ethanesulfonamide Chemical compound C(C1=CC=CC=C1)N1N=NC2=C1C=C(C=C2NS(=O)(=O)CC)Br FJHIMXMEXSHHSV-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- QAEFVJJTYXCCPA-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-ethylbenzimidazol-4-yl]methanesulfonamide Chemical compound CCC1=NC2=C(NS(C)(=O)=O)C=C(C=C2N1CC1CC1)C1=CN(C)C(=O)C(C)=C1 QAEFVJJTYXCCPA-UHFFFAOYSA-N 0.000 description 1
- UXDANKQCPCLPSB-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-methylbenzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(NS(C)(=O)=O)=C2N=C(C)N(CC3CC3)C2=C1 UXDANKQCPCLPSB-UHFFFAOYSA-N 0.000 description 1
- MIELHBUJUJCIJO-UHFFFAOYSA-N N-[1-(cyclopropylmethyl)-6-(1,5-dimethyl-6-oxopyridin-3-yl)-3-fluoroindazol-4-yl]methanesulfonamide Chemical compound C1(CC1)CN1N=C(C2=C(C=C(C=C12)C1=CN(C(C(=C1)C)=O)C)NS(=O)(=O)C)F MIELHBUJUJCIJO-UHFFFAOYSA-N 0.000 description 1
- VLMDDMICJGALMW-UHFFFAOYSA-N N-[1-benzyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)-2-methylbenzimidazol-4-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C)C1=O)C1=CC(NS(C)(=O)=O)=C2N=C(C)N(CC3=CC=CC=C3)C2=C1 VLMDDMICJGALMW-UHFFFAOYSA-N 0.000 description 1
- UDHKQTCAQRTSNH-UHFFFAOYSA-N N-[1-butyl-6-(1,5-dimethyl-6-oxopyridin-3-yl)benzimidazol-4-yl]ethanesulfonamide Chemical compound C(CCC)N1C=NC2=C1C=C(C=C2NS(=O)(=O)CC)C1=CN(C(C(=C1)C)=O)C UDHKQTCAQRTSNH-UHFFFAOYSA-N 0.000 description 1
- MWMRNAUIHFFKQC-UHFFFAOYSA-N N-[2-(1,5-dimethyl-6-oxopyridin-3-yl)-9-[(4-fluorophenyl)methyl]-8-methylpurin-6-yl]methanesulfonamide Chemical compound CN1C=C(C=C(C1=O)C)C1=NC(=C2N=C(N(C2=N1)CC1=CC=C(C=C1)F)C)NS(=O)(=O)C MWMRNAUIHFFKQC-UHFFFAOYSA-N 0.000 description 1
- ZCKIZCSNTWZMCP-UHFFFAOYSA-N N-[2-amino-5-bromo-3-(cyclopropylmethylamino)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=C(N)C(NCC2CC2)=CC(Br)=C1 ZCKIZCSNTWZMCP-UHFFFAOYSA-N 0.000 description 1
- QKAZCYFKAORTON-SSDOTTSWSA-N N-[2-amino-5-bromo-3-[[(2R)-1-methoxypropan-2-yl]amino]phenyl]methanesulfonamide Chemical compound NC1=C(C=C(C=C1N[C@@H](COC)C)Br)NS(=O)(=O)C QKAZCYFKAORTON-SSDOTTSWSA-N 0.000 description 1
- IJFAPGNLXCKZSH-UHFFFAOYSA-N N-[2-chloro-9-[(4-fluorophenyl)methyl]-8-methylpurin-6-yl]methanesulfonamide Chemical compound ClC1=NC(=C2N=C(N(C2=N1)CC1=CC=C(C=C1)F)C)NS(=O)(=O)C IJFAPGNLXCKZSH-UHFFFAOYSA-N 0.000 description 1
- USCXTHQXBKFRGG-UHFFFAOYSA-N N-[2-cyclopropyl-3-methyl-7-(2-methyl-1-oxoisoquinolin-4-yl)benzimidazol-5-yl]ethanesulfonamide Chemical compound C1(CC1)C=1N(C2=C(N=1)C(=CC(=C2)NS(=O)(=O)CC)C1=CN(C(C2=CC=CC=C12)=O)C)C USCXTHQXBKFRGG-UHFFFAOYSA-N 0.000 description 1
- GBSFFNPNAHSDPX-UHFFFAOYSA-N N-[5-bromo-3-(cyclopropylmethylamino)-2-nitrophenyl]methanesulfonamide Chemical compound BrC=1C=C(C(=C(C=1)NS(=O)(=O)C)[N+](=O)[O-])NCC1CC1 GBSFFNPNAHSDPX-UHFFFAOYSA-N 0.000 description 1
- KFZOOQHNDWALLF-SSDOTTSWSA-N N-[5-bromo-3-[[(2R)-1-methoxypropan-2-yl]amino]-2-nitrophenyl]methanesulfonamide Chemical compound BrC=1C=C(C(=C(C=1)NS(=O)(=O)C)[N+](=O)[O-])N[C@@H](COC)C KFZOOQHNDWALLF-SSDOTTSWSA-N 0.000 description 1
- OFOQZNODJLGDEX-UHFFFAOYSA-N N-[6-bromo-1-(cyclopropylmethyl)-2-ethoxybenzimidazol-4-yl]methanesulfonamide Chemical compound BrC=1C=C(C2=C(N(C(=N2)OCC)CC2CC2)C=1)NS(=O)(=O)C OFOQZNODJLGDEX-UHFFFAOYSA-N 0.000 description 1
- XDPLODISALEKGU-UHFFFAOYSA-N N-[6-bromo-1-(cyclopropylmethyl)-2-ethylbenzimidazol-4-yl]methanesulfonamide Chemical compound BrC=1C=C(C2=C(N(C(=N2)CC)CC2CC2)C=1)NS(=O)(=O)C XDPLODISALEKGU-UHFFFAOYSA-N 0.000 description 1
- OWJKLMLDURKZBI-UHFFFAOYSA-N N-[6-bromo-1-(cyclopropylmethyl)-2-methoxybenzimidazol-4-yl]methanesulfonamide Chemical compound BrC=1C=C(C2=C(N(C(=N2)OC)CC2CC2)C=1)NS(=O)(=O)C OWJKLMLDURKZBI-UHFFFAOYSA-N 0.000 description 1
- BQOMWJDZVPDZLR-UHFFFAOYSA-N N-[6-bromo-1-[(3-fluorophenyl)methyl]benzimidazol-4-yl]ethanesulfonamide Chemical compound BrC=1C=C(C2=C(N(C=N2)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)CC BQOMWJDZVPDZLR-UHFFFAOYSA-N 0.000 description 1
- DQPTTZSMFDZHOG-UHFFFAOYSA-N N-[6-bromo-1-[(3-fluorophenyl)methyl]benzimidazol-4-yl]methanesulfonamide Chemical compound BrC=1C=C(C2=C(N(C=N2)CC2=CC(=CC=C2)F)C=1)NS(=O)(=O)C DQPTTZSMFDZHOG-UHFFFAOYSA-N 0.000 description 1
- UYFDINYAHQHKHP-UHFFFAOYSA-N N-benzyl-5-bromo-3-fluoro-2-nitroaniline Chemical compound C(C1=CC=CC=C1)NC1=C(C(=CC(=C1)Br)F)[N+](=O)[O-] UYFDINYAHQHKHP-UHFFFAOYSA-N 0.000 description 1
- DBQYMYIRKYQHPJ-UHFFFAOYSA-N N-benzyl-5-bromo-3-methylsulfanyl-2-nitroaniline Chemical compound C(C1=CC=CC=C1)NC1=C(C(=CC(=C1)Br)SC)[N+](=O)[O-] DBQYMYIRKYQHPJ-UHFFFAOYSA-N 0.000 description 1
- AHQNQCHICALEPT-UHFFFAOYSA-N N-benzyl-5-bromo-3-methylsulfonyl-2-nitroaniline Chemical compound C(C1=CC=CC=C1)NC1=C(C(=CC(=C1)Br)S(=O)(=O)C)[N+](=O)[O-] AHQNQCHICALEPT-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 102000007999 Nuclear Proteins Human genes 0.000 description 1
- 108010089610 Nuclear Proteins Proteins 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- 108010003571 Nut Proteins Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 102100027069 Odontogenic ameloblast-associated protein Human genes 0.000 description 1
- 101710091533 Odontogenic ameloblast-associated protein Proteins 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 244000025272 Persea americana Species 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- 108010012271 Positive Transcriptional Elongation Factor B Proteins 0.000 description 1
- 102000019014 Positive Transcriptional Elongation Factor B Human genes 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 108091030071 RNAI Proteins 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000255588 Tephritidae Species 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 101710195626 Transcriptional activator protein Proteins 0.000 description 1
- 101710150448 Transcriptional regulator Myc Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- AVPMRIWGOGRNBF-UHFFFAOYSA-N [bromo(fluoro)methyl]benzene Chemical compound FC(Br)C1=CC=CC=C1 AVPMRIWGOGRNBF-UHFFFAOYSA-N 0.000 description 1
- 206010000210 abortion Diseases 0.000 description 1
- 231100000176 abortion Toxicity 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- AEMOLEFTQBMNLQ-BKBMJHBISA-N alpha-D-galacturonic acid Chemical class O[C@H]1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-BKBMJHBISA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005870 benzindolyl group Chemical group 0.000 description 1
- 125000005875 benzo[b][1,4]dioxepinyl group Chemical group 0.000 description 1
- 125000005876 benzo[b][1,4]oxazinyl group Chemical group 0.000 description 1
- 125000000928 benzodioxinyl group Chemical group O1C(=COC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000005878 benzonaphthofuranyl group Chemical group 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000012472 biological sample Substances 0.000 description 1
- 230000001851 biosynthetic effect Effects 0.000 description 1
- 230000006287 biotinylation Effects 0.000 description 1
- 238000007413 biotinylation Methods 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000001364 causal effect Effects 0.000 description 1
- 230000025084 cell cycle arrest Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000006329 citrullination Effects 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 239000002875 cyclin dependent kinase inhibitor Substances 0.000 description 1
- 229940043378 cyclin-dependent kinase inhibitor Drugs 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000002498 deadly effect Effects 0.000 description 1
- 125000005507 decahydroisoquinolyl group Chemical group 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 150000001975 deuterium Chemical group 0.000 description 1
- 125000005509 dibenzothiophenyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000002158 endotoxin Substances 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- ZCRZCMUDOWDGOB-UHFFFAOYSA-N ethanesulfonimidic acid Chemical compound CCS(N)(=O)=O ZCRZCMUDOWDGOB-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HZAIHFIZXXSPFA-UHFFFAOYSA-N ethynylcyclopropane Chemical group [C+]#CC1CC1 HZAIHFIZXXSPFA-UHFFFAOYSA-N 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical group C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000009368 gene silencing by RNA Effects 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 208000005017 glioblastoma Diseases 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 230000003862 health status Effects 0.000 description 1
- 239000000833 heterodimer Substances 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- 102000033785 histone binding proteins Human genes 0.000 description 1
- 108091009732 histone binding proteins Proteins 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- XMBWDFGMSWQBCA-YPZZEJLDSA-N iodane Chemical compound [125IH] XMBWDFGMSWQBCA-YPZZEJLDSA-N 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229940044173 iodine-125 Drugs 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 235000018977 lysine Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WYSPMXSNCAFCFV-UHFFFAOYSA-N methyl 2-fluoro-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C=C1F WYSPMXSNCAFCFV-UHFFFAOYSA-N 0.000 description 1
- DRUFUUXPRULILR-UHFFFAOYSA-N methyl 5-bromo-2-fluoro-4-hydroxybenzoate Chemical compound COC(=O)C1=CC(Br)=C(O)C=C1F DRUFUUXPRULILR-UHFFFAOYSA-N 0.000 description 1
- WQRFOIQALFKLTI-UHFFFAOYSA-N methyl 5-bromo-4-(cyclopropylmethoxy)-2-fluorobenzoate Chemical compound BrC=1C(=CC(=C(C(=O)OC)C=1)F)OCC1CC1 WQRFOIQALFKLTI-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000009456 molecular mechanism Effects 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 125000005322 morpholin-1-yl group Chemical group 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Chemical group C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 125000005060 octahydroindolyl group Chemical group N1(CCC2CCCCC12)* 0.000 description 1
- 125000005061 octahydroisoindolyl group Chemical group C1(NCC2CCCCC12)* 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 230000026731 phosphorylation Effects 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000009596 postnatal growth Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 229940074439 potassium sodium tartrate Drugs 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- DRINJBFRTLBHNF-UHFFFAOYSA-N propane-2-sulfonyl chloride Chemical compound CC(C)S(Cl)(=O)=O DRINJBFRTLBHNF-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000004952 protein activity Effects 0.000 description 1
- 230000019639 protein methylation Effects 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000012363 selectfluor Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- LYPGDCWPTHTUDO-UHFFFAOYSA-M sodium;methanesulfinate Chemical compound [Na+].CS([O-])=O LYPGDCWPTHTUDO-UHFFFAOYSA-M 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 206010041823 squamous cell carcinoma Diseases 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000010741 sumoylation Effects 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- AHJWSRRHTXRLAQ-UHFFFAOYSA-N tetramethoxymethane Chemical compound COC(OC)(OC)OC AHJWSRRHTXRLAQ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005985 thienyl[1,3]dithianyl group Chemical group 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- INQOMBQAUSQDDS-FIBGUPNXSA-N trideuterio(iodo)methane Chemical compound [2H]C([2H])([2H])I INQOMBQAUSQDDS-FIBGUPNXSA-N 0.000 description 1
- CWLNAJYDRSIKJS-UHFFFAOYSA-N triethoxymethoxyethane Chemical compound CCOC(OCC)(OCC)OCC CWLNAJYDRSIKJS-UHFFFAOYSA-N 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005455 trithianyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000010798 ubiquitination Methods 0.000 description 1
- 230000034512 ubiquitination Effects 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
- C07D473/34—Nitrogen atom attached in position 6, e.g. adenine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/428—Thiazoles condensed with carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/437—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a five-membered ring having nitrogen as a ring hetero atom, e.g. indolizine, beta-carboline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/06—Peri-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201562148098P | 2015-04-15 | 2015-04-15 | |
| US62/148,098 | 2015-04-15 | ||
| PCT/US2016/027874 WO2016168682A2 (en) | 2015-04-15 | 2016-04-15 | Bromodomain inhibitor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20170135938A true KR20170135938A (ko) | 2017-12-08 |
Family
ID=57126317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020177032364A Withdrawn KR20170135938A (ko) | 2015-04-15 | 2016-04-15 | 브로모도메인 억제제 |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US9908885B2 (enExample) |
| EP (2) | EP3831383A1 (enExample) |
| JP (1) | JP6856543B2 (enExample) |
| KR (1) | KR20170135938A (enExample) |
| CN (1) | CN107635558A (enExample) |
| AR (1) | AR104259A1 (enExample) |
| AU (1) | AU2016249273B2 (enExample) |
| CA (1) | CA2982588A1 (enExample) |
| CL (1) | CL2017002606A1 (enExample) |
| CO (1) | CO2017011484A2 (enExample) |
| EA (1) | EA201792229A1 (enExample) |
| EC (1) | ECSP17070706A (enExample) |
| ES (1) | ES2868355T3 (enExample) |
| HK (1) | HK1243326A1 (enExample) |
| IL (1) | IL255006A0 (enExample) |
| MX (1) | MX2017013207A (enExample) |
| PE (1) | PE20180258A1 (enExample) |
| PH (1) | PH12017501888A1 (enExample) |
| SG (1) | SG11201708470SA (enExample) |
| TW (1) | TW201643153A (enExample) |
| WO (1) | WO2016168682A2 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2023090859A1 (ko) * | 2021-11-17 | 2023-05-25 | 일동제약(주) | 아이속사졸 유도체의 제조 방법 및 그의 신규한 중간체 |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR104259A1 (es) * | 2015-04-15 | 2017-07-05 | Celgene Quanticel Res Inc | Inhibidores de bromodominio |
| AU2016305513A1 (en) | 2015-08-11 | 2018-03-08 | Neomed Institute | Aryl-substituted dihydroquinolinones, their preparation and their use as pharmaceuticals |
| WO2017024406A1 (en) | 2015-08-11 | 2017-02-16 | Neomed Institute | N-substituted bicyclic lactams, their preparation and their use as pharmaceuticals |
| JP6912039B2 (ja) | 2015-08-12 | 2021-07-28 | ネオメド インスティテュートNeomed Institute | 置換ベンゾイミダゾール、それらの調製及び医薬品としてのそれらの使用 |
| US10501459B2 (en) | 2015-10-21 | 2019-12-10 | Neomed Institute | Substituted imidazo[1,2-a]pyridines as bromodomain inhibitors |
| US10519151B2 (en) | 2016-01-28 | 2019-12-31 | Neomed Institute | Substituted [1,2,4]triazolo[4,3-A]pyridines, their preparation and their use as pharmaceuticals |
| US10150754B2 (en) | 2016-04-19 | 2018-12-11 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| CN108314680A (zh) * | 2017-01-16 | 2018-07-24 | 凯惠科技发展(上海)有限公司 | 一种含芳环化合物、其制备方法、药物组合物及应用 |
| TW202332436A (zh) | 2017-04-18 | 2023-08-16 | 美商塞爾基因定量細胞研究公司 | 治療用化合物 |
| CN107098844B (zh) * | 2017-05-17 | 2019-07-30 | 许昌学院 | 一种c-5位硝基取代的酰基吲哚啉类化合物的合成方法 |
| MX2020006612A (es) * | 2017-12-20 | 2020-11-09 | Betta Pharmaceuticals Co Ltd | Compuesto que funciona como inhibidor de proteína de bromodominio y composición. |
| JP2021512167A (ja) | 2018-01-30 | 2021-05-13 | フォグホーン セラピューティクス インコーポレイテッドFoghorn Therapeutics Inc. | 障害を治療するための方法及び化合物 |
| CN108516973A (zh) * | 2018-03-30 | 2018-09-11 | 广西师范大学 | 3-苯并噻唑-1-(3-二甲氨基)丙基喹啉-4-酮衍生物及其制备方法和应用 |
| BR112021001019A2 (pt) * | 2018-07-23 | 2021-04-13 | Celgene Quanticel Research, Inc. | Processo para a preparação de inibidor de bromodomínio |
| TWI833819B (zh) | 2018-10-05 | 2024-03-01 | 美商安尼波那生物公司 | 用於治療與apj受體活性相關的病狀的化合物及組成物 |
| AU2019372121A1 (en) | 2018-10-30 | 2021-05-27 | Nuvation Bio Inc. | Heterocyclic compounds as BET inhibitors |
| JP2022523073A (ja) * | 2019-01-29 | 2022-04-21 | フォグホーン セラピューティクス インコーポレイテッド | 化合物及びその使用 |
| US20230065463A1 (en) * | 2019-01-29 | 2023-03-02 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| WO2020160198A1 (en) | 2019-01-29 | 2020-08-06 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| WO2020160196A1 (en) * | 2019-01-29 | 2020-08-06 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| JP2022053557A (ja) * | 2019-02-08 | 2022-04-06 | マルホ株式会社 | ピリドン誘導体 |
| EP4424379A3 (en) * | 2019-04-24 | 2024-10-30 | Convergene Llc | Small molecule bromodomain inhibitors and uses thereof |
| CN112174945B (zh) * | 2019-07-02 | 2022-06-07 | 四川大学 | 具有抗癌作用的吲唑类化合物及其制备方法和用途 |
| KR102677015B1 (ko) * | 2019-07-02 | 2024-06-19 | 누베이션 바이오 인크. | Bet 억제제로서의 헤테로시클릭 화합물 |
| WO2021022163A2 (en) * | 2019-07-31 | 2021-02-04 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| IL295101B1 (en) | 2020-01-29 | 2025-10-01 | Foghorn Therapeutics Inc | Materials and their use |
| WO2022025880A1 (en) * | 2020-07-29 | 2022-02-03 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| US11787800B2 (en) | 2020-07-29 | 2023-10-17 | Foghorn Therapeutics Inc. | BRD9 degraders and uses thereof |
| US11767330B2 (en) | 2021-07-06 | 2023-09-26 | Foghorn Therapeutics Inc. | Citrate salt, pharmaceutical compositions, and methods of making and using the same |
| CN114014842B (zh) * | 2021-11-04 | 2024-03-01 | 中国药科大学 | 一种杂环酮类化合物与其组合物及其制备方法和应用 |
| GB202213163D0 (en) | 2022-09-08 | 2022-10-26 | Cambridge Entpr Ltd | Novel compounds, compositions and therapeutic uses thereof |
Family Cites Families (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1349418A (en) * | 1919-08-05 | 1920-08-10 | George F Flynn | Motor-support |
| US3590036A (en) * | 1968-11-18 | 1971-06-29 | George Y Lesher | Naphthyridine-3-carboxylic acids,their derivatives and preparation thereof |
| DE2011970A1 (en) | 1970-03-13 | 1971-11-18 | CH. Boehringer Sohn, 6507 Ingelheim | Imidazo-(1, 2-a)- pyrimidines prepn |
| US3635667A (en) | 1970-07-23 | 1972-01-18 | Fmc Corp | Drycleaning with hydrogen peroxide |
| GB1322318A (en) * | 1971-05-19 | 1973-07-04 | Sterling Drug Inc | 1-alkyl-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acids and esters |
| BE786028A (fr) | 1971-07-08 | 1973-01-08 | Boehringer Sohn Ingelheim | 2,3-dihydro-oxo-imidazo(1,2-a)-pyrimidines, leurs sels d'addition avec des acides et procedes pour les fabriquer |
| DE2356005A1 (de) | 1973-11-09 | 1975-05-22 | Boehringer Sohn Ingelheim | Neue 7-amino-imidazo eckige klammer auf 1,2-a eckige klammer zu pyrimidine, diese enthaltende arzneimittel sowie verfahren zu deren herstellung |
| AU577105B2 (en) | 1985-04-02 | 1988-09-15 | T.P.O. :Pharmachim: | Acylaminic penicillin derivatives |
| US6117940A (en) | 1997-10-17 | 2000-09-12 | Mjalli; Adnan M. M. | Amino-ketone solid support templates |
| KR100904011B1 (ko) * | 2000-06-12 | 2009-06-22 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 1,2-디하이드로피리딘 화합물 및 그의 제조 방법 |
| GB0129260D0 (en) * | 2001-12-06 | 2002-01-23 | Eisai London Res Lab Ltd | Pharmaceutical compositions and their uses |
| MXPA05002004A (es) | 2002-09-26 | 2005-04-28 | Pfizer | Derivados de pirazol. |
| JP2005089352A (ja) | 2003-09-16 | 2005-04-07 | Kissei Pharmaceut Co Ltd | 新規なイミダゾ[1,5−a]ピラジン誘導体、それを含有する医薬組成物およびそれらの用途 |
| AU2004276268B2 (en) * | 2003-09-23 | 2009-01-29 | Merck Sharp & Dohme Corp. | Isoquinoline potassium channel inhibitors |
| WO2005030791A2 (en) | 2003-09-23 | 2005-04-07 | Merck & Co., Inc. | Isoquinolinone potassium channel inhibitors |
| KR100703068B1 (ko) | 2003-12-30 | 2007-04-05 | 에스케이케미칼주식회사 | 피리딘 유도체와 이의 제조방법, 및 이를 포함하는약제조성물 |
| TW200536830A (en) * | 2004-02-06 | 2005-11-16 | Chugai Pharmaceutical Co Ltd | 1-(2H)-isoquinolone derivative |
| WO2005095384A1 (en) | 2004-04-01 | 2005-10-13 | Astellas Pharma Inc. | Pyrazine derivatives and pharmaceutical use thereof as adenosine antagonists |
| GB0420722D0 (en) | 2004-09-17 | 2004-10-20 | Addex Pharmaceuticals Sa | Novel allosteric modulators |
| KR100781704B1 (ko) | 2005-04-20 | 2007-12-03 | 에스케이케미칼주식회사 | 피리딘 유도체와 이의 제조방법, 및 이를 포함하는약제조성물 |
| US7452892B2 (en) | 2005-06-17 | 2008-11-18 | Bristol-Myers Squibb Company | Triazolopyrimidine cannabinoid receptor 1 antagonists |
| JP5049970B2 (ja) | 2005-07-26 | 2012-10-17 | サノフイ | Rho−キナーゼ阻害剤としてのシクロヘキシルアミンイソキノロン誘導体 |
| UA93882C2 (ru) | 2005-07-26 | 2011-03-25 | Санофи-Авентис | Пиперидинил-замещенные производные изохинолона kak ингибиторы rho-киназы |
| US20070099911A1 (en) | 2005-10-28 | 2007-05-03 | Wyeth | Pyrroloquinolinone derivatives as 5-hydroxytryptamine-6 ligands |
| US7795262B2 (en) | 2006-03-10 | 2010-09-14 | Neurogen Corporation | Piperazinyl oxoalkyl tetrahydroisoquinolines and related analogues |
| GB0612428D0 (en) | 2006-06-22 | 2006-08-02 | Prolysis Ltd | Antibacterial agents |
| MY150746A (en) | 2006-12-27 | 2014-02-28 | Sanofi Aventis | Substituted isoquinoline and isoquinolinone derivatives as inhibitors of rho-kinase |
| WO2008077556A1 (en) | 2006-12-27 | 2008-07-03 | Sanofi-Aventis | Cycloalkylamine substituted isoquinoline and isoquinolinone derivatives |
| NZ577980A (en) | 2006-12-27 | 2012-01-12 | Sanofi Aventis | Cycloalkylamine substituted isoquinolone derivatives |
| WO2009029214A1 (en) * | 2007-08-23 | 2009-03-05 | Amgen Inc. | Isoquinolone derivatives as phosphodiesterase 10 inhibitors |
| MX2010008375A (es) | 2008-01-30 | 2011-03-04 | Cephalon Inc Star | Derivados de piperidina espirocíclicos substituidos como ligandos de receptores de histamina-3 (h3). |
| JP5433691B2 (ja) | 2008-06-25 | 2014-03-05 | ブリストル−マイヤーズ スクイブ カンパニー | Hiv結合阻害剤としてのジケトピペリジン誘導体 |
| WO2010039186A2 (en) * | 2008-09-23 | 2010-04-08 | Renovis, Inc. | Compounds useful as faah modulators and uses thereof |
| EP2196465A1 (en) | 2008-12-15 | 2010-06-16 | Almirall, S.A. | (3-oxo)pyridazin-4-ylurea derivatives as PDE4 inhibitors |
| US8283360B2 (en) * | 2008-12-19 | 2012-10-09 | Merck Sharp & Dohme Corp. | Bicyclic heterocyclic derivatives and methods of use thereof |
| RU2615130C2 (ru) | 2009-10-06 | 2017-04-04 | Милленниум Фармасьютикалз, Инк | Гетероциклические соединения, используемые в качестве ингибиторов pdk1 |
| CA2784710A1 (en) * | 2009-12-15 | 2011-06-23 | Shionogi & Co., Ltd. | Oxadiazole derivative having endothelial lipase inhibitory activity |
| AU2011273931B2 (en) | 2010-06-28 | 2015-04-23 | Merck Patent Gmbh | 2,4- diaryl - substituted [1,8] naphthyridines as kinase inhibitors for use against cancer |
| JPWO2012086735A1 (ja) * | 2010-12-22 | 2014-06-05 | 大正製薬株式会社 | 縮合複素環化合物 |
| WO2012162254A1 (en) | 2011-05-23 | 2012-11-29 | Elan Pharmaceuticals, Inc. | Inhibitors of lrrk2 kinase activity |
| RU2477723C2 (ru) * | 2011-06-16 | 2013-03-20 | Общество С Ограниченной Ответственностью "Фьюжн Фарма" | Ингибиторы протеинкиназ (варианты), их применение для лечения онкологических заболеваний и фармацевтическая композиция на их основе |
| CN102827073A (zh) | 2011-06-17 | 2012-12-19 | 安吉奥斯医药品有限公司 | 治疗活性组合物和它们的使用方法 |
| RU2014121983A (ru) | 2011-10-31 | 2015-12-10 | Ксенон Фармасьютикалз Инк. | Биарильные простоэфирные сульфонамиды и их применение в качестве терапевтических средств |
| CN103183675A (zh) | 2011-12-27 | 2013-07-03 | 山东轩竹医药科技有限公司 | 磷酸二酯酶-4抑制剂 |
| WO2013130855A1 (en) * | 2012-03-02 | 2013-09-06 | Takeda Pharmaceutical Company Limited | Indazole derivatives |
| TR201807207T4 (tr) * | 2012-06-11 | 2018-06-21 | Ucb Biopharma Sprl | Tnf-alfa modüle edici benzimidazol bileşikleri. |
| JP2014024838A (ja) * | 2012-06-21 | 2014-02-06 | Taisho Pharmaceutical Co Ltd | 縮合複素環化合物を有効成分として含有する血糖低下作用薬 |
| WO2014015088A1 (en) * | 2012-07-19 | 2014-01-23 | Bristol-Myers Squibb Company | Amide, urea or sulfone amide linked benzothiazole inhibitors of endothelial lipase |
| US9765039B2 (en) | 2012-11-21 | 2017-09-19 | Zenith Epigenetics Ltd. | Biaryl derivatives as bromodomain inhibitors |
| BR112015016580A2 (pt) | 2013-01-11 | 2017-07-11 | Fujifilm Corp | composto heterocíclico contendo nitrogênio ou sal deste |
| AU2014249192B2 (en) * | 2013-03-11 | 2017-12-21 | The Regents Of The University Of Michigan | BET bromodomain inhibitors and therapeutic methods using the same |
| KR102244719B1 (ko) * | 2013-03-15 | 2021-04-26 | 플렉시콘 인코퍼레이티드 | 헤테로시클릭 화합물 및 그의 용도 |
| EA029312B1 (ru) * | 2013-05-27 | 2018-03-30 | Новартис Аг | Производные имидазопирролидинона и их применение при лечении заболеваний |
| WO2015004533A2 (en) * | 2013-06-21 | 2015-01-15 | Zenith Epigenetics Corp. | Novel substituted bicyclic compounds as bromodomain inhibitors |
| WO2014205594A1 (en) * | 2013-06-24 | 2014-12-31 | Merck Sharp & Dohme Corp. | Substituted benzofuran compounds and methods of use thereof for treatment of viral diseases |
| HUE040645T2 (hu) * | 2013-06-26 | 2019-03-28 | Abbvie Inc | BTK-inhibitor primer karboxamidok |
| HRP20200341T1 (hr) * | 2013-10-18 | 2020-06-12 | Celgene Quanticel Research, Inc. | Bromodomenski (bet) inhibitori |
| WO2015081189A1 (en) * | 2013-11-26 | 2015-06-04 | Incyte Corporation | Bicyclic heterocycles as bet protein inhibitors |
| RU2695664C1 (ru) * | 2013-12-09 | 2019-07-25 | Юсб Байофарма Спрл | Производные имидазопиридина в качестве модуляторов активности tnf |
| WO2015105749A1 (en) * | 2014-01-07 | 2015-07-16 | Bristol-Myers Squibb Company | Sulfone amide linked benzothiazole inhibitors of endothelial lipase |
| US9499551B2 (en) | 2014-01-24 | 2016-11-22 | Confluence Life Sciences, Inc. | Substituted pyrrolo[2,3-b]pyridines for treating cancer or inflammatory diseases |
| KR102702503B1 (ko) * | 2014-04-23 | 2024-09-05 | 인사이트 홀딩스 코포레이션 | BET 단백질의 저해제로서의 1H-피롤로[2,3-c]피리딘-7(6H)-온 및 피라졸로[3,4-c]피리딘-7(6H)-온 |
| MA40940A (fr) * | 2014-11-10 | 2017-09-19 | Constellation Pharmaceuticals Inc | Pyrrolopyridines substituées utilisées en tant qu'inhibiteurs de bromodomaines |
| MA40943A (fr) * | 2014-11-10 | 2017-09-19 | Constellation Pharmaceuticals Inc | Pyrrolopyridines substituées utilisées en tant qu'inhibiteurs de bromodomaines |
| WO2016086200A1 (en) | 2014-11-27 | 2016-06-02 | Genentech, Inc. | 4,5,6,7-tetrahydro-1 h-pyrazolo[4,3-c]pyridin-3-amine compounds as cbp and/or ep300 inhibitors |
| US11319318B2 (en) * | 2015-03-05 | 2022-05-03 | Boehringer Ingelheim International Gmbh | Pyridinones and isoquinolinones as inhibitors of the bromodomain BRD9 |
| AR104259A1 (es) * | 2015-04-15 | 2017-07-05 | Celgene Quanticel Res Inc | Inhibidores de bromodominio |
| TW201642860A (zh) * | 2015-04-22 | 2016-12-16 | 塞爾基因定量細胞研究公司 | 布羅莫結構域抑制劑 |
-
2016
- 2016-04-14 AR ARP160101014A patent/AR104259A1/es unknown
- 2016-04-15 SG SG11201708470SA patent/SG11201708470SA/en unknown
- 2016-04-15 US US15/130,503 patent/US9908885B2/en active Active
- 2016-04-15 MX MX2017013207A patent/MX2017013207A/es unknown
- 2016-04-15 AU AU2016249273A patent/AU2016249273B2/en not_active Ceased
- 2016-04-15 KR KR1020177032364A patent/KR20170135938A/ko not_active Withdrawn
- 2016-04-15 EP EP20215944.8A patent/EP3831383A1/en not_active Withdrawn
- 2016-04-15 PE PE2017002197A patent/PE20180258A1/es not_active Application Discontinuation
- 2016-04-15 TW TW105111879A patent/TW201643153A/zh unknown
- 2016-04-15 CN CN201680034663.2A patent/CN107635558A/zh active Pending
- 2016-04-15 EA EA201792229A patent/EA201792229A1/ru unknown
- 2016-04-15 EP EP16780891.4A patent/EP3283077B1/en active Active
- 2016-04-15 WO PCT/US2016/027874 patent/WO2016168682A2/en not_active Ceased
- 2016-04-15 CA CA2982588A patent/CA2982588A1/en active Pending
- 2016-04-15 JP JP2017553414A patent/JP6856543B2/ja not_active Expired - Fee Related
- 2016-04-15 ES ES16780891T patent/ES2868355T3/es active Active
- 2016-04-15 HK HK18102785.5A patent/HK1243326A1/zh unknown
-
2017
- 2017-10-13 CL CL2017002606A patent/CL2017002606A1/es unknown
- 2017-10-15 IL IL255006A patent/IL255006A0/en unknown
- 2017-10-18 PH PH12017501888A patent/PH12017501888A1/en unknown
- 2017-10-24 EC ECIEPI201770706A patent/ECSP17070706A/es unknown
- 2017-11-08 CO CONC2017/0011484A patent/CO2017011484A2/es unknown
-
2018
- 2018-01-12 US US15/870,557 patent/US10494371B2/en active Active
-
2019
- 2019-11-04 US US16/673,839 patent/US10807982B2/en active Active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2023090859A1 (ko) * | 2021-11-17 | 2023-05-25 | 일동제약(주) | 아이속사졸 유도체의 제조 방법 및 그의 신규한 중간체 |
Also Published As
| Publication number | Publication date |
|---|---|
| WO2016168682A3 (en) | 2016-12-08 |
| CL2017002606A1 (es) | 2018-05-18 |
| SG11201708470SA (en) | 2017-11-29 |
| US20200071332A1 (en) | 2020-03-05 |
| PE20180258A1 (es) | 2018-02-05 |
| HK1243326A1 (zh) | 2018-07-13 |
| US20170050968A1 (en) | 2017-02-23 |
| TW201643153A (zh) | 2016-12-16 |
| EP3283077A4 (en) | 2019-01-23 |
| EP3283077A2 (en) | 2018-02-21 |
| JP6856543B2 (ja) | 2021-04-07 |
| CA2982588A1 (en) | 2016-10-20 |
| US10494371B2 (en) | 2019-12-03 |
| ES2868355T3 (es) | 2021-10-21 |
| AU2016249273A1 (en) | 2017-11-09 |
| AU2016249273B2 (en) | 2020-07-09 |
| ECSP17070706A (es) | 2017-12-01 |
| PH12017501888A1 (en) | 2018-03-05 |
| MX2017013207A (es) | 2018-02-19 |
| EP3831383A1 (en) | 2021-06-09 |
| EP3283077B1 (en) | 2021-03-10 |
| AR104259A1 (es) | 2017-07-05 |
| US20180134710A1 (en) | 2018-05-17 |
| WO2016168682A2 (en) | 2016-10-20 |
| US10807982B2 (en) | 2020-10-20 |
| JP2018511626A (ja) | 2018-04-26 |
| IL255006A0 (en) | 2017-12-31 |
| EA201792229A1 (ru) | 2018-05-31 |
| CO2017011484A2 (es) | 2018-01-31 |
| US9908885B2 (en) | 2018-03-06 |
| CN107635558A (zh) | 2018-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10807982B2 (en) | Bromodomain inhibitors | |
| US11884680B2 (en) | Bromodomain inhibitors | |
| HK40080347A (en) | Bromodomain inhibitors | |
| HK40017640A (en) | Bromodomain inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20171108 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination |