KR20100024494A - 퀴나졸리논 화합물 및 이의 사용 방법 - Google Patents
퀴나졸리논 화합물 및 이의 사용 방법 Download PDFInfo
- Publication number
- KR20100024494A KR20100024494A KR1020107001013A KR20107001013A KR20100024494A KR 20100024494 A KR20100024494 A KR 20100024494A KR 1020107001013 A KR1020107001013 A KR 1020107001013A KR 20107001013 A KR20107001013 A KR 20107001013A KR 20100024494 A KR20100024494 A KR 20100024494A
- Authority
- KR
- South Korea
- Prior art keywords
- chloro
- compound
- oxo
- propyl
- phenylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 205
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 title abstract description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 220
- -1 quinazolinone compound Chemical class 0.000 claims abstract description 107
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 89
- 201000011510 cancer Diseases 0.000 claims abstract description 50
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 37
- 201000010099 disease Diseases 0.000 claims abstract description 35
- 230000002062 proliferating effect Effects 0.000 claims abstract description 31
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 20
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims description 87
- 125000000217 alkyl group Chemical group 0.000 claims description 67
- 125000003118 aryl group Chemical group 0.000 claims description 56
- 125000003342 alkenyl group Chemical group 0.000 claims description 48
- 125000000304 alkynyl group Chemical group 0.000 claims description 48
- 238000011282 treatment Methods 0.000 claims description 42
- 125000001072 heteroaryl group Chemical group 0.000 claims description 40
- 125000000623 heterocyclic group Chemical group 0.000 claims description 35
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 35
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 18
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical class 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000004414 alkyl thio group Chemical group 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 239000002246 antineoplastic agent Substances 0.000 claims description 12
- 229940127089 cytotoxic agent Drugs 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 12
- 239000003937 drug carrier Substances 0.000 claims description 10
- 239000002207 metabolite Substances 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 9
- 229960004397 cyclophosphamide Drugs 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 9
- 229940002612 prodrug Drugs 0.000 claims description 9
- 239000000651 prodrug Substances 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 230000004614 tumor growth Effects 0.000 claims description 9
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 claims description 8
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 8
- 125000005157 alkyl carboxy group Chemical group 0.000 claims description 8
- 229960002949 fluorouracil Drugs 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 7
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 7
- 125000005518 carboxamido group Chemical group 0.000 claims description 7
- 125000004112 carboxyamino group Chemical group [H]OC(=O)N([H])[*] 0.000 claims description 7
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 7
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 claims description 6
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 claims description 6
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 claims description 6
- 229960000485 methotrexate Drugs 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 claims description 5
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 claims description 5
- BLCLNMBMMGCOAS-URPVMXJPSA-N Goserelin Chemical compound C([C@@H](C(=O)N[C@H](COC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NNC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 BLCLNMBMMGCOAS-URPVMXJPSA-N 0.000 claims description 5
- 108010069236 Goserelin Proteins 0.000 claims description 5
- 229930012538 Paclitaxel Natural products 0.000 claims description 5
- 125000005422 alkyl sulfonamido group Chemical group 0.000 claims description 5
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 5
- 229960001904 epirubicin Drugs 0.000 claims description 5
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 5
- 229960001592 paclitaxel Drugs 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 claims description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005551 L01XE03 - Erlotinib Substances 0.000 claims description 4
- 239000005511 L01XE05 - Sorafenib Substances 0.000 claims description 4
- 206010025323 Lymphomas Diseases 0.000 claims description 4
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims description 4
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 claims description 4
- 229960004562 carboplatin Drugs 0.000 claims description 4
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 claims description 4
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 claims description 4
- 229960002913 goserelin Drugs 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229960004641 rituximab Drugs 0.000 claims description 4
- 230000004083 survival effect Effects 0.000 claims description 4
- NNQVTJNCYBICNC-RUZDIDTESA-N 2-[(1r)-1-[3-aminopropyl(benzyl)amino]propyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CC=C1 NNQVTJNCYBICNC-RUZDIDTESA-N 0.000 claims description 3
- 206010000830 Acute leukaemia Diseases 0.000 claims description 3
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 claims description 3
- 101100002068 Bacillus subtilis (strain 168) araR gene Proteins 0.000 claims description 3
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 claims description 3
- 108010092160 Dactinomycin Proteins 0.000 claims description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 claims description 3
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 claims description 3
- 239000005411 L01XE02 - Gefitinib Substances 0.000 claims description 3
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 claims description 3
- 208000034578 Multiple myelomas Diseases 0.000 claims description 3
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 claims description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 3
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 claims description 3
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 3
- 229960001220 amsacrine Drugs 0.000 claims description 3
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 claims description 3
- 229960002932 anastrozole Drugs 0.000 claims description 3
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 claims description 3
- 101150044616 araC gene Proteins 0.000 claims description 3
- 229960000397 bevacizumab Drugs 0.000 claims description 3
- 229940127093 camptothecin Drugs 0.000 claims description 3
- 229960005395 cetuximab Drugs 0.000 claims description 3
- 208000024207 chronic leukemia Diseases 0.000 claims description 3
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 3
- 229960004316 cisplatin Drugs 0.000 claims description 3
- 229960000640 dactinomycin Drugs 0.000 claims description 3
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 claims description 3
- 229960003668 docetaxel Drugs 0.000 claims description 3
- 229930013356 epothilone Natural products 0.000 claims description 3
- 150000003883 epothilone derivatives Chemical class 0.000 claims description 3
- 229960001433 erlotinib Drugs 0.000 claims description 3
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 claims description 3
- 229960005420 etoposide Drugs 0.000 claims description 3
- 229960000255 exemestane Drugs 0.000 claims description 3
- 229960002584 gefitinib Drugs 0.000 claims description 3
- 229960005277 gemcitabine Drugs 0.000 claims description 3
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000003106 haloaryl group Chemical group 0.000 claims description 3
- 229960000908 idarubicin Drugs 0.000 claims description 3
- 229960003881 letrozole Drugs 0.000 claims description 3
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 claims description 3
- 208000032839 leukemia Diseases 0.000 claims description 3
- 229960004844 lovastatin Drugs 0.000 claims description 3
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 claims description 3
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 claims description 3
- 201000001441 melanoma Diseases 0.000 claims description 3
- 208000037819 metastatic cancer Diseases 0.000 claims description 3
- 208000011575 metastatic malignant neoplasm Diseases 0.000 claims description 3
- UPJSUQWHUVLLNW-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(Cl)C=CC=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 UPJSUQWHUVLLNW-XMMPIXPASA-N 0.000 claims description 3
- 229950006344 nocodazole Drugs 0.000 claims description 3
- 229960004622 raloxifene Drugs 0.000 claims description 3
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 claims description 3
- 229960003787 sorafenib Drugs 0.000 claims description 3
- 229960001603 tamoxifen Drugs 0.000 claims description 3
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 claims description 3
- 229960001278 teniposide Drugs 0.000 claims description 3
- 229960000575 trastuzumab Drugs 0.000 claims description 3
- 229960003048 vinblastine Drugs 0.000 claims description 3
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 claims description 3
- 229960004528 vincristine Drugs 0.000 claims description 3
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 claims description 3
- LFQSXOVCXBUCAD-HHHXNRCGSA-N 2-[(1r)-1-[3-aminopropyl-[(4-methylphenyl)methyl]amino]but-3-ynyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound C1=CC(C)=CC=C1CN(CCCN)[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 LFQSXOVCXBUCAD-HHHXNRCGSA-N 0.000 claims description 2
- 206010006187 Breast cancer Diseases 0.000 claims description 2
- 208000026310 Breast neoplasm Diseases 0.000 claims description 2
- 206010009944 Colon cancer Diseases 0.000 claims description 2
- 206010018338 Glioma Diseases 0.000 claims description 2
- 208000018142 Leiomyosarcoma Diseases 0.000 claims description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 2
- 206010033128 Ovarian cancer Diseases 0.000 claims description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 2
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 2
- 208000006994 Precancerous Conditions Diseases 0.000 claims description 2
- 206010060862 Prostate cancer Diseases 0.000 claims description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 2
- 206010039491 Sarcoma Diseases 0.000 claims description 2
- 208000009956 adenocarcinoma Diseases 0.000 claims description 2
- 208000029742 colonic neoplasm Diseases 0.000 claims description 2
- 201000010536 head and neck cancer Diseases 0.000 claims description 2
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 2
- 206010073071 hepatocellular carcinoma Diseases 0.000 claims description 2
- 208000029824 high grade glioma Diseases 0.000 claims description 2
- 201000005202 lung cancer Diseases 0.000 claims description 2
- 208000020816 lung neoplasm Diseases 0.000 claims description 2
- 201000011614 malignant glioma Diseases 0.000 claims description 2
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 2
- 229960001156 mitoxantrone Drugs 0.000 claims description 2
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 claims description 2
- YAYZWTCHLOBYQD-UHFFFAOYSA-N n-(2-aminoethyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCN)C(=O)C1=CC=CC(Cl)=C1F YAYZWTCHLOBYQD-UHFFFAOYSA-N 0.000 claims description 2
- RTBHIXZJQLKSBT-JOCHJYFZSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3,4,5-tetrafluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C(F)=C(F)C=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 RTBHIXZJQLKSBT-JOCHJYFZSA-N 0.000 claims description 2
- OHXWDTHDBWOXTK-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3,5-trifluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C=C(F)C=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 OHXWDTHDBWOXTK-XMMPIXPASA-N 0.000 claims description 2
- SYLQVCWRPBEWMT-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3-difluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C=CC=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 SYLQVCWRPBEWMT-XMMPIXPASA-N 0.000 claims description 2
- WAVGFGWZADWHPG-RUZDIDTESA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3,5-difluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C=C(F)C=C(F)C=2)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 WAVGFGWZADWHPG-RUZDIDTESA-N 0.000 claims description 2
- PKJCHTDCQMJVBA-AREMUKBSSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N(CCCN)[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 PKJCHTDCQMJVBA-AREMUKBSSA-N 0.000 claims description 2
- QYGVNBUVTAOEJX-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-fluorobenzenesulfonamide Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)S(=O)(=O)C1=CC=CC(F)=C1 QYGVNBUVTAOEJX-XMMPIXPASA-N 0.000 claims description 2
- QDWVCXBIUGRWJL-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-6-chloro-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC=C(Cl)C=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 QDWVCXBIUGRWJL-UHFFFAOYSA-N 0.000 claims description 2
- KGKFBFYCTIOLDB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-6-methyl-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC=C(C)C=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 KGKFBFYCTIOLDB-UHFFFAOYSA-N 0.000 claims description 2
- AVWJOPMTPXAOOL-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3,3-dimethylbutyl]-4-bromobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC(C)(C)C)N(CCCN)C(=O)C1=CC=C(Br)C=C1 AVWJOPMTPXAOOL-UHFFFAOYSA-N 0.000 claims description 2
- YGOBSPYEBYCDLP-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylsulfanylpropyl]-4-pyrazol-1-ylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CCSC)N(CCCN)C(=O)C(C=C1)=CC=C1N1C=CC=N1 YGOBSPYEBYCDLP-UHFFFAOYSA-N 0.000 claims description 2
- AZQYFJAHFJSKLD-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)pent-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC#CC)N(CCCN)C(=O)C1=CC=CC(Cl)=C1F AZQYFJAHFJSKLD-UHFFFAOYSA-N 0.000 claims description 2
- FSGJJPWMFBEPAA-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)pentyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CCCC)N(CCCN)C(=O)C1=CC=C(C)C=C1 FSGJJPWMFBEPAA-UHFFFAOYSA-N 0.000 claims description 2
- QWOYYQBHHOPEJK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(7-chloro-4-oxo-3-phenoxyquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(OC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 QWOYYQBHHOPEJK-UHFFFAOYSA-N 0.000 claims description 2
- 229940086322 navelbine Drugs 0.000 claims description 2
- 201000002528 pancreatic cancer Diseases 0.000 claims description 2
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 claims description 2
- JXLYSJRDGCGARV-CFWMRBGOSA-N vinblastine Chemical compound C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-CFWMRBGOSA-N 0.000 claims description 2
- CILBMBUYJCWATM-PYGJLNRPSA-N vinorelbine ditartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC CILBMBUYJCWATM-PYGJLNRPSA-N 0.000 claims description 2
- 229960004679 doxorubicin Drugs 0.000 claims 2
- 229940049920 malate Drugs 0.000 claims 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 claims 1
- 229940110254 minocin Drugs 0.000 claims 1
- GLMUAFMGXXHGLU-VQAITOIOSA-N minocycline hydrochloride Chemical compound [H+].[Cl-].C([C@H]1C2)C3=C(N(C)C)C=CC(O)=C3C(=O)C1=C(O)[C@@]1(O)[C@@H]2[C@H](N(C)C)C(O)=C(C(N)=O)C1=O GLMUAFMGXXHGLU-VQAITOIOSA-N 0.000 claims 1
- QKLXBZNRIFDKAN-HSZRJFAPSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-1,3,5-trimethylpyrazole-4-sulfonamide Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)S(=O)(=O)C=1C(C)=NN(C)C=1C QKLXBZNRIFDKAN-HSZRJFAPSA-N 0.000 claims 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 claims 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 71
- 239000002253 acid Substances 0.000 description 69
- 238000003786 synthesis reaction Methods 0.000 description 56
- 230000015572 biosynthetic process Effects 0.000 description 54
- BKBGADAXEXAIEZ-UHFFFAOYSA-N O=C(C(C(N=C1)=C2)=CC=C2Cl)N1NC1=CC=CC=C1 Chemical compound O=C(C(C(N=C1)=C2)=CC=C2Cl)N1NC1=CC=CC=C1 BKBGADAXEXAIEZ-UHFFFAOYSA-N 0.000 description 48
- 210000004027 cell Anatomy 0.000 description 47
- PNFVIPIQXAIUAY-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CCC(C(O)=O)NC(=O)OC(C)(C)C PNFVIPIQXAIUAY-UHFFFAOYSA-N 0.000 description 32
- 239000000203 mixture Substances 0.000 description 32
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- FCSSYEWURMTUSM-UHFFFAOYSA-N 3-chloro-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1F FCSSYEWURMTUSM-UHFFFAOYSA-N 0.000 description 22
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 22
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 18
- 125000001424 substituent group Chemical group 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- VBYJOUAMJITBNL-UHFFFAOYSA-N 3-chloro-2-fluorobenzoyl chloride Chemical compound FC1=C(Cl)C=CC=C1C(Cl)=O VBYJOUAMJITBNL-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 241000124008 Mammalia Species 0.000 description 13
- 239000003153 chemical reaction reagent Substances 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- 102000010638 Kinesin Human genes 0.000 description 12
- 108010063296 Kinesin Proteins 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000003814 drug Substances 0.000 description 12
- 230000000394 mitotic effect Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 230000000694 effects Effects 0.000 description 11
- 230000003902 lesion Effects 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- 125000004442 acylamino group Chemical group 0.000 description 10
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 10
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 10
- 125000001769 aryl amino group Chemical group 0.000 description 10
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 10
- 125000004429 atom Chemical group 0.000 description 10
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 10
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 10
- 125000004986 diarylamino group Chemical group 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 102000029749 Microtubule Human genes 0.000 description 9
- 108091022875 Microtubule Proteins 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 9
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 9
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 description 9
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 9
- 125000005129 aryl carbonyl group Chemical group 0.000 description 9
- 125000005110 aryl thio group Chemical group 0.000 description 9
- 125000005200 aryloxy carbonyloxy group Chemical group 0.000 description 9
- 238000003556 assay Methods 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Chemical group C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 210000004688 microtubule Anatomy 0.000 description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 8
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 8
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 8
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 8
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- 238000009097 single-agent therapy Methods 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 206010041349 Somnolence Diseases 0.000 description 7
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 7
- 150000007942 carboxylates Chemical class 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 125000005842 heteroatom Chemical group 0.000 description 7
- 230000011278 mitosis Effects 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 7
- 229940067157 phenylhydrazine Drugs 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- LMRDBJZQDUVCQH-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetaldehyde Chemical compound C1=CC=C2C(=O)N(CC=O)C(=O)C2=C1 LMRDBJZQDUVCQH-UHFFFAOYSA-N 0.000 description 6
- OJLISTAWQHSIHL-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CS1 OJLISTAWQHSIHL-UHFFFAOYSA-N 0.000 description 6
- SDNQIPIYWUJIHP-XMMPIXPASA-N 2-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]amino]propyl]isoindole-1,3-dione Chemical compound C=1C(Cl)=CC=C(C2=O)C=1N=C([C@@H](CC#C)NCCCN1C(C3=CC=CC=C3C1=O)=O)N2NC1=CC=CC=C1 SDNQIPIYWUJIHP-XMMPIXPASA-N 0.000 description 6
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 6
- SZXBQTSZISFIAO-UHFFFAOYSA-N 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)C(C(O)=O)NC(=O)OC(C)(C)C SZXBQTSZISFIAO-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical group C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- YNTOKMNHRPSGFU-UHFFFAOYSA-N n-Propyl carbamate Chemical compound CCCOC(N)=O YNTOKMNHRPSGFU-UHFFFAOYSA-N 0.000 description 6
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000003981 vehicle Substances 0.000 description 6
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 5
- 241000282414 Homo sapiens Species 0.000 description 5
- 201000004681 Psoriasis Diseases 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 230000030833 cell death Effects 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 239000004816 latex Substances 0.000 description 5
- 229920000126 latex Polymers 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 238000012216 screening Methods 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 4
- 108091006112 ATPases Proteins 0.000 description 4
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- 101001008953 Homo sapiens Kinesin-like protein KIF11 Proteins 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- QWCKQJZIFLGMSD-UHFFFAOYSA-N alpha-aminobutyric acid Chemical compound CCC(N)C(O)=O QWCKQJZIFLGMSD-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 4
- 230000004663 cell proliferation Effects 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- PNFVIPIQXAIUAY-ZCFIWIBFSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC[C@H](C(O)=O)NC(=O)OC(C)(C)C PNFVIPIQXAIUAY-ZCFIWIBFSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical class C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 3
- ANVIYYKETYLSRV-UHFFFAOYSA-N 2,3-difluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(F)=C1F ANVIYYKETYLSRV-UHFFFAOYSA-N 0.000 description 3
- JLZVIWSFUPLSOR-UHFFFAOYSA-N 2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1F JLZVIWSFUPLSOR-UHFFFAOYSA-N 0.000 description 3
- GFFFBPYCLRLSOM-OAHLLOKOSA-N 2-[(1r)-1-aminobut-3-ynyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound C#CC[C@@H](N)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 GFFFBPYCLRLSOM-OAHLLOKOSA-N 0.000 description 3
- IMUSLIHRIYOHEV-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid Chemical compound CSCCC(C(O)=O)NC(=O)OC(C)(C)C IMUSLIHRIYOHEV-UHFFFAOYSA-N 0.000 description 3
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 3
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 3
- VPHHJAOJUJHJKD-UHFFFAOYSA-N 3,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1 VPHHJAOJUJHJKD-UHFFFAOYSA-N 0.000 description 3
- FPENCTDAQQQKNY-UHFFFAOYSA-N 3,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1 FPENCTDAQQQKNY-UHFFFAOYSA-N 0.000 description 3
- PKTSBFXIHLYGEY-UHFFFAOYSA-N 3-chloro-4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(Cl)=C1 PKTSBFXIHLYGEY-UHFFFAOYSA-N 0.000 description 3
- TUXYZHVUPGXXQG-UHFFFAOYSA-N 4-bromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1 TUXYZHVUPGXXQG-UHFFFAOYSA-N 0.000 description 3
- BBYDXOIZLAWGSL-UHFFFAOYSA-N 4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-N 0.000 description 3
- MDXGYYOJGPFFJL-UHFFFAOYSA-N 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)CC(C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 102100027629 Kinesin-like protein KIF11 Human genes 0.000 description 3
- 208000035823 Non-specific autoimmune cerebellar ataxia without characteristic antibodies Diseases 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical group C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical group C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical group C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000004308 accommodation Effects 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 210000004292 cytoskeleton Anatomy 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 238000011081 inoculation Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 210000004962 mammalian cell Anatomy 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000013642 negative control Substances 0.000 description 3
- 238000011580 nude mouse model Methods 0.000 description 3
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 210000003491 skin Anatomy 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 3
- 230000002992 thymic effect Effects 0.000 description 3
- 210000001541 thymus gland Anatomy 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- WEPXLRANFJEOFZ-UHFFFAOYSA-N 2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1F WEPXLRANFJEOFZ-UHFFFAOYSA-N 0.000 description 2
- IHRMSSGDXMQPBA-UHFFFAOYSA-N 2,3-difluoro-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C(F)=C1F IHRMSSGDXMQPBA-UHFFFAOYSA-N 0.000 description 2
- QZIVNVIPFGKDQE-UHFFFAOYSA-N 2,6-difluoro-3-methylbenzoic acid Chemical compound CC1=CC=C(F)C(C(O)=O)=C1F QZIVNVIPFGKDQE-UHFFFAOYSA-N 0.000 description 2
- PTDNHYVEBIHJBK-UHFFFAOYSA-M 2-chloro-1,3-dimethylimidazol-1-ium;chloride Chemical compound [Cl-].CN1C=C[N+](C)=C1Cl PTDNHYVEBIHJBK-UHFFFAOYSA-M 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- CXKCZFDUOYMOOP-UHFFFAOYSA-N 3,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(Cl)=C1 CXKCZFDUOYMOOP-UHFFFAOYSA-N 0.000 description 2
- IBSDSIHTMABATG-UHFFFAOYSA-N 3-(1,3-dioxoisoindol-2-yl)propanal Chemical compound C1=CC=C2C(=O)N(CCC=O)C(=O)C2=C1 IBSDSIHTMABATG-UHFFFAOYSA-N 0.000 description 2
- CNBUSIJNWNXLQQ-UHFFFAOYSA-N 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=C(O)C=C1 CNBUSIJNWNXLQQ-UHFFFAOYSA-N 0.000 description 2
- VOIZNVUXCQLQHS-UHFFFAOYSA-N 3-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1 VOIZNVUXCQLQHS-UHFFFAOYSA-N 0.000 description 2
- XUQCONCMPCVUDM-UHFFFAOYSA-N 3-fluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1F XUQCONCMPCVUDM-UHFFFAOYSA-N 0.000 description 2
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 2
- VOCCEVKUXUIHOI-UHFFFAOYSA-N 4-fluoro-3-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1F VOCCEVKUXUIHOI-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 description 2
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 241000238633 Odonata Species 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000000692 Student's t-test Methods 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229940009456 adriamycin Drugs 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229960003965 antiepileptics Drugs 0.000 description 2
- 229940124584 antitussives Drugs 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- FVCYEPDYLBECFV-RUZDIDTESA-N benzyl n-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]amino]propyl]carbamate Chemical compound N([C@H](CC#C)C1=NC=2C(C(N1NC=1C=CC=CC=1)=O)=CC=C(C=2)Cl)CCCNC(=O)OCC1=CC=CC=C1 FVCYEPDYLBECFV-RUZDIDTESA-N 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 238000003271 compound fluorescence assay Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical group C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000036210 malignancy Effects 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- UNOBOFLHBVWMQK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-2,4-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(Cl)=C1F UNOBOFLHBVWMQK-UHFFFAOYSA-N 0.000 description 2
- LBWFXVZLPYTWQI-IPOVEDGCSA-N n-[2-(diethylamino)ethyl]-5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-1h-pyrrole-3-carboxamide;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C LBWFXVZLPYTWQI-IPOVEDGCSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000008024 pharmaceutical diluent Substances 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 2
- ZEXKKIXCRDTKBF-UHFFFAOYSA-N quinoline-2-carboxamide Chemical compound C1=CC=CC2=NC(C(=O)N)=CC=C21 ZEXKKIXCRDTKBF-UHFFFAOYSA-N 0.000 description 2
- 238000001959 radiotherapy Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 2
- 238000007423 screening assay Methods 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 description 2
- 125000004426 substituted alkynyl group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- 238000012353 t test Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 125000004001 thioalkyl group Chemical group 0.000 description 2
- 229930192474 thiophene Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 150000003852 triazoles Chemical group 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 2
- JNBRDOQHPXUXLY-UHFFFAOYSA-N (2,5-difluorophenyl)hydrazine Chemical compound NNC1=CC(F)=CC=C1F JNBRDOQHPXUXLY-UHFFFAOYSA-N 0.000 description 1
- PENWGQNPFRRVQI-UHFFFAOYSA-N (2-fluorophenyl)hydrazine Chemical compound NNC1=CC=CC=C1F PENWGQNPFRRVQI-UHFFFAOYSA-N 0.000 description 1
- HFSXFDKOXKNGIA-UHFFFAOYSA-N (3-fluorophenyl)hydrazine Chemical compound NNC1=CC=CC(F)=C1 HFSXFDKOXKNGIA-UHFFFAOYSA-N 0.000 description 1
- MWWSFMDVAYGXBV-MYPASOLCSA-N (7r,9s)-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydrochloride Chemical compound Cl.O([C@@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 MWWSFMDVAYGXBV-MYPASOLCSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- DNGLRCHMGDDHNC-UHFFFAOYSA-N 1-benzothiophene-2-carbonyl chloride Chemical compound C1=CC=C2SC(C(=O)Cl)=CC2=C1 DNGLRCHMGDDHNC-UHFFFAOYSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- DKFHWNGVMWFBJE-UHFFFAOYSA-N 1-ethynylcyclohexene Chemical compound C#CC1=CCCCC1 DKFHWNGVMWFBJE-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 1
- QTIPHWWHHRFTNO-UHFFFAOYSA-N 2,3,5-trifluorobenzoyl chloride Chemical compound FC1=CC(F)=C(F)C(C(Cl)=O)=C1 QTIPHWWHHRFTNO-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- NNDHNNWJECFTJG-UHFFFAOYSA-N 2,3-difluoro-4-methoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(F)=C1F NNDHNNWJECFTJG-UHFFFAOYSA-N 0.000 description 1
- XYFNRGYOYWRUSY-UHFFFAOYSA-N 2,3-difluoro-6-methoxybenzoyl chloride Chemical compound COC1=CC=C(F)C(F)=C1C(Cl)=O XYFNRGYOYWRUSY-UHFFFAOYSA-N 0.000 description 1
- CDCFERWURRNLLA-UHFFFAOYSA-N 2,3-difluorobenzoyl chloride Chemical compound FC1=CC=CC(C(Cl)=O)=C1F CDCFERWURRNLLA-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- LXCIIPPXRHOCQN-UHFFFAOYSA-N 2,6-difluoro-3-methylbenzoyl chloride Chemical compound CC1=CC=C(F)C(C(Cl)=O)=C1F LXCIIPPXRHOCQN-UHFFFAOYSA-N 0.000 description 1
- AZPGHBCYHLLFAF-CYBMUJFWSA-N 2-[(1r)-1-aminobut-3-ynyl]-3-anilinopyrido[3,2-d]pyrimidin-4-one Chemical compound C#CC[C@@H](N)C1=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 AZPGHBCYHLLFAF-CYBMUJFWSA-N 0.000 description 1
- QVHJQCGUWFKTSE-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)C(C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-UHFFFAOYSA-N 0.000 description 1
- CHJWFCMBPUTQSZ-HSZRJFAPSA-N 2-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]amino]propyl]isoindole-1,3-dione Chemical compound C1([C@H](NCCCN2C(C3=CC=CC=C3C2=O)=O)CC)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 CHJWFCMBPUTQSZ-HSZRJFAPSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 1
- NBUUUJWWOARGNW-UHFFFAOYSA-N 2-amino-5-methylbenzoic acid Chemical compound CC1=CC=C(N)C(C(O)=O)=C1 NBUUUJWWOARGNW-UHFFFAOYSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-UHFFFAOYSA-N 2-aminohexanoic acid Chemical compound CCCCC(N)C(O)=O LRQKBLKVPFOOQJ-UHFFFAOYSA-N 0.000 description 1
- OYZWEOORLJBPMA-UHFFFAOYSA-N 3,5-difluorobenzoyl chloride Chemical compound FC1=CC(F)=CC(C(Cl)=O)=C1 OYZWEOORLJBPMA-UHFFFAOYSA-N 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- YGYZTZAEZMCPSC-UHFFFAOYSA-N 3-chloro-2,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(Cl)=C1F YGYZTZAEZMCPSC-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- PEPBFCOIJRULGJ-UHFFFAOYSA-N 3h-1,2,3-benzodioxazole Chemical compound C1=CC=C2NOOC2=C1 PEPBFCOIJRULGJ-UHFFFAOYSA-N 0.000 description 1
- PUQVQDMFCAGQQB-UHFFFAOYSA-N 4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)CC(C(O)=O)NC(=O)OC(C)(C)C PUQVQDMFCAGQQB-UHFFFAOYSA-N 0.000 description 1
- RFJWCCHRWJSWGI-UHFFFAOYSA-N 4-(1h-pyrazol-5-yl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=NN1 RFJWCCHRWJSWGI-UHFFFAOYSA-N 0.000 description 1
- PEPCYJSDHYMIFN-UHFFFAOYSA-N 4-chloro-2,5-difluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(Cl)C=C1F PEPCYJSDHYMIFN-UHFFFAOYSA-N 0.000 description 1
- KHZDUKKKWXLPFY-UHFFFAOYSA-N 4-chloro-2,6-difluorobenzoyl chloride Chemical compound FC1=CC(Cl)=CC(F)=C1C(Cl)=O KHZDUKKKWXLPFY-UHFFFAOYSA-N 0.000 description 1
- NRFKZFFVTGGEQF-UHFFFAOYSA-N 4-fluoro-3-methylbenzaldehyde Chemical compound CC1=CC(C=O)=CC=C1F NRFKZFFVTGGEQF-UHFFFAOYSA-N 0.000 description 1
- GHICCUXQJBDNRN-UHFFFAOYSA-N 4-iodobenzoic acid Chemical compound OC(=O)C1=CC=C(I)C=C1 GHICCUXQJBDNRN-UHFFFAOYSA-N 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 1
- XOEKYPIBVOGCDG-UHFFFAOYSA-N 4-pyrazol-1-ylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N1N=CC=C1 XOEKYPIBVOGCDG-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 208000030507 AIDS Diseases 0.000 description 1
- 238000006064 ATPase reaction Methods 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 208000003200 Adenoma Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- IRMVYBCUZJQJOT-UHFFFAOYSA-N C#CCC(C(N1Nc2ccccc2)=Nc2cc(Cl)ccc2C1=O)N(CCCN)C(c(c(F)cc(Cl)c1)c1F)=O Chemical compound C#CCC(C(N1Nc2ccccc2)=Nc2cc(Cl)ccc2C1=O)N(CCCN)C(c(c(F)cc(Cl)c1)c1F)=O IRMVYBCUZJQJOT-UHFFFAOYSA-N 0.000 description 1
- WAVGFGWZADWHPG-UHFFFAOYSA-N C#CCC(C(N1Nc2ccccc2)=Nc2cc(Cl)ccc2C1=O)N(CCCN)C(c1cc(F)cc(F)c1)=O Chemical compound C#CCC(C(N1Nc2ccccc2)=Nc2cc(Cl)ccc2C1=O)N(CCCN)C(c1cc(F)cc(F)c1)=O WAVGFGWZADWHPG-UHFFFAOYSA-N 0.000 description 1
- 0 C*(**1)**C(N=C(C(C)(*)N(*)**)N2***)=C1C2=O Chemical compound C*(**1)**C(N=C(C(C)(*)N(*)**)N2***)=C1C2=O 0.000 description 1
- WBEVYPUZQAKSKX-GFCCVEGCSA-N CC/N=C(/[C@@H](CC#C)N)\NNc1ccccc1 Chemical compound CC/N=C(/[C@@H](CC#C)N)\NNc1ccccc1 WBEVYPUZQAKSKX-GFCCVEGCSA-N 0.000 description 1
- LKSJIFHRPSYAPN-UHFFFAOYSA-N CCC(C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)N(CCCN)C(c(cc1)ccc1Br)=O Chemical compound CCC(C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)N(CCCN)C(c(cc1)ccc1Br)=O LKSJIFHRPSYAPN-UHFFFAOYSA-N 0.000 description 1
- FRVGPPASCVKEMF-AREMUKBSSA-N CC[C@H](C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)N(CCCN)Cc1ccc(C)cc1 Chemical compound CC[C@H](C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)N(CCCN)Cc1ccc(C)cc1 FRVGPPASCVKEMF-AREMUKBSSA-N 0.000 description 1
- 241000282836 Camelus dromedarius Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- FIEGAKLLRHZXKN-UHFFFAOYSA-N Cc(cc1)ccc1C(N(CCCN)C(Cc1ccc[s]1)C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)=O Chemical compound Cc(cc1)ccc1C(N(CCCN)C(Cc1ccc[s]1)C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)=O FIEGAKLLRHZXKN-UHFFFAOYSA-N 0.000 description 1
- XVAUJDQHXGOODX-UHFFFAOYSA-N Cc(ccc(C(N(CCCN)C(CC#C)C(N1Nc2ccccc2)=Nc2cccnc2C1=O)=O)c1F)c1F Chemical compound Cc(ccc(C(N(CCCN)C(CC#C)C(N1Nc2ccccc2)=Nc2cccnc2C1=O)=O)c1F)c1F XVAUJDQHXGOODX-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 101710088194 Dehydrogenase Proteins 0.000 description 1
- 208000001154 Dermoid Cyst Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- 206010058314 Dysplasia Diseases 0.000 description 1
- 244000148064 Enicostema verticillatum Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000283073 Equus caballus Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- DIZNINCSFSAMLJ-UHFFFAOYSA-N FC1C=C(F)C(F)=CC1(F)C(Cl)=O Chemical compound FC1C=C(F)C(F)=CC1(F)C(Cl)=O DIZNINCSFSAMLJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 229930182816 L-glutamine Natural products 0.000 description 1
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 1
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 206010024612 Lipoma Diseases 0.000 description 1
- 206010025219 Lymphangioma Diseases 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 206010027626 Milia Diseases 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- 208000004304 Myofibromatosis Diseases 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- VAOKDBKLQLXNNH-UHFFFAOYSA-N NCCCN(C(Cc(cc1)ccc1O)C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)C(c(cc1)cc(Cl)c1Cl)=O Chemical compound NCCCN(C(Cc(cc1)ccc1O)C(N1Nc2ccccc2)=Nc(cc(cc2)Cl)c2C1=O)C(c(cc1)cc(Cl)c1Cl)=O VAOKDBKLQLXNNH-UHFFFAOYSA-N 0.000 description 1
- 206010029113 Neovascularisation Diseases 0.000 description 1
- 241000232901 Nephroma Species 0.000 description 1
- 208000007256 Nevus Diseases 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical group C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 206010043276 Teratoma Diseases 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 108010022394 Threonine synthase Proteins 0.000 description 1
- 102000005497 Thymidylate Synthase Human genes 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 241000269370 Xenopus <genus> Species 0.000 description 1
- GQRHLSBDFHZSFC-OAHLLOKOSA-N [(1R)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]carbamic acid Chemical compound ClC1=CC=C2C(N(C(=NC2=C1)[C@@H](CC#C)NC(O)=O)NC1=CC=CC=C1)=O GQRHLSBDFHZSFC-OAHLLOKOSA-N 0.000 description 1
- PASACJUCYZVYOQ-UHFFFAOYSA-N [I].C[SiH](C)C Chemical compound [I].C[SiH](C)C PASACJUCYZVYOQ-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 239000003070 absorption delaying agent Substances 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005089 alkenylaminocarbonyl group Chemical group 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 229940045799 anthracyclines and related substance Drugs 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003886 aromatase inhibitor Substances 0.000 description 1
- 229940046844 aromatase inhibitors Drugs 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PQMOZOQTXKMYSK-UHFFFAOYSA-N benzyl n-(3-oxopropyl)carbamate Chemical compound O=CCCNC(=O)OCC1=CC=CC=C1 PQMOZOQTXKMYSK-UHFFFAOYSA-N 0.000 description 1
- AUEBLRHDOXUKIV-XMMPIXPASA-N benzyl n-[3-[[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]amino]propyl]carbamate Chemical compound C1([C@@H](CC#C)NCCCNC(=O)OCC=2C=CC=CC=2)=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 AUEBLRHDOXUKIV-XMMPIXPASA-N 0.000 description 1
- IQOPLVIAJSHTSY-WJOKGBTCSA-N benzyl n-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-(3-chloro-2-fluorobenzoyl)amino]propyl]carbamate Chemical compound FC1=C(Cl)C=CC=C1C(=O)N([C@H](CC#C)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CCCNC(=O)OCC1=CC=CC=C1 IQOPLVIAJSHTSY-WJOKGBTCSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 208000035269 cancer or benign tumor Diseases 0.000 description 1
- 208000001969 capillary hemangioma Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000025084 cell cycle arrest Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000001516 cell proliferation assay Methods 0.000 description 1
- 230000003833 cell viability Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 231100000481 chemical toxicant Toxicity 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical class O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 1
- GYOZYWVXFNDGLU-XLPZGREQSA-N dTMP Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)C1 GYOZYWVXFNDGLU-XLPZGREQSA-N 0.000 description 1
- JSRLJPSBLDHEIO-SHYZEUOFSA-N dUMP Chemical compound O1[C@H](COP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C=C1 JSRLJPSBLDHEIO-SHYZEUOFSA-N 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 229940082789 erbitux Drugs 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000001917 fluorescence detection Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940020967 gemzar Drugs 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229940080856 gleevec Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 1
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 201000011066 hemangioma Diseases 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940022353 herceptin Drugs 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000013537 high throughput screening Methods 0.000 description 1
- 102000055595 human KIF11 Human genes 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 230000010661 induction of programmed cell death Effects 0.000 description 1
- 201000011489 infantile myofibromatosis Diseases 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229940084651 iressa Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 210000002510 keratinocyte Anatomy 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000011866 long-term treatment Methods 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 238000000504 luminescence detection Methods 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000000520 microinjection Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- IFJCNNHVRGEHCV-JOCHJYFZSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(Cl)C=CC=2)F)=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 IFJCNNHVRGEHCV-JOCHJYFZSA-N 0.000 description 1
- VAOZDWQCFJVLTB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-3-bromobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC=CC(Br)=C1 VAOZDWQCFJVLTB-UHFFFAOYSA-N 0.000 description 1
- GEHAQCGAXKTQOY-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC=C(F)C=C1 GEHAQCGAXKTQOY-UHFFFAOYSA-N 0.000 description 1
- IURXTGBTUNBXHY-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylbutyl]-3,4-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC(C)C)N(CCCN)C(=O)C1=CC=C(F)C(F)=C1 IURXTGBTUNBXHY-UHFFFAOYSA-N 0.000 description 1
- JPHOFHWTFJWQCI-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-2,3-difluoro-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C(F)=C1F JPHOFHWTFJWQCI-UHFFFAOYSA-N 0.000 description 1
- KASZJCLEUBOROE-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(Cl)=C1 KASZJCLEUBOROE-UHFFFAOYSA-N 0.000 description 1
- XPIDNGFPALVBGX-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C=C1 XPIDNGFPALVBGX-UHFFFAOYSA-N 0.000 description 1
- AGIQCCGFKZXBSB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-iodobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(I)C=C1 AGIQCCGFKZXBSB-UHFFFAOYSA-N 0.000 description 1
- TVBHAMDSTVYAFE-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C([N+]([O-])=O)C=C1 TVBHAMDSTVYAFE-UHFFFAOYSA-N 0.000 description 1
- FFOGGSBTFFBRJK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(7-chloro-4-oxo-3-phenylmethoxyquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(OCC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 FFOGGSBTFFBRJK-UHFFFAOYSA-N 0.000 description 1
- WYRGCRZZFQNKEI-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-[7-chloro-3-(2-fluoroanilino)-4-oxoquinazolin-2-yl]propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C(=CC=CC=2)F)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 WYRGCRZZFQNKEI-UHFFFAOYSA-N 0.000 description 1
- COIQWOHOKNZGPH-SSEXGKCCSA-N n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3-chloro-n-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-fluorobenzamide Chemical compound FC1=C(Cl)C=CC=C1C(=O)N([C@H](CC#C)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CCCN1C(=O)C2=CC=CC=C2C1=O COIQWOHOKNZGPH-SSEXGKCCSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 208000025351 nephroma Diseases 0.000 description 1
- 230000005015 neuronal process Effects 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- 229940080607 nexavar Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- UOKZUTXLHRTLFH-UHFFFAOYSA-N o-phenylhydroxylamine Chemical compound NOC1=CC=CC=C1 UOKZUTXLHRTLFH-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 208000010626 plasma cell neoplasm Diseases 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000011535 reaction buffer Substances 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- HSSLDCABUXLXKM-UHFFFAOYSA-N resorufin Chemical group C1=CC(=O)C=C2OC3=CC(O)=CC=C3N=C21 HSSLDCABUXLXKM-UHFFFAOYSA-N 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000009094 second-line therapy Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 201000008261 skin carcinoma Diseases 0.000 description 1
- 201000009381 skin hemangioma Diseases 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 150000008053 sultones Chemical class 0.000 description 1
- 229960002812 sunitinib malate Drugs 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 229940034785 sutent Drugs 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940120982 tarceva Drugs 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- RCINICONZNJXQF-XAZOAEDWSA-N taxol® Chemical compound O([C@@H]1[C@@]2(CC(C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3(C21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-XAZOAEDWSA-N 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- LHSYIIFYBVDYIC-QGZVFWFLSA-N tert-butyl n-[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H](CC#C)C1=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 LHSYIIFYBVDYIC-QGZVFWFLSA-N 0.000 description 1
- YFYWVTJUISZJNZ-GOSISDBHSA-N tert-butyl n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 YFYWVTJUISZJNZ-GOSISDBHSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical group 0.000 description 1
- 125000005300 thiocarboxy group Chemical group C(=S)(O)* 0.000 description 1
- BWJZHYWAXLWLTB-UHFFFAOYSA-N thiophene-3-sulfonamide Chemical compound NS(=O)(=O)C=1C=CSC=1 BWJZHYWAXLWLTB-UHFFFAOYSA-N 0.000 description 1
- 238000009095 third-line therapy Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000004784 trichloromethoxy group Chemical group ClC(O*)(Cl)Cl 0.000 description 1
- 108010002164 tyrosine receptor Proteins 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 229940033942 zoladex Drugs 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Oncology (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US94583807P | 2007-06-22 | 2007-06-22 | |
| US60/945,838 | 2007-06-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20100024494A true KR20100024494A (ko) | 2010-03-05 |
Family
ID=39846620
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020107001013A Withdrawn KR20100024494A (ko) | 2007-06-22 | 2008-06-19 | 퀴나졸리논 화합물 및 이의 사용 방법 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US8232285B2 (enExample) |
| EP (1) | EP2173724B1 (enExample) |
| JP (1) | JP2010530885A (enExample) |
| KR (1) | KR20100024494A (enExample) |
| CN (1) | CN101801937A (enExample) |
| AU (1) | AU2008268613A1 (enExample) |
| BR (1) | BRPI0813355A2 (enExample) |
| CA (1) | CA2704282A1 (enExample) |
| IL (1) | IL202740A0 (enExample) |
| MX (1) | MX2009013815A (enExample) |
| TW (1) | TW200918069A (enExample) |
| WO (1) | WO2009002808A2 (enExample) |
| ZA (1) | ZA201000183B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2011242988B2 (en) * | 2010-04-19 | 2013-02-07 | Sri International | Compositions and method for the treatment of multiple myeloma |
| US8940742B2 (en) | 2012-04-10 | 2015-01-27 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| US9751888B2 (en) | 2013-10-04 | 2017-09-05 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| MX389256B (es) | 2013-10-04 | 2025-03-20 | Infinity Pharmaceuticals Inc | Compuestos heterociclicos y usos de los mismos. |
| US20150132575A1 (en) * | 2013-11-14 | 2015-05-14 | Honeywell International Inc. | Luminescent fibers, articles including the same, and methods of forming the same |
| EA201691872A1 (ru) | 2014-03-19 | 2017-04-28 | Инфинити Фармасьютикалз, Инк. | Гетероциклические соединения для применения в лечении pi3k-гамма-опосредованных расстройств |
| WO2016054491A1 (en) | 2014-10-03 | 2016-04-07 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| CN108349985A (zh) | 2015-09-14 | 2018-07-31 | 无限药品股份有限公司 | 异喹啉酮的固体形式、其制备方法、包含其的组合物及其使用方法 |
| WO2017161116A1 (en) | 2016-03-17 | 2017-09-21 | Infinity Pharmaceuticals, Inc. | Isotopologues of isoquinolinone and quinazolinone compounds and uses thereof as pi3k kinase inhibitors |
| WO2017214269A1 (en) | 2016-06-08 | 2017-12-14 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| TW201825465A (zh) | 2016-09-23 | 2018-07-16 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| TW201813963A (zh) | 2016-09-23 | 2018-04-16 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| TW201815787A (zh) | 2016-09-23 | 2018-05-01 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| US20210188843A1 (en) * | 2018-05-11 | 2021-06-24 | The United States Of America,As Represented By The Secretary,Department Of Health And Human Services | Quinoline compounds and their preparation and use as antimalarial agents |
| CN113354590A (zh) * | 2020-03-05 | 2021-09-07 | 宁波康柏睿格医药科技有限公司 | 拮抗nod1/2受体信号通路的喹唑啉酮类化合物 |
Family Cites Families (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BG16042A3 (bg) * | 1968-11-12 | 1972-05-20 | Nans Ott | Метод за получаване на нови 2(1н)-хиназолинони |
| AU543928B2 (en) | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
| US4522811A (en) * | 1982-07-08 | 1985-06-11 | Syntex (U.S.A.) Inc. | Serial injection of muramyldipeptides and liposomes enhances the anti-infective activity of muramyldipeptides |
| US5187167A (en) * | 1986-03-27 | 1993-02-16 | Imperial Chemical Industries Plc | Pharmaceutical compositions comprising quinazolin-4-one derivatives |
| GB8707053D0 (en) * | 1987-03-25 | 1987-04-29 | Ici Plc | Anti-tumour agents |
| CZ280738B6 (cs) * | 1988-02-10 | 1996-04-17 | F. Hoffmann - La Roche And Co., Aktiengesellschaft | Substituované pyrroly, jejich použití pro výrobu léčiv a léčiva na jejich bázi |
| GB8827820D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| GB8827988D0 (en) * | 1988-11-30 | 1989-01-05 | Smith Kline French Lab | Chemical compounds |
| USRE36736E (en) * | 1989-02-06 | 2000-06-13 | Hoffman-La Roche Inc. | Substituted pyrroles |
| GB8904161D0 (en) * | 1989-02-23 | 1989-04-05 | Hoffmann La Roche | Substituted pyrroles |
| MC2096A1 (fr) | 1989-02-23 | 1991-02-15 | Hoffmann La Roche | Pyrroles substitues |
| US5380746A (en) * | 1989-05-05 | 1995-01-10 | Goedecke Aktiengesellschaft | Bis-(1H-indol-3-YL)-maleinimide derivatives, processes for the preparation thereof and pharmaceutical compositions containing them |
| CA2015996C (en) | 1989-05-05 | 2001-08-28 | Hartmut Osswald | Bis-(1h-indol-3-yl)-maleinimide derivatives and their use as pharmaceuticals |
| DE4005969A1 (de) | 1990-02-26 | 1991-08-29 | Boehringer Mannheim Gmbh | Neue trisubstituierte pyrrole, verfahren zu ihrer herstellung sowie arzneimittel, die diese verbindungen enthalten |
| DE4005970A1 (de) | 1990-02-26 | 1991-08-29 | Boehringer Mannheim Gmbh | Neue trisubstituierte maleinimide, verfahren zu ihrer herstellung sowie arzneimittel, die diese verbindungen enthalten |
| AU640016B2 (en) * | 1990-05-30 | 1993-08-12 | Imperial Chemical Industries Plc | Hydroquinazoline derivatives |
| US5292747A (en) * | 1990-08-07 | 1994-03-08 | Hoffman-La Roche Inc. | Substituted pyrroles |
| US5591842A (en) * | 1991-11-29 | 1997-01-07 | Banyu Pharmaceutical Co., Ltd. | Indolopyrrolocarbazole derivatives |
| ATE180785T1 (de) | 1992-03-12 | 1999-06-15 | Smithkline Beecham Plc | Kondensierte indol-derivate als 5-ht4-rezeptor- antagonisten |
| WO1993018765A1 (en) | 1992-03-20 | 1993-09-30 | The Wellcome Foundation Limited | Indole derivatives with antiviral activity |
| US5721230A (en) * | 1993-05-10 | 1998-02-24 | Hoffmann-La Roche Inc. | Substituted pyrroles |
| ATE456367T1 (de) | 1993-12-23 | 2010-02-15 | Lilly Co Eli | Proteinkinase c inhibitoren |
| US5545636A (en) * | 1993-12-23 | 1996-08-13 | Eli Lilly And Company | Protein kinase C inhibitors |
| US6524832B1 (en) * | 1994-02-04 | 2003-02-25 | Arch Development Corporation | DNA damaging agents in combination with tyrosine kinase inhibitors |
| WO1995024190A2 (en) * | 1994-03-07 | 1995-09-14 | Sugen, Inc. | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| WO1995030682A1 (en) | 1994-05-09 | 1995-11-16 | Banyu Pharmaceutical Co., Ltd. | Antitumor indolopyprolocarbazole derivative |
| IL110831A (en) | 1994-08-31 | 1998-12-27 | Hadasit Med Res Service | Pharmaceutical compositions containing quinazolinone derivatives for preventing restenosis |
| US5591855A (en) * | 1994-10-14 | 1997-01-07 | Cephalon, Inc. | Fused pyrrolocarbazoles |
| IL112125A (en) | 1994-12-22 | 1998-02-08 | Hadasit Med Res Service | Quinazolinone-containing pharmaceutical compositions |
| US5559228A (en) * | 1995-03-30 | 1996-09-24 | Eli Lilly And Company | Synthesis of bisindolylmaleimides |
| US5747498A (en) * | 1996-05-28 | 1998-05-05 | Pfizer Inc. | Alkynyl and azido-substituted 4-anilinoquinazolines |
| BR9710648A (pt) | 1996-03-20 | 1999-08-17 | Lilly Co Eli | S¡ntese de indolilmaleimidas |
| PE91698A1 (es) * | 1996-07-29 | 1998-12-24 | Hoffmann La Roche | Pirroles sustituidos |
| PE91598A1 (es) | 1996-07-29 | 1998-12-24 | Hoffmann La Roche | Pirroles sustituidos |
| CA2263862A1 (en) | 1996-08-23 | 1998-02-26 | Margaret Mary Faul | Synthesis of bisindolylmalimides |
| SE9603283D0 (sv) * | 1996-09-10 | 1996-09-10 | Astra Ab | New compounds |
| AU4920397A (en) | 1996-10-11 | 1998-05-11 | Chiron Corporation | Purine inhibitors of glycogen synthase kinase 3 (gsk3) |
| US6028075A (en) | 1997-02-11 | 2000-02-22 | Pines; Mark | Quinazolinone containing pharmaceutical compositions for prevention of neovascularization and for treating malignancies |
| US5859261A (en) * | 1997-03-20 | 1999-01-12 | Eli Lilly And Company | Synthesis of indolylmaleimides |
| US6184377B1 (en) * | 1997-12-15 | 2001-02-06 | Sepracor Inc. | Compositions containing N-amino- and N-hydroxy-quinazolinones and methods for preparing libraries thereof |
| AU4929999A (en) | 1998-07-30 | 2000-02-21 | Japan Tobacco Inc. | Disubstituted maleimide compounds and medicinal utilization thereof |
| WO2000047575A1 (en) | 1999-02-09 | 2000-08-17 | Sagami Chemical Research Center | Pyrrole derivatives and cell death inhibitors |
| US6545004B1 (en) | 1999-10-27 | 2003-04-08 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| EP1686120A3 (en) | 1999-10-27 | 2007-05-30 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| UA74803C2 (uk) * | 1999-11-11 | 2006-02-15 | Осі Фармасьютікалз, Інк. | Стійкий поліморф гідрохлориду n-(3-етинілфеніл)-6,7-біс(2-метоксіетокси)-4-хіназолінаміну, спосіб його одержання (варіанти) та фармацевтичне застосування |
| EP1250334B1 (en) | 1999-12-16 | 2004-05-19 | Eli Lilly And Company | Medicaments useful for the treatment of proliferative diseases |
| US6867198B2 (en) * | 1999-12-16 | 2005-03-15 | Eli Lilly And Company | Agents and methods for the treatment of proliferative diseases |
| WO2001074807A1 (en) | 2000-03-30 | 2001-10-11 | Sagami Chemical Research Center | Indolylpyrrole derivatives and cell death inhibitors |
| AU783615B2 (en) | 2000-05-11 | 2005-11-17 | Consejo Superior De Investigaciones Cientificas | Heterocyclic inhibitors of glycogen synthase kinase GSK-3 |
| EP1355921A2 (en) | 2000-06-29 | 2003-10-29 | North Shore-Long Island Jewish Health System | Modulators of cellular proliferation and angiogenesis, methods for use and identification thereof |
| US7074824B2 (en) | 2001-07-31 | 2006-07-11 | Arqule, Inc. | Pharmaceutical compositions containing beta-lapachone, or derivatives or analogs thereof, and methods of using same |
| US6962944B2 (en) | 2001-07-31 | 2005-11-08 | Arqule, Inc. | Pharmaceutical compositions containing beta-lapachone, or derivatives or analogs thereof, and methods of using same |
| US7060705B2 (en) * | 2001-11-07 | 2006-06-13 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| WO2003043995A1 (en) | 2001-11-20 | 2003-05-30 | Cytokinetics, Inc. | Process for the racemization of chiral quinazolinones |
| AU2003219679B2 (en) | 2002-01-23 | 2009-02-26 | Texas Tech University | Mammalian migration inducting gene and methods for detection and inhibition of migrating tumor cells |
| US7009049B2 (en) | 2002-02-15 | 2006-03-07 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| KR100974770B1 (ko) | 2002-03-05 | 2010-08-06 | 일라이 릴리 앤드 캄파니 | 키나제 억제제로서의 퓨린 유도체 |
| US7214800B2 (en) | 2002-05-09 | 2007-05-08 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7038048B2 (en) * | 2002-05-23 | 2006-05-02 | Cytokinetics, Inc. | 3H-pyridopyrimidin-4-one compounds, compositions, and methods of their use |
| CA2485343A1 (en) * | 2002-05-23 | 2004-05-13 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| JP2006501201A (ja) * | 2002-07-23 | 2006-01-12 | サイトキネティクス・インコーポレーテッド | 化合物、組成物および方法 |
| EP1620573A4 (en) | 2003-04-15 | 2006-12-20 | Avalon Pharmaceuticals | DETERMINATION OF CANCER-ASSOCIATED GENES AND THERAPEUTIC OBJECTS USING MOLECULAR CYTOGENETIC PROCEDURES |
| US20050043233A1 (en) | 2003-04-29 | 2005-02-24 | Boehringer Ingelheim International Gmbh | Combinations for the treatment of diseases involving cell proliferation, migration or apoptosis of myeloma cells or angiogenesis |
| CA2526285A1 (en) | 2003-05-15 | 2004-12-23 | Arqule, Inc. | Inhibitors of p38 and methods of using the same |
| US7345046B2 (en) | 2003-05-30 | 2008-03-18 | Chiron Corporation | Heteroaryl-fused pyrimidinyl compounds as anticancer agents |
| EP2367008A3 (en) | 2003-06-06 | 2014-12-24 | Genentech, Inc. | Modulating the interaction between HGF beta chain and C-Met |
| WO2005007193A2 (en) | 2003-07-07 | 2005-01-27 | Vande Woude, George, F. | Inhibition of tumor angiogenesis by combination of thrombospondin-1 and inhibitors of vascular endothelial growth factor |
| RU2006124743A (ru) | 2003-12-11 | 2008-01-20 | Дженентек, Инк. (Us) | СПОСОБЫ И КОМПОЗИЦИИ ДЛЯ ИНГИБИРОВАНИЯ ДИМЕРИЗАЦИИ И АКТИВАЦИИ с-Мет |
| US8178672B2 (en) | 2004-10-19 | 2012-05-15 | Arqule, Inc. | Synthesis of imidazooxazole and imidazothiazole inhibitors of p38 MAP kinase |
| PL1846406T3 (pl) | 2005-02-09 | 2011-04-29 | Arqule Inc | Pochodne imidowe kwasu maleinowego, kompozycje farmaceutyczne i sposoby leczenia nowotworów |
| KR20140068234A (ko) | 2005-03-31 | 2014-06-05 | 더 제너럴 하스피탈 코포레이션 | Hgf/hgfr 활성의 모니터링 및 조정 |
| WO2007123892A2 (en) * | 2006-04-17 | 2007-11-01 | Arqule Inc. | Raf inhibitors and their uses |
-
2008
- 2008-06-19 US US12/142,762 patent/US8232285B2/en active Active
- 2008-06-19 WO PCT/US2008/067571 patent/WO2009002808A2/en not_active Ceased
- 2008-06-19 CN CN200880104552A patent/CN101801937A/zh active Pending
- 2008-06-19 CA CA2704282A patent/CA2704282A1/en not_active Abandoned
- 2008-06-19 KR KR1020107001013A patent/KR20100024494A/ko not_active Withdrawn
- 2008-06-19 JP JP2010513424A patent/JP2010530885A/ja not_active Withdrawn
- 2008-06-19 MX MX2009013815A patent/MX2009013815A/es not_active Application Discontinuation
- 2008-06-19 EP EP08771527A patent/EP2173724B1/en active Active
- 2008-06-19 AU AU2008268613A patent/AU2008268613A1/en not_active Abandoned
- 2008-06-19 BR BRPI0813355-7A2A patent/BRPI0813355A2/pt not_active IP Right Cessation
- 2008-06-20 TW TW097123156A patent/TW200918069A/zh unknown
-
2009
- 2009-12-15 IL IL202740A patent/IL202740A0/en unknown
-
2010
- 2010-01-11 ZA ZA2010/00183A patent/ZA201000183B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CN101801937A (zh) | 2010-08-11 |
| CA2704282A1 (en) | 2008-12-31 |
| BRPI0813355A2 (pt) | 2014-12-30 |
| US20090130097A1 (en) | 2009-05-21 |
| WO2009002808A2 (en) | 2008-12-31 |
| MX2009013815A (es) | 2010-03-01 |
| ZA201000183B (en) | 2011-03-30 |
| IL202740A0 (en) | 2010-06-30 |
| EP2173724B1 (en) | 2012-12-05 |
| WO2009002808A3 (en) | 2009-07-23 |
| EP2173724A2 (en) | 2010-04-14 |
| AU2008268613A1 (en) | 2008-12-31 |
| US8232285B2 (en) | 2012-07-31 |
| TW200918069A (en) | 2009-05-01 |
| JP2010530885A (ja) | 2010-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20100024494A (ko) | 퀴나졸리논 화합물 및 이의 사용 방법 | |
| US20110217300A1 (en) | Quinazolinone Compounds and Methods of Use Thereof | |
| CA2592286C (en) | Quinazoline derivatives for inhibiting cancer cell growth and method for the preparation thereof | |
| ES2376552T3 (es) | Compuestos de quinazolinona como agentes antic�?ncer. | |
| ES2651730T3 (es) | Moduladores c-Met y métodos de uso | |
| CN100381428C (zh) | 喹唑啉酮类化合物及应用 | |
| JP5036002B2 (ja) | 2−アミノ−7,8−ジヒドロ−6H−ピリド[4,3−d]ピリミジン−5−オン | |
| US20040067969A1 (en) | Syntheses of quinazolinones | |
| SK145497A3 (en) | Quinazoline derivatives, preparation method thereof and pharmaceutical composition containing the same | |
| JP2006501201A (ja) | 化合物、組成物および方法 | |
| BRPI0620462A2 (pt) | composto, processo para preparar um composto, composição farmacêutica, uso de um composto, e,métodos para produzir um efeito inibidor de b-raf e um efeito anti-cáncer em um animal de sangue quente, e para tratar uma doença | |
| KR20080006614A (ko) | 증식 질환의 치료에 유용한 hsp90 억제제인2-아미노-퀴나졸린-5-온 | |
| JP7190755B2 (ja) | オキサジノキナゾリンおよびオキサジノキノリン系化合物、ならびに調製方法およびその使用 | |
| JP4792128B2 (ja) | 癌に対するhsp90阻害剤としての5−(2−ヒドロキシフェニル)テトラゾール | |
| JP2011500603A5 (enExample) | ||
| ES2369707T3 (es) | 2-amino-7,8-dihidro-6h-pirido(4,3-d)pirimidin-5-onas, procedimiento para su preparación y composiciones farmacéuticas que contienen las mismas. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20100115 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination | ||
| WITN | Application deemed withdrawn, e.g. because no request for examination was filed or no examination fee was paid |