JP2010530885A - キナゾリノン化合物およびその使用方法 - Google Patents
キナゾリノン化合物およびその使用方法 Download PDFInfo
- Publication number
- JP2010530885A JP2010530885A JP2010513424A JP2010513424A JP2010530885A JP 2010530885 A JP2010530885 A JP 2010530885A JP 2010513424 A JP2010513424 A JP 2010513424A JP 2010513424 A JP2010513424 A JP 2010513424A JP 2010530885 A JP2010530885 A JP 2010530885A
- Authority
- JP
- Japan
- Prior art keywords
- chloro
- oxo
- compound
- propyl
- phenylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 184
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 title abstract description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 205
- -1 quinazolinone compound Chemical class 0.000 claims abstract description 115
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 84
- 201000011510 cancer Diseases 0.000 claims abstract description 52
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 38
- 230000002062 proliferating effect Effects 0.000 claims abstract description 31
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 22
- 239000002246 antineoplastic agent Substances 0.000 claims abstract description 11
- 229940127089 cytotoxic agent Drugs 0.000 claims abstract description 11
- 239000003937 drug carrier Substances 0.000 claims abstract description 11
- 239000000546 pharmaceutical excipient Substances 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 66
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims description 60
- 125000003118 aryl group Chemical group 0.000 claims description 53
- 125000003342 alkenyl group Chemical group 0.000 claims description 49
- 125000000304 alkynyl group Chemical group 0.000 claims description 48
- 125000001072 heteroaryl group Chemical group 0.000 claims description 41
- 125000000623 heterocyclic group Chemical group 0.000 claims description 34
- 238000011282 treatment Methods 0.000 claims description 33
- 208000035475 disorder Diseases 0.000 claims description 31
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 26
- 125000003545 alkoxy group Chemical group 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 20
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 18
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 18
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical class 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000004414 alkyl thio group Chemical group 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 claims description 10
- 239000002207 metabolite Substances 0.000 claims description 10
- 229940002612 prodrug Drugs 0.000 claims description 10
- 239000000651 prodrug Substances 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 9
- 229960004397 cyclophosphamide Drugs 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 9
- 230000004614 tumor growth Effects 0.000 claims description 9
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 claims description 8
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 8
- 125000005157 alkyl carboxy group Chemical group 0.000 claims description 8
- 229960002949 fluorouracil Drugs 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- SPFPGSYLNIIQMG-UHFFFAOYSA-N (carboxyamino)carbamic acid Chemical compound OC(=O)NNC(O)=O SPFPGSYLNIIQMG-UHFFFAOYSA-N 0.000 claims description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 7
- 125000004422 alkyl sulphonamide group Chemical group 0.000 claims description 7
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 7
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 7
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 claims description 6
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 claims description 6
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 claims description 6
- 229960000485 methotrexate Drugs 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 229930012538 Paclitaxel Natural products 0.000 claims description 5
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 5
- 229960001592 paclitaxel Drugs 0.000 claims description 5
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 claims description 5
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 claims description 4
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 claims description 4
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 claims description 4
- BLCLNMBMMGCOAS-URPVMXJPSA-N Goserelin Chemical compound C([C@@H](C(=O)N[C@H](COC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NNC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 BLCLNMBMMGCOAS-URPVMXJPSA-N 0.000 claims description 4
- 108010069236 Goserelin Proteins 0.000 claims description 4
- 239000005517 L01XE01 - Imatinib Substances 0.000 claims description 4
- 239000005411 L01XE02 - Gefitinib Substances 0.000 claims description 4
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 claims description 4
- 208000006994 Precancerous Conditions Diseases 0.000 claims description 4
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 claims description 4
- 229940127093 camptothecin Drugs 0.000 claims description 4
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 claims description 4
- 229960001904 epirubicin Drugs 0.000 claims description 4
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 claims description 4
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 claims description 4
- UPJSUQWHUVLLNW-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(Cl)C=CC=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 UPJSUQWHUVLLNW-XMMPIXPASA-N 0.000 claims description 4
- 229960004641 rituximab Drugs 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 claims description 3
- 206010000830 Acute leukaemia Diseases 0.000 claims description 3
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 claims description 3
- 101100002068 Bacillus subtilis (strain 168) araR gene Proteins 0.000 claims description 3
- 108010092160 Dactinomycin Proteins 0.000 claims description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 claims description 3
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 claims description 3
- 206010025323 Lymphomas Diseases 0.000 claims description 3
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 claims description 3
- 208000034578 Multiple myelomas Diseases 0.000 claims description 3
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 claims description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 3
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 claims description 3
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 claims description 3
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 3
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 claims description 3
- 229960001220 amsacrine Drugs 0.000 claims description 3
- 229960002932 anastrozole Drugs 0.000 claims description 3
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 claims description 3
- 101150044616 araC gene Proteins 0.000 claims description 3
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims description 3
- 229960000397 bevacizumab Drugs 0.000 claims description 3
- 229960004562 carboplatin Drugs 0.000 claims description 3
- 229960005395 cetuximab Drugs 0.000 claims description 3
- 208000024207 chronic leukemia Diseases 0.000 claims description 3
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 3
- 229960004316 cisplatin Drugs 0.000 claims description 3
- 229960000640 dactinomycin Drugs 0.000 claims description 3
- 229960000975 daunorubicin Drugs 0.000 claims description 3
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 claims description 3
- 229960003668 docetaxel Drugs 0.000 claims description 3
- 229930013356 epothilone Natural products 0.000 claims description 3
- 150000003883 epothilone derivatives Chemical class 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 claims description 3
- 229960005420 etoposide Drugs 0.000 claims description 3
- 229960000255 exemestane Drugs 0.000 claims description 3
- 229960002584 gefitinib Drugs 0.000 claims description 3
- 229960005277 gemcitabine Drugs 0.000 claims description 3
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 3
- 229960002913 goserelin Drugs 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000003106 haloaryl group Chemical group 0.000 claims description 3
- 229960000908 idarubicin Drugs 0.000 claims description 3
- 229960002411 imatinib Drugs 0.000 claims description 3
- 229960003881 letrozole Drugs 0.000 claims description 3
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 claims description 3
- 229960004844 lovastatin Drugs 0.000 claims description 3
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 claims description 3
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 claims description 3
- 201000001441 melanoma Diseases 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229960001156 mitoxantrone Drugs 0.000 claims description 3
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 claims description 3
- WAVGFGWZADWHPG-RUZDIDTESA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3,5-difluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C=C(F)C=C(F)C=2)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 WAVGFGWZADWHPG-RUZDIDTESA-N 0.000 claims description 3
- 229940086322 navelbine Drugs 0.000 claims description 3
- 229950006344 nocodazole Drugs 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 229960004622 raloxifene Drugs 0.000 claims description 3
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 claims description 3
- 229960001603 tamoxifen Drugs 0.000 claims description 3
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 claims description 3
- 229960001278 teniposide Drugs 0.000 claims description 3
- 229960003048 vinblastine Drugs 0.000 claims description 3
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 claims description 3
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 claims description 3
- 229960004528 vincristine Drugs 0.000 claims description 3
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 claims description 3
- CILBMBUYJCWATM-PYGJLNRPSA-N vinorelbine ditartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC CILBMBUYJCWATM-PYGJLNRPSA-N 0.000 claims description 3
- 101100495912 Arabidopsis thaliana CHR12 gene Proteins 0.000 claims description 2
- 206010006187 Breast cancer Diseases 0.000 claims description 2
- 208000026310 Breast neoplasm Diseases 0.000 claims description 2
- 206010009944 Colon cancer Diseases 0.000 claims description 2
- 206010018338 Glioma Diseases 0.000 claims description 2
- 208000018142 Leiomyosarcoma Diseases 0.000 claims description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 2
- 206010033128 Ovarian cancer Diseases 0.000 claims description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 2
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 2
- 206010060862 Prostate cancer Diseases 0.000 claims description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 2
- 206010039491 Sarcoma Diseases 0.000 claims description 2
- 208000009956 adenocarcinoma Diseases 0.000 claims description 2
- 208000029742 colonic neoplasm Diseases 0.000 claims description 2
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 2
- 206010073071 hepatocellular carcinoma Diseases 0.000 claims description 2
- 231100000844 hepatocellular carcinoma Toxicity 0.000 claims description 2
- 208000029824 high grade glioma Diseases 0.000 claims description 2
- 208000032839 leukemia Diseases 0.000 claims description 2
- 201000005202 lung cancer Diseases 0.000 claims description 2
- 208000020816 lung neoplasm Diseases 0.000 claims description 2
- 201000011614 malignant glioma Diseases 0.000 claims description 2
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 2
- 208000037819 metastatic cancer Diseases 0.000 claims description 2
- 208000011575 metastatic malignant neoplasm Diseases 0.000 claims description 2
- RTBHIXZJQLKSBT-JOCHJYFZSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3,4,5-tetrafluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C(F)=C(F)C=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 RTBHIXZJQLKSBT-JOCHJYFZSA-N 0.000 claims description 2
- OHXWDTHDBWOXTK-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3,5-trifluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C=C(F)C=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 OHXWDTHDBWOXTK-XMMPIXPASA-N 0.000 claims description 2
- JOUODUPCUZHBNU-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3-difluoro-4-methylbenzamide Chemical compound FC1=C(F)C(C)=CC=C1C(=O)N(CCCN)[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 JOUODUPCUZHBNU-XMMPIXPASA-N 0.000 claims description 2
- SYLQVCWRPBEWMT-XMMPIXPASA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-2,3-difluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(F)C=CC=2)F)=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 SYLQVCWRPBEWMT-XMMPIXPASA-N 0.000 claims description 2
- PKJCHTDCQMJVBA-AREMUKBSSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N(CCCN)[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 PKJCHTDCQMJVBA-AREMUKBSSA-N 0.000 claims description 2
- QKLXBZNRIFDKAN-HSZRJFAPSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-1,3,5-trimethylpyrazole-4-sulfonamide Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)S(=O)(=O)C=1C(C)=NN(C)C=1C QKLXBZNRIFDKAN-HSZRJFAPSA-N 0.000 claims description 2
- QWOYYQBHHOPEJK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(7-chloro-4-oxo-3-phenoxyquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(OC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 QWOYYQBHHOPEJK-UHFFFAOYSA-N 0.000 claims description 2
- 201000002528 pancreatic cancer Diseases 0.000 claims description 2
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 5
- 229960004679 doxorubicin Drugs 0.000 claims 2
- 150000005347 biaryls Chemical group 0.000 claims 1
- 125000004407 fluoroaryl group Chemical group 0.000 claims 1
- 230000004083 survival effect Effects 0.000 claims 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 97
- AMKHAJIFPHJYMH-SSDOTTSWSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)CC#C AMKHAJIFPHJYMH-SSDOTTSWSA-N 0.000 description 64
- FCSSYEWURMTUSM-UHFFFAOYSA-N 3-chloro-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1F FCSSYEWURMTUSM-UHFFFAOYSA-N 0.000 description 45
- 210000004027 cell Anatomy 0.000 description 45
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- PNFVIPIQXAIUAY-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CCC(C(O)=O)NC(=O)OC(C)(C)C PNFVIPIQXAIUAY-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 31
- 238000002844 melting Methods 0.000 description 28
- 230000008018 melting Effects 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 25
- 239000000047 product Substances 0.000 description 21
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 20
- 238000005481 NMR spectroscopy Methods 0.000 description 19
- 238000007630 basic procedure Methods 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 125000001424 substituent group Chemical group 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 17
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 239000003814 drug Substances 0.000 description 17
- VBYJOUAMJITBNL-UHFFFAOYSA-N 3-chloro-2-fluorobenzoyl chloride Chemical compound FC1=C(Cl)C=CC=C1C(Cl)=O VBYJOUAMJITBNL-UHFFFAOYSA-N 0.000 description 16
- 230000000694 effects Effects 0.000 description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 102000010638 Kinesin Human genes 0.000 description 13
- 108010063296 Kinesin Proteins 0.000 description 13
- 241000124008 Mammalia Species 0.000 description 13
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 13
- 230000000394 mitotic effect Effects 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- 229940079593 drug Drugs 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- 125000004442 acylamino group Chemical group 0.000 description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 10
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 10
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 10
- 125000001769 aryl amino group Chemical group 0.000 description 10
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 10
- 125000004429 atom Chemical group 0.000 description 10
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 10
- 125000004986 diarylamino group Chemical group 0.000 description 10
- 238000005160 1H NMR spectroscopy Methods 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 102000029749 Microtubule Human genes 0.000 description 9
- 108091022875 Microtubule Proteins 0.000 description 9
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 9
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 9
- 125000005129 aryl carbonyl group Chemical group 0.000 description 9
- 125000005200 aryloxy carbonyloxy group Chemical group 0.000 description 9
- 150000007942 carboxylates Chemical class 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 210000004688 microtubule Anatomy 0.000 description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 8
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 8
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 8
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 description 8
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 8
- 125000005110 aryl thio group Chemical group 0.000 description 8
- 238000003556 assay Methods 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 8
- IBSDSIHTMABATG-UHFFFAOYSA-N 3-(1,3-dioxoisoindol-2-yl)propanal Chemical compound C1=CC=C2C(=O)N(CCC=O)C(=O)C2=C1 IBSDSIHTMABATG-UHFFFAOYSA-N 0.000 description 7
- 239000005711 Benzoic acid Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 7
- 125000005842 heteroatom Chemical group 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 7
- 229940067157 phenylhydrazine Drugs 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- LMRDBJZQDUVCQH-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetaldehyde Chemical compound C1=CC=C2C(=O)N(CC=O)C(=O)C2=C1 LMRDBJZQDUVCQH-UHFFFAOYSA-N 0.000 description 6
- OJLISTAWQHSIHL-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid Chemical group CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CS1 OJLISTAWQHSIHL-UHFFFAOYSA-N 0.000 description 6
- SZXBQTSZISFIAO-UHFFFAOYSA-N 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)C(C(O)=O)NC(=O)OC(C)(C)C SZXBQTSZISFIAO-UHFFFAOYSA-N 0.000 description 6
- 241000282414 Homo sapiens Species 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 235000010233 benzoic acid Nutrition 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 6
- 239000003981 vehicle Substances 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 241000699666 Mus <mouse, genus> Species 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 230000030833 cell death Effects 0.000 description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 230000011278 mitosis Effects 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- YNTOKMNHRPSGFU-UHFFFAOYSA-N n-Propyl carbamate Chemical compound CCCOC(N)=O YNTOKMNHRPSGFU-UHFFFAOYSA-N 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 238000010189 synthetic method Methods 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical group C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 4
- SURCGQGDUADKBL-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N(NCCO)C2=O)=O)=C3C2=CC=CC3=C1 SURCGQGDUADKBL-UHFFFAOYSA-N 0.000 description 4
- GFFFBPYCLRLSOM-OAHLLOKOSA-N 2-[(1r)-1-aminobut-3-ynyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound C#CC[C@@H](N)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 GFFFBPYCLRLSOM-OAHLLOKOSA-N 0.000 description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 4
- 108091006112 ATPases Proteins 0.000 description 4
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 4
- 101001008953 Homo sapiens Kinesin-like protein KIF11 Proteins 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000004663 cell proliferation Effects 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 238000009097 single-agent therapy Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical group [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 4
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- PNFVIPIQXAIUAY-ZCFIWIBFSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC[C@H](C(O)=O)NC(=O)OC(C)(C)C PNFVIPIQXAIUAY-ZCFIWIBFSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical class C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 3
- AZPGHBCYHLLFAF-CYBMUJFWSA-N 2-[(1r)-1-aminobut-3-ynyl]-3-anilinopyrido[3,2-d]pyrimidin-4-one Chemical compound C#CC[C@@H](N)C1=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 AZPGHBCYHLLFAF-CYBMUJFWSA-N 0.000 description 3
- IMUSLIHRIYOHEV-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid Chemical compound CSCCC(C(O)=O)NC(=O)OC(C)(C)C IMUSLIHRIYOHEV-UHFFFAOYSA-N 0.000 description 3
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 3
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 3
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 3
- TUXYZHVUPGXXQG-UHFFFAOYSA-N 4-bromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1 TUXYZHVUPGXXQG-UHFFFAOYSA-N 0.000 description 3
- MDXGYYOJGPFFJL-UHFFFAOYSA-N 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)CC(C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 102100027629 Kinesin-like protein KIF11 Human genes 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 208000035823 Non-specific autoimmune cerebellar ataxia without characteristic antibodies Diseases 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000000692 Student's t-test Methods 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940009456 adriamycin Drugs 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001408 amides Chemical group 0.000 description 3
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 239000012131 assay buffer Substances 0.000 description 3
- 238000011717 athymic nude mouse Methods 0.000 description 3
- FVCYEPDYLBECFV-RUZDIDTESA-N benzyl n-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]amino]propyl]carbamate Chemical compound N([C@H](CC#C)C1=NC=2C(C(N1NC=1C=CC=CC=1)=O)=CC=C(C=2)Cl)CCCNC(=O)OCC1=CC=CC=C1 FVCYEPDYLBECFV-RUZDIDTESA-N 0.000 description 3
- KWEDUNSJJZVRKR-UHFFFAOYSA-N carbononitridic azide Chemical group [N-]=[N+]=NC#N KWEDUNSJJZVRKR-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000002512 chemotherapy Methods 0.000 description 3
- 210000004292 cytoskeleton Anatomy 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 238000011081 inoculation Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000000504 luminescence detection Methods 0.000 description 3
- 239000013642 negative control Substances 0.000 description 3
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 238000013207 serial dilution Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 210000003491 skin Anatomy 0.000 description 3
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 2
- ANVIYYKETYLSRV-UHFFFAOYSA-N 2,3-difluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(F)=C1F ANVIYYKETYLSRV-UHFFFAOYSA-N 0.000 description 2
- JLZVIWSFUPLSOR-UHFFFAOYSA-N 2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1F JLZVIWSFUPLSOR-UHFFFAOYSA-N 0.000 description 2
- QZIVNVIPFGKDQE-UHFFFAOYSA-N 2,6-difluoro-3-methylbenzoic acid Chemical compound CC1=CC=C(F)C(C(O)=O)=C1F QZIVNVIPFGKDQE-UHFFFAOYSA-N 0.000 description 2
- PTDNHYVEBIHJBK-UHFFFAOYSA-M 2-chloro-1,3-dimethylimidazol-1-ium;chloride Chemical compound [Cl-].CN1C=C[N+](C)=C1Cl PTDNHYVEBIHJBK-UHFFFAOYSA-M 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- FPENCTDAQQQKNY-UHFFFAOYSA-N 3,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1 FPENCTDAQQQKNY-UHFFFAOYSA-N 0.000 description 2
- CNBUSIJNWNXLQQ-UHFFFAOYSA-N 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=C(O)C=C1 CNBUSIJNWNXLQQ-UHFFFAOYSA-N 0.000 description 2
- PKTSBFXIHLYGEY-UHFFFAOYSA-N 3-chloro-4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(Cl)=C1 PKTSBFXIHLYGEY-UHFFFAOYSA-N 0.000 description 2
- XUQCONCMPCVUDM-UHFFFAOYSA-N 3-fluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1F XUQCONCMPCVUDM-UHFFFAOYSA-N 0.000 description 2
- ZQVKTHRQIXSMGY-UHFFFAOYSA-N 4-Ethylbenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C=C1 ZQVKTHRQIXSMGY-UHFFFAOYSA-N 0.000 description 2
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 2
- VOCCEVKUXUIHOI-UHFFFAOYSA-N 4-fluoro-3-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1F VOCCEVKUXUIHOI-UHFFFAOYSA-N 0.000 description 2
- BBYDXOIZLAWGSL-UHFFFAOYSA-N 4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-N 0.000 description 2
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 description 2
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 2
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 2
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 108091000080 Phosphotransferase Proteins 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 206010065874 Psoriatic conditions Diseases 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- QWCKQJZIFLGMSD-UHFFFAOYSA-N alpha-aminobutyric acid Chemical compound CCC(N)C(O)=O QWCKQJZIFLGMSD-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 230000000954 anitussive effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229940124584 antitussives Drugs 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical group C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- IQOPLVIAJSHTSY-WJOKGBTCSA-N benzyl n-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-(3-chloro-2-fluorobenzoyl)amino]propyl]carbamate Chemical compound FC1=C(Cl)C=CC=C1C(=O)N([C@H](CC#C)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CCCNC(=O)OCC1=CC=CC=C1 IQOPLVIAJSHTSY-WJOKGBTCSA-N 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 238000003271 compound fluorescence assay Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000005538 encapsulation Methods 0.000 description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000001917 fluorescence detection Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000013537 high throughput screening Methods 0.000 description 2
- 230000000147 hypnotic effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 238000004020 luminiscence type Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 206010061289 metastatic neoplasm Diseases 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- IFJCNNHVRGEHCV-JOCHJYFZSA-N n-(3-aminopropyl)-n-[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound C1([C@@H](CC#C)N(CCCN)C(=O)C=2C(=C(Cl)C=CC=2)F)=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 IFJCNNHVRGEHCV-JOCHJYFZSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000008024 pharmaceutical diluent Substances 0.000 description 2
- 102000020233 phosphotransferase Human genes 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 238000001959 radiotherapy Methods 0.000 description 2
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 2
- 238000007423 screening assay Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 description 2
- 125000004426 substituted alkynyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- LHSYIIFYBVDYIC-QGZVFWFLSA-N tert-butyl n-[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H](CC#C)C1=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 LHSYIIFYBVDYIC-QGZVFWFLSA-N 0.000 description 2
- 125000004001 thioalkyl group Chemical group 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- 150000003852 triazoles Chemical class 0.000 description 2
- JNBRDOQHPXUXLY-UHFFFAOYSA-N (2,5-difluorophenyl)hydrazine Chemical compound NNC1=CC(F)=CC=C1F JNBRDOQHPXUXLY-UHFFFAOYSA-N 0.000 description 1
- PENWGQNPFRRVQI-UHFFFAOYSA-N (2-fluorophenyl)hydrazine Chemical compound NNC1=CC=CC=C1F PENWGQNPFRRVQI-UHFFFAOYSA-N 0.000 description 1
- HFSXFDKOXKNGIA-UHFFFAOYSA-N (3-fluorophenyl)hydrazine Chemical compound NNC1=CC=CC(F)=C1 HFSXFDKOXKNGIA-UHFFFAOYSA-N 0.000 description 1
- MWWSFMDVAYGXBV-MYPASOLCSA-N (7r,9s)-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydrochloride Chemical compound Cl.O([C@@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 MWWSFMDVAYGXBV-MYPASOLCSA-N 0.000 description 1
- QLSAMUCENQZGHN-UHFFFAOYSA-N 1,3,5-trimethylpyrazole-4-sulfonyl chloride Chemical compound CC1=NN(C)C(C)=C1S(Cl)(=O)=O QLSAMUCENQZGHN-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical group C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- HWYOLYBDYSEPLB-UHFFFAOYSA-N 1,3-dichlorocyclohexa-2,4-diene-1-carboxylic acid Chemical compound ClC1(C(=O)O)CC=CC(=C1)Cl HWYOLYBDYSEPLB-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- ZEWIGQRZKRSYKR-UHFFFAOYSA-N 1,4-dichlorocyclohexa-2,4-diene-1-carboxylic acid Chemical compound ClC1(C(=O)O)CC=C(C=C1)Cl ZEWIGQRZKRSYKR-UHFFFAOYSA-N 0.000 description 1
- DNGLRCHMGDDHNC-UHFFFAOYSA-N 1-benzothiophene-2-carbonyl chloride Chemical compound C1=CC=C2SC(C(=O)Cl)=CC2=C1 DNGLRCHMGDDHNC-UHFFFAOYSA-N 0.000 description 1
- DKFHWNGVMWFBJE-UHFFFAOYSA-N 1-ethynylcyclohexene Chemical compound C#CC1=CCCCC1 DKFHWNGVMWFBJE-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical group C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- WEPXLRANFJEOFZ-UHFFFAOYSA-N 2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1F WEPXLRANFJEOFZ-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- IHRMSSGDXMQPBA-UHFFFAOYSA-N 2,3-difluoro-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C(F)=C1F IHRMSSGDXMQPBA-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- NNQVTJNCYBICNC-RUZDIDTESA-N 2-[(1r)-1-[3-aminopropyl(benzyl)amino]propyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CC=C1 NNQVTJNCYBICNC-RUZDIDTESA-N 0.000 description 1
- WYBCHXNPRSMCIT-AREMUKBSSA-N 2-[(1r)-1-[3-aminopropyl-[(4-fluoro-3-methylphenyl)methyl]amino]propyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=C(F)C(C)=C1 WYBCHXNPRSMCIT-AREMUKBSSA-N 0.000 description 1
- LFQSXOVCXBUCAD-HHHXNRCGSA-N 2-[(1r)-1-[3-aminopropyl-[(4-methylphenyl)methyl]amino]but-3-ynyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound C1=CC(C)=CC=C1CN(CCCN)[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 LFQSXOVCXBUCAD-HHHXNRCGSA-N 0.000 description 1
- FRVGPPASCVKEMF-AREMUKBSSA-N 2-[(1r)-1-[3-aminopropyl-[(4-methylphenyl)methyl]amino]propyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound NCCCN([C@H](CC)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=C(C)C=C1 FRVGPPASCVKEMF-AREMUKBSSA-N 0.000 description 1
- WMEYSZDBMIOXDV-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-ynoic acid Chemical compound CC#CCC(C(O)=O)NC(=O)OC(C)(C)C WMEYSZDBMIOXDV-UHFFFAOYSA-N 0.000 description 1
- QVHJQCGUWFKTSE-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)C(C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-UHFFFAOYSA-N 0.000 description 1
- FRVGPPASCVKEMF-UHFFFAOYSA-N 2-[1-[3-aminopropyl-[(4-methylphenyl)methyl]amino]propyl]-3-anilino-7-chloroquinazolin-4-one Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)CC1=CC=C(C)C=C1 FRVGPPASCVKEMF-UHFFFAOYSA-N 0.000 description 1
- SDNQIPIYWUJIHP-XMMPIXPASA-N 2-[3-[[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]amino]propyl]isoindole-1,3-dione Chemical compound C=1C(Cl)=CC=C(C2=O)C=1N=C([C@@H](CC#C)NCCCN1C(C3=CC=CC=C3C1=O)=O)N2NC1=CC=CC=C1 SDNQIPIYWUJIHP-XMMPIXPASA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 1
- NBUUUJWWOARGNW-UHFFFAOYSA-N 2-amino-5-methylbenzoic acid Chemical compound CC1=CC=C(N)C(C(O)=O)=C1 NBUUUJWWOARGNW-UHFFFAOYSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-UHFFFAOYSA-N 2-aminohexanoic acid Chemical compound CCCCC(N)C(O)=O LRQKBLKVPFOOQJ-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- VPHHJAOJUJHJKD-UHFFFAOYSA-N 3,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1 VPHHJAOJUJHJKD-UHFFFAOYSA-N 0.000 description 1
- CXKCZFDUOYMOOP-UHFFFAOYSA-N 3,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(Cl)=C1 CXKCZFDUOYMOOP-UHFFFAOYSA-N 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- VOIZNVUXCQLQHS-UHFFFAOYSA-N 3-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1 VOIZNVUXCQLQHS-UHFFFAOYSA-N 0.000 description 1
- YGYZTZAEZMCPSC-UHFFFAOYSA-N 3-chloro-2,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(Cl)=C1F YGYZTZAEZMCPSC-UHFFFAOYSA-N 0.000 description 1
- OKYSUJVCDXZGKE-UHFFFAOYSA-N 3-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(S(Cl)(=O)=O)=C1 OKYSUJVCDXZGKE-UHFFFAOYSA-N 0.000 description 1
- PEPBFCOIJRULGJ-UHFFFAOYSA-N 3h-1,2,3-benzodioxazole Chemical group C1=CC=C2NOOC2=C1 PEPBFCOIJRULGJ-UHFFFAOYSA-N 0.000 description 1
- PUQVQDMFCAGQQB-UHFFFAOYSA-N 4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)CC(C(O)=O)NC(=O)OC(C)(C)C PUQVQDMFCAGQQB-UHFFFAOYSA-N 0.000 description 1
- RFJWCCHRWJSWGI-UHFFFAOYSA-N 4-(1h-pyrazol-5-yl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=NN1 RFJWCCHRWJSWGI-UHFFFAOYSA-N 0.000 description 1
- RZPBZEISZUFQSV-UHFFFAOYSA-N 4-(4-aminonaphthalen-1-yl)naphthalen-1-amine Chemical compound C12=CC=CC=C2C(N)=CC=C1C1=CC=C(N)C2=CC=CC=C12 RZPBZEISZUFQSV-UHFFFAOYSA-N 0.000 description 1
- NRFKZFFVTGGEQF-UHFFFAOYSA-N 4-fluoro-3-methylbenzaldehyde Chemical compound CC1=CC(C=O)=CC=C1F NRFKZFFVTGGEQF-UHFFFAOYSA-N 0.000 description 1
- GHICCUXQJBDNRN-UHFFFAOYSA-N 4-iodobenzoic acid Chemical compound OC(=O)C1=CC=C(I)C=C1 GHICCUXQJBDNRN-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 208000030507 AIDS Diseases 0.000 description 1
- 238000006064 ATPase reaction Methods 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282836 Camelus dromedarius Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- 101710088194 Dehydrogenase Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- 206010058314 Dysplasia Diseases 0.000 description 1
- 208000000471 Dysplastic Nevus Syndrome Diseases 0.000 description 1
- 244000148064 Enicostema verticillatum Species 0.000 description 1
- 208000010305 Epidermal Cyst Diseases 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- DIZNINCSFSAMLJ-UHFFFAOYSA-N FC1C=C(F)C(F)=CC1(F)C(Cl)=O Chemical compound FC1C=C(F)C(F)=CC1(F)C(Cl)=O DIZNINCSFSAMLJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 229930182816 L-glutamine Natural products 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 206010024612 Lipoma Diseases 0.000 description 1
- 206010025219 Lymphangioma Diseases 0.000 description 1
- 238000000719 MTS assay Methods 0.000 description 1
- 231100000070 MTS assay Toxicity 0.000 description 1
- 206010027145 Melanocytic naevus Diseases 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 206010027626 Milia Diseases 0.000 description 1
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- 208000004304 Myofibromatosis Diseases 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- 206010029113 Neovascularisation Diseases 0.000 description 1
- 241000232901 Nephroma Species 0.000 description 1
- 208000007256 Nevus Diseases 0.000 description 1
- 208000001715 Osteoblastoma Diseases 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 208000007452 Plasmacytoma Diseases 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- 206010037211 Psychomotor hyperactivity Diseases 0.000 description 1
- 208000034541 Rare lymphatic malformation Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 206010043276 Teratoma Diseases 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 108010022394 Threonine synthase Proteins 0.000 description 1
- 102000005497 Thymidylate Synthase Human genes 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 241000269370 Xenopus <genus> Species 0.000 description 1
- GQRHLSBDFHZSFC-OAHLLOKOSA-N [(1R)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]carbamic acid Chemical compound ClC1=CC=C2C(N(C(=NC2=C1)[C@@H](CC#C)NC(O)=O)NC1=CC=CC=C1)=O GQRHLSBDFHZSFC-OAHLLOKOSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 239000003070 absorption delaying agent Substances 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005089 alkenylaminocarbonyl group Chemical group 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940124277 aminobutyric acid Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940045799 anthracyclines and related substance Drugs 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 230000001640 apoptogenic effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000003886 aromatase inhibitor Substances 0.000 description 1
- 229940046844 aromatase inhibitors Drugs 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- PQMOZOQTXKMYSK-UHFFFAOYSA-N benzyl n-(3-oxopropyl)carbamate Chemical compound O=CCCNC(=O)OCC1=CC=CC=C1 PQMOZOQTXKMYSK-UHFFFAOYSA-N 0.000 description 1
- KBILQEUUSUVFPC-GDLZYMKVSA-N benzyl n-[3-[[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]-(3-chloro-2-fluorobenzoyl)amino]propyl]carbamate Chemical compound FC1=C(Cl)C=CC=C1C(=O)N([C@H](CC#C)C=1N(C(=O)C2=NC=CC=C2N=1)NC=1C=CC=CC=1)CCCNC(=O)OCC1=CC=CC=C1 KBILQEUUSUVFPC-GDLZYMKVSA-N 0.000 description 1
- AUEBLRHDOXUKIV-XMMPIXPASA-N benzyl n-[3-[[(1r)-1-(3-anilino-4-oxopyrido[3,2-d]pyrimidin-2-yl)but-3-ynyl]amino]propyl]carbamate Chemical compound C1([C@@H](CC#C)NCCCNC(=O)OCC=2C=CC=CC=2)=NC2=CC=CN=C2C(=O)N1NC1=CC=CC=C1 AUEBLRHDOXUKIV-XMMPIXPASA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 208000001969 capillary hemangioma Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000006143 cell culture medium Substances 0.000 description 1
- 230000025084 cell cycle arrest Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000001516 cell proliferation assay Methods 0.000 description 1
- 230000003833 cell viability Effects 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 231100000481 chemical toxicant Toxicity 0.000 description 1
- 201000002797 childhood leukemia Diseases 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000002759 chromosomal effect Effects 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- GYOZYWVXFNDGLU-XLPZGREQSA-N dTMP Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)C1 GYOZYWVXFNDGLU-XLPZGREQSA-N 0.000 description 1
- JSRLJPSBLDHEIO-SHYZEUOFSA-N dUMP Chemical compound O1[C@H](COP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C=C1 JSRLJPSBLDHEIO-SHYZEUOFSA-N 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005070 decynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 230000026058 directional locomotion Effects 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 229940082789 erbitux Drugs 0.000 description 1
- 229960001433 erlotinib Drugs 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940020967 gemzar Drugs 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 229940080856 gleevec Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 201000011066 hemangioma Diseases 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940022353 herceptin Drugs 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 102000055595 human KIF11 Human genes 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 230000010661 induction of programmed cell death Effects 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 201000011489 infantile myofibromatosis Diseases 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011221 initial treatment Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229940084651 iressa Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 210000002510 keratinocyte Anatomy 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 208000019420 lymphoid neoplasm Diseases 0.000 description 1
- 238000012792 lyophilization process Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 210000003584 mesangial cell Anatomy 0.000 description 1
- 230000031864 metaphase Effects 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000000520 microinjection Methods 0.000 description 1
- 230000036456 mitotic arrest Effects 0.000 description 1
- YAYZWTCHLOBYQD-UHFFFAOYSA-N n-(2-aminoethyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCN)C(=O)C1=CC=CC(Cl)=C1F YAYZWTCHLOBYQD-UHFFFAOYSA-N 0.000 description 1
- BZBMEPOSQOAVFF-UHFFFAOYSA-N n-(2-aminoethyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-chlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCN)C(=O)C1=CC=C(Cl)C=C1 BZBMEPOSQOAVFF-UHFFFAOYSA-N 0.000 description 1
- PUYGTWVQDNGILT-UHFFFAOYSA-N n-(2-aminoethyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-fluoro-3-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCN)C(=O)C1=CC=C(F)C(C)=C1 PUYGTWVQDNGILT-UHFFFAOYSA-N 0.000 description 1
- VQXMSOGENRTKCP-UHFFFAOYSA-N n-(2-aminoethyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCN)C(=O)C1=CC=C(C)C=C1 VQXMSOGENRTKCP-UHFFFAOYSA-N 0.000 description 1
- QDWVCXBIUGRWJL-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-6-chloro-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC=C(Cl)C=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 QDWVCXBIUGRWJL-UHFFFAOYSA-N 0.000 description 1
- KGKFBFYCTIOLDB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-6-methyl-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC=C(C)C=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 KGKFBFYCTIOLDB-UHFFFAOYSA-N 0.000 description 1
- RFVSGVUQTZIZJX-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-(4-hydroxyphenyl)ethyl]-2,3,4-trifluorobenzamide Chemical compound C=1C=C(F)C(F)=C(F)C=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=C(O)C=C1 RFVSGVUQTZIZJX-UHFFFAOYSA-N 0.000 description 1
- VAOKDBKLQLXNNH-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-(4-hydroxyphenyl)ethyl]-3,4-dichlorobenzamide Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=C(O)C=C1 VAOKDBKLQLXNNH-UHFFFAOYSA-N 0.000 description 1
- VAOZDWQCFJVLTB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-3-bromobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC=CC(Br)=C1 VAOZDWQCFJVLTB-UHFFFAOYSA-N 0.000 description 1
- YYZFSELASWYIKO-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-3-fluoro-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC=C(C)C(F)=C1 YYZFSELASWYIKO-UHFFFAOYSA-N 0.000 description 1
- ORYFRLVZDXTXEU-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-4-chloro-2,5-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC(F)=C(Cl)C=C1F ORYFRLVZDXTXEU-UHFFFAOYSA-N 0.000 description 1
- GEHAQCGAXKTQOY-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-methylpropyl]-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C(C)C)N(CCCN)C(=O)C1=CC=C(F)C=C1 GEHAQCGAXKTQOY-UHFFFAOYSA-N 0.000 description 1
- OKHCTUPLZDFPIK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-2,3-difluorobenzamide Chemical compound C=1C=CC(F)=C(F)C=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 OKHCTUPLZDFPIK-UHFFFAOYSA-N 0.000 description 1
- MRZUVVYUPQOOQP-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-3,4-difluorobenzamide Chemical compound C=1C=C(F)C(F)=CC=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 MRZUVVYUPQOOQP-UHFFFAOYSA-N 0.000 description 1
- ZRLQDSOLDQCPRA-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-3-chloro-4-fluorobenzamide Chemical compound C=1C=C(F)C(Cl)=CC=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 ZRLQDSOLDQCPRA-UHFFFAOYSA-N 0.000 description 1
- ONFVCIFYQVMZOE-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-4-bromobenzamide Chemical compound C=1C=C(Br)C=CC=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 ONFVCIFYQVMZOE-UHFFFAOYSA-N 0.000 description 1
- FUGPDSOKRQSZGZ-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-4-fluorobenzamide Chemical compound C=1C=C(F)C=CC=1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 FUGPDSOKRQSZGZ-UHFFFAOYSA-N 0.000 description 1
- FIEGAKLLRHZXKN-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-2-thiophen-2-ylethyl]-4-methylbenzamide Chemical compound C1=CC(C)=CC=C1C(=O)N(CCCN)C(C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CC1=CC=CS1 FIEGAKLLRHZXKN-UHFFFAOYSA-N 0.000 description 1
- IURXTGBTUNBXHY-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylbutyl]-3,4-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC(C)C)N(CCCN)C(=O)C1=CC=C(F)C(F)=C1 IURXTGBTUNBXHY-UHFFFAOYSA-N 0.000 description 1
- PPFNYTFVMQLIOW-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylbutyl]-3,5-dichlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC(C)C)N(CCCN)C(=O)C1=CC(Cl)=CC(Cl)=C1 PPFNYTFVMQLIOW-UHFFFAOYSA-N 0.000 description 1
- VIEBKTCNMQLXBD-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylbutyl]-3-chloro-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC(C)C)N(CCCN)C(=O)C1=CC=C(F)C(Cl)=C1 VIEBKTCNMQLXBD-UHFFFAOYSA-N 0.000 description 1
- XTXUYUBNDNDAFK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylsulfanylpropyl]-2,3-difluoro-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CCSC)N(CCCN)C(=O)C1=CC=C(C)C(F)=C1F XTXUYUBNDNDAFK-UHFFFAOYSA-N 0.000 description 1
- BCWMXCHCGPTRFA-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)-3-methylsulfanylpropyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CCSC)N(CCCN)C(=O)C1=CC=CC(Cl)=C1F BCWMXCHCGPTRFA-UHFFFAOYSA-N 0.000 description 1
- UPJSUQWHUVLLNW-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound C=1C=CC(Cl)=C(F)C=1C(=O)N(CCCN)C(CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 UPJSUQWHUVLLNW-UHFFFAOYSA-N 0.000 description 1
- YBOCPBPLVCTAIT-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-4-chloro-2,5-difluorobenzamide Chemical compound C=1C(F)=C(Cl)C=C(F)C=1C(=O)N(CCCN)C(CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 YBOCPBPLVCTAIT-UHFFFAOYSA-N 0.000 description 1
- RZGURAHGVHKQKD-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)ethyl]-3,4-dichlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(C)N(CCCN)C(=O)C1=CC=C(Cl)C(Cl)=C1 RZGURAHGVHKQKD-UHFFFAOYSA-N 0.000 description 1
- AZQYFJAHFJSKLD-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)pent-3-ynyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC#CC)N(CCCN)C(=O)C1=CC=CC(Cl)=C1F AZQYFJAHFJSKLD-UHFFFAOYSA-N 0.000 description 1
- FSGJJPWMFBEPAA-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)pentyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CCCC)N(CCCN)C(=O)C1=CC=C(C)C=C1 FSGJJPWMFBEPAA-UHFFFAOYSA-N 0.000 description 1
- OTFXSAVTBUSIPV-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-2,3,4-trifluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(F)=C1F OTFXSAVTBUSIPV-UHFFFAOYSA-N 0.000 description 1
- ZDRPICMAOFUAAK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-2,3-dichlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=CC(Cl)=C1Cl ZDRPICMAOFUAAK-UHFFFAOYSA-N 0.000 description 1
- UCFDKIWBMKIJSI-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-2,3-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=CC(F)=C1F UCFDKIWBMKIJSI-UHFFFAOYSA-N 0.000 description 1
- OHVIOEJABBJBLW-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3,4-dichlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(Cl)C(Cl)=C1 OHVIOEJABBJBLW-UHFFFAOYSA-N 0.000 description 1
- KEUSSHJYSPHCPG-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3,4-difluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(F)=C1 KEUSSHJYSPHCPG-UHFFFAOYSA-N 0.000 description 1
- GHYUXRUQWYVERL-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3,5-dichlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC(Cl)=CC(Cl)=C1 GHYUXRUQWYVERL-UHFFFAOYSA-N 0.000 description 1
- KQUGQTZGGZTFJA-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-bromobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=CC(Br)=C1 KQUGQTZGGZTFJA-UHFFFAOYSA-N 0.000 description 1
- XDPLTGJCXHSVDQ-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-2-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=CC(Cl)=C1F XDPLTGJCXHSVDQ-UHFFFAOYSA-N 0.000 description 1
- KASZJCLEUBOROE-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-chloro-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(Cl)=C1 KASZJCLEUBOROE-UHFFFAOYSA-N 0.000 description 1
- OMNWMBDWQGLIOM-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-3-fluoro-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C(F)=C1 OMNWMBDWQGLIOM-UHFFFAOYSA-N 0.000 description 1
- LKSJIFHRPSYAPN-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-bromobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(Br)C=C1 LKSJIFHRPSYAPN-UHFFFAOYSA-N 0.000 description 1
- GLBNRHSVOXZPCV-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-chlorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(Cl)C=C1 GLBNRHSVOXZPCV-UHFFFAOYSA-N 0.000 description 1
- RFBOZGOEKAVXPN-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-fluoro-3-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C(C)=C1 RFBOZGOEKAVXPN-UHFFFAOYSA-N 0.000 description 1
- XPIDNGFPALVBGX-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-fluorobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(F)C=C1 XPIDNGFPALVBGX-UHFFFAOYSA-N 0.000 description 1
- AGIQCCGFKZXBSB-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-iodobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(I)C=C1 AGIQCCGFKZXBSB-UHFFFAOYSA-N 0.000 description 1
- OCBKUTJLOFZEFI-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 OCBKUTJLOFZEFI-UHFFFAOYSA-N 0.000 description 1
- TVBHAMDSTVYAFE-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C([N+]([O-])=O)C=C1 TVBHAMDSTVYAFE-UHFFFAOYSA-N 0.000 description 1
- FFOGGSBTFFBRJK-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-(7-chloro-4-oxo-3-phenylmethoxyquinazolin-2-yl)propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(OCC=2C=CC=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 FFOGGSBTFFBRJK-UHFFFAOYSA-N 0.000 description 1
- IMMSQEYBXLKHPX-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-[7-chloro-3-(2,5-difluoroanilino)-4-oxoquinazolin-2-yl]propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C(=CC=C(F)C=2)F)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 IMMSQEYBXLKHPX-UHFFFAOYSA-N 0.000 description 1
- WYRGCRZZFQNKEI-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-[7-chloro-3-(2-fluoroanilino)-4-oxoquinazolin-2-yl]propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C(=CC=CC=2)F)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 WYRGCRZZFQNKEI-UHFFFAOYSA-N 0.000 description 1
- CWDGVARRICTHOW-UHFFFAOYSA-N n-(3-aminopropyl)-n-[1-[7-chloro-3-(3-fluoroanilino)-4-oxoquinazolin-2-yl]propyl]-4-methylbenzamide Chemical compound N=1C2=CC(Cl)=CC=C2C(=O)N(NC=2C=C(F)C=CC=2)C=1C(CC)N(CCCN)C(=O)C1=CC=C(C)C=C1 CWDGVARRICTHOW-UHFFFAOYSA-N 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- COIQWOHOKNZGPH-SSEXGKCCSA-N n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]-3-chloro-n-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-fluorobenzamide Chemical compound FC1=C(Cl)C=CC=C1C(=O)N([C@H](CC#C)C=1N(C(=O)C2=CC=C(Cl)C=C2N=1)NC=1C=CC=CC=1)CCCN1C(=O)C2=CC=CC=C2C1=O COIQWOHOKNZGPH-SSEXGKCCSA-N 0.000 description 1
- LBWFXVZLPYTWQI-IPOVEDGCSA-N n-[2-(diethylamino)ethyl]-5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-1h-pyrrole-3-carboxamide;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C LBWFXVZLPYTWQI-IPOVEDGCSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000001338 necrotic effect Effects 0.000 description 1
- 208000025351 nephroma Diseases 0.000 description 1
- 210000002241 neurite Anatomy 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 208000004649 neutrophil actin dysfunction Diseases 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- 229940080607 nexavar Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005071 nonynyl group Chemical group C(#CCCCCCCC)* 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- UOKZUTXLHRTLFH-UHFFFAOYSA-N o-phenylhydroxylamine Chemical compound NOC1=CC=CC=C1 UOKZUTXLHRTLFH-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005069 octynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 201000009612 pediatric lymphoma Diseases 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 208000027232 peripheral nervous system disease Diseases 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011535 reaction buffer Substances 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- HSSLDCABUXLXKM-UHFFFAOYSA-N resorufin Chemical group C1=CC(=O)C=C2OC3=CC(O)=CC=C3N=C21 HSSLDCABUXLXKM-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000013341 scale-up Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 201000008261 skin carcinoma Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229960003787 sorafenib Drugs 0.000 description 1
- 230000012391 spindle elongation Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000011255 standard chemotherapy Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical group NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 150000008053 sultones Chemical class 0.000 description 1
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 1
- 229960001796 sunitinib Drugs 0.000 description 1
- 229940034785 sutent Drugs 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 238000012353 t test Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940120982 tarceva Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 description 1
- RCINICONZNJXQF-XAZOAEDWSA-N taxol® Chemical compound O([C@@H]1[C@@]2(CC(C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3(C21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-XAZOAEDWSA-N 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- YFYWVTJUISZJNZ-GOSISDBHSA-N tert-butyl n-[(1r)-1-(3-anilino-7-chloro-4-oxoquinazolin-2-yl)but-3-ynyl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H](CC#C)C1=NC2=CC(Cl)=CC=C2C(=O)N1NC1=CC=CC=C1 YFYWVTJUISZJNZ-GOSISDBHSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000005300 thiocarboxy group Chemical group C(=S)(O)* 0.000 description 1
- BWJZHYWAXLWLTB-UHFFFAOYSA-N thiophene-3-sulfonamide Chemical compound NS(=O)(=O)C=1C=CSC=1 BWJZHYWAXLWLTB-UHFFFAOYSA-N 0.000 description 1
- YSPWSQNKRBSICH-UHFFFAOYSA-N thiophene-3-sulfonyl chloride Chemical compound ClS(=O)(=O)C=1C=CSC=1 YSPWSQNKRBSICH-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 229960000575 trastuzumab Drugs 0.000 description 1
- 125000004784 trichloromethoxy group Chemical group ClC(O*)(Cl)Cl 0.000 description 1
- 125000006168 tricyclic group Chemical group 0.000 description 1
- 108010002164 tyrosine receptor Proteins 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 229940033942 zoladex Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Oncology (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US94583807P | 2007-06-22 | 2007-06-22 | |
| PCT/US2008/067571 WO2009002808A2 (en) | 2007-06-22 | 2008-06-19 | Quinazolinone compounds and methods of use thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2010530885A true JP2010530885A (ja) | 2010-09-16 |
| JP2010530885A5 JP2010530885A5 (enExample) | 2012-07-19 |
Family
ID=39846620
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2010513424A Withdrawn JP2010530885A (ja) | 2007-06-22 | 2008-06-19 | キナゾリノン化合物およびその使用方法 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US8232285B2 (enExample) |
| EP (1) | EP2173724B1 (enExample) |
| JP (1) | JP2010530885A (enExample) |
| KR (1) | KR20100024494A (enExample) |
| CN (1) | CN101801937A (enExample) |
| AU (1) | AU2008268613A1 (enExample) |
| BR (1) | BRPI0813355A2 (enExample) |
| CA (1) | CA2704282A1 (enExample) |
| IL (1) | IL202740A0 (enExample) |
| MX (1) | MX2009013815A (enExample) |
| TW (1) | TW200918069A (enExample) |
| WO (1) | WO2009002808A2 (enExample) |
| ZA (1) | ZA201000183B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP5469779B2 (ja) * | 2010-04-19 | 2014-04-16 | エスアールアイ インターナショナル | 多発性骨髄腫の治療のための組成物および方法 |
| US8940742B2 (en) | 2012-04-10 | 2015-01-27 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| UA121104C2 (uk) | 2013-10-04 | 2020-04-10 | Інфініті Фармасьютикалз, Інк. | Гетероциклічні сполуки і їх застосування |
| WO2015051241A1 (en) | 2013-10-04 | 2015-04-09 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| US20150132575A1 (en) * | 2013-11-14 | 2015-05-14 | Honeywell International Inc. | Luminescent fibers, articles including the same, and methods of forming the same |
| NZ724368A (en) | 2014-03-19 | 2023-07-28 | Infinity Pharmaceuticals Inc | Heterocyclic compounds for use in the treatment of pi3k-gamma mediated disorders |
| WO2016054491A1 (en) | 2014-10-03 | 2016-04-07 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| CN114230571B (zh) | 2015-09-14 | 2025-07-08 | 无限药品股份有限公司 | 异喹啉酮的固体形式、其制备方法、包含其的组合物及其使用方法 |
| US10759806B2 (en) | 2016-03-17 | 2020-09-01 | Infinity Pharmaceuticals, Inc. | Isotopologues of isoquinolinone and quinazolinone compounds and uses thereof as PI3K kinase inhibitors |
| US10919914B2 (en) | 2016-06-08 | 2021-02-16 | Infinity Pharmaceuticals, Inc. | Heterocyclic compounds and uses thereof |
| TW201813963A (zh) | 2016-09-23 | 2018-04-16 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| TW201825465A (zh) | 2016-09-23 | 2018-07-16 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| TW201815787A (zh) | 2016-09-23 | 2018-05-01 | 美商基利科學股份有限公司 | 磷脂醯肌醇3-激酶抑制劑 |
| US20210188843A1 (en) * | 2018-05-11 | 2021-06-24 | The United States Of America,As Represented By The Secretary,Department Of Health And Human Services | Quinoline compounds and their preparation and use as antimalarial agents |
| CN113354590A (zh) * | 2020-03-05 | 2021-09-07 | 宁波康柏睿格医药科技有限公司 | 拮抗nod1/2受体信号通路的喹唑啉酮类化合物 |
Family Cites Families (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BG16042A3 (bg) * | 1968-11-12 | 1972-05-20 | Nans Ott | Метод за получаване на нови 2(1н)-хиназолинони |
| AU543928B2 (en) | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
| US4522811A (en) * | 1982-07-08 | 1985-06-11 | Syntex (U.S.A.) Inc. | Serial injection of muramyldipeptides and liposomes enhances the anti-infective activity of muramyldipeptides |
| US5187167A (en) * | 1986-03-27 | 1993-02-16 | Imperial Chemical Industries Plc | Pharmaceutical compositions comprising quinazolin-4-one derivatives |
| GB8707053D0 (en) * | 1987-03-25 | 1987-04-29 | Ici Plc | Anti-tumour agents |
| NZ227850A (en) * | 1988-02-10 | 1991-11-26 | Hoffmann La Roche | Indole substituted pyrrole derivatives; preparatory process and medicaments for use against inflammatory immunological, bronchopulmonary or vascular disorders |
| GB8827820D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| GB8827988D0 (en) * | 1988-11-30 | 1989-01-05 | Smith Kline French Lab | Chemical compounds |
| USRE36736E (en) * | 1989-02-06 | 2000-06-13 | Hoffman-La Roche Inc. | Substituted pyrroles |
| GB8904161D0 (en) * | 1989-02-23 | 1989-04-05 | Hoffmann La Roche | Substituted pyrroles |
| MC2096A1 (fr) | 1989-02-23 | 1991-02-15 | Hoffmann La Roche | Pyrroles substitues |
| US5380746A (en) * | 1989-05-05 | 1995-01-10 | Goedecke Aktiengesellschaft | Bis-(1H-indol-3-YL)-maleinimide derivatives, processes for the preparation thereof and pharmaceutical compositions containing them |
| CA2015996C (en) | 1989-05-05 | 2001-08-28 | Hartmut Osswald | Bis-(1h-indol-3-yl)-maleinimide derivatives and their use as pharmaceuticals |
| DE4005970A1 (de) | 1990-02-26 | 1991-08-29 | Boehringer Mannheim Gmbh | Neue trisubstituierte maleinimide, verfahren zu ihrer herstellung sowie arzneimittel, die diese verbindungen enthalten |
| DE4005969A1 (de) | 1990-02-26 | 1991-08-29 | Boehringer Mannheim Gmbh | Neue trisubstituierte pyrrole, verfahren zu ihrer herstellung sowie arzneimittel, die diese verbindungen enthalten |
| AU640016B2 (en) * | 1990-05-30 | 1993-08-12 | Imperial Chemical Industries Plc | Hydroquinazoline derivatives |
| US5292747A (en) * | 1990-08-07 | 1994-03-08 | Hoffman-La Roche Inc. | Substituted pyrroles |
| US5591842A (en) * | 1991-11-29 | 1997-01-07 | Banyu Pharmaceutical Co., Ltd. | Indolopyrrolocarbazole derivatives |
| HU219121B (hu) | 1992-03-12 | 2001-02-28 | Smithkline Beecham Plc. | Kondenzált indolszármazékok, eljárás előállításukra és ezeket tartalmazó 5-HT4-receptor antagonista hatású gyógyászati készítmények |
| JPH07504673A (ja) | 1992-03-20 | 1995-05-25 | ザ・ウエルカム・ファウンデーション・リミテッド | 抗ウイルス活性を有するインドール誘導体 |
| US5721230A (en) * | 1993-05-10 | 1998-02-24 | Hoffmann-La Roche Inc. | Substituted pyrroles |
| EP1449529B1 (en) | 1993-12-23 | 2010-01-27 | Eli Lilly And Company | Protein Kinase C Inhibitors |
| US5545636A (en) * | 1993-12-23 | 1996-08-13 | Eli Lilly And Company | Protein kinase C inhibitors |
| US6524832B1 (en) * | 1994-02-04 | 2003-02-25 | Arch Development Corporation | DNA damaging agents in combination with tyrosine kinase inhibitors |
| AU2096895A (en) * | 1994-03-07 | 1995-09-25 | Sugen, Incorporated | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| WO1995030682A1 (en) | 1994-05-09 | 1995-11-16 | Banyu Pharmaceutical Co., Ltd. | Antitumor indolopyprolocarbazole derivative |
| IL110831A (en) | 1994-08-31 | 1998-12-27 | Hadasit Med Res Service | Pharmaceutical compositions containing quinazolinone derivatives for preventing restenosis |
| US5591855A (en) * | 1994-10-14 | 1997-01-07 | Cephalon, Inc. | Fused pyrrolocarbazoles |
| IL112125A (en) | 1994-12-22 | 1998-02-08 | Hadasit Med Res Service | Quinazolinone-containing pharmaceutical compositions |
| US5559228A (en) * | 1995-03-30 | 1996-09-24 | Eli Lilly And Company | Synthesis of bisindolylmaleimides |
| US5747498A (en) * | 1996-05-28 | 1998-05-05 | Pfizer Inc. | Alkynyl and azido-substituted 4-anilinoquinazolines |
| JP3258334B2 (ja) | 1996-03-20 | 2002-02-18 | イーライ・リリー・アンド・カンパニー | インドリルマレイミドの合成 |
| PE91598A1 (es) | 1996-07-29 | 1998-12-24 | Hoffmann La Roche | Pirroles sustituidos |
| PE91698A1 (es) * | 1996-07-29 | 1998-12-24 | Hoffmann La Roche | Pirroles sustituidos |
| WO1998007693A1 (en) | 1996-08-23 | 1998-02-26 | Eli Lilly And Company | Synthesis of bisindolylmalimides |
| SE9603283D0 (sv) * | 1996-09-10 | 1996-09-10 | Astra Ab | New compounds |
| US6153618A (en) | 1996-10-11 | 2000-11-28 | Chiron Corporation | Inhibitors of glycogen synthase 3 kinase |
| US6028075A (en) | 1997-02-11 | 2000-02-22 | Pines; Mark | Quinazolinone containing pharmaceutical compositions for prevention of neovascularization and for treating malignancies |
| US5859261A (en) * | 1997-03-20 | 1999-01-12 | Eli Lilly And Company | Synthesis of indolylmaleimides |
| US6184377B1 (en) * | 1997-12-15 | 2001-02-06 | Sepracor Inc. | Compositions containing N-amino- and N-hydroxy-quinazolinones and methods for preparing libraries thereof |
| CN1320123A (zh) | 1998-07-30 | 2001-10-31 | 日本烟草产业株式会社 | 二取代马来酰亚胺化合物及其医药用途 |
| EP1152002A4 (en) | 1999-02-09 | 2002-04-17 | Sagami Chem Res | PYRROL DERIVATIVES AND CELL DEATH INHIBITORS |
| US6545004B1 (en) | 1999-10-27 | 2003-04-08 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| CA2388646C (en) | 1999-10-27 | 2009-01-27 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| UA74803C2 (uk) * | 1999-11-11 | 2006-02-15 | Осі Фармасьютікалз, Інк. | Стійкий поліморф гідрохлориду n-(3-етинілфеніл)-6,7-біс(2-метоксіетокси)-4-хіназолінаміну, спосіб його одержання (варіанти) та фармацевтичне застосування |
| EP1242420A2 (en) | 1999-12-16 | 2002-09-25 | Eli Lilly And Company | Agents and methods for the treatment of proliferative diseases |
| ATE267194T1 (de) | 1999-12-16 | 2004-06-15 | Lilly Co Eli | Medikamente geeignet zur behandlung von proliferativen erkrankungen |
| US20030087949A1 (en) | 2000-03-30 | 2003-05-08 | Mikiko Sodeoka | Indolylpyrrole derivatives and cell death inhibitors |
| DE60129222T2 (de) | 2000-05-11 | 2008-03-06 | Consejo Superior de Investigaciónes Científicas | Heterocyclischen inhibitoren von glycogen synthase kinase gsk-3 |
| AU7785401A (en) | 2000-06-29 | 2002-01-14 | Long Island Jewish Res Inst | Modulators of cellular proliferation and angiogenesis, methods for use and identification thereof |
| US6962944B2 (en) | 2001-07-31 | 2005-11-08 | Arqule, Inc. | Pharmaceutical compositions containing beta-lapachone, or derivatives or analogs thereof, and methods of using same |
| US7074824B2 (en) | 2001-07-31 | 2006-07-11 | Arqule, Inc. | Pharmaceutical compositions containing beta-lapachone, or derivatives or analogs thereof, and methods of using same |
| JP2005511581A (ja) * | 2001-11-07 | 2005-04-28 | メルク エンド カムパニー インコーポレーテッド | 有糸分裂キネシン阻害剤 |
| US6753428B2 (en) | 2001-11-20 | 2004-06-22 | Cytokinetics, Inc. | Process for the racemization of chiral quinazolinones |
| CA2473853A1 (en) | 2002-01-23 | 2003-08-14 | J. Suzanne Lindsey | Mammalian migration inducting gene and methods for detection and inhibition of migrating tumor cells |
| US7009049B2 (en) | 2002-02-15 | 2006-03-07 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| PT1483265E (pt) | 2002-03-05 | 2007-01-31 | Lilly Co Eli | Derivados de purina como inibidores de quinase |
| EP1553931A4 (en) | 2002-05-09 | 2006-08-30 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| US7038048B2 (en) * | 2002-05-23 | 2006-05-02 | Cytokinetics, Inc. | 3H-pyridopyrimidin-4-one compounds, compositions, and methods of their use |
| JP2006506401A (ja) * | 2002-05-23 | 2006-02-23 | メルク エンド カムパニー インコーポレーテッド | 有糸分裂キネシン阻害薬 |
| JP2006501201A (ja) * | 2002-07-23 | 2006-01-12 | サイトキネティクス・インコーポレーテッド | 化合物、組成物および方法 |
| US20070059697A1 (en) | 2003-04-15 | 2007-03-15 | Avalon Pharmaceuticals, Inc | Determining cancer-linked genes and therapeutic targets using molecular cytogenetic methods |
| US20050043233A1 (en) | 2003-04-29 | 2005-02-24 | Boehringer Ingelheim International Gmbh | Combinations for the treatment of diseases involving cell proliferation, migration or apoptosis of myeloma cells or angiogenesis |
| EP1633758B1 (en) | 2003-05-15 | 2011-11-23 | Arqule, Inc. | Imidazothiazoles and imidazoxazole derivatives as inhibitors of p38 |
| US7345046B2 (en) | 2003-05-30 | 2008-03-18 | Chiron Corporation | Heteroaryl-fused pyrimidinyl compounds as anticancer agents |
| KR101148657B1 (ko) | 2003-06-06 | 2012-07-05 | 제넨테크, 인크. | Hgf 베타 쇄와 c-met 사이의 상호작용의 변조 |
| EP1648493B1 (en) | 2003-07-07 | 2009-12-09 | Van Andel Research Institute | Inhibition of tumor angiogenesis by combination of thrombospondin-1 and inhibitors of vascular endothelial growth factor |
| CN1922208A (zh) | 2003-12-11 | 2007-02-28 | 健泰科生物技术公司 | 用于抑制c-met二聚化及活化的方法和组合物 |
| US8178672B2 (en) | 2004-10-19 | 2012-05-15 | Arqule, Inc. | Synthesis of imidazooxazole and imidazothiazole inhibitors of p38 MAP kinase |
| RU2409579C2 (ru) | 2005-02-09 | 2011-01-20 | Аркьюл, Инк. | Композиции и способы лечения рака |
| TWI362940B (en) | 2005-03-31 | 2012-05-01 | Gen Hospital Corp | A use of agonist and/or antagonist of hgf/hgfr activity |
| WO2007123892A2 (en) * | 2006-04-17 | 2007-11-01 | Arqule Inc. | Raf inhibitors and their uses |
-
2008
- 2008-06-19 CA CA2704282A patent/CA2704282A1/en not_active Abandoned
- 2008-06-19 EP EP08771527A patent/EP2173724B1/en active Active
- 2008-06-19 MX MX2009013815A patent/MX2009013815A/es not_active Application Discontinuation
- 2008-06-19 BR BRPI0813355-7A2A patent/BRPI0813355A2/pt not_active IP Right Cessation
- 2008-06-19 CN CN200880104552A patent/CN101801937A/zh active Pending
- 2008-06-19 KR KR1020107001013A patent/KR20100024494A/ko not_active Withdrawn
- 2008-06-19 JP JP2010513424A patent/JP2010530885A/ja not_active Withdrawn
- 2008-06-19 US US12/142,762 patent/US8232285B2/en active Active
- 2008-06-19 WO PCT/US2008/067571 patent/WO2009002808A2/en not_active Ceased
- 2008-06-19 AU AU2008268613A patent/AU2008268613A1/en not_active Abandoned
- 2008-06-20 TW TW097123156A patent/TW200918069A/zh unknown
-
2009
- 2009-12-15 IL IL202740A patent/IL202740A0/en unknown
-
2010
- 2010-01-11 ZA ZA2010/00183A patent/ZA201000183B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU2008268613A1 (en) | 2008-12-31 |
| US8232285B2 (en) | 2012-07-31 |
| TW200918069A (en) | 2009-05-01 |
| CN101801937A (zh) | 2010-08-11 |
| EP2173724B1 (en) | 2012-12-05 |
| WO2009002808A3 (en) | 2009-07-23 |
| CA2704282A1 (en) | 2008-12-31 |
| ZA201000183B (en) | 2011-03-30 |
| US20090130097A1 (en) | 2009-05-21 |
| BRPI0813355A2 (pt) | 2014-12-30 |
| WO2009002808A2 (en) | 2008-12-31 |
| IL202740A0 (en) | 2010-06-30 |
| MX2009013815A (es) | 2010-03-01 |
| KR20100024494A (ko) | 2010-03-05 |
| EP2173724A2 (en) | 2010-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2010530885A (ja) | キナゾリノン化合物およびその使用方法 | |
| US20110217300A1 (en) | Quinazolinone Compounds and Methods of Use Thereof | |
| CA2592286C (en) | Quinazoline derivatives for inhibiting cancer cell growth and method for the preparation thereof | |
| ES2376552T3 (es) | Compuestos de quinazolinona como agentes antic�?ncer. | |
| ES2369652T3 (es) | Moduladores c-met y métodos de uso. | |
| US7482343B2 (en) | Compounds, methods and compositions | |
| US20080021050A1 (en) | Compounds, compositions, and methods | |
| JP2005536475A (ja) | 化合物、組成物、および方法 | |
| JP2003512461A (ja) | キナゾリノンを用いた方法並びに組成 | |
| JP2005529076A (ja) | キナゾリノンの合成 | |
| JP2994165B2 (ja) | キナゾリン誘導体、その製造法および該キナゾリン誘導体を含有する抗癌作用を得るための医薬調剤 | |
| MX2007002433A (es) | Derivados de quinazolinona y su uso como inhibidores de b-raf. | |
| JP4792128B2 (ja) | 癌に対するhsp90阻害剤としての5−(2−ヒドロキシフェニル)テトラゾール | |
| JP2011500603A5 (enExample) | ||
| AU638679B2 (en) | Antiproliferative cyclic compounds | |
| CN102531949A (zh) | 一种取代苯甲酰胺类化合物及其制备方法和用途 | |
| US8916572B2 (en) | Bis-quinazoline derivatives as inhibitors for epidermal growth factor receptor (EGFR) tyrosine kinase | |
| Kumar et al. | Design and synthesis of novel N-[3-(benzimidazol-2-ylamino) phenyl] amine and N-[3-(benzoxazol-2-ylamino) phenyl] amine derivatives as potential anticancer agents | |
| ES2369707T3 (es) | 2-amino-7,8-dihidro-6h-pirido(4,3-d)pirimidin-5-onas, procedimiento para su preparación y composiciones farmacéuticas que contienen las mismas. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20110513 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20110513 |
|
| A072 | Dismissal of procedure [no reply to invitation to correct request for examination] |
Free format text: JAPANESE INTERMEDIATE CODE: A073 Effective date: 20120913 |
|
| A300 | Application deemed to be withdrawn because no request for examination was validly filed |
Free format text: JAPANESE INTERMEDIATE CODE: A300 Effective date: 20121002 |