JPS6114141B2 - - Google Patents
Info
- Publication number
- JPS6114141B2 JPS6114141B2 JP51126786A JP12678676A JPS6114141B2 JP S6114141 B2 JPS6114141 B2 JP S6114141B2 JP 51126786 A JP51126786 A JP 51126786A JP 12678676 A JP12678676 A JP 12678676A JP S6114141 B2 JPS6114141 B2 JP S6114141B2
- Authority
- JP
- Japan
- Prior art keywords
- compounds
- mixture
- compound
- added
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 68
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 6
- 239000000203 mixture Substances 0.000 description 31
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 15
- 241000700159 Rattus Species 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 7
- 230000003509 anti-fertility effect Effects 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- -1 methoxy, ethoxy, propoxy, isopropoxy, butyloxy, isobutyloxy, t- Butyloxy, sec-butyloxy, amyloxy, isoamyloxy, t-amyloxy Chemical group 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000003433 contraceptive agent Substances 0.000 description 5
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KEIFWROAQVVDBN-UHFFFAOYSA-N 1,2-dihydronaphthalene Chemical class C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 description 4
- 241000271566 Aves Species 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 3
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000035935 pregnancy Effects 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000282421 Canidae Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- BNZYBNYNPXKWCM-UHFFFAOYSA-N phenyl 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC1=CC=CC=C1 BNZYBNYNPXKWCM-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 2
- 230000003637 steroidlike Effects 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- VBKXLXCGRUVRQO-UHFFFAOYSA-N (4-hydroxyphenyl)-(6-hydroxy-1-phenyl-3,4-dihydronaphthalen-2-yl)methanone Chemical compound C1=CC(O)=CC=C1C(=O)C(CCC1=CC(O)=CC=C11)=C1C1=CC=CC=C1 VBKXLXCGRUVRQO-UHFFFAOYSA-N 0.000 description 1
- CVFWKMJYJPBDPV-UHFFFAOYSA-N (4-methoxyphenyl)-(6-methoxy-3-phenyl-1h-inden-2-yl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=C(C=2C=CC=CC=2)C2=CC=C(OC)C=C2C1 CVFWKMJYJPBDPV-UHFFFAOYSA-N 0.000 description 1
- NWRRLJGMPCIDEU-UHFFFAOYSA-N (6-methoxynaphthalen-1-yl)-phenylmethanone Chemical compound COC=1C=C2C=CC=C(C2=CC1)C(C1=CC=CC=C1)=O NWRRLJGMPCIDEU-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- PXORBAGTGTXORO-UHFFFAOYSA-N 1-phenyl-1h-indene Chemical compound C1=CC2=CC=CC=C2C1C1=CC=CC=C1 PXORBAGTGTXORO-UHFFFAOYSA-N 0.000 description 1
- YOLNRLYREUHGLJ-UHFFFAOYSA-N 3,4-dihydronaphthalen-2-yl-(4-hydroxyphenyl)methanone Chemical class C1=CC(O)=CC=C1C(=O)C1=CC2=CC=CC=C2CC1 YOLNRLYREUHGLJ-UHFFFAOYSA-N 0.000 description 1
- BJJQJLOZWBZEGA-UHFFFAOYSA-N 3-Methoxybenzenepropanoic acid Chemical compound COC1=CC=CC(CCC(O)=O)=C1 BJJQJLOZWBZEGA-UHFFFAOYSA-N 0.000 description 1
- QOPRWBRNMPANKN-UHFFFAOYSA-N 5-methoxy-2,3-dihydroinden-1-one Chemical compound COC1=CC=C2C(=O)CCC2=C1 QOPRWBRNMPANKN-UHFFFAOYSA-N 0.000 description 1
- BYFKVUHAZRQWRW-UHFFFAOYSA-N 5-methoxy-2-(4-methoxybenzoyl)-2,3-dihydroinden-1-one Chemical compound C1=CC(OC)=CC=C1C(=O)C1C(=O)C2=CC=C(OC)C=C2C1 BYFKVUHAZRQWRW-UHFFFAOYSA-N 0.000 description 1
- QTUANRNBNIECOH-UHFFFAOYSA-N 7,8-dihydronaphthalen-2-ol Chemical group C1=CCCC2=CC(O)=CC=C21 QTUANRNBNIECOH-UHFFFAOYSA-N 0.000 description 1
- 241000272517 Anseriformes Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- 241000958587 Canis aureus Species 0.000 description 1
- 241000282470 Canis latrans Species 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000276694 Carangidae Species 0.000 description 1
- 241001466804 Carnivora Species 0.000 description 1
- 241000272201 Columbiformes Species 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000007027 Oral Candidiasis Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000287182 Sturnidae Species 0.000 description 1
- 241000287411 Turdidae Species 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 244000000054 animal parasite Species 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000013076 target substance Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/65—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by splitting-off hydrogen atoms or functional groups; by hydrogenolysis of functional groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/625,992 US4017546A (en) | 1975-10-28 | 1975-10-28 | Novel antifertility agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5253844A JPS5253844A (en) | 1977-04-30 |
| JPS6114141B2 true JPS6114141B2 (show.php) | 1986-04-17 |
Family
ID=24508497
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51126786A Granted JPS5253844A (en) | 1975-10-28 | 1976-10-20 | Novel antiifertile agent |
Country Status (31)
| Country | Link |
|---|---|
| US (2) | US4017546A (show.php) |
| JP (1) | JPS5253844A (show.php) |
| AR (1) | AR221031A1 (show.php) |
| AT (1) | AT347443B (show.php) |
| AU (1) | AU503883B2 (show.php) |
| BE (1) | BE847717A (show.php) |
| BG (1) | BG27556A3 (show.php) |
| CA (1) | CA1064926A (show.php) |
| CH (1) | CH624375A5 (show.php) |
| CS (1) | CS234003B2 (show.php) |
| DD (1) | DD127462A5 (show.php) |
| DE (1) | DE2647906C2 (show.php) |
| DK (1) | DK484676A (show.php) |
| ES (1) | ES452736A1 (show.php) |
| FR (1) | FR2329265A1 (show.php) |
| GB (1) | GB1562806A (show.php) |
| GR (1) | GR61239B (show.php) |
| HU (1) | HU176092B (show.php) |
| IE (1) | IE43642B1 (show.php) |
| IL (1) | IL50414A (show.php) |
| MX (1) | MX4320E (show.php) |
| NL (1) | NL7611973A (show.php) |
| NZ (1) | NZ182426A (show.php) |
| PH (2) | PH13486A (show.php) |
| PL (1) | PL106987B1 (show.php) |
| PT (1) | PT65754B (show.php) |
| RO (1) | RO70754A (show.php) |
| SE (1) | SE431086B (show.php) |
| SU (1) | SU654164A3 (show.php) |
| YU (1) | YU262176A (show.php) |
| ZA (1) | ZA766441B (show.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4017546A (en) * | 1975-10-28 | 1977-04-12 | Eli Lilly And Company | Novel antifertility agents |
| US4400543A (en) * | 1975-10-28 | 1983-08-23 | Eli Lilly And Company | 3-Phenyl-4-benzoyl-1,2-dihydronaphthalenes |
| US4230862A (en) * | 1975-10-28 | 1980-10-28 | Eli Lilly And Company | Antifertility compounds |
| US4323707A (en) * | 1975-10-28 | 1982-04-06 | Eli Lilly And Company | Antifertility compounds |
| US5552401A (en) * | 1995-02-28 | 1996-09-03 | Eli Lilly And Company | 2-benzyl-3-arylbenzothiophenes |
| US6107346A (en) * | 1997-08-11 | 2000-08-22 | Eli Lilly And Company | Methods for treating hyperlipidemia |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2551316A (en) * | 1948-02-20 | 1951-05-01 | Searle & Co | 9-aminoalkyl 9-alkanoyl 9, 10 dihydroanthracenes |
| US3274213A (en) * | 1961-09-05 | 1966-09-20 | Upjohn Co | Alkoxy-substituted 2-phenyl-1-(tertiary-aminoalkoxy)phenyl-3, 4-dihydronaphthalenes |
| US3396169A (en) * | 1966-10-26 | 1968-08-06 | Upjohn Co | Substituted 2-phenyl-1-(tertiary-aminoalkoxy) phenyl-3, 4-dihydronaphthalenes |
| US3862232A (en) * | 1963-07-03 | 1975-01-21 | Upjohn Co | 1-(p-hydroxyphenyl)-2-phenyl-6-(2-diethylaminoethoxy)-3,4-dihydronaphthalene and the salts thereof |
| US3293263A (en) * | 1963-12-09 | 1966-12-20 | Upjohn Co | Diphenylbenzocycloalkenes |
| US3519675A (en) * | 1964-06-01 | 1970-07-07 | Upjohn Co | 1,2-diphenyl-3,4-dihydronaphthalenes and 2,3-diphenylindenes |
| US3320271A (en) * | 1964-06-01 | 1967-05-16 | Upjohn Co | 1, 2-diphenyl-3, 4-dihydronaphthalenes and 2, 3-diphenylindenes |
| US3483293A (en) * | 1967-12-15 | 1969-12-09 | Upjohn Co | Method for controlling birds and rodents |
| US4017546A (en) * | 1975-10-28 | 1977-04-12 | Eli Lilly And Company | Novel antifertility agents |
-
1975
- 1975-10-28 US US05/625,992 patent/US4017546A/en not_active Expired - Lifetime
-
1976
- 1976-09-02 AU AU17407/76A patent/AU503883B2/en not_active Expired
- 1976-09-05 IL IL50414A patent/IL50414A/xx unknown
- 1976-10-20 MX MX764987U patent/MX4320E/es unknown
- 1976-10-20 JP JP51126786A patent/JPS5253844A/ja active Granted
- 1976-10-21 CA CA263,843A patent/CA1064926A/en not_active Expired
- 1976-10-21 NZ NZ182426A patent/NZ182426A/xx unknown
- 1976-10-22 PH PH19041A patent/PH13486A/en unknown
- 1976-10-22 DE DE2647906A patent/DE2647906C2/de not_active Expired
- 1976-10-22 HU HU76EI712A patent/HU176092B/hu unknown
- 1976-10-25 PT PT65754A patent/PT65754B/pt unknown
- 1976-10-25 GR GR52002A patent/GR61239B/el unknown
- 1976-10-25 GB GB44176/76A patent/GB1562806A/en not_active Expired
- 1976-10-26 ES ES452736A patent/ES452736A1/es not_active Expired
- 1976-10-26 RO RO7688225A patent/RO70754A/ro unknown
- 1976-10-26 SU SU762414100A patent/SU654164A3/ru active
- 1976-10-27 SE SE7611952A patent/SE431086B/xx not_active IP Right Cessation
- 1976-10-27 IE IE2373/76A patent/IE43642B1/en unknown
- 1976-10-27 DK DK484676A patent/DK484676A/da not_active Application Discontinuation
- 1976-10-27 YU YU02621/76A patent/YU262176A/xx unknown
- 1976-10-27 CH CH1355276A patent/CH624375A5/de not_active IP Right Cessation
- 1976-10-27 ZA ZA00766441A patent/ZA766441B/xx unknown
- 1976-10-28 BG BG034553A patent/BG27556A3/xx unknown
- 1976-10-28 AT AT800676A patent/AT347443B/de not_active IP Right Cessation
- 1976-10-28 BE BE1007723A patent/BE847717A/xx not_active IP Right Cessation
- 1976-10-28 NL NL7611973A patent/NL7611973A/xx not_active Application Discontinuation
- 1976-10-28 CS CS766972A patent/CS234003B2/cs unknown
- 1976-10-28 PL PL1976193327A patent/PL106987B1/pl unknown
- 1976-10-28 FR FR7632512A patent/FR2329265A1/fr active Granted
- 1976-10-28 DD DD195509A patent/DD127462A5/xx unknown
- 1976-10-28 AR AR265275A patent/AR221031A1/es active
- 1976-11-24 US US05/744,488 patent/US4075223A/en not_active Expired - Lifetime
-
1979
- 1979-09-17 PH PH23040A patent/PH14545A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1090795A (en) | 2-phenyl-3-aroylbenzothiophenes and their 1-oxides | |
| US4230862A (en) | Antifertility compounds | |
| EP0861223B1 (en) | Process for the synthesis of curcumin-related compounds | |
| US4075227A (en) | Antifertility compounds | |
| PL144294B1 (en) | Method of obtaining novel polycyclic aromatic compounds | |
| US4323707A (en) | Antifertility compounds | |
| US3120551A (en) | 5-(4-biphenylyl)-3-methylvaleric acid and functional derivatives thereof | |
| JPS6114141B2 (show.php) | ||
| IE47960B1 (en) | Tetrazole derivatives | |
| HUT53608A (en) | Process for production of derivatives of (pirrolil-phenil)-substituated gidroxam-acid | |
| US4400543A (en) | 3-Phenyl-4-benzoyl-1,2-dihydronaphthalenes | |
| JPS6045191B2 (ja) | 新しい抗受精剤 | |
| KR800000942B1 (ko) | 아로일-페닐나프탈렌 유도체의 제조방법 | |
| US3979468A (en) | 4'-Chloro-4-ethynylbiphenyl and method of preparing same | |
| KR800000145B1 (ko) | 새로운 항 수정제의 제조방법 | |
| US4927819A (en) | Cyclo-octane neuroprotective agents | |
| KR800000943B1 (ko) | 아로일-페닐나프탈렌 유도체의 제조방법 | |
| US4283404A (en) | Aroylethenylpiperidinobutyrophenone antipsychotic agents | |
| KR800001036B1 (ko) | 새로운 항수정제의 제조방법 | |
| US2783234A (en) | 2[beta-(3', 4'-dimethoxyphenyl) ethyl]-4, 6, 7-trimethoxyquinoline | |
| SU860701A1 (ru) | Способ получени производных бензопирана | |
| PL126745B1 (en) | Insecticide |