JPS57159789A - Preparation of cephamycin derivative - Google Patents
Preparation of cephamycin derivativeInfo
- Publication number
- JPS57159789A JPS57159789A JP4485481A JP4485481A JPS57159789A JP S57159789 A JPS57159789 A JP S57159789A JP 4485481 A JP4485481 A JP 4485481A JP 4485481 A JP4485481 A JP 4485481A JP S57159789 A JPS57159789 A JP S57159789A
- Authority
- JP
- Japan
- Prior art keywords
- cephamycin
- compound
- hetero
- halogen
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- UCKZMPLVLCKKMO-LHLIQPBNSA-N cephamycin Chemical class S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](C)[C@]21OC UCKZMPLVLCKKMO-LHLIQPBNSA-N 0.000 title abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 abstract 3
- -1 carboxylic acid halide Chemical class 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- 239000002904 solvent Substances 0.000 abstract 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 abstract 2
- 125000002252 acyl group Chemical group 0.000 abstract 2
- 150000008282 halocarbons Chemical class 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 abstract 1
- LXWBXEWUSAABOA-UHFFFAOYSA-N Cephamycin-C Natural products S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)C(OC)(NC(=O)CCCC(N)C(O)=O)C21 LXWBXEWUSAABOA-UHFFFAOYSA-N 0.000 abstract 1
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- LXWBXEWUSAABOA-VXSYNFHWSA-N cephamycin C Chemical compound S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)[C@@](OC)(NC(=O)CCC[C@@H](N)C(O)=O)[C@H]21 LXWBXEWUSAABOA-VXSYNFHWSA-N 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
Landscapes
- Cephalosporin Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4485481A JPS57159789A (en) | 1981-03-27 | 1981-03-27 | Preparation of cephamycin derivative |
| SE8201087A SE452620B (sv) | 1981-02-23 | 1982-02-22 | Forfarande for framstellning av derivat av beta-laktamantibiotika |
| DK075582A DK162603C (da) | 1981-02-23 | 1982-02-22 | Fremgangsmaade til fremstilling af beta-lactam-antibiotica |
| CH108282A CH646977A5 (en) | 1981-02-23 | 1982-02-22 | Process for the preparation of derivatives of beta-lactam antibiotics |
| NL8200708A NL8200708A (nl) | 1981-02-23 | 1982-02-23 | Werkwijze voor de bereiding van beta-lactamantibioticaverbindingen. |
| CA000396796A CA1194470A (en) | 1981-02-23 | 1982-02-23 | PROCESS FOR PREPARING DERIVATIVES OF .beta.-LACTAM ANTI- BIOTICS |
| ES509837A ES8305362A1 (es) | 1981-02-23 | 1982-02-23 | Un procedimiento para preparar derivados de antibioticos-lactamicos. |
| IT67194/82A IT1157951B (it) | 1981-02-23 | 1982-02-23 | Procedimento per la preparazione di antibiotici betalattamici |
| FI820582A FI72521C (fi) | 1981-02-23 | 1982-02-23 | Foerfarande foer framstaellning av cefalosporinderivat. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4485481A JPS57159789A (en) | 1981-03-27 | 1981-03-27 | Preparation of cephamycin derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57159789A true JPS57159789A (en) | 1982-10-01 |
| JPH0158189B2 JPH0158189B2 (enExample) | 1989-12-11 |
Family
ID=12703064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4485481A Granted JPS57159789A (en) | 1981-02-23 | 1981-03-27 | Preparation of cephamycin derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57159789A (enExample) |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5520723A (en) * | 1978-08-02 | 1980-02-14 | Nippon Kayaku Co Ltd | Preparation of cephalosporin compound |
-
1981
- 1981-03-27 JP JP4485481A patent/JPS57159789A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5520723A (en) * | 1978-08-02 | 1980-02-14 | Nippon Kayaku Co Ltd | Preparation of cephalosporin compound |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0158189B2 (enExample) | 1989-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5498795A (en) | Cephalosporin derivative and its preparation | |
| JPS56131565A (en) | 4-substituted-2-oxoazetidine compound and its preparation | |
| JPS55115892A (en) | 3-phosphonocephalosporanic acid derivative, its preparation, and medicine containing the same | |
| JPS5573686A (en) | Novel penicillin | |
| JPS57159789A (en) | Preparation of cephamycin derivative | |
| JPS54103888A (en) | Novel 7alpha-methoxy-cephalosporin | |
| JPS56154483A (en) | Preparation or pyrrole derivative | |
| JPS54144392A (en) | Cephalosporin derivative | |
| JPS5625188A (en) | 7alpha-methoxycephalosporin | |
| JPS55160794A (en) | N6-substituted cordycepin and its preparation | |
| JPS56135488A (en) | Novel preparative method of cephalosporanic acid derivative | |
| JPS54144391A (en) | 7-aminosporanic acid derivative and its preparation | |
| JPS55136281A (en) | Xanthine derivative | |
| JPS55136287A (en) | Novel penicillin, cephalosporin, and their preparation | |
| JPS57136586A (en) | Cephalosporin derivative and its preparation | |
| JPS5598188A (en) | Novel cephalosporin and its preparation | |
| JPS56128787A (en) | Cephalosporin derivative and its preparation | |
| JPS567795A (en) | N-acylcephalosporin derivative and its salt | |
| JPS56131591A (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid compound, its salt, preparation thereof and preventing agent and remedy for microbism containing the same as active consitutent | |
| JPS6431761A (en) | Polyhalogenoindoline derivative | |
| JPS5677273A (en) | Flavan derivative and its acid addition salt | |
| JPS5569583A (en) | Pyrido 3,2,1-jk carbazole derivative | |
| JPS5629526A (en) | Preparation of acylcyanide | |
| JPS55118485A (en) | Benzo ij quinolizine-2-carboxylic acid derivative | |
| JPS5738788A (en) | 2-aminoheterocycle borane and its preparation |