JPH0415779B2 - - Google Patents
Info
- Publication number
- JPH0415779B2 JPH0415779B2 JP6505684A JP6505684A JPH0415779B2 JP H0415779 B2 JPH0415779 B2 JP H0415779B2 JP 6505684 A JP6505684 A JP 6505684A JP 6505684 A JP6505684 A JP 6505684A JP H0415779 B2 JPH0415779 B2 JP H0415779B2
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- substituted
- group
- hydrogen
- chr
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 87
- 150000001875 compounds Chemical class 0.000 claims description 59
- 229910052739 hydrogen Inorganic materials 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 38
- -1 nitro, amino Chemical group 0.000 claims description 32
- 150000002431 hydrogen Chemical class 0.000 claims description 30
- 125000006648 (C1-C8) haloalkyl group Chemical group 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 22
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 20
- 125000003342 alkenyl group Chemical group 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 125000004414 alkyl thio group Chemical group 0.000 claims description 17
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 241000196324 Embryophyta Species 0.000 claims description 11
- 125000000304 alkynyl group Chemical group 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 125000003282 alkyl amino group Chemical group 0.000 claims description 10
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052717 sulfur Chemical group 0.000 claims description 10
- 239000011593 sulfur Chemical group 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 230000002363 herbicidal effect Effects 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000001768 cations Chemical class 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 125000000232 haloalkynyl group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- KPPVNWGJXFMGAM-UUILKARUSA-N (e)-2-methyl-1-(6-methyl-3,4-dihydro-2h-quinolin-1-yl)but-2-en-1-one Chemical compound CC1=CC=C2N(C(=O)C(/C)=C/C)CCCC2=C1 KPPVNWGJXFMGAM-UUILKARUSA-N 0.000 claims description 5
- 125000004450 alkenylene group Chemical group 0.000 claims description 5
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 claims description 5
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 claims description 5
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- 125000000033 alkoxyamino group Chemical group 0.000 claims description 4
- 238000007126 N-alkylation reaction Methods 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- ZVHPCOYNVUUBQG-UHFFFAOYSA-N 2-methylpropyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-methoxy-2-nitroanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=C(C=C(C=C1)C(F)(F)F)Cl)[N+](=O)[O-])CC(=O)OCC(C)C ZVHPCOYNVUUBQG-UHFFFAOYSA-N 0.000 claims description 2
- STXSYZPJZJZZTA-UHFFFAOYSA-N methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-n-methoxy-2-nitroanilino]acetate Chemical compound C1=C([N+]([O-])=O)C(N(CC(=O)OC)OC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 STXSYZPJZJZZTA-UHFFFAOYSA-N 0.000 claims description 2
- IRFWCAMJNHGQLN-UHFFFAOYSA-N methyl 2-[5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-n-methoxy-2-nitroanilino]acetate Chemical compound C1=C([N+]([O-])=O)C(N(CC(=O)OC)OC)=CC(OC=2C(=CC(=CN=2)C(F)(F)F)Cl)=C1 IRFWCAMJNHGQLN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 15
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- 238000012746 preparative thin layer chromatography Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- OLDWFVBRFOYIEL-UHFFFAOYSA-N 5-[2-chloro-4-(trifluoromethyl)phenoxy]-n-methoxy-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(NOC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 OLDWFVBRFOYIEL-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 229940045803 cuprous chloride Drugs 0.000 description 2
- 239000004491 dispersible concentrate Substances 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- IHEOGOJRIWLPMH-UHFFFAOYSA-N 2-chloro-1-(3,4-dinitrophenoxy)-4-(trifluoromethyl)benzene Chemical compound C1=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl IHEOGOJRIWLPMH-UHFFFAOYSA-N 0.000 description 1
- BPYFMEUGFHZTNS-UHFFFAOYSA-N 2-methoxyethyl 2-[5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-N-methoxy-2-nitroanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=NC=C(C=C1Cl)C(F)(F)F)[N+](=O)[O-])CC(=O)OCCOC BPYFMEUGFHZTNS-UHFFFAOYSA-N 0.000 description 1
- UABMKAIRADVCKC-UHFFFAOYSA-N 5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-n-methoxy-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(NOC)=CC(OC=2C(=CC(=CN=2)C(F)(F)F)Cl)=C1 UABMKAIRADVCKC-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 1
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241001502129 Mullus Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 244000236458 Panicum colonum Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 235000008406 SarachaNachtschatten Nutrition 0.000 description 1
- 235000004790 Solanum aculeatissimum Nutrition 0.000 description 1
- 235000008424 Solanum demissum Nutrition 0.000 description 1
- 235000018253 Solanum ferox Nutrition 0.000 description 1
- 235000000208 Solanum incanum Nutrition 0.000 description 1
- 235000013131 Solanum macrocarpon Nutrition 0.000 description 1
- 235000009869 Solanum phureja Nutrition 0.000 description 1
- 240000002307 Solanum ptychanthum Species 0.000 description 1
- 235000000341 Solanum ptychanthum Nutrition 0.000 description 1
- 235000017622 Solanum xanthocarpum Nutrition 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005262 alkoxyamine group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- GGWIUBBZFAFCIG-UHFFFAOYSA-N methyl 2-[2-amino-5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-N-methoxyanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=NC=C(C=C1Cl)C(F)(F)F)N)CC(=O)OC GGWIUBBZFAFCIG-UHFFFAOYSA-N 0.000 description 1
- XXHDYBAIEVALAY-UHFFFAOYSA-N methyl 2-[2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-methoxyanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=C(C=C(C=C1)C(F)(F)F)Cl)Cl)CC(=O)OC XXHDYBAIEVALAY-UHFFFAOYSA-N 0.000 description 1
- GTYGEPPTDIHOHT-UHFFFAOYSA-N methyl 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-N-methoxyanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=NC=C(C=C1Cl)C(F)(F)F)Cl)CC(=O)OC GTYGEPPTDIHOHT-UHFFFAOYSA-N 0.000 description 1
- CVGQYAZPHVHSCY-UHFFFAOYSA-N methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-cyano-N-methoxyanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=C(C=C(C=C1)C(F)(F)F)Cl)C#N)CC(=O)OC CVGQYAZPHVHSCY-UHFFFAOYSA-N 0.000 description 1
- HHSKOQFZFGRKLS-UHFFFAOYSA-N methyl 2-[5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-2-cyano-N-methoxyanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=NC=C(C=C1Cl)C(F)(F)F)C#N)CC(=O)OC HHSKOQFZFGRKLS-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- ACEONLNNWKIPTM-UHFFFAOYSA-N methyl 2-bromopropanoate Chemical compound COC(=O)C(C)Br ACEONLNNWKIPTM-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical class C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- ISIRFIHFOCCMSW-UHFFFAOYSA-N propan-2-yl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-methoxy-2-nitroanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=C(C=C(C=C1)C(F)(F)F)Cl)[N+](=O)[O-])CC(=O)OC(C)C ISIRFIHFOCCMSW-UHFFFAOYSA-N 0.000 description 1
- GRHZEGWNJCFOQQ-UHFFFAOYSA-N propan-2-yl 2-[5-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy-N-methoxy-2-nitroanilino]acetate Chemical compound CON(C1=C(C=CC(=C1)OC1=NC=C(C=C1Cl)C(F)(F)F)[N+](=O)[O-])CC(=O)OC(C)C GRHZEGWNJCFOQQ-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000009666 routine test Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US481044 | 1983-03-31 | ||
| US06/481,044 US4526608A (en) | 1982-07-14 | 1983-03-31 | Certain 2-pyridyloxyphenyl-oximino-ether-carboxylates, herbicidal compositions containing same and their herbicidal method of use |
| US526182 | 1983-08-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59225148A JPS59225148A (ja) | 1984-12-18 |
| JPH0415779B2 true JPH0415779B2 (OSRAM) | 1992-03-19 |
Family
ID=23910361
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59065056A Granted JPS59225148A (ja) | 1983-03-31 | 1984-03-30 | 新規アニリン類およびその用途 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4526608A (OSRAM) |
| JP (1) | JPS59225148A (OSRAM) |
| BE (1) | BE899207A (OSRAM) |
| CS (1) | CS247174B2 (OSRAM) |
| IT (1) | IT8447963A0 (OSRAM) |
| SU (1) | SU1303026A3 (OSRAM) |
| ZA (1) | ZA842431B (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5077436A (en) * | 1985-02-22 | 1991-12-31 | Mitsui Toatsu Chemicals, Inc. | Bis(3-aminophenoxy) aromatics and method of preparing the same |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| CA1257598A (en) * | 1987-08-11 | 1989-07-18 | Harukazu Fukami | Herbicidally active phenoxyalkanecarboxylic acid derivatives |
| US5205855A (en) * | 1987-08-11 | 1993-04-27 | Suntory Limited | Herbicidally active phenoxyalkanecarboxylic acid derivatives |
| EP0379915A1 (de) * | 1989-01-26 | 1990-08-01 | Bayer Ag | Substituierte Phenoxybenzonitril-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide und Pflanzenwuchsregulatoren |
| DK0624155T4 (da) | 1992-01-29 | 2003-01-06 | Basf Ag | Carbamater og plantebeskyttelsesmidler indeholdende disse |
| EP1144380A4 (en) * | 1998-11-30 | 2003-11-26 | Ishihara Sangyo Kaisha | META-NITROPHENOL DERIVATIVE AND A METHOD FOR THE PRODUCTION THEREOF |
| DE60118917T2 (de) * | 2000-06-26 | 2006-11-30 | Pfizer Products Inc., Groton | PYRROLO[2,3-d]PYRIMIDIN-VERBINDUNGEN ALS IMMUNOSUPPRESSIVE WIRKSTOFFE ' |
| JP2005503345A (ja) * | 2001-04-30 | 2005-02-03 | バイエル・コーポレーシヨン | 新規な4−アミノ−5,6−置換チオフェノ[2,3−d]ピリミジン |
| AU2003224717B2 (en) * | 2002-03-26 | 2009-07-16 | Koch Agronomic Services, Llc | Slow release nitrogen seed coat |
| US7214825B2 (en) | 2003-10-17 | 2007-05-08 | Honeywell International Inc. | O-(3-chloropropenyl) hydroxylamine free base |
| ME01269B (me) * | 2008-08-20 | 2013-06-20 | Zoetis Services Llc | Jedinjenja pirolo (2,3-d) pirimidina |
| US20160145202A1 (en) * | 2013-06-27 | 2016-05-26 | Basf Se | Strobilurin Type Compounds for Combating Phytopathogenic Fungi |
| NL2022471B1 (en) | 2019-01-29 | 2020-08-18 | Vationpharma B V | Solid state forms of oclacitinib |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2938595A1 (de) * | 1979-09-24 | 1981-04-23 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Verfahren zur herstellung von diphenylaethern |
| US4419123A (en) * | 1981-10-19 | 1983-12-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-3'-carbon-substituted-4'-substituted diphenyl ethers |
| DE3265648D1 (en) * | 1981-11-09 | 1985-09-26 | Duphar Int Res | New diphenyl ethers having herbicidal activity |
-
1983
- 1983-03-31 US US06/481,044 patent/US4526608A/en not_active Expired - Fee Related
-
1984
- 1984-03-21 BE BE1/10984A patent/BE899207A/fr not_active IP Right Cessation
- 1984-03-29 IT IT8447963A patent/IT8447963A0/it unknown
- 1984-03-29 CS CS842360A patent/CS247174B2/cs unknown
- 1984-03-30 ZA ZA842431A patent/ZA842431B/xx unknown
- 1984-03-30 SU SU843720521A patent/SU1303026A3/ru active
- 1984-03-30 JP JP59065056A patent/JPS59225148A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IT8447963A0 (it) | 1984-03-29 |
| SU1303026A3 (ru) | 1987-04-07 |
| ZA842431B (en) | 1985-11-27 |
| US4526608A (en) | 1985-07-02 |
| BE899207A (fr) | 1984-09-21 |
| CS247174B2 (en) | 1986-12-18 |
| JPS59225148A (ja) | 1984-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69126825T2 (de) | Substituierte Phthalide und heterozyklische Phthalide | |
| DK172914B1 (da) | Herbicide pyridin- og -quinolinforbindelser, mellemprodukter til fremstilling heraf, samt herbicid indeholdende forbindelse | |
| JP3157234B2 (ja) | 除草性カルボキシアミド誘導体 | |
| EP0447004B1 (en) | Herbicidal carboxamide derivatives | |
| DE60118155T2 (de) | 3-phenoxy-1-phenyl acetylenderivate und ihre verwendung als herbizide | |
| JPH0415779B2 (OSRAM) | ||
| EP0353187A2 (de) | Neue Herbizide | |
| US5071468A (en) | Triazolopyrimidine herbicides | |
| CZ205096A3 (en) | Aryl- and heteroarylpyrimidines and herbicidal agents in which said compounds are comprised | |
| AU595229B2 (en) | Substituted semicarbazones, thiosemicarbazones and isothiosemicarbazones | |
| EP0042750A2 (en) | Quinoxalinyloxy ethers as selective weed control agents | |
| US4308053A (en) | Certain 2-pyridinyloxy-N-lower-alkane-sulfonyl benzamides and their use as herbicides | |
| US6251829B1 (en) | Herbicidal benzoyloxy carboxylates and carboxamides | |
| WO1985004661A1 (en) | Novel phosphinates | |
| DE69018404T2 (de) | Herbizide Acrylonitrilderivate. | |
| EP0148119A2 (de) | 2-Phenoxypropions ure-cyanamide | |
| US4556414A (en) | Herbicidal dihydropyridine amides | |
| US4008067A (en) | Oxacyclohexane derivatives | |
| US4731446A (en) | Imidazo[1,2-a]pyrimidine sulfonic acids and acid halides | |
| US5536703A (en) | Herbicidal substituted benzoyl bicycloalkanediones | |
| US4799952A (en) | Herbicidal imidazolo(1,2-a)pyrimidine-2-sulfonanilides | |
| US4406689A (en) | Certain aralkyloxy or thio-pyridyl-imidazo-pyridines and their herbicidal use | |
| CA1198114A (en) | Anilines and their use | |
| US4193790A (en) | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds | |
| DE3514798A1 (de) | 2,4-bis-(alkoximinoalkyl)-cyclohexan-1,3-dione |