JPH0355411B2 - - Google Patents
Info
- Publication number
- JPH0355411B2 JPH0355411B2 JP58231622A JP23162283A JPH0355411B2 JP H0355411 B2 JPH0355411 B2 JP H0355411B2 JP 58231622 A JP58231622 A JP 58231622A JP 23162283 A JP23162283 A JP 23162283A JP H0355411 B2 JPH0355411 B2 JP H0355411B2
- Authority
- JP
- Japan
- Prior art keywords
- sio
- zsm
- zeolite
- cation
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000010457 zeolite Substances 0.000 claims description 90
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 71
- 229910021536 Zeolite Inorganic materials 0.000 claims description 67
- -1 alkaline earth metal cation Chemical class 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 29
- 150000001768 cations Chemical class 0.000 claims description 27
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 23
- 239000013078 crystal Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 20
- 239000011541 reaction mixture Substances 0.000 claims description 19
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 14
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 13
- 150000001340 alkali metals Chemical class 0.000 claims description 13
- 239000011734 sodium Substances 0.000 claims description 12
- 238000002441 X-ray diffraction Methods 0.000 claims description 11
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 11
- 239000000377 silicon dioxide Substances 0.000 claims description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- 229910052708 sodium Inorganic materials 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- 238000002425 crystallisation Methods 0.000 claims description 7
- 230000008025 crystallization Effects 0.000 claims description 7
- 239000011591 potassium Chemical group 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052792 caesium Chemical group 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical group [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 4
- 125000000524 functional group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000010586 diagram Methods 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 14
- 238000001179 sorption measurement Methods 0.000 description 13
- 239000000463 material Substances 0.000 description 12
- 229910052761 rare earth metal Inorganic materials 0.000 description 12
- 239000011148 porous material Substances 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- 150000002910 rare earth metals Chemical class 0.000 description 8
- 239000004215 Carbon black (E152) Substances 0.000 description 7
- 229910000323 aluminium silicate Inorganic materials 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 6
- 239000002156 adsorbate Substances 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 230000000737 periodic effect Effects 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000002178 crystalline material Substances 0.000 description 4
- 230000018044 dehydration Effects 0.000 description 4
- 238000006297 dehydration reaction Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 229910052684 Cerium Inorganic materials 0.000 description 3
- 229910052688 Gadolinium Inorganic materials 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910052779 Neodymium Inorganic materials 0.000 description 3
- 229910052777 Praseodymium Inorganic materials 0.000 description 3
- 229910052772 Samarium Inorganic materials 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000005899 aromatization reaction Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical group [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000005336 cracking Methods 0.000 description 3
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052746 lanthanum Inorganic materials 0.000 description 3
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 3
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 2
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical compound [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- BYFGZMCJNACEKR-UHFFFAOYSA-N aluminium(i) oxide Chemical compound [Al]O[Al] BYFGZMCJNACEKR-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000007323 disproportionation reaction Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 229910052809 inorganic oxide Inorganic materials 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- WTQUHLHXFJEOTI-UHFFFAOYSA-H trichloroneodymium;trichloropraseodymium Chemical compound Cl[Pr](Cl)Cl.Cl[Nd](Cl)Cl WTQUHLHXFJEOTI-UHFFFAOYSA-H 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- UGDYSZBHTRVGOR-UHFFFAOYSA-M 1-ethylpyridin-1-ium;fluoride Chemical compound [F-].CC[N+]1=CC=CC=C1 UGDYSZBHTRVGOR-UHFFFAOYSA-M 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 229910004283 SiO 4 Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- TYYRFZAVEXQXSN-UHFFFAOYSA-H aluminium sulfate hexadecahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O TYYRFZAVEXQXSN-UHFFFAOYSA-H 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000000498 ball milling Methods 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000004523 catalytic cracking Methods 0.000 description 1
- 238000004517 catalytic hydrocracking Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 description 1
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 125000005131 dialkylammonium group Chemical group 0.000 description 1
- UAMZXLIURMNTHD-UHFFFAOYSA-N dialuminum;magnesium;oxygen(2-) Chemical group [O-2].[O-2].[O-2].[O-2].[Mg+2].[Al+3].[Al+3] UAMZXLIURMNTHD-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000008131 herbal destillate Substances 0.000 description 1
- JQOAQUXIUNVRQW-UHFFFAOYSA-N hexane Chemical compound CCCCCC.CCCCCC JQOAQUXIUNVRQW-UHFFFAOYSA-N 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum oxide Inorganic materials [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000011738 major mineral Substances 0.000 description 1
- 235000011963 major mineral Nutrition 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052680 mordenite Inorganic materials 0.000 description 1
- PLDDOISOJJCEMH-UHFFFAOYSA-N neodymium oxide Inorganic materials [O-2].[O-2].[O-2].[Nd+3].[Nd+3] PLDDOISOJJCEMH-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- KTUFCUMIWABKDW-UHFFFAOYSA-N oxo(oxolanthaniooxy)lanthanum Chemical compound O=[La]O[La]=O KTUFCUMIWABKDW-UHFFFAOYSA-N 0.000 description 1
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910001404 rare earth metal oxide Inorganic materials 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000001846 repelling effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- FKTOIHSPIPYAPE-UHFFFAOYSA-N samarium(III) oxide Inorganic materials [O-2].[O-2].[O-2].[Sm+3].[Sm+3] FKTOIHSPIPYAPE-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229910019655 synthetic inorganic crystalline material Inorganic materials 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B39/00—Compounds having molecular sieve and base-exchange properties, e.g. crystalline zeolites; Their preparation; After-treatment, e.g. ion-exchange or dealumination
- C01B39/02—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof; Direct preparation thereof; Preparation thereof starting from a reaction mixture containing a crystalline zeolite of another type, or from preformed reactants; After-treatment thereof
- C01B39/46—Other types characterised by their X-ray diffraction pattern and their defined composition
- C01B39/48—Other types characterised by their X-ray diffraction pattern and their defined composition using at least one organic template directing agent
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Organic Chemistry (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Catalysts (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US448133 | 1982-12-09 | ||
| US06/448,133 US4481177A (en) | 1982-12-09 | 1982-12-09 | Synthesis of zeolite ZSM-22 with a heterocyclic organic compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59111912A JPS59111912A (ja) | 1984-06-28 |
| JPH0355411B2 true JPH0355411B2 (enExample) | 1991-08-23 |
Family
ID=23779138
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58231622A Granted JPS59111912A (ja) | 1982-12-09 | 1983-12-09 | 複素環式有機化合物を用いるゼオライトzsm−22の合成 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4481177A (enExample) |
| EP (1) | EP0116203B1 (enExample) |
| JP (1) | JPS59111912A (enExample) |
| AU (1) | AU569265B2 (enExample) |
| BR (1) | BR8306764A (enExample) |
| CA (1) | CA1207305A (enExample) |
| DE (1) | DE3372605D1 (enExample) |
| DK (1) | DK163576C (enExample) |
| NZ (1) | NZ206333A (enExample) |
| ZA (1) | ZA839195B (enExample) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ202099A (en) * | 1981-10-21 | 1986-07-11 | Ici Plc | Preparation of zeolite nu-10 |
| US5248841A (en) * | 1982-04-30 | 1993-09-28 | Mobil Oil Corporation | Hydrocarbon conversion with ZSM-22 zeolite |
| US5243112A (en) * | 1982-04-30 | 1993-09-07 | Mobil Oil Corp. | Lubricant range hydrocarbons from light olefins |
| US5254767A (en) * | 1982-04-30 | 1993-10-19 | Mobil Oil Corp. | Highly siliceous porous crystalline material and its use in conversion of oxygenates |
| US5336478A (en) * | 1982-04-30 | 1994-08-09 | Mobil Oil Corp. | Highly siliceous porous crystalline material |
| US5254770A (en) * | 1982-09-01 | 1993-10-19 | Mobil Oil Corp. | Isomerization of aromatic compounds over ZSM-22 zeolite |
| US4568654A (en) * | 1982-11-03 | 1986-02-04 | Mobil Oil Corporation | Zeolite ZSM-51 composition |
| US4840780A (en) * | 1983-03-28 | 1989-06-20 | Mobil Oil Corporation | ZSM-51, method of preparing same and catalytic conversion therewith |
| US4585746A (en) * | 1984-06-27 | 1986-04-29 | Mobil Oil Corporation | Synthesis of crystalline silicate ZSM-12 |
| US4585747A (en) * | 1984-06-27 | 1986-04-29 | Mobil Oil Corporation | Synthesis of crystalline silicate ZSM-48 |
| US4584286A (en) * | 1984-06-27 | 1986-04-22 | Mobil Oil Corporation | Synthesis of crystalline silicate ZSM-35 |
| GB8423615D0 (en) * | 1984-09-18 | 1984-10-24 | Shell Int Research | Preparation of composite crystalline aluminium silicates |
| US4574043A (en) * | 1984-11-19 | 1986-03-04 | Mobil Oil Corporation | Catalytic process for manufacture of low pour lubricating oils |
| US4562166A (en) * | 1984-11-19 | 1985-12-31 | Mobil Oil Corporation | Synthesis of Dodecasil-1H with a methylazabicyclononanium directing agent |
| US4637923A (en) * | 1985-06-27 | 1987-01-20 | Mobil Oil Corporation | Synthetic crystalline silicate |
| US4626421A (en) * | 1985-06-28 | 1986-12-02 | Chevron Research Company | Preparation of magadiite |
| DE3532748A1 (de) * | 1985-09-13 | 1987-03-19 | Degussa | Templatverbindungen, ihre herstellung und verwendung |
| ZA867945B (en) * | 1985-11-12 | 1988-05-25 | Mobil Oil Corp | Layered silicates |
| LU86284A1 (fr) * | 1986-01-30 | 1987-09-03 | Belge Etat | Procede d'obtention d'ethylene a partir d'ethanol |
| US5580508A (en) * | 1986-04-04 | 1996-12-03 | Ube Industries, Ltd. | Process for preparing calcium silicate articles |
| US4814543A (en) * | 1987-12-28 | 1989-03-21 | Mobil Oil Corporation | Nitrogen resistant paraffin hydroisomerization catalysts |
| US4919790A (en) * | 1988-01-19 | 1990-04-24 | Mobil Oil Corporation | Method for hydrocarbon dewaxing utilizing a reactivated spent MTG zeolite catalyst |
| US5053373A (en) * | 1988-03-23 | 1991-10-01 | Chevron Research Company | Zeolite SSZ-32 |
| US5174888A (en) * | 1990-01-25 | 1992-12-29 | Mobil Oil Corp. | Catalytic conversion |
| US5198203A (en) * | 1990-01-25 | 1993-03-30 | Mobil Oil Corp. | Synthetic mesoporous crystalline material |
| US5102643A (en) * | 1990-01-25 | 1992-04-07 | Mobil Oil Corp. | Composition of synthetic porous crystalline material, its synthesis |
| US5300277A (en) * | 1990-01-25 | 1994-04-05 | Mobil Oil Corporation | Synthesis of mesoporous crystalline material |
| US5785947A (en) * | 1991-12-18 | 1998-07-28 | Chevron U.S.A. Inc. | Preparation of zeolites using organic template and amine |
| ATE155454T1 (de) * | 1992-01-30 | 1997-08-15 | Exxon Chemical Patents Inc | Alkenoligomerisierung |
| SG47070A1 (en) * | 1992-06-05 | 1998-03-20 | Exxon Chemical Patents Inc | Zsm-22 zeolite |
| US5866096A (en) * | 1994-12-09 | 1999-02-02 | Exxon Chemical Patents, Inc. | ZSM-22 zeolite |
| US5430218A (en) * | 1993-08-27 | 1995-07-04 | Chevron U.S.A. Inc. | Dehydrogenation using dehydrogenation catalyst and polymer-porous solid composite membrane |
| AU681948B2 (en) * | 1994-02-22 | 1997-09-11 | Exxon Chemical Patents Inc. | Oligomerization and catalysts therefor |
| US5707600A (en) * | 1995-03-17 | 1998-01-13 | Chevron U.S.A. Inc. | Process for preparing medium pore size zeolites using neutral amines |
| US5849975A (en) * | 1997-01-07 | 1998-12-15 | Chevron U.S.A. Inc. | Process for isomerization of normal olefin |
| US6143940A (en) * | 1998-12-30 | 2000-11-07 | Chevron U.S.A. Inc. | Method for making a heavy wax composition |
| US6150577A (en) * | 1998-12-30 | 2000-11-21 | Chevron U.S.A., Inc. | Method for conversion of waste plastics to lube oil |
| EP1435337A3 (en) * | 1999-11-09 | 2006-10-04 | Kao Corporation | Process for preparing fine zeolite particles |
| FI118516B (fi) * | 2003-03-14 | 2007-12-14 | Neste Oil Oyj | Menetelmä katalyytin valmistamiseksi |
| US7390763B2 (en) * | 2003-10-31 | 2008-06-24 | Chevron U.S.A. Inc. | Preparing small crystal SSZ-32 and its use in a hydrocarbon conversion process |
| US20080083657A1 (en) * | 2006-10-04 | 2008-04-10 | Zones Stacey I | Isomerization process using metal-modified small crystallite mtt molecular sieve |
| US8088961B2 (en) * | 2007-12-27 | 2012-01-03 | Chevron U.S.A. Inc. | Process for preparing a pour point depressing lubricant base oil component from waste plastic and use thereof |
| US20100160700A1 (en) * | 2008-12-18 | 2010-06-24 | Chevron U.S.A. Inc. | Process and catalysts for reforming fisher tropsch naphthas to aromatics |
| CN102441416B (zh) * | 2010-10-13 | 2013-10-09 | 中国石油化工股份有限公司 | 一种石蜡烃择形异构化催化剂及其制备方法和应用 |
| US8900548B2 (en) | 2011-10-12 | 2014-12-02 | Exxonmobil Research And Engineering Company | Synthesis of MSE-framework type molecular sieves |
| SG11201400503WA (en) | 2011-10-12 | 2014-08-28 | Exxonmobil Res & Eng Co | Synthesis of mse-framework type molecular sieves |
| US9266744B2 (en) | 2013-10-10 | 2016-02-23 | Chevron U.S.A. Inc. | Synthesis of borosilicate ton-framework type molecular sieves |
| CN104211080B (zh) * | 2014-09-01 | 2016-07-06 | 中科合成油技术有限公司 | 一种Fe同晶取代ZSM-22分子筛的制备方法 |
| US9815706B2 (en) * | 2014-12-04 | 2017-11-14 | Uop Llc | Zeolites using an organo-1-oxa-4-azoniumcyclohexane compound |
| US9751772B2 (en) * | 2014-12-04 | 2017-09-05 | Uop Llc | Aluminophosphate molecular sieves using an organo-1-oxa-4-azoniumcyclohexane compound |
| US10654817B2 (en) | 2014-12-04 | 2020-05-19 | Uop Llc | Organo-1-oxa-4-azonium cyclohexane compounds |
| US10633355B2 (en) | 2014-12-04 | 2020-04-28 | Uop Llc | Organo-1-oxa-4-azonium cyclohexane compounds |
| US10597373B2 (en) | 2014-12-04 | 2020-03-24 | Uop Llc | Organo-1-oxa-4-azonium cyclohexane compounds |
| US9522896B2 (en) * | 2014-12-04 | 2016-12-20 | Uop Llc | Organo-1-oxa-4-azonium cyclohexane compounds |
| WO2016123640A2 (en) * | 2015-01-29 | 2016-08-04 | The Petroleum Oil And Gas Corporation Of South Africa (Pty) Ltd | Oligomerisation catalyst |
| CN106853972B (zh) * | 2015-12-09 | 2019-11-08 | 中国石油天然气股份有限公司 | 一种ton沸石的稳定合成方法 |
| WO2017152072A1 (en) | 2016-03-04 | 2017-09-08 | California Institute Of Technology | New germanosilicate compositions and methods of preparing the same |
| CN107285331A (zh) * | 2016-04-12 | 2017-10-24 | 中国石油化工股份有限公司 | 介孔zsm-22分子筛、其合成方法及其应用 |
| BR112018076987B1 (pt) | 2016-06-24 | 2022-05-03 | Albemarle Corporation | Zsm-22 mesoporoso para aumento da produção de propileno |
| JP7164601B2 (ja) * | 2017-06-19 | 2022-11-01 | セイケム インコーポレイテッド | 修飾反応組成物を用いるssz-39の合成方法 |
| CN110785379B (zh) * | 2017-06-19 | 2022-12-27 | 赛成公司 | 基于吗啉的季铵阳离子及由其制备的aei型沸石 |
| US10843930B1 (en) | 2019-11-13 | 2020-11-24 | Saudi Arabian Oil Company | Systems and methods for synthesis of ZSM-22 zeolite |
| EP4244188B1 (en) | 2020-11-10 | 2024-06-05 | Chevron U.S.A. Inc. | Organotemplate-free synthesis of a zeolite of ton framework type |
| US11565943B2 (en) | 2021-02-11 | 2023-01-31 | Chevron U.S.A. Inc. | Synthesis of ton framework type molecular sieves |
| US11618013B2 (en) | 2021-03-19 | 2023-04-04 | Saudi Arabian Oil Company | Systems and methods for the synthesizing ZSM-22 zeolites |
| CN113307287B (zh) * | 2021-06-21 | 2022-12-30 | 山西大学 | 一种高结晶度zsm-22分子筛的动态合成方法 |
| US11964875B2 (en) | 2022-03-24 | 2024-04-23 | Chevron U.S.A. Inc. | Synthesis of *MRE framework type molecular sieves |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3941871A (en) * | 1973-11-02 | 1976-03-02 | Mobil Oil Corporation | Crystalline silicates and method of preparing the same |
| US4061717A (en) * | 1974-10-03 | 1977-12-06 | Mobil Oil Corporation | Directed crystallization of synthetic aluminosilicates |
| US4061724A (en) * | 1975-09-22 | 1977-12-06 | Union Carbide Corporation | Crystalline silica |
| NL7812162A (nl) * | 1978-12-14 | 1980-06-17 | Shell Int Research | Werkwijze voor de bereiding van ferrieriet. |
| US4205053A (en) * | 1979-02-01 | 1980-05-27 | Mobil Oil Corporation | Manufacture of nitrogenous zeolites |
| JPS56140023A (en) * | 1980-04-03 | 1981-11-02 | Mitsubishi Chem Ind Ltd | Manufacture of synthetic zeolite |
| EP0040016B1 (en) * | 1980-05-13 | 1984-09-12 | Imperial Chemical Industries Plc | Zeolite nu-3 |
| JPS577816A (en) * | 1980-06-13 | 1982-01-16 | Idemitsu Kosan Co Ltd | Manufacture of crystalline aluminosilicate zeolite |
| DE3170192D1 (en) * | 1980-12-11 | 1985-05-30 | Ici Plc | Zeolites |
| EP0055045B1 (en) * | 1980-12-19 | 1984-09-12 | Imperial Chemical Industries Plc | Production of ethers |
| IN157506B (enExample) * | 1981-01-08 | 1986-04-12 | British Petroleum Co | |
| DE3267236D1 (en) * | 1981-04-02 | 1985-12-12 | Mobil Oil Corp | Zeolite, method of preparing same, and catalytic conversion therewith |
| DE3117135A1 (de) * | 1981-04-30 | 1982-11-18 | Bayer Ag, 5090 Leverkusen | Kristallines alumosilicat, verfahren zu dessen herstellung sowie dessen verwendung zur katalytischen umwandlung von methanol und/oder dimethylether in kohlenwasserstoffe |
| DE3269577D1 (en) * | 1981-05-20 | 1986-04-10 | Ici Plc | Zeolites |
| NZ202099A (en) * | 1981-10-21 | 1986-07-11 | Ici Plc | Preparation of zeolite nu-10 |
| US4388285A (en) * | 1981-11-12 | 1983-06-14 | Mobil Oil Corporation | Process for the preparation of ZSM-5 utilizing transition metal complexes during crystallization |
| US4391785A (en) * | 1981-12-21 | 1983-07-05 | Mobil Oil Corporation | Preparation of ZSM-12 type zeolites |
| US4414189A (en) * | 1982-05-27 | 1983-11-08 | Mobil Oil Corporation | Modification of catalytic activity of synthetic zeolites |
| NL8202992A (nl) * | 1982-07-26 | 1984-02-16 | Shell Int Research | Werkwijze voor het ontparaffineren van koolwaterstofolien. |
-
1982
- 1982-12-09 US US06/448,133 patent/US4481177A/en not_active Expired - Lifetime
-
1983
- 1983-11-21 AU AU21561/83A patent/AU569265B2/en not_active Ceased
- 1983-11-21 EP EP83307093A patent/EP0116203B1/en not_active Expired
- 1983-11-21 DE DE8383307093T patent/DE3372605D1/de not_active Expired
- 1983-11-21 NZ NZ206333A patent/NZ206333A/en unknown
- 1983-11-22 CA CA000441683A patent/CA1207305A/en not_active Expired
- 1983-12-08 BR BR8306764A patent/BR8306764A/pt unknown
- 1983-12-08 DK DK564483A patent/DK163576C/da not_active IP Right Cessation
- 1983-12-09 ZA ZA839195A patent/ZA839195B/xx unknown
- 1983-12-09 JP JP58231622A patent/JPS59111912A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ZA839195B (en) | 1985-07-31 |
| BR8306764A (pt) | 1984-07-17 |
| NZ206333A (en) | 1986-10-08 |
| EP0116203B1 (en) | 1987-07-22 |
| JPS59111912A (ja) | 1984-06-28 |
| EP0116203A1 (en) | 1984-08-22 |
| DK564483A (da) | 1984-06-10 |
| AU569265B2 (en) | 1988-01-28 |
| CA1207305A (en) | 1986-07-08 |
| AU2156183A (en) | 1984-06-14 |
| DK564483D0 (da) | 1983-12-08 |
| DE3372605D1 (en) | 1987-08-27 |
| US4481177A (en) | 1984-11-06 |
| DK163576C (da) | 1992-09-07 |
| DK163576B (da) | 1992-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0355411B2 (enExample) | ||
| EP0147034B1 (en) | A process for making zeolite zsm-45 with a dimethyldiethylammonium directing agent | |
| US4698217A (en) | Crystalline silicate ZSM-58 and process for its preparation using a methyltropinium cation | |
| US4397827A (en) | Silico-crystal method of preparing same and catalytic conversion therewith | |
| US4076842A (en) | Crystalline zeolite ZSM-23 and synthesis thereof | |
| US4287166A (en) | Zeolite ZSM-39 | |
| US3941871A (en) | Crystalline silicates and method of preparing the same | |
| US5441721A (en) | Synthesis of porous crystalline MCM-58 | |
| US4902406A (en) | Synthesis of zeolite ZSM-22 | |
| US4104151A (en) | Organic compound conversion over ZSM-23 | |
| EP0174121B1 (en) | A zeolite, a method of its synthesis, and organic conversion therewith | |
| US4981663A (en) | Synthetic crystal MCM-35 | |
| US4552739A (en) | Method of preparing crystalline zeolite ZSM-12 and product | |
| US5437855A (en) | Synthetic porous crystalline MCM-58, its synthesis and use | |
| EP0013630B1 (en) | Zsm-12 zeolite composition, method of preparing same and catalytic conversion therewith | |
| US5068096A (en) | Synthesis of crystalline silicate MCM-47 | |
| US4209499A (en) | Crystalline zeolite ZSM-43 synthesis thereof | |
| US4285922A (en) | Method of preparing crystalline zeolite | |
| US4448675A (en) | Silico-crystal ZSM-48 method of preparing same and catalytic conversion therewith | |
| US5190736A (en) | Synthesis of crystalline ZSM-35 | |
| EP0143642A2 (en) | A process for making zeolite ZSM-45 | |
| US4430314A (en) | Method of preparing crystalline zeolite | |
| US5209918A (en) | Synthesis of crystalline ZSM-5-type material | |
| US4637923A (en) | Synthetic crystalline silicate | |
| US4357233A (en) | Catalytic conversion with zeolite ZSM-39 |