JP3497164B2 - 二環式フィブリノーゲン拮抗薬 - Google Patents
二環式フィブリノーゲン拮抗薬Info
- Publication number
- JP3497164B2 JP3497164B2 JP50170293A JP50170293A JP3497164B2 JP 3497164 B2 JP3497164 B2 JP 3497164B2 JP 50170293 A JP50170293 A JP 50170293A JP 50170293 A JP50170293 A JP 50170293A JP 3497164 B2 JP3497164 B2 JP 3497164B2
- Authority
- JP
- Japan
- Prior art keywords
- amino
- tetrahydro
- oxo
- phenyl
- carbonyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000002619 bicyclic group Chemical group 0.000 title description 8
- 229940122331 Fibrinogen antagonist Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 409
- 125000001424 substituent group Chemical group 0.000 claims abstract description 18
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 4
- -1 -OR 12 Chemical group 0.000 claims description 227
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 137
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 115
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 92
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 89
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 68
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 229910052799 carbon Inorganic materials 0.000 claims description 19
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 16
- 150000001413 amino acids Chemical class 0.000 claims description 15
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000005188 oxoalkyl group Chemical group 0.000 claims description 7
- UNFFUCUNUNMQNI-UHFFFAOYSA-N 3-[7-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-2,5-dihydro-1h-1,4-benzodiazepin-4-yl]propanoic acid Chemical compound C1=CC(C=NN)=CC=C1C(=O)NC1=CC=C(NCC(=O)N(CCC(O)=O)C2)C2=C1 UNFFUCUNUNMQNI-UHFFFAOYSA-N 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 4
- 125000001072 heteroaryl group Chemical group 0.000 claims description 4
- SXHPOBDTEYIZFL-UHFFFAOYSA-N 2-(1h-1,4-benzodiazepin-2-yl)acetic acid Chemical compound N1C(CC(=O)O)=CN=CC2=CC=CC=C21 SXHPOBDTEYIZFL-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- AKFLRQBKMQFIIL-UHFFFAOYSA-N 4-methanehydrazonoyl-n-[2-methyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1h-1,4-benzodiazepin-7-yl]benzamide Chemical compound C1=C2CN(CCC=3C=CC=CC=3)C(=O)C(C)NC2=CC=C1NC(=O)C1=CC=C(C=NN)C=C1 AKFLRQBKMQFIIL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- GKRMEZIDMWUSHY-LYKKTTPLSA-N 2-[7-[[(2S)-2-[acetyl(methyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-oxo-1,2,4,5-tetrahydro-1,4-benzodiazepin-2-yl]acetic acid Chemical compound CN([C@@H](CCCNC(N)=N)C(=O)NC=1C=CC2=C(CNC(C(N2)CC(=O)O)=O)C1)C(C)=O GKRMEZIDMWUSHY-LYKKTTPLSA-N 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000002877 alkyl aryl group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 51
- 229910052717 sulfur Inorganic materials 0.000 abstract description 17
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 16
- 229910052760 oxygen Inorganic materials 0.000 abstract description 15
- 208000010110 spontaneous platelet aggregation Diseases 0.000 abstract description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract description 8
- 125000005842 heteroatom Chemical group 0.000 abstract description 7
- 230000002401 inhibitory effect Effects 0.000 abstract description 7
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 7
- 229920006395 saturated elastomer Polymers 0.000 abstract description 7
- 230000000694 effects Effects 0.000 abstract description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract description 6
- 230000002378 acidificating effect Effects 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 364
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 282
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 184
- 239000000243 solution Substances 0.000 description 171
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 159
- 239000000203 mixture Substances 0.000 description 155
- 235000019439 ethyl acetate Nutrition 0.000 description 143
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 106
- 239000000741 silica gel Substances 0.000 description 88
- 229910002027 silica gel Inorganic materials 0.000 description 88
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 84
- 239000007787 solid Substances 0.000 description 83
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 69
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 69
- 238000006243 chemical reaction Methods 0.000 description 66
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 64
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 49
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 44
- 238000003818 flash chromatography Methods 0.000 description 41
- 239000011541 reaction mixture Substances 0.000 description 41
- 238000005481 NMR spectroscopy Methods 0.000 description 40
- 239000002904 solvent Substances 0.000 description 40
- 239000011734 sodium Substances 0.000 description 38
- 239000000706 filtrate Substances 0.000 description 37
- 238000002360 preparation method Methods 0.000 description 37
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 36
- 238000004809 thin layer chromatography Methods 0.000 description 34
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 32
- 229910052786 argon Inorganic materials 0.000 description 32
- 229960000583 acetic acid Drugs 0.000 description 30
- 239000003054 catalyst Substances 0.000 description 30
- 230000002829 reductive effect Effects 0.000 description 30
- 238000010992 reflux Methods 0.000 description 30
- 238000003756 stirring Methods 0.000 description 29
- 239000000284 extract Substances 0.000 description 27
- 108090000765 processed proteins & peptides Proteins 0.000 description 26
- 238000002844 melting Methods 0.000 description 24
- 230000008018 melting Effects 0.000 description 24
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 23
- 239000012267 brine Substances 0.000 description 23
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 23
- 229910052763 palladium Inorganic materials 0.000 description 22
- 238000000746 purification Methods 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000003921 oil Substances 0.000 description 20
- 235000019198 oils Nutrition 0.000 description 20
- 101001068640 Nicotiana tabacum Basic form of pathogenesis-related protein 1 Proteins 0.000 description 18
- 238000004128 high performance liquid chromatography Methods 0.000 description 18
- 239000001257 hydrogen Substances 0.000 description 18
- 239000012074 organic phase Substances 0.000 description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 16
- 239000003527 fibrinolytic agent Substances 0.000 description 16
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 16
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 15
- 238000000921 elemental analysis Methods 0.000 description 15
- 239000005457 ice water Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 235000002639 sodium chloride Nutrition 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 239000002253 acid Substances 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- 239000003153 chemical reaction reagent Substances 0.000 description 13
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 229940024606 amino acid Drugs 0.000 description 12
- 230000027455 binding Effects 0.000 description 12
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 12
- 229910052938 sodium sulfate Inorganic materials 0.000 description 12
- 235000011152 sodium sulphate Nutrition 0.000 description 12
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 125000006239 protecting group Chemical group 0.000 description 11
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 10
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 10
- 235000008504 concentrate Nutrition 0.000 description 10
- 239000012141 concentrate Substances 0.000 description 10
- 239000012043 crude product Substances 0.000 description 10
- 239000003814 drug Substances 0.000 description 10
- 238000001802 infusion Methods 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- DUMCJIQEKVEWRJ-UHFFFAOYSA-N 2-(1,2-benzodiazepin-2-yl)acetic acid Chemical compound OC(=O)CN1C=CC=C2C=CC=CC2=N1 DUMCJIQEKVEWRJ-UHFFFAOYSA-N 0.000 description 9
- IYMAXBFPHPZYIK-BQBZGAKWSA-N Arg-Gly-Asp Chemical group NC(N)=NCCC[C@H](N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(O)=O IYMAXBFPHPZYIK-BQBZGAKWSA-N 0.000 description 9
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 9
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 9
- 229940079593 drug Drugs 0.000 description 9
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 9
- 102000004169 proteins and genes Human genes 0.000 description 9
- 108090000623 proteins and genes Proteins 0.000 description 9
- 229960000187 tissue plasminogen activator Drugs 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 8
- 229910004373 HOAc Inorganic materials 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 8
- 238000007796 conventional method Methods 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 238000001727 in vivo Methods 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 8
- 102000004196 processed proteins & peptides Human genes 0.000 description 8
- 108020003175 receptors Proteins 0.000 description 8
- 102000005962 receptors Human genes 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 8
- 108010010803 Gelatin Proteins 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 7
- 239000000872 buffer Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 125000000524 functional group Chemical group 0.000 description 7
- 229920000159 gelatin Polymers 0.000 description 7
- 239000008273 gelatin Substances 0.000 description 7
- 235000019322 gelatine Nutrition 0.000 description 7
- 235000011852 gelatine desserts Nutrition 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- PBIOITGADXMFJO-UHFFFAOYSA-N 4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=N)NC(=O)OCC1=CC=CC=C1 PBIOITGADXMFJO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- 102000001938 Plasminogen Activators Human genes 0.000 description 6
- 108010001014 Plasminogen Activators Proteins 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000012300 argon atmosphere Substances 0.000 description 6
- 229940007550 benzyl acetate Drugs 0.000 description 6
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 238000007911 parenteral administration Methods 0.000 description 6
- 229940127126 plasminogen activator Drugs 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- 206010038563 Reocclusion Diseases 0.000 description 5
- 108010023197 Streptokinase Proteins 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 230000002776 aggregation Effects 0.000 description 5
- 238000004220 aggregation Methods 0.000 description 5
- 229940049706 benzodiazepine Drugs 0.000 description 5
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 229960005202 streptokinase Drugs 0.000 description 5
- 239000011593 sulfur Chemical group 0.000 description 5
- 238000000825 ultraviolet detection Methods 0.000 description 5
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 4
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 108010012088 Fibrinogen Receptors Proteins 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 4
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 4
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000008121 dextrose Substances 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000002502 liposome Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Chemical group 0.000 description 4
- 229940117803 phenethylamine Drugs 0.000 description 4
- 210000002381 plasma Anatomy 0.000 description 4
- 229910003446 platinum oxide Inorganic materials 0.000 description 4
- 238000010791 quenching Methods 0.000 description 4
- 102220240796 rs553605556 Human genes 0.000 description 4
- 108010073863 saruplase Proteins 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 229960005356 urokinase Drugs 0.000 description 4
- 229910052727 yttrium Inorganic materials 0.000 description 4
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 3
- VVXFDFQEIRGULC-UHFFFAOYSA-N 2-fluoro-5-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(F)C(C=O)=C1 VVXFDFQEIRGULC-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- 108010058207 Anistreplase Proteins 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- VSAWYYFNOAMQRU-UHFFFAOYSA-N COC(=O)CC1=CN=CC2=CC=CC=C2N1 Chemical compound COC(=O)CC1=CN=CC2=CC=CC=C2N1 VSAWYYFNOAMQRU-UHFFFAOYSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 108010073385 Fibrin Proteins 0.000 description 3
- 102000009123 Fibrin Human genes 0.000 description 3
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 208000006011 Stroke Diseases 0.000 description 3
- 229940022663 acetate Drugs 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 229960000983 anistreplase Drugs 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 3
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229950003499 fibrin Drugs 0.000 description 3
- 230000003480 fibrinolytic effect Effects 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 230000000171 quenching effect Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 2
- BAPVEFMJOJIJGT-LURJTMIESA-N (2s)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)N(C)C(=O)OC(C)(C)C BAPVEFMJOJIJGT-LURJTMIESA-N 0.000 description 2
- PTDVPWWJRCOIIO-UHFFFAOYSA-N (4-methoxyphenyl)methanethiol Chemical compound COC1=CC=C(CS)C=C1 PTDVPWWJRCOIIO-UHFFFAOYSA-N 0.000 description 2
- FHGWEHGZBUBQKL-UHFFFAOYSA-N 1,2-benzothiazepine Chemical compound S1N=CC=CC2=CC=CC=C12 FHGWEHGZBUBQKL-UHFFFAOYSA-N 0.000 description 2
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical group CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- QVHJQCGUWFKTSE-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)C(C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- RUCHWTKMOWXHLU-UHFFFAOYSA-N 5-nitroanthranilic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(O)=O RUCHWTKMOWXHLU-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- 108010069514 Cyclic Peptides Proteins 0.000 description 2
- 102000001189 Cyclic Peptides Human genes 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- 206010051055 Deep vein thrombosis Diseases 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 108010049003 Fibrinogen Proteins 0.000 description 2
- 102000008946 Fibrinogen Human genes 0.000 description 2
- 102100037362 Fibronectin Human genes 0.000 description 2
- 108010067306 Fibronectins Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 206010061216 Infarction Diseases 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- HOKKHZGPKSLGJE-UHFFFAOYSA-N N-Methyl-DL-aspartic acid Chemical compound CNC(C(O)=O)CC(O)=O HOKKHZGPKSLGJE-UHFFFAOYSA-N 0.000 description 2
- KAJBMCZQVSQJDE-YFKPBYRVSA-N Nalpha-(tert-butoxycarbonyl)-l-aspartic acid Chemical group CC(C)(C)OC(=O)N[C@H](C(O)=O)CC(O)=O KAJBMCZQVSQJDE-YFKPBYRVSA-N 0.000 description 2
- 241001274216 Naso Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical group CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 208000010378 Pulmonary Embolism Diseases 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 101710172711 Structural protein Proteins 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 206010047249 Venous thrombosis Diseases 0.000 description 2
- 102100035140 Vitronectin Human genes 0.000 description 2
- 108010031318 Vitronectin Proteins 0.000 description 2
- 102100023038 WD and tetratricopeptide repeats protein 1 Human genes 0.000 description 2
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 206010000891 acute myocardial infarction Diseases 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 2
- 150000001557 benzodiazepines Chemical class 0.000 description 2
- 239000012455 biphasic mixture Substances 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 230000035602 clotting Effects 0.000 description 2
- 230000009137 competitive binding Effects 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N cycloheptane Chemical compound C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 229940012952 fibrinogen Drugs 0.000 description 2
- 239000002319 fibrinogen receptor antagonist Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 230000007574 infarction Effects 0.000 description 2
- 108010044426 integrins Proteins 0.000 description 2
- 102000006495 integrins Human genes 0.000 description 2
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 2
- 238000010255 intramuscular injection Methods 0.000 description 2
- 239000007927 intramuscular injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000012669 liquid formulation Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- OKJGAAZZZSWSJL-VMPITWQZSA-N methyl (e)-4-(2-phenylethylamino)but-2-enoate Chemical compound COC(=O)\C=C\CNCCC1=CC=CC=C1 OKJGAAZZZSWSJL-VMPITWQZSA-N 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical compound CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- YTJSFYQNRXLOIC-UHFFFAOYSA-N octadecylsilane Chemical compound CCCCCCCCCCCCCCCCCC[SiH3] YTJSFYQNRXLOIC-UHFFFAOYSA-N 0.000 description 2
- HEGSGKPQLMEBJL-RKQHYHRCSA-N octyl beta-D-glucopyranoside Chemical compound CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O HEGSGKPQLMEBJL-RKQHYHRCSA-N 0.000 description 2
- SFJGCXYXEFWEBK-UHFFFAOYSA-N oxazepine Chemical compound O1C=CC=CC=N1 SFJGCXYXEFWEBK-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 238000010647 peptide synthesis reaction Methods 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical compound CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- NYERMPLPURRVGM-UHFFFAOYSA-N thiazepine Chemical compound S1C=CC=CC=N1 NYERMPLPURRVGM-UHFFFAOYSA-N 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 201000010875 transient cerebral ischemia Diseases 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- LKRMSSDDHQZQHJ-ZETCQYMHSA-N (2s)-2-amino-5-(diaminomethylideneamino)-2-methylpentanoic acid Chemical compound OC(=O)[C@](N)(C)CCCN=C(N)N LKRMSSDDHQZQHJ-ZETCQYMHSA-N 0.000 description 1
- VGBXXMDPLYMPIV-QMMMGPOBSA-N (2s)-2-amino-5-[ethyl-(n'-ethylcarbamimidoyl)amino]pentanoic acid Chemical compound CCN=C(N)N(CC)CCC[C@H](N)C(O)=O VGBXXMDPLYMPIV-QMMMGPOBSA-N 0.000 description 1
- NWGZOALPWZDXNG-LURJTMIESA-N (2s)-5-(diaminomethylideneamino)-2-(dimethylamino)pentanoic acid Chemical group CN(C)[C@H](C(O)=O)CCCNC(N)=N NWGZOALPWZDXNG-LURJTMIESA-N 0.000 description 1
- DLZXLCHQWOZGSE-UHFFFAOYSA-N (3-nitrophenyl)methylazanium;chloride Chemical compound Cl.NCC1=CC=CC([N+]([O-])=O)=C1 DLZXLCHQWOZGSE-UHFFFAOYSA-N 0.000 description 1
- JKQGWXSVEFCNSS-MJGOQNOKSA-N (3ar,10br)-8-amino-5-(2-phenylethyl)-3,3a,6,10b-tetrahydrofuro[3,2-d][2]benzazepine-2,4-dione Chemical compound O=C([C@@H]1CC(=O)O[C@H]1C1=CC=C(C=C1C1)N)N1CCC1=CC=CC=C1 JKQGWXSVEFCNSS-MJGOQNOKSA-N 0.000 description 1
- XYRSLQYIKBGVDS-MJGOQNOKSA-N (3ar,10br)-8-nitro-5-(2-phenylethyl)-3,3a,6,10b-tetrahydrofuro[3,2-d][2]benzazepine-2,4-dione Chemical compound O=C([C@@H]1CC(=O)O[C@H]1C1=CC=C(C=C1C1)[N+](=O)[O-])N1CCC1=CC=CC=C1 XYRSLQYIKBGVDS-MJGOQNOKSA-N 0.000 description 1
- SMIXZZMSWYOQPW-UHFFFAOYSA-N (4-nitrophenyl)methylazanium;chloride Chemical compound [Cl-].[NH3+]CC1=CC=C([N+]([O-])=O)C=C1 SMIXZZMSWYOQPW-UHFFFAOYSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- ZCXLTWVZYXBHJS-UHFFFAOYSA-N 1,2-benzoxazepine Chemical compound O1N=CC=CC2=CC=CC=C12 ZCXLTWVZYXBHJS-UHFFFAOYSA-N 0.000 description 1
- CHRJZRDFSQHIFI-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;styrene Chemical compound C=CC1=CC=CC=C1.C=CC1=CC=CC=C1C=C CHRJZRDFSQHIFI-UHFFFAOYSA-N 0.000 description 1
- TZCPCKNHXULUIY-RGULYWFUSA-N 1,2-distearoyl-sn-glycero-3-phosphoserine Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OC[C@H](N)C(O)=O)OC(=O)CCCCCCCCCCCCCCCCC TZCPCKNHXULUIY-RGULYWFUSA-N 0.000 description 1
- 125000004234 1,4-benzodiazepinyl group Chemical group N1C(=CN=CC2=C1C=CC=C2)* 0.000 description 1
- CGHIBGNXEGJPQZ-UHFFFAOYSA-N 1-hexyne Chemical class CCCCC#C CGHIBGNXEGJPQZ-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IBXNCJKFFQIKKY-UHFFFAOYSA-N 1-pentyne Chemical class CCCC#C IBXNCJKFFQIKKY-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- GJUCCSLSLQGLHI-UHFFFAOYSA-N 1h-azepine;pyridazine Chemical class C1=CC=NN=C1.N1C=CC=CC=C1 GJUCCSLSLQGLHI-UHFFFAOYSA-N 0.000 description 1
- QETIGJLYBPLODY-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,2-benzothiazepine Chemical class C1CCNSC2=CC=CC=C21 QETIGJLYBPLODY-UHFFFAOYSA-N 0.000 description 1
- QEYQSYAGLRIYBE-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-1,2-benzodiazepine Chemical class C1CCNNC2=CC=CC=C21 QEYQSYAGLRIYBE-UHFFFAOYSA-N 0.000 description 1
- MZBVNYACSSGXID-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-1-benzazepine Chemical class N1CCCCC2=CC=CC=C21 MZBVNYACSSGXID-UHFFFAOYSA-N 0.000 description 1
- SCEIUGQQBYRBPP-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-azepine Chemical compound C1CCC=CNC1 SCEIUGQQBYRBPP-UHFFFAOYSA-N 0.000 description 1
- VVYDNZJZLOPPSB-UHFFFAOYSA-N 2,3-dihydro-1,2-benzothiazepine Chemical compound C1=CCNSC2=CC=CC=C21 VVYDNZJZLOPPSB-UHFFFAOYSA-N 0.000 description 1
- RIUSCLBEBIOIRP-UHFFFAOYSA-N 2,3-dihydro-1,2-benzoxazepine Chemical compound C1=CCNOC2=CC=CC=C21 RIUSCLBEBIOIRP-UHFFFAOYSA-N 0.000 description 1
- WSSWXGZEJNNFSN-UHFFFAOYSA-N 2,3-dihydro-1h-1-benzazepine Chemical compound N1CCC=CC2=CC=CC=C21 WSSWXGZEJNNFSN-UHFFFAOYSA-N 0.000 description 1
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical group CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 1
- DWJRBQIFHZHZCO-UHFFFAOYSA-N 2-(2-fluoro-5-nitrophenyl)-1,3-dioxolane Chemical compound [O-][N+](=O)C1=CC=C(F)C(C2OCCO2)=C1 DWJRBQIFHZHZCO-UHFFFAOYSA-N 0.000 description 1
- ZAVITQSFGZRELC-UHFFFAOYSA-N 2-(bromomethyl)-1-[(4-methoxyphenyl)methylsulfanyl]-4-nitrobenzene Chemical compound C1=CC(OC)=CC=C1CSC1=CC=C([N+]([O-])=O)C=C1CBr ZAVITQSFGZRELC-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 description 1
- HZLIDYMJFYQFPQ-UHFFFAOYSA-N 2-[3-oxo-5-(oxomethylidene)-4-(2-phenylethyl)-1,2-dihydro-1,4-benzodiazepin-2-yl]acetic acid Chemical compound O=C1C(CC(=O)O)NC2=CC=CC=C2C(=C=O)N1CCC1=CC=CC=C1 HZLIDYMJFYQFPQ-UHFFFAOYSA-N 0.000 description 1
- FGQAGKGXYKOHHH-UHFFFAOYSA-N 2-[7-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1h-1,4-benzodiazepin-2-yl]acetic acid Chemical compound C1=CC(C=NN)=CC=C1C(=O)NC1=CC=C(NC(CC(O)=O)C(=O)N(CCC=2C=CC=CC=2)C2)C2=C1 FGQAGKGXYKOHHH-UHFFFAOYSA-N 0.000 description 1
- CUSBDEQDNUEDRU-UHFFFAOYSA-N 2-[7-nitro-3-oxo-4-(2-phenylethyl)-5h-1,4-benzothiazepin-2-yl]acetic acid Chemical compound O=C1C(CC(=O)O)SC2=CC=C([N+]([O-])=O)C=C2CN1CCC1=CC=CC=C1 CUSBDEQDNUEDRU-UHFFFAOYSA-N 0.000 description 1
- IFPQOXNWLSRZKX-UHFFFAOYSA-N 2-amino-4-(diaminomethylideneamino)butanoic acid Chemical compound OC(=O)C(N)CCN=C(N)N IFPQOXNWLSRZKX-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- VFVHWCKUHAEDMY-UHFFFAOYSA-N 2-chloro-5-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C=O)=C1 VFVHWCKUHAEDMY-UHFFFAOYSA-N 0.000 description 1
- LJOODBDWMQKMFB-UHFFFAOYSA-M 2-cyclohexylacetate Chemical compound [O-]C(=O)CC1CCCCC1 LJOODBDWMQKMFB-UHFFFAOYSA-M 0.000 description 1
- LHCVWZUYSBZIKE-UHFFFAOYSA-N 2-fluoro-3-nitrobenzonitrile Chemical group [O-][N+](=O)C1=CC=CC(C#N)=C1F LHCVWZUYSBZIKE-UHFFFAOYSA-N 0.000 description 1
- YLACBMHBZVYOAP-UHFFFAOYSA-N 2-fluoro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(F)C(C#N)=C1 YLACBMHBZVYOAP-UHFFFAOYSA-N 0.000 description 1
- LZWKYPJFAHZBJK-UHFFFAOYSA-N 2-methanehydrazonoylbenzoic acid Chemical compound NN=CC1=CC=CC=C1C(O)=O LZWKYPJFAHZBJK-UHFFFAOYSA-N 0.000 description 1
- NHAGJJQNQXNWOC-UHFFFAOYSA-N 2-methyl-7-nitro-4-(2-phenylethyl)-2,5-dihydro-1h-1,4-benzodiazepin-3-one Chemical compound O=C1C(C)NC2=CC=C([N+]([O-])=O)C=C2CN1CCC1=CC=CC=C1 NHAGJJQNQXNWOC-UHFFFAOYSA-N 0.000 description 1
- IXVHHIJPEWQWLQ-UHFFFAOYSA-N 2-methyl-n-(2-phenylethyl)propan-2-amine Chemical compound CC(C)(C)NCCC1=CC=CC=C1 IXVHHIJPEWQWLQ-UHFFFAOYSA-N 0.000 description 1
- VNJOEUSYAMPBAK-UHFFFAOYSA-N 2-methylbenzenesulfonic acid;hydrate Chemical compound O.CC1=CC=CC=C1S(O)(=O)=O VNJOEUSYAMPBAK-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- SEADJJCWSPCSHY-UHFFFAOYSA-N 2h-2,4-benzodiazepine Chemical class N1C=NC=C2C=CC=CC2=C1 SEADJJCWSPCSHY-UHFFFAOYSA-N 0.000 description 1
- XUUSYXJGMRQBKQ-UHFFFAOYSA-N 2h-2-benzazepine Chemical compound N1C=CC=C2C=CC=CC2=C1 XUUSYXJGMRQBKQ-UHFFFAOYSA-N 0.000 description 1
- ISCMYZGMRHODRP-UHFFFAOYSA-N 3-(iminomethylideneamino)-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCN=C=N ISCMYZGMRHODRP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WITJHZRCLVXYCA-UHFFFAOYSA-N 3h-1,2-benzodioxepine Chemical compound C1=CCOOC2=CC=CC=C21 WITJHZRCLVXYCA-UHFFFAOYSA-N 0.000 description 1
- YGLDQFWPUCURIP-UHFFFAOYSA-N 3h-3-benzazepine Chemical compound C1=CNC=CC2=CC=CC=C21 YGLDQFWPUCURIP-UHFFFAOYSA-N 0.000 description 1
- JOWXBGIZDALBJW-UHFFFAOYSA-N 3h-dioxepine Chemical compound C1OOC=CC=C1 JOWXBGIZDALBJW-UHFFFAOYSA-N 0.000 description 1
- ZHCFEJYBPAVHJC-UHFFFAOYSA-N 3h-dithiepine Chemical compound C1SSC=CC=C1 ZHCFEJYBPAVHJC-UHFFFAOYSA-N 0.000 description 1
- UGJWJWTYLWRXFE-UHFFFAOYSA-N 3h-oxathiepine Chemical compound C1SOC=CC=C1 UGJWJWTYLWRXFE-UHFFFAOYSA-N 0.000 description 1
- IIFAAUCAJOOMJH-UHFFFAOYSA-N 4,1-benzothiazepine Chemical compound S1C=CN=C2C=CC=CC2=C1 IIFAAUCAJOOMJH-UHFFFAOYSA-N 0.000 description 1
- YAVSXFRYNGAFRN-UHFFFAOYSA-N 4,1-benzoxazepine Chemical compound O1C=CN=C2C=CC=CC2=C1 YAVSXFRYNGAFRN-UHFFFAOYSA-N 0.000 description 1
- FUMODQYXPKTVOU-UHFFFAOYSA-N 4,5,6,7-tetrahydrooxazepine Chemical compound C1CCC=NOC1 FUMODQYXPKTVOU-UHFFFAOYSA-N 0.000 description 1
- YODKUGYVVJOVCM-UHFFFAOYSA-N 4-(4-hydroxybutyl)-3-nitrobenzoic acid Chemical compound OCCCCC1=CC=C(C(O)=O)C=C1[N+]([O-])=O YODKUGYVVJOVCM-UHFFFAOYSA-N 0.000 description 1
- LFIWXXXFJFOECP-UHFFFAOYSA-N 4-(aminomethyl)benzonitrile Chemical compound NCC1=CC=C(C#N)C=C1 LFIWXXXFJFOECP-UHFFFAOYSA-N 0.000 description 1
- MIIADZYPHVTLPR-UHFFFAOYSA-N 4-(methoxycarbonyl)-3-nitrobenzoic acid Chemical compound COC(=O)C1=CC=C(C(O)=O)C=C1[N+]([O-])=O MIIADZYPHVTLPR-UHFFFAOYSA-N 0.000 description 1
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- IGQGXIVCGKMRAM-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonamide Chemical compound CC1=CC(S(N)(=O)=O)=CC=C1N IGQGXIVCGKMRAM-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- UEALKTCRMBVTFN-UHFFFAOYSA-N 4-nitroanthranilic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1C(O)=O UEALKTCRMBVTFN-UHFFFAOYSA-N 0.000 description 1
- MPPJHOAWVLWBIY-UHFFFAOYSA-N 4-o-tert-butyl 1-o-methyl 2-nitrobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC(C)(C)C)C=C1[N+]([O-])=O MPPJHOAWVLWBIY-UHFFFAOYSA-N 0.000 description 1
- FLDCSPABIQBYKP-UHFFFAOYSA-N 5-chloro-1,2-dimethylbenzimidazole Chemical compound ClC1=CC=C2N(C)C(C)=NC2=C1 FLDCSPABIQBYKP-UHFFFAOYSA-N 0.000 description 1
- YNHGHPCGMBEGEU-UHFFFAOYSA-N 5-phenyl-1h-1,4-benzodiazepine Chemical class C12=CC=CC=C2NC=CN=C1C1=CC=CC=C1 YNHGHPCGMBEGEU-UHFFFAOYSA-N 0.000 description 1
- SKBAQKWHFBMOHH-UHFFFAOYSA-N 7-amino-2-methyl-4-(2-phenylethyl)-2,5-dihydro-1h-1,4-benzodiazepin-3-one Chemical compound O=C1C(C)NC2=CC=C(N)C=C2CN1CCC1=CC=CC=C1 SKBAQKWHFBMOHH-UHFFFAOYSA-N 0.000 description 1
- GWAQYWSNCVEJMW-UHFFFAOYSA-N 7-nitro-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=CC([N+](=O)[O-])=CC=C21 GWAQYWSNCVEJMW-UHFFFAOYSA-N 0.000 description 1
- DTRRHWQMEXXDFE-UHFFFAOYSA-N 8,9-dihydro-7h-benzo[7]annulene Chemical compound C1CCC=CC2=CC=CC=C21 DTRRHWQMEXXDFE-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000001741 Ammonium adipate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002388 Angina unstable Diseases 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 208000006386 Bone Resorption Diseases 0.000 description 1
- 108700016947 Bos taurus structural-GP Proteins 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical group CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- BXTRCOBBLJSOMT-UHFFFAOYSA-N C1(=CC=CC=C1)CCN1CC2=C(C=C(C1)CC(=O)O)C=CC=C2 Chemical compound C1(=CC=CC=C1)CCN1CC2=C(C=C(C1)CC(=O)O)C=CC=C2 BXTRCOBBLJSOMT-UHFFFAOYSA-N 0.000 description 1
- QGYXUZACPGPWPH-UHFFFAOYSA-N C1=C2CN(CCC=3C=CC=CC=3)C(=O)C(C)NC2=CC=C1NC(=O)C(C=C1)=CC=C1C(=NN)C(=O)OCC1=CC=CC=C1 Chemical compound C1=C2CN(CCC=3C=CC=CC=3)C(=O)C(C)NC2=CC=C1NC(=O)C(C=C1)=CC=C1C(=NN)C(=O)OCC1=CC=CC=C1 QGYXUZACPGPWPH-UHFFFAOYSA-N 0.000 description 1
- QKVVPQSHSLQXEE-UHFFFAOYSA-N C=1C=C(C(O)=O)C=CC=1C(=NN)C(=O)OCC1=CC=CC=C1 Chemical group C=1C=C(C(O)=O)C=CC=1C(=NN)C(=O)OCC1=CC=CC=C1 QKVVPQSHSLQXEE-UHFFFAOYSA-N 0.000 description 1
- DHPIRESYODUJNL-UHFFFAOYSA-N COC(CC=1NC2=C(C=CC=1)C=CC=C2)=O Chemical compound COC(CC=1NC2=C(C=CC=1)C=CC=C2)=O DHPIRESYODUJNL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 101800001982 Cholecystokinin Proteins 0.000 description 1
- 102100025841 Cholecystokinin Human genes 0.000 description 1
- 102100032392 Circadian-associated transcriptional repressor Human genes 0.000 description 1
- 101710130150 Circadian-associated transcriptional repressor Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- KAEIECJEFVOHLU-UHFFFAOYSA-N ClC1=C(C=O)C=C(C=C1)[N+](=O)[O-].ClC1=C(CNCCC2=CC=CC=C2)C=C(C=C1)[N+](=O)[O-] Chemical compound ClC1=C(C=O)C=C(C=C1)[N+](=O)[O-].ClC1=C(CNCCC2=CC=CC=C2)C=C(C=C1)[N+](=O)[O-] KAEIECJEFVOHLU-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 101000783577 Dendroaspis angusticeps Thrombostatin Proteins 0.000 description 1
- 101000783578 Dendroaspis jamesoni kaimosae Dendroaspin Proteins 0.000 description 1
- 208000002251 Dissecting Aneurysm Diseases 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- ZWZWYGMENQVNFU-UHFFFAOYSA-N Glycerophosphorylserin Natural products OC(=O)C(N)COP(O)(=O)OCC(O)CO ZWZWYGMENQVNFU-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 208000032382 Ischaemic stroke Diseases 0.000 description 1
- QNAYBMKLOCPYGJ-UWTATZPHSA-N L-Alanine Natural products C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 1
- QUOGESRFPZDMMT-UHFFFAOYSA-N L-Homoarginine Natural products OC(=O)C(N)CCCCNC(N)=N QUOGESRFPZDMMT-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- QUOGESRFPZDMMT-YFKPBYRVSA-N L-homoarginine Chemical compound OC(=O)[C@@H](N)CCCCNC(N)=N QUOGESRFPZDMMT-YFKPBYRVSA-N 0.000 description 1
- 108090001090 Lectins Proteins 0.000 description 1
- 102000004856 Lectins Human genes 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 244000137850 Marrubium vulgare Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- FFKZOUIEAHOBHW-UHFFFAOYSA-N N,4-dimethyl-N-nitrosobenzenesulfonamide Chemical group O=NN(C)S(=O)(=O)C1=CC=C(C)C=C1 FFKZOUIEAHOBHW-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- HYQHGAJNOBGSCA-UHFFFAOYSA-N N1=CC=C(CC2=C1C=CC=C2)CC(=O)O Chemical compound N1=CC=C(CC2=C1C=CC=C2)CC(=O)O HYQHGAJNOBGSCA-UHFFFAOYSA-N 0.000 description 1
- YNUTVOPNNBKQQK-VTIYRKAUSA-N O=C([C@@H]1CC(=O)O[C@H]1C1=CC=C(C=C1C1)NC(=O)C2=CC=C(C=C2)C=NNC(=O)OCC=2C=CC=CC=2)N1CCC1=CC=CC=C1 Chemical compound O=C([C@@H]1CC(=O)O[C@H]1C1=CC=C(C=C1C1)NC(=O)C2=CC=C(C=C2)C=NNC(=O)OCC=2C=CC=CC=2)N1CCC1=CC=CC=C1 YNUTVOPNNBKQQK-VTIYRKAUSA-N 0.000 description 1
- 241000233855 Orchidaceae Species 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 102000013566 Plasminogen Human genes 0.000 description 1
- 108010051456 Plasminogen Proteins 0.000 description 1
- 108010035030 Platelet Membrane Glycoprotein IIb Proteins 0.000 description 1
- 206010050661 Platelet aggregation inhibition Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 108010039918 Polylysine Proteins 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 241001125046 Sardina pilchardus Species 0.000 description 1
- 229920002684 Sepharose Polymers 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 206010043561 Thrombocytopenic purpura Diseases 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000002938 Thrombospondin Human genes 0.000 description 1
- 108060008245 Thrombospondin Proteins 0.000 description 1
- 201000007023 Thrombotic Thrombocytopenic Purpura Diseases 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 208000007814 Unstable Angina Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Inorganic materials [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
- FKFMMMVFFYPIEE-UHFFFAOYSA-N [(3-aminophenyl)-azaniumylidenemethyl]azanium;dichloride Chemical compound Cl.Cl.NC(=N)C1=CC=CC(N)=C1 FKFMMMVFFYPIEE-UHFFFAOYSA-N 0.000 description 1
- ZLUQDYJYBGNECH-UHFFFAOYSA-N [4-nitro-2-[(2-phenylethylamino)methyl]phenyl]methanol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1CNCCC1=CC=CC=C1 ZLUQDYJYBGNECH-UHFFFAOYSA-N 0.000 description 1
- CDOMXXVCZQOOMT-UHFFFAOYSA-N [phenoxy(phenyl)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CDOMXXVCZQOOMT-UHFFFAOYSA-N 0.000 description 1
- 238000002679 ablation Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 159000000021 acetate salts Chemical group 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 108010013985 adhesion receptor Proteins 0.000 description 1
- 102000019997 adhesion receptor Human genes 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000019293 ammonium adipate Nutrition 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 125000005427 anthranyl group Chemical group 0.000 description 1
- 230000000702 anti-platelet effect Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 229940127218 antiplatelet drug Drugs 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 229940005530 anxiolytics Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 108010072041 arginyl-glycyl-aspartic acid Proteins 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001503 aryl iodides Chemical class 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- YDGMGEXADBMOMJ-UHFFFAOYSA-N asymmetrical dimethylarginine Natural products CN(C)C(N)=NCCCC(N)C(O)=O YDGMGEXADBMOMJ-UHFFFAOYSA-N 0.000 description 1
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 150000008038 benzoazepines Chemical class 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Substances N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- RDMFQOYEZPXZDC-UHFFFAOYSA-N benzyl 3-nitro-4-(4-oxobutyl)benzoate Chemical compound C1=C(CCCC=O)C([N+](=O)[O-])=CC(C(=O)OCC=2C=CC=CC=2)=C1 RDMFQOYEZPXZDC-UHFFFAOYSA-N 0.000 description 1
- UVPDHWHCQXLANC-UHFFFAOYSA-N benzyl 4-(6-ethoxy-6-oxohex-4-enyl)-3-nitrobenzoate Chemical compound C1=C([N+]([O-])=O)C(CCCC=CC(=O)OCC)=CC=C1C(=O)OCC1=CC=CC=C1 UVPDHWHCQXLANC-UHFFFAOYSA-N 0.000 description 1
- SEKYCHHFFYIDEI-UHFFFAOYSA-N benzyl n-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-oxobutyl)phenyl]carbamate Chemical compound C1=C(CCCC=O)C(NC(=O)OC(C)(C)C)=CC(NC(=O)OCC=2C=CC=CC=2)=C1 SEKYCHHFFYIDEI-UHFFFAOYSA-N 0.000 description 1
- BMHXZRFYFYHGNS-UHFFFAOYSA-N benzyl n-[4-(4-hydroxybutyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate Chemical compound C1=C(CCCCO)C(NC(=O)OC(C)(C)C)=CC(NC(=O)OCC=2C=CC=CC=2)=C1 BMHXZRFYFYHGNS-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 230000024279 bone resorption Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000002612 cardiopulmonary effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940107137 cholecystokinin Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000007333 cyanation reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- OGMXHVXOWRAHCE-UHFFFAOYSA-N dichloromethane;n-ethyl-n-propan-2-ylpropan-2-amine;methanol Chemical compound OC.ClCCl.CCN(C(C)C)C(C)C OGMXHVXOWRAHCE-UHFFFAOYSA-N 0.000 description 1
- MWPIIMNHWGOFBL-UHFFFAOYSA-N dichloromethane;toluene Chemical compound ClCCl.CC1=CC=CC=C1 MWPIIMNHWGOFBL-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- PAYWCKGMOYQZAW-UHFFFAOYSA-N dimethyl 2-nitrobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C([N+]([O-])=O)=C1 PAYWCKGMOYQZAW-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical group C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- HLGRRZFWTBVGMM-UHFFFAOYSA-L disodium;sulfate;dihydrate Chemical compound O.O.[Na+].[Na+].[O-]S([O-])(=O)=O HLGRRZFWTBVGMM-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- ODCCJTMPMUFERV-UHFFFAOYSA-N ditert-butyl carbonate Chemical compound CC(C)(C)OC(=O)OC(C)(C)C ODCCJTMPMUFERV-UHFFFAOYSA-N 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- ZHIMCPJPTHUEOQ-UHFFFAOYSA-N ethyl 3-[7-amino-1-(4-nitrophenyl)-5-oxo-2,3-dihydro-1,4-benzodiazepin-4-yl]propanoate Chemical compound C12=CC=C(N)C=C2C(=O)N(CCC(=O)OCC)CCN1C1=CC=C([N+]([O-])=O)C=C1 ZHIMCPJPTHUEOQ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000000004 hemodynamic effect Effects 0.000 description 1
- 125000004836 hexamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- COQRGFWWJBEXRC-UHFFFAOYSA-N hydron;methyl 2-aminoacetate;chloride Chemical compound Cl.COC(=O)CN COQRGFWWJBEXRC-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002523 lectin Substances 0.000 description 1
- 108010034897 lentil lectin Proteins 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical group [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- 229940071648 metered dose inhaler Drugs 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- CKFGINPQOCXMAZ-UHFFFAOYSA-N methanediol Chemical compound OCO CKFGINPQOCXMAZ-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- RWIKCBHOVNDESJ-NSCUHMNNSA-N methyl (e)-4-bromobut-2-enoate Chemical compound COC(=O)\C=C\CBr RWIKCBHOVNDESJ-NSCUHMNNSA-N 0.000 description 1
- RRMXKIZFOYPMKP-UHFFFAOYSA-N methyl 2-(3-oxo-2,5-dihydro-1h-1,4-benzodiazepin-4-yl)acetate Chemical compound N1CC(=O)N(CC(=O)OC)CC2=CC=CC=C21 RRMXKIZFOYPMKP-UHFFFAOYSA-N 0.000 description 1
- WNNOGICUCYOVNY-UHFFFAOYSA-N methyl 2-(7-amino-3-oxo-1,2,4,5-tetrahydro-1,4-benzodiazepin-2-yl)acetate Chemical compound C1NC(=O)C(CC(=O)OC)NC2=CC=C(N)C=C21 WNNOGICUCYOVNY-UHFFFAOYSA-N 0.000 description 1
- WNZDDKIJYISPMT-UHFFFAOYSA-N methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrobenzoate Chemical compound COC(=O)C1=CC=C([N+]([O-])=O)C=C1NC(=O)OC(C)(C)C WNZDDKIJYISPMT-UHFFFAOYSA-N 0.000 description 1
- BINBTJFWVQBNFL-UHFFFAOYSA-N methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)benzoate Chemical compound C1=C(NC(=O)OC(C)(C)C)C(C(=O)OC)=CC(NC(=O)OCC=2C=CC=CC=2)=C1 BINBTJFWVQBNFL-UHFFFAOYSA-N 0.000 description 1
- VOQBLPBLKSXCDB-UHFFFAOYSA-N methyl 2-amino-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC=C1N VOQBLPBLKSXCDB-UHFFFAOYSA-N 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- OQMRAZOFTJHTJZ-UHFFFAOYSA-N methyl 4-(2-amino-4-nitrophenyl)butanoate Chemical compound COC(=O)CCCC1=CC=C([N+]([O-])=O)C=C1N OQMRAZOFTJHTJZ-UHFFFAOYSA-N 0.000 description 1
- DZLZEUNLXPNGOQ-UHFFFAOYSA-N methyl 4-(4-acetyloxybutyl)-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(CCCCOC(C)=O)C([N+]([O-])=O)=C1 DZLZEUNLXPNGOQ-UHFFFAOYSA-N 0.000 description 1
- KVKWRSNRAXOBFC-UHFFFAOYSA-N methyl 4-(4-hydroxybutyl)benzoate Chemical compound COC(=O)C1=CC=C(CCCCO)C=C1 KVKWRSNRAXOBFC-UHFFFAOYSA-N 0.000 description 1
- IOXDKBBLDJFEOK-UHFFFAOYSA-N methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitrophenyl]butanoate Chemical compound COC(=O)CCCC1=CC=C([N+]([O-])=O)C=C1NC(=O)OC(C)(C)C IOXDKBBLDJFEOK-UHFFFAOYSA-N 0.000 description 1
- YDQBXACOFDLVKT-UHFFFAOYSA-N methyl 4-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoate Chemical compound COC(=O)CCCC1=CC=C(N)C=C1NC(=O)OC(C)(C)C YDQBXACOFDLVKT-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- ITFZASUFZUCDSU-UHFFFAOYSA-N n,n-diethylethanamine;methylsulfinylmethane Chemical compound CS(C)=O.CCN(CC)CC ITFZASUFZUCDSU-UHFFFAOYSA-N 0.000 description 1
- RZQGNGZZGBNABH-UHFFFAOYSA-N n-[(2-chloro-5-nitrophenyl)methyl]-2-phenylethanamine Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(CNCCC=2C=CC=CC=2)=C1 RZQGNGZZGBNABH-UHFFFAOYSA-N 0.000 description 1
- GFIAXGIMEQPDSY-UHFFFAOYSA-N n-[(2-fluoro-5-nitrophenyl)methyl]-2-phenylethanamine Chemical compound [O-][N+](=O)C1=CC=C(F)C(CNCCC=2C=CC=CC=2)=C1 GFIAXGIMEQPDSY-UHFFFAOYSA-N 0.000 description 1
- KACNXDITAQFNSW-UHFFFAOYSA-N n-[[2-[(4-methoxyphenyl)methylsulfanyl]-5-nitrophenyl]methyl]-2-phenylethanamine Chemical compound C1=CC(OC)=CC=C1CSC1=CC=C([N+]([O-])=O)C=C1CNCCC1=CC=CC=C1 KACNXDITAQFNSW-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000004817 pentamethylene group Chemical class [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 230000003169 placental effect Effects 0.000 description 1
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 1
- 210000004623 platelet-rich plasma Anatomy 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000656 polylysine Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 238000011110 re-filtration Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 230000010410 reperfusion Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 235000019512 sardine Nutrition 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- KYKFCSHPTAVNJD-UHFFFAOYSA-L sodium adipate Chemical compound [Na+].[Na+].[O-]C(=O)CCCCC([O-])=O KYKFCSHPTAVNJD-UHFFFAOYSA-L 0.000 description 1
- 239000001601 sodium adipate Substances 0.000 description 1
- 235000011049 sodium adipate Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 238000002415 sodium dodecyl sulfate polyacrylamide gel electrophoresis Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000008259 solid foam Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 125000004962 sulfoxyl group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- KKGIWBUJQFFOGX-UHFFFAOYSA-N tert-butyl (2-methylpropan-2-yl)oxycarbonyloxycarbonyloxycarbonyl carbonate Chemical compound CC(C)(C)OC(=O)OC(=O)OC(=O)OC(=O)OC(C)(C)C KKGIWBUJQFFOGX-UHFFFAOYSA-N 0.000 description 1
- SJMDMGHPMLKLHQ-UHFFFAOYSA-N tert-butyl 2-aminoacetate Chemical compound CC(C)(C)OC(=O)CN SJMDMGHPMLKLHQ-UHFFFAOYSA-N 0.000 description 1
- GUWRTHBWWMGYBW-UHFFFAOYSA-N tert-butyl 3-methyl-4-nitrobenzoate;3-methyl-4-nitrobenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1[N+]([O-])=O.CC1=CC(C(=O)OC(C)(C)C)=CC=C1[N+]([O-])=O GUWRTHBWWMGYBW-UHFFFAOYSA-N 0.000 description 1
- NXHDMOGWVRMCTL-UHFFFAOYSA-N tert-butyl n-[(4-nitrophenyl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC=C([N+]([O-])=O)C=C1 NXHDMOGWVRMCTL-UHFFFAOYSA-N 0.000 description 1
- GQAUPTTUSSLXPS-UHFFFAOYSA-N tert-butyl n-[[3-(aminomethyl)phenyl]methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC=CC(CN)=C1 GQAUPTTUSSLXPS-UHFFFAOYSA-N 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- BISQTCXKVNCDDA-UHFFFAOYSA-N thiepine Chemical compound S1C=CC=CC=C1 BISQTCXKVNCDDA-UHFFFAOYSA-N 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- IIHPVYJPDKJYOU-UHFFFAOYSA-N triphenylcarbethoxymethylenephosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OCC)C1=CC=CC=C1 IIHPVYJPDKJYOU-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 108010047303 von Willebrand Factor Proteins 0.000 description 1
- 102100036537 von Willebrand factor Human genes 0.000 description 1
- 229960001134 von willebrand factor Drugs 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/06—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms
- C07D233/08—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms with alkyl radicals, containing more than four carbon atoms, directly attached to ring carbon atoms
- C07D233/10—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms with alkyl radicals, containing more than four carbon atoms, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/02—Seven-membered rings
- C07D267/08—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D267/12—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D267/14—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D281/02—Seven-membered rings
- C07D281/04—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D281/08—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D281/10—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Vascular Medicine (AREA)
- Urology & Nephrology (AREA)
- Epidemiology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Materials For Medical Uses (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US72300991A | 1991-06-28 | 1991-06-28 | |
| US723,009 | 1991-06-28 | ||
| PCT/US1992/005463 WO1993000095A2 (en) | 1991-06-28 | 1992-06-26 | Bicyclic fibrinogen antagonists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH06509074A JPH06509074A (ja) | 1994-10-13 |
| JP3497164B2 true JP3497164B2 (ja) | 2004-02-16 |
Family
ID=24904429
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP50170293A Expired - Fee Related JP3497164B2 (ja) | 1991-06-28 | 1992-06-26 | 二環式フィブリノーゲン拮抗薬 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US5693636A (ja�@�@) |
| EP (1) | EP0593603B1 (ja�@�@) |
| JP (1) | JP3497164B2 (ja�@�@) |
| KR (1) | KR940701259A (ja�@�@) |
| AT (1) | ATE228115T1 (ja�@�@) |
| AU (1) | AU666318B2 (ja�@�@) |
| CA (1) | CA2112360A1 (ja�@�@) |
| DE (1) | DE69232854T2 (ja�@�@) |
| ES (1) | ES2190428T3 (ja�@�@) |
| IE (1) | IE922087A1 (ja�@�@) |
| NZ (1) | NZ243326A (ja�@�@) |
| PT (1) | PT100631B (ja�@�@) |
| TW (1) | TW218018B (ja�@�@) |
| WO (1) | WO1993000095A2 (ja�@�@) |
| ZA (1) | ZA924760B (ja�@�@) |
Families Citing this family (95)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6017877A (en) * | 1990-04-06 | 2000-01-25 | La Jolla Cancer Research Foundation | Method and composition for treating thrombosis |
| US6521594B1 (en) | 1990-04-06 | 2003-02-18 | La Jolla Cancer Research Foundation | Method and composition for treating thrombosis |
| US5780303A (en) * | 1990-04-06 | 1998-07-14 | La Jolla Cancer Research Foundation | Method and composition for treating thrombosis |
| US5672585A (en) * | 1990-04-06 | 1997-09-30 | La Jolla Cancer Research Foundation | Method and composition for treating thrombosis |
| US6019958A (en) * | 1991-02-08 | 2000-02-01 | Diatide, Inc. | Technetium-99m labeled peptides for imaging inflammation |
| US5736122A (en) * | 1991-02-08 | 1998-04-07 | Diatide, Inc. | Technetium-99m labeled peptides for thrombus imaging |
| US5645815A (en) | 1991-02-08 | 1997-07-08 | Diatide, Inc. | Radiolabled compounds for thrombus imaging |
| DE69230525T2 (de) * | 1991-02-08 | 2000-06-21 | Diatide, Inc. | Technetium-99m markierte Polypeptide zur Bildformung |
| US5693636A (en) * | 1991-06-28 | 1997-12-02 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| US5939412A (en) * | 1992-06-26 | 1999-08-17 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| US5250679A (en) * | 1991-10-18 | 1993-10-05 | Genentech, Inc. | Nonpeptidyl platelet aggregation inhibitors having specificity for the GPIIb III.sub. receptor |
| US5674863A (en) * | 1991-10-18 | 1997-10-07 | Genentech, Inc. | Nonpeptidyl integrin inhibitors having specificity for the GPIIb IIIa receptor |
| ES2197160T3 (es) * | 1992-12-21 | 2004-01-01 | Smithkline Beecham Corp | Antagonistas fibronogeno bicicliclos. |
| US5441952A (en) * | 1993-04-05 | 1995-08-15 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US6056940A (en) * | 1993-04-08 | 2000-05-02 | Diatide, Inc. | Radiolabeled compounds for thrombus imaging |
| AU6909194A (en) * | 1993-05-14 | 1994-12-12 | Board Of Regents, The University Of Texas System | Preparation of n-cyanodithioimino-carbonates and 3-mercapto-5-amino-1h-1,2,4-triazole |
| US6448269B1 (en) | 1993-07-22 | 2002-09-10 | Eli Lilly And Company | Glycoprotein IIb/IIIa antagonists |
| US6137002A (en) | 1993-07-22 | 2000-10-24 | Eli Lilly And Company | Glycoprotein IIb/IIIa antagonists |
| US5731324A (en) * | 1993-07-22 | 1998-03-24 | Eli Lilly And Company | Glycoprotein IIb/IIIa antagonists |
| IL110172A (en) * | 1993-07-22 | 2001-10-31 | Lilly Co Eli | Bicyclic compounds and pharmaceutical compositions containing them |
| US6403578B1 (en) | 1993-12-21 | 2002-06-11 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| MA23420A1 (fr) * | 1994-01-07 | 1995-10-01 | Smithkline Beecham Corp | Antagonistes bicycliques de fibrinogene. |
| ZA955391B (en) * | 1994-06-29 | 1996-02-09 | Smithkline Beecham Corp | Vitronectin receptor antagonists |
| NZ290008A (en) * | 1994-06-29 | 1998-08-26 | Smithkline Beecham Corp | Vitronectin receptor antagonists, comprising a fibrinogen antagonist analogue linked to a heterocycle |
| US6458784B1 (en) | 1994-06-29 | 2002-10-01 | Smithkline Beecham Corporation | Vitronectin receptor antagonists |
| JPH10504825A (ja) * | 1994-08-22 | 1998-05-12 | スミスクライン・ビーチャム・コーポレイション | 二環式化合物 |
| WO1996017833A1 (en) * | 1994-12-09 | 1996-06-13 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| EP0799189A4 (en) * | 1994-12-13 | 1999-03-17 | Smithkline Beecham Corp | BICYCLIC FIBRINOGENIC ANTAGONISTS |
| WO1996026190A1 (en) * | 1995-02-22 | 1996-08-29 | Smithkline Beecham Corporation | Integrin receptor antagonists |
| DE19516483A1 (de) * | 1995-05-05 | 1996-11-07 | Merck Patent Gmbh | Adhäsionsrezeptor-Antagonisten |
| US5977101A (en) * | 1995-06-29 | 1999-11-02 | Smithkline Beecham Corporation | Benzimidazoles/Imidazoles Linked to a Fibrinogen Receptor Antagonist Template Having Vitronectin Receptor Antagonist Activity |
| ZA9610853B (en) | 1995-12-29 | 1998-04-06 | Smithkline Beecham Corp | Processes and intermediates for preparing pharmaceuticals. |
| WO1997024122A1 (en) * | 1995-12-29 | 1997-07-10 | Smithkline Beecham Corporation | Vitronectin receptor antagonists |
| US6686350B1 (en) | 1996-07-25 | 2004-02-03 | Biogen, Inc. | Cell adhesion inhibitors |
| NZ333904A (en) * | 1996-07-25 | 2000-06-23 | Biogen Inc | VLA-4 and IIb/IIIa cell adhesion inhibitors |
| US5693641A (en) * | 1996-08-16 | 1997-12-02 | Berlex Laboratories Inc. | Bicyclic pyrimidine derivatives and their use as anti-coagulants |
| MA24309A1 (fr) | 1996-09-03 | 1998-04-01 | Smithkline Beecham Corp | Procede pour la preparation de produit pharmaceutique cristallin. |
| US20030125317A1 (en) * | 1996-10-02 | 2003-07-03 | Smithkline Beecham Corporation | Vitronectin receptor antagonists |
| DE19653645A1 (de) * | 1996-12-20 | 1998-06-25 | Hoechst Ag | Vitronectin - Rezeptorantagonisten, deren Herstellung sowie deren Verwendung |
| US6218387B1 (en) | 1996-12-20 | 2001-04-17 | Hoechst Aktiengesellschaft | Vitronectin receptor anatagonists, their preparation and their use |
| DE19653647A1 (de) | 1996-12-20 | 1998-06-25 | Hoechst Ag | Vitronectin - Rezeptorantagonisten, deren Herstellung sowie deren Verwendung |
| US6482821B2 (en) | 1996-12-20 | 2002-11-19 | Hoechst Aktiengellschaft | Vitronectin receptor antagonists, their preparation and their use |
| CN1246157A (zh) * | 1996-12-27 | 2000-03-01 | 史密丝克莱恩比彻姆有限公司 | 用脂酶进行苯并二氮杂䓬-乙酸酯的酶拆分 |
| US6265418B1 (en) * | 1997-07-31 | 2001-07-24 | Ube Industries, Ltd. | N-acylamino acid amide compounds and intermediates for preparation thereof |
| US6100254A (en) * | 1997-10-10 | 2000-08-08 | Board Of Regents, The University Of Texas System | Inhibitors of protein tyrosine kinases |
| WO1999033798A1 (en) * | 1997-12-25 | 1999-07-08 | Yamanouchi Pharmaceutical Co., Ltd. | Nitrogenous heterocyclic derivatives |
| US6197794B1 (en) | 1998-01-08 | 2001-03-06 | Celltech Therapeutics Limited | Phenylalanine derivatives |
| US6329372B1 (en) | 1998-01-27 | 2001-12-11 | Celltech Therapeutics Limited | Phenylalanine derivatives |
| KR20010082515A (ko) | 1998-02-17 | 2001-08-30 | 우에노 도시오 | 아미디노 유도체 및 그 유도체를 유효 성분으로서함유하는 약제 |
| DE69919334T2 (de) | 1998-02-26 | 2005-08-04 | Celltech Therapeutics Ltd., Slough | Phenylalaninderivate als inhibitoren von alpha4 integrinen |
| GB9805655D0 (en) | 1998-03-16 | 1998-05-13 | Celltech Therapeutics Ltd | Chemical compounds |
| US6521626B1 (en) | 1998-03-24 | 2003-02-18 | Celltech R&D Limited | Thiocarboxamide derivatives |
| JP2003504301A (ja) | 1998-04-01 | 2003-02-04 | ブリストル−マイヤーズ スクイブ ファーマ カンパニー | インテグリンアンタゴニスト |
| GB9811159D0 (en) | 1998-05-22 | 1998-07-22 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9811969D0 (en) | 1998-06-03 | 1998-07-29 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9812088D0 (en) | 1998-06-05 | 1998-08-05 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9814414D0 (en) | 1998-07-03 | 1998-09-02 | Celltech Therapeutics Ltd | Chemical compounds |
| US6974878B2 (en) * | 2001-03-21 | 2005-12-13 | Symyx Technologies, Inc. | Catalyst ligands, catalytic metal complexes and processes using same |
| GB9821061D0 (en) | 1998-09-28 | 1998-11-18 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9821222D0 (en) | 1998-09-30 | 1998-11-25 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9825652D0 (en) | 1998-11-23 | 1999-01-13 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9826174D0 (en) | 1998-11-30 | 1999-01-20 | Celltech Therapeutics Ltd | Chemical compounds |
| US6204282B1 (en) | 1998-11-30 | 2001-03-20 | Schering Corporation | Benzimidazole compounds that are vitronectin receptor antagonists |
| AU3894800A (en) * | 1999-03-23 | 2000-10-09 | Axys Pharmaceuticals, Inc. | Solid phase synthesis of benzodiazepine diones |
| GB9908662D0 (en) * | 1999-04-15 | 1999-06-09 | Smithkline Beecham Plc | Novel process for preparing benzodiazepines |
| CO5180550A1 (es) | 1999-04-19 | 2002-07-30 | Smithkline Beecham Corp | Inhibidores de fab i |
| US6518283B1 (en) | 1999-05-28 | 2003-02-11 | Celltech R&D Limited | Squaric acid derivatives |
| AU5826100A (en) * | 1999-07-13 | 2001-01-30 | F. Hoffmann-La Roche Ag | Benzazepinones and quinazolines |
| US6429214B1 (en) | 1999-07-21 | 2002-08-06 | Wyeth | Bicyclic antagonists selective for the αvβ3 integrin |
| US6534513B1 (en) | 1999-09-29 | 2003-03-18 | Celltech R&D Limited | Phenylalkanoic acid derivatives |
| AU784646B2 (en) | 1999-11-18 | 2006-05-18 | Antexpharma, Inc. | Substituted 1-benzazepines and derivatives thereof |
| US6455539B2 (en) | 1999-12-23 | 2002-09-24 | Celltech R&D Limited | Squaric acid derivates |
| DE60130910T2 (de) | 2000-04-17 | 2008-07-10 | Ucb Pharma, S.A. | Enamin-derivate als zell-adhäsionsmoleküle |
| US6403608B1 (en) | 2000-05-30 | 2002-06-11 | Celltech R&D, Ltd. | 3-Substituted isoquinolin-1-yl derivatives |
| US6545013B2 (en) | 2000-05-30 | 2003-04-08 | Celltech R&D Limited | 2,7-naphthyridine derivatives |
| US6740654B2 (en) | 2000-07-07 | 2004-05-25 | Celltech R & D Limited | Squaric acid derivatives |
| AU2001275724A1 (en) | 2000-08-02 | 2002-02-13 | Celltech R&D Limited | 3-substituted isoquinolin-1-yl derivatives |
| EP1443963B1 (en) * | 2001-10-22 | 2014-05-21 | The Scripps Research Institute | Antibody targeting compounds |
| US20060127385A1 (en) | 2002-12-06 | 2006-06-15 | The Trustees Of Boston University | Method for sustaining enos activity |
| US7928143B2 (en) * | 2003-10-03 | 2011-04-19 | Ono Pharmaceutical Co., Ltd. | Method for preventing and/or treating neurodegenerative diseases |
| US8710045B2 (en) | 2004-01-22 | 2014-04-29 | The Trustees Of Columbia University In The City Of New York | Agents for preventing and treating disorders involving modulation of the ryanodine receptors |
| US20070122408A1 (en) * | 2005-10-20 | 2007-05-31 | The Scripps Research Institute | Fc Labeling for Immunostaining and Immunotargeting |
| JP2012517447A (ja) | 2009-02-10 | 2012-08-02 | ザ スクリプス リサーチ インスティチュート | 化学的にプログラムされたワクチン接種法 |
| ES2642586T3 (es) | 2009-07-27 | 2017-11-16 | Gilead Sciences, Inc. | Compuestos heterocíclicos condensados como moduladores de canales iónicos |
| EP2588197B1 (en) | 2010-07-02 | 2014-11-05 | Gilead Sciences, Inc. | Fused heterocyclic compounds as ion channel modulators |
| KR20140033377A (ko) | 2011-05-10 | 2014-03-18 | 길리애드 사이언시즈, 인코포레이티드 | 나트륨 채널 조절제로서의 융합된 헤테로시클릭 화합물 |
| UY34171A (es) | 2011-07-01 | 2013-01-31 | Gilead Sciences Inc | Compuestos heterocíclicos fusionados como moduladores del canal iónico |
| AU2015224425B2 (en) * | 2011-07-01 | 2017-02-09 | Gilead Sciences, Inc. | Fused benzoxazepinones as ion channel modulators |
| NO3175985T3 (ja�@�@) | 2011-07-01 | 2018-04-28 | ||
| EP2708535A1 (en) | 2012-05-11 | 2014-03-19 | Les Laboratoires Servier | Agents for treating disorders involving modulation of ryanodine receptors |
| WO2016075239A1 (en) * | 2014-11-14 | 2016-05-19 | Boehringer Ingelheim International Gmbh | Aryl and heteroaryl-fused tetrahydro-1,4-oxazepine amides as somatostatin receptor subtype 4 (sstr4) agonists |
| CN105348148B (zh) * | 2015-11-30 | 2017-12-26 | 山东新华制药股份有限公司 | 制备达比加群酯中间体缩合物的杂质的草酸盐的方法 |
| EP3521269A1 (en) | 2018-02-06 | 2019-08-07 | Clariant Plastics & Coatings Ltd | Process for preparation of 1-nitrobenzene-2-alkyloxycarbonyl-5-carboxylic acid |
| CN110845308A (zh) * | 2019-10-24 | 2020-02-28 | 扬州工业职业技术学院 | 一种辣椒素的制备工艺 |
| CN113444009B (zh) * | 2021-07-28 | 2023-08-01 | 珠海润都制药股份有限公司 | 一种坎地沙坦酯中间体母液的回收方法 |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1592552A (en) * | 1976-12-10 | 1981-07-08 | Inst Nat Sante Rech Med | Pseudopeptides used as medicaments |
| LU77316A1 (ja�@�@) * | 1977-05-11 | 1979-01-19 | ||
| HU179018B (en) * | 1978-10-19 | 1982-08-28 | Gyogyszerkutato Intezet | Process for producing new 5h-2,3-benzodiazepine derivatives |
| CA1145333A (en) * | 1980-02-08 | 1983-04-26 | Quirico Branca | Benzodiazepine derivatives |
| CA1163266A (en) * | 1980-07-31 | 1984-03-06 | Albert E. Fischli | Benzodiazepine derivatives |
| CA1157855A (en) * | 1980-07-31 | 1983-11-29 | Albert E. Fischli | Benzodiazepine derivatives |
| NL8005133A (nl) * | 1980-09-12 | 1982-04-01 | Duphar Int Res | Fenylpiperazinederivaten met antiagressieve werking. |
| NZ204130A (en) * | 1982-05-12 | 1986-03-14 | Hoffmann La Roche | Bicyclic heterocyclic compounds and pharmaceutical compositions |
| US5059688A (en) * | 1982-06-14 | 1991-10-22 | Hoechst-Roussel Pharmaceuticals Inc. | 1-aryloxy-2,3,4,5-tetrahydro-3-benzazepine preparation |
| DE3418271A1 (de) * | 1984-05-17 | 1985-11-21 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue benzazepinderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| US4820834A (en) * | 1984-06-26 | 1989-04-11 | Merck & Co., Inc. | Benzodiazepine analogs |
| EP0204349A3 (de) * | 1985-06-01 | 1990-01-03 | Dr. Karl Thomae GmbH | Neue heteroaromatische Aminderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DE3781263T2 (de) * | 1986-12-15 | 1993-04-08 | Inst Nat Sante Rech Med | Peptid-derivate und deren verwendung in der therapie. |
| DE3702755A1 (de) * | 1987-01-30 | 1988-08-11 | Hoechst Ag | 3,5-di-tert.-butyl-4-hydroxybenzoesaeureamid, verschiedene von dessen derivaten, verfahren zur herstellung dieser verbindungen, die sie enthaltenden arzneimittel und ihre verwendung |
| WO1989005150A1 (en) * | 1987-12-10 | 1989-06-15 | La Jolla Cancer Research Foundation | Conformationally stabilized cell adhesion peptides |
| DK107688D0 (da) * | 1988-03-01 | 1988-03-01 | Novo Industri As | Carbaminsyreestere af substituerede 7-hydroxy-2,3,4,5-tetrahydro-1h-3-benzazepiner |
| ZW6189A1 (en) * | 1988-05-09 | 1990-05-09 | Smithkline Beckman Corp | Anti-aggregatory peptides |
| US4902684A (en) * | 1988-06-20 | 1990-02-20 | E. R. Squibb & Sons, Inc. | Benzazepine and benzothiazepine derivatives |
| US5039805A (en) * | 1988-12-08 | 1991-08-13 | Hoffmann-La Roche Inc. | Novel benzoic and phenylacetic acid derivatives |
| US5084466A (en) * | 1989-01-31 | 1992-01-28 | Hoffmann-La Roche Inc. | Novel carboxamide pyridine compounds which have useful pharmaceutical utility |
| ES2052172T3 (es) * | 1989-03-23 | 1994-07-01 | Pfizer | Agentes antialergicos basados en diazepina. |
| JPH04211071A (ja) * | 1990-03-05 | 1992-08-03 | Hokuriku Seiyaku Co Ltd | 多環式化合物 |
| NZ239876A (en) * | 1990-09-27 | 1993-12-23 | Merck & Co Inc | Glycyl-b-alanine derivatives and pharmaceutical compositions thereof. |
| IL99537A (en) * | 1990-09-27 | 1995-11-27 | Merck & Co Inc | Fibrinogen receptor antagonists and pharmaceutical compositions containing them |
| NZ239846A (en) * | 1990-09-27 | 1994-11-25 | Merck & Co Inc | Sulphonamide derivatives and pharmaceutical compositions thereof |
| IL99539A0 (en) * | 1990-09-27 | 1992-08-18 | Merck & Co Inc | Fibrinogen receptor antagonists and pharmaceutical compositions containing them |
| EP0557406A4 (en) * | 1990-11-01 | 1993-10-06 | Smith-Kline Beecham Corporation | -g(g)-turn peptidomimetics as fibrinogen antagonists |
| AU9122391A (en) * | 1990-11-30 | 1992-06-25 | Smithkline Beecham Corporation | Hiv protease inhibitors |
| TW198715B (ja�@�@) * | 1991-04-19 | 1993-01-21 | Dtsuka Seiyaku Kk | |
| EP0523845A3 (en) * | 1991-06-14 | 1993-11-18 | Merck & Co Inc | New benzodiazepine analogs |
| US5693636A (en) * | 1991-06-28 | 1997-12-02 | Smithkline Beecham Corporation | Bicyclic fibrinogen antagonists |
| US5250679A (en) * | 1991-10-18 | 1993-10-05 | Genentech, Inc. | Nonpeptidyl platelet aggregation inhibitors having specificity for the GPIIb III.sub. receptor |
| US5149699A (en) * | 1991-10-24 | 1992-09-22 | American Home Products Corporation | Substituted pyridopyrimidines useful as antgiotensin II antagonists |
| US5241065A (en) * | 1992-02-25 | 1993-08-31 | Schering Corporation | 2,3,4,5-tetrahydro-1h-3-benzazepines having anti-psychotic activity |
| ATE163927T1 (de) * | 1992-11-09 | 1998-03-15 | Knoll Ag | 1,4-benzothiazepine verwendbar als neurologische mittel |
| ES2197160T3 (es) * | 1992-12-21 | 2004-01-01 | Smithkline Beecham Corp | Antagonistas fibronogeno bicicliclos. |
| US5493020A (en) * | 1993-07-29 | 1996-02-20 | Genentech, Inc. | Tricyclic inhibitors of the GPIIb IIIa receptor |
-
1992
- 1992-06-26 US US07/923,794 patent/US5693636A/en not_active Expired - Fee Related
- 1992-06-26 EP EP92914832A patent/EP0593603B1/en not_active Expired - Lifetime
- 1992-06-26 AT AT92914832T patent/ATE228115T1/de not_active IP Right Cessation
- 1992-06-26 CA CA002112360A patent/CA2112360A1/en not_active Abandoned
- 1992-06-26 WO PCT/US1992/005463 patent/WO1993000095A2/en not_active Ceased
- 1992-06-26 KR KR1019930704088A patent/KR940701259A/ko not_active Ceased
- 1992-06-26 DE DE69232854T patent/DE69232854T2/de not_active Expired - Fee Related
- 1992-06-26 PT PT100631A patent/PT100631B/pt not_active IP Right Cessation
- 1992-06-26 ES ES92914832T patent/ES2190428T3/es not_active Expired - Lifetime
- 1992-06-26 AU AU22711/92A patent/AU666318B2/en not_active Ceased
- 1992-06-26 ZA ZA924760A patent/ZA924760B/xx unknown
- 1992-06-26 JP JP50170293A patent/JP3497164B2/ja not_active Expired - Fee Related
- 1992-06-26 NZ NZ243326A patent/NZ243326A/en unknown
- 1992-07-01 IE IE208792A patent/IE922087A1/en not_active Application Discontinuation
- 1992-08-01 TW TW081106117A patent/TW218018B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| DE69232854T2 (de) | 2003-09-04 |
| WO1993000095A2 (en) | 1993-01-07 |
| JPH06509074A (ja) | 1994-10-13 |
| CA2112360A1 (en) | 1993-12-23 |
| TW218018B (ja�@�@) | 1993-12-21 |
| US5693636A (en) | 1997-12-02 |
| PT100631B (pt) | 1999-06-30 |
| ATE228115T1 (de) | 2002-12-15 |
| KR940701259A (ko) | 1994-05-28 |
| EP0593603A1 (en) | 1994-04-27 |
| AU666318B2 (en) | 1996-02-08 |
| DE69232854D1 (de) | 2003-01-02 |
| WO1993000095A3 (en) | 1993-02-18 |
| ES2190428T3 (es) | 2003-08-01 |
| EP0593603B1 (en) | 2002-11-20 |
| ZA924760B (en) | 1993-03-31 |
| AU2271192A (en) | 1993-01-25 |
| EP0593603A4 (en) | 1994-03-07 |
| PT100631A (pt) | 1993-09-30 |
| NZ243326A (en) | 1995-10-26 |
| IE922087A1 (en) | 1992-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3497164B2 (ja) | 二環式フィブリノーゲン拮抗薬 | |
| EP0674623B1 (en) | Bicyclic fibrinogen antagonists | |
| US5602145A (en) | Bicyclic fibrinogen antagonists | |
| EP0738150B1 (en) | Bicyclic fibrinogen antagonists | |
| EP0610334B1 (en) | Nonpeptidyl integrin inhibitors having specificity for the gpii b iii a receptor | |
| US5939412A (en) | Bicyclic fibrinogen antagonists | |
| JPH10504825A (ja) | 二環式化合物 | |
| JPH08503712A (ja) | 血小板凝集の阻害用ベンズイミダゾール化合物 | |
| CA2298544A1 (en) | Integrin receptor antagonists | |
| JPH08505846A (ja) | 血小板凝集阻害用化合物 | |
| JPH11505509A (ja) | 二環式フィブリノーゲン拮抗薬 | |
| JPH04210967A (ja) | 2−ベンズアゼピン化合物 | |
| US6403578B1 (en) | Bicyclic fibrinogen antagonists | |
| EP0800395A1 (en) | Fibrinogen receptor antagonists | |
| WO1994022440A1 (en) | Bicyclic compounds which inhibit platelet aggregation | |
| AU4380301A (en) | Bicyclic fibrinogen antagonists | |
| HK1014668B (en) | Bicyclic fibrinogen antagonists |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20071128 Year of fee payment: 4 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20081128 Year of fee payment: 5 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20081128 Year of fee payment: 5 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20091128 Year of fee payment: 6 |
|
| LAPS | Cancellation because of no payment of annual fees |