JP2012512151A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2012512151A5 JP2012512151A5 JP2011540235A JP2011540235A JP2012512151A5 JP 2012512151 A5 JP2012512151 A5 JP 2012512151A5 JP 2011540235 A JP2011540235 A JP 2011540235A JP 2011540235 A JP2011540235 A JP 2011540235A JP 2012512151 A5 JP2012512151 A5 JP 2012512151A5
- Authority
- JP
- Japan
- Prior art keywords
- imidazo
- vinyl
- thiazole
- carboxamide
- thiazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 171
- -1 6-{(E) -2- [2- (cyclopropylmethoxy) -3-methoxyphenyl] ethenyl} imidazo [2,1-b] [1,3] thiazol-5-yl Chemical group 0.000 claims description 87
- 125000001072 heteroaryl group Chemical group 0.000 claims description 73
- 125000000217 alkyl group Chemical group 0.000 claims description 70
- 239000000203 mixture Substances 0.000 claims description 62
- 125000000623 heterocyclic group Chemical group 0.000 claims description 59
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 57
- 125000003118 aryl group Chemical group 0.000 claims description 56
- 229920002554 vinyl polymer Polymers 0.000 claims description 56
- 239000001257 hydrogen Substances 0.000 claims description 48
- 229910052739 hydrogen Inorganic materials 0.000 claims description 48
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 45
- 125000003342 alkenyl group Chemical group 0.000 claims description 41
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 39
- 125000001188 haloalkyl group Chemical group 0.000 claims description 37
- 150000002431 hydrogen Chemical class 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 34
- 208000002193 Pain Diseases 0.000 claims description 32
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 26
- 239000011734 sodium Substances 0.000 claims description 25
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 23
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 23
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 22
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 22
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 22
- 208000035475 disorder Diseases 0.000 claims description 20
- 201000010099 disease Diseases 0.000 claims description 19
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical class 0.000 claims description 18
- 229910052708 sodium Inorganic materials 0.000 claims description 16
- 125000000304 alkynyl group Chemical group 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 239000011591 potassium Substances 0.000 claims description 12
- 229910052700 potassium Inorganic materials 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 10
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 9
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 9
- 229910052744 lithium Inorganic materials 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 230000006870 function Effects 0.000 claims description 8
- 208000004296 neuralgia Diseases 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 8
- 125000001331 3-methylbutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 claims description 7
- 125000004104 aryloxy group Chemical group 0.000 claims description 7
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 claims description 6
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- PKBYSNWDIFBUJW-VAWYXSNFSA-N n-(4-tert-butyl-1,3-thiazol-2-yl)-6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)NC=2SC=C(N=2)C(C)(C)C)=C1OCC(C)(C)C PKBYSNWDIFBUJW-VAWYXSNFSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 201000008482 osteoarthritis Diseases 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 208000024891 symptom Diseases 0.000 claims description 6
- 208000000094 Chronic Pain Diseases 0.000 claims description 5
- 208000004550 Postoperative Pain Diseases 0.000 claims description 5
- 208000005298 acute pain Diseases 0.000 claims description 5
- 238000003556 assay Methods 0.000 claims description 5
- 208000021722 neuropathic pain Diseases 0.000 claims description 5
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 5
- 208000011580 syndromic disease Diseases 0.000 claims description 5
- 238000012360 testing method Methods 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 206010020751 Hypersensitivity Diseases 0.000 claims description 4
- 208000026935 allergic disease Diseases 0.000 claims description 4
- 230000000172 allergic effect Effects 0.000 claims description 4
- 206010003246 arthritis Diseases 0.000 claims description 4
- 230000009610 hypersensitivity Effects 0.000 claims description 4
- 230000001404 mediated effect Effects 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 208000004371 toothache Diseases 0.000 claims description 4
- OOFSAZADFPZLIW-MDZDMXLPSA-N 6-[(e)-2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CCCC1OC=1C(OC)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC1=NC(C(F)(F)F)=CS1 OOFSAZADFPZLIW-MDZDMXLPSA-N 0.000 claims description 3
- ABMONLDJYBIDKQ-MDZDMXLPSA-N 6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]-n-(4-methyl-1,3-thiazol-2-yl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)NC=2SC=C(C)N=2)=C1OCC(C)(C)C ABMONLDJYBIDKQ-MDZDMXLPSA-N 0.000 claims description 3
- UYERHYJUWPGGIN-CMDGGOBGSA-N 6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)NC=2SC=C(N=2)C(F)(F)F)=C1OCC(C)(C)C UYERHYJUWPGGIN-CMDGGOBGSA-N 0.000 claims description 3
- ABSXFDMTOKOQBO-MDZDMXLPSA-N 6-[(e)-2-[2-(cyclobutylmethoxy)-3-(difluoromethoxy)phenyl]ethenyl]-n-(4-cyclopropyl-1,3-thiazol-2-yl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CCC1COC=1C(OC(F)F)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC(SC=1)=NC=1C1CC1 ABSXFDMTOKOQBO-MDZDMXLPSA-N 0.000 claims description 3
- SHZQUNAWQAVJJZ-KPKJPENVSA-N 6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]-n-[4-(trifluoromethoxy)phenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CC1COC=1C(OC)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC1=CC=C(OC(F)(F)F)C=C1 SHZQUNAWQAVJJZ-KPKJPENVSA-N 0.000 claims description 3
- FELPHWAWJAUCAY-BQYQJAHWSA-N 6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CC1COC=1C(OC)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC1=NC(C(F)(F)F)=CS1 FELPHWAWJAUCAY-BQYQJAHWSA-N 0.000 claims description 3
- KONLPBXOQIVYIA-CMDGGOBGSA-N 6-[(e)-2-[2-cyclopentyloxy-3-(difluoromethoxy)phenyl]ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CCCC1OC=1C(OC(F)F)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC1=NC(C(F)(F)F)=CS1 KONLPBXOQIVYIA-CMDGGOBGSA-N 0.000 claims description 3
- MSIPQSOAPYZROY-BQYQJAHWSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]-n-(2,2,2-trifluoroethyl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NCC(F)(F)F)N2C=CSC2=N1 MSIPQSOAPYZROY-BQYQJAHWSA-N 0.000 claims description 3
- NOTUPWMMXIVDAK-MDZDMXLPSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]-n-(4-propan-2-yl-1,3-thiazol-2-yl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)C1=CSC(NC(=O)C=2N3C=CSC3=NC=2\C=C\C=2C(=C(OC(F)F)C=CC=2)OCC(C)(C)C)=N1 NOTUPWMMXIVDAK-MDZDMXLPSA-N 0.000 claims description 3
- HVEWWSZNDCOJAM-ZHACJKMWSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]-n-(5,6-dihydro-4h-cyclopenta[d][1,3]thiazol-2-yl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2SC=3CCCC=3N=2)N2C=CSC2=N1 HVEWWSZNDCOJAM-ZHACJKMWSA-N 0.000 claims description 3
- UUVOTZSPVFEKNH-VQHVLOKHSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]-n-(6-fluoro-1,3-benzothiazol-2-yl)imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2SC3=CC(F)=CC=C3N=2)N2C=CSC2=N1 UUVOTZSPVFEKNH-VQHVLOKHSA-N 0.000 claims description 3
- WJVGOERDXLNBJH-ZHACJKMWSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]-n-[[3-(trifluoromethyl)phenyl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NCC=2C=C(C=CC=2)C(F)(F)F)N2C=CSC2=N1 WJVGOERDXLNBJH-ZHACJKMWSA-N 0.000 claims description 3
- ZSGGLLMMFYVSFX-BQYQJAHWSA-N 6-[(e)-2-[3-methoxy-2-(2-methylpropoxy)phenyl]ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)NC=2SC=C(N=2)C(F)(F)F)=C1OCC(C)C ZSGGLLMMFYVSFX-BQYQJAHWSA-N 0.000 claims description 3
- 201000004384 Alopecia Diseases 0.000 claims description 3
- 208000019901 Anxiety disease Diseases 0.000 claims description 3
- 208000006820 Arthralgia Diseases 0.000 claims description 3
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 claims description 3
- OYPRJOBELJOOCE-BKFZFHPZSA-N Calcium-45 Chemical compound [45Ca] OYPRJOBELJOOCE-BKFZFHPZSA-N 0.000 claims description 3
- 206010058019 Cancer Pain Diseases 0.000 claims description 3
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 claims description 3
- 208000015943 Coeliac disease Diseases 0.000 claims description 3
- 208000011231 Crohn disease Diseases 0.000 claims description 3
- 206010012289 Dementia Diseases 0.000 claims description 3
- 201000004624 Dermatitis Diseases 0.000 claims description 3
- 208000032131 Diabetic Neuropathies Diseases 0.000 claims description 3
- 208000004232 Enteritis Diseases 0.000 claims description 3
- 208000018522 Gastrointestinal disease Diseases 0.000 claims description 3
- 208000023105 Huntington disease Diseases 0.000 claims description 3
- 206010061218 Inflammation Diseases 0.000 claims description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims description 3
- 208000027530 Meniere disease Diseases 0.000 claims description 3
- 208000019695 Migraine disease Diseases 0.000 claims description 3
- 208000007101 Muscle Cramp Diseases 0.000 claims description 3
- 208000001294 Nociceptive Pain Diseases 0.000 claims description 3
- 208000008589 Obesity Diseases 0.000 claims description 3
- 206010033645 Pancreatitis Diseases 0.000 claims description 3
- 208000004403 Prostatic Hyperplasia Diseases 0.000 claims description 3
- 208000017442 Retinal disease Diseases 0.000 claims description 3
- 206010038923 Retinopathy Diseases 0.000 claims description 3
- ZDFIDBBCRXNMST-UHFFFAOYSA-N S1C=2N(C=C1)C(=CN2)C(=O)N2CC=1N(CC2)C(=NN1)C(F)(F)F Chemical compound S1C=2N(C=C1)C(=CN2)C(=O)N2CC=1N(CC2)C(=NN1)C(F)(F)F ZDFIDBBCRXNMST-UHFFFAOYSA-N 0.000 claims description 3
- 208000005392 Spasm Diseases 0.000 claims description 3
- 108010062740 TRPV Cation Channels Proteins 0.000 claims description 3
- 102000011040 TRPV Cation Channels Human genes 0.000 claims description 3
- 208000009205 Tinnitus Diseases 0.000 claims description 3
- 206010060875 Uraemic pruritus Diseases 0.000 claims description 3
- 206010046543 Urinary incontinence Diseases 0.000 claims description 3
- 208000024780 Urticaria Diseases 0.000 claims description 3
- 206010047700 Vomiting Diseases 0.000 claims description 3
- OJPGXZVQULKRIG-BUHFOSPRSA-N [6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazol-5-yl]-(3,4-dihydro-2h-quinolin-1-yl)methanone Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)N2C3=CC=CC=C3CCC2)=C1OCC1CC1 OJPGXZVQULKRIG-BUHFOSPRSA-N 0.000 claims description 3
- 231100000360 alopecia Toxicity 0.000 claims description 3
- 208000006673 asthma Diseases 0.000 claims description 3
- 230000036760 body temperature Effects 0.000 claims description 3
- 230000003925 brain function Effects 0.000 claims description 3
- 206010012601 diabetes mellitus Diseases 0.000 claims description 3
- 210000001508 eye Anatomy 0.000 claims description 3
- 208000021302 gastroesophageal reflux disease Diseases 0.000 claims description 3
- 208000009326 ileitis Diseases 0.000 claims description 3
- 208000027866 inflammatory disease Diseases 0.000 claims description 3
- 230000004054 inflammatory process Effects 0.000 claims description 3
- 208000002551 irritable bowel syndrome Diseases 0.000 claims description 3
- 230000007794 irritation Effects 0.000 claims description 3
- 230000000302 ischemic effect Effects 0.000 claims description 3
- 206010027175 memory impairment Diseases 0.000 claims description 3
- 206010027599 migraine Diseases 0.000 claims description 3
- 210000004400 mucous membrane Anatomy 0.000 claims description 3
- 210000004165 myocardium Anatomy 0.000 claims description 3
- GLARRLPLBDDBOF-CMDGGOBGSA-N n-(2-cyanoethyl)-6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NCCC#N)N2C=CSC2=N1 GLARRLPLBDDBOF-CMDGGOBGSA-N 0.000 claims description 3
- CTWMFVBCEDTCQE-ZHACJKMWSA-N n-(4-cyclobutyl-1,3-thiazol-2-yl)-6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2SC=C(N=2)C2CCC2)N2C=CSC2=N1 CTWMFVBCEDTCQE-ZHACJKMWSA-N 0.000 claims description 3
- NTUFRDLXFHYONC-CMDGGOBGSA-N n-(5-cyanopyridin-2-yl)-6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2N=CC(=CC=2)C#N)N2C=CSC2=N1 NTUFRDLXFHYONC-CMDGGOBGSA-N 0.000 claims description 3
- KLPUJMXCSQYYHV-BQYQJAHWSA-N n-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2C(=CC(=CN=2)C(F)(F)F)Cl)N2C=CSC2=N1 KLPUJMXCSQYYHV-BQYQJAHWSA-N 0.000 claims description 3
- HDGPJQJLFCVOHK-OUKQBFOZSA-N n-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(=O)NC=2SC=C(N=2)C=2C=CC(=CC=2)C#N)=C1OCC(C)(C)C HDGPJQJLFCVOHK-OUKQBFOZSA-N 0.000 claims description 3
- 230000004770 neurodegeneration Effects 0.000 claims description 3
- 201000001119 neuropathy Diseases 0.000 claims description 3
- 230000007823 neuropathy Effects 0.000 claims description 3
- 235000020824 obesity Nutrition 0.000 claims description 3
- 208000033808 peripheral neuropathy Diseases 0.000 claims description 3
- 230000001823 pruritic effect Effects 0.000 claims description 3
- 208000023504 respiratory system disease Diseases 0.000 claims description 3
- 231100000886 tinnitus Toxicity 0.000 claims description 3
- 206010044652 trigeminal neuralgia Diseases 0.000 claims description 3
- 230000008673 vomiting Effects 0.000 claims description 3
- 210000003905 vulva Anatomy 0.000 claims description 3
- RLWIXOQDBILIDJ-UHFFFAOYSA-N 4-[5-(trifluoromethyl)pyridin-2-yl]piperazine-1-carbaldehyde Chemical compound N1=CC(C(F)(F)F)=CC=C1N1CCN(C=O)CC1 RLWIXOQDBILIDJ-UHFFFAOYSA-N 0.000 claims description 2
- MCOWLMHLGJJRSG-BQYQJAHWSA-N 6-[(e)-2-[2-(cyclobutylmethoxy)-3-(difluoromethoxy)phenyl]ethenyl]-n-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound C1CCC1COC=1C(OC(F)F)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)NC1=NC(C(F)(F)F)=CS1 MCOWLMHLGJJRSG-BQYQJAHWSA-N 0.000 claims description 2
- OZCTXGZFQBMDLX-CMDGGOBGSA-N 6-[4-[6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carbonyl]piperazin-1-yl]pyridine-3-carbonitrile Chemical compound C1CC1COC=1C(OC)=CC=CC=1\C=C\C=1N=C2SC=CN2C=1C(=O)N(CC1)CCN1C1=CC=C(C#N)C=N1 OZCTXGZFQBMDLX-CMDGGOBGSA-N 0.000 claims description 2
- 206010017886 Gastroduodenal ulcer Diseases 0.000 claims description 2
- 206010020649 Hyperkeratosis Diseases 0.000 claims description 2
- 208000001126 Keratosis Diseases 0.000 claims description 2
- 208000008469 Peptic Ulcer Diseases 0.000 claims description 2
- 206010039085 Rhinitis allergic Diseases 0.000 claims description 2
- 201000010105 allergic rhinitis Diseases 0.000 claims description 2
- 231100000029 gastro-duodenal ulcer Toxicity 0.000 claims description 2
- YVYVROKOAMOIBN-OUKQBFOZSA-N n-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2SC=C(N=2)C2CC2)N2C=CC=CC2=N1 YVYVROKOAMOIBN-OUKQBFOZSA-N 0.000 claims description 2
- 208000037916 non-allergic rhinitis Diseases 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 2
- 102000003568 TRPV3 Human genes 0.000 claims 2
- 101150043371 Trpv3 gene Proteins 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 206010020559 Hyperacusis Diseases 0.000 claims 1
- 206010023347 Keratoacanthoma Diseases 0.000 claims 1
- 239000012458 free base Substances 0.000 claims 1
- ZMBYQTGAXZOMOO-UHFFFAOYSA-N imidazo[1,2-a]pyridine-3-carboxamide Chemical compound C1=CC=CN2C(C(=O)N)=CN=C21 ZMBYQTGAXZOMOO-UHFFFAOYSA-N 0.000 claims 1
- 230000002265 prevention Effects 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 119
- 239000000543 intermediate Substances 0.000 description 114
- 238000000034 method Methods 0.000 description 100
- 239000007787 solid Substances 0.000 description 82
- 239000000047 product Substances 0.000 description 75
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 72
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 58
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 58
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 41
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 39
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 38
- IXWOUPGDGMCKGT-UHFFFAOYSA-N 2,3-dihydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1O IXWOUPGDGMCKGT-UHFFFAOYSA-N 0.000 description 36
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 36
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 35
- 239000002904 solvent Substances 0.000 description 31
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000002585 base Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 230000008878 coupling Effects 0.000 description 17
- 238000010168 coupling process Methods 0.000 description 17
- 238000005859 coupling reaction Methods 0.000 description 17
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- OVMGTNMCYLZGLS-UHFFFAOYSA-N 4-(trifluoromethyl)-1,3-thiazol-2-amine Chemical compound NC1=NC(C(F)(F)F)=CS1 OVMGTNMCYLZGLS-UHFFFAOYSA-N 0.000 description 14
- 229910000104 sodium hydride Inorganic materials 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000012312 sodium hydride Substances 0.000 description 10
- 125000001424 substituent group Chemical group 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 210000004027 cell Anatomy 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 108020003175 receptors Proteins 0.000 description 7
- 102000005962 receptors Human genes 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 7
- 0 C/C1=C(/*2)\C=C2/C(/CCc2c(C(*)=O)[n]c(*)n2)=C/C=C1 Chemical compound C/C1=C(/*2)\C=C2/C(/CCc2c(C(*)=O)[n]c(*)n2)=C/C=C1 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 125000002619 bicyclic group Chemical group 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 150000001721 carbon Chemical group 0.000 description 6
- 239000007822 coupling agent Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 5
- BLZVCIGGICSWIG-UHFFFAOYSA-N 2-aminoethoxydiphenylborane Chemical compound C=1C=CC=CC=1B(OCCN)C1=CC=CC=C1 BLZVCIGGICSWIG-UHFFFAOYSA-N 0.000 description 5
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 5
- 108091006146 Channels Proteins 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 235000011852 gelatine desserts Nutrition 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 108091053409 transient receptor (TC 1.A.4) family Proteins 0.000 description 5
- 102000042565 transient receptor (TC 1.A.4) family Human genes 0.000 description 5
- DDEBSQUTYSPZGA-UHFFFAOYSA-M (5-ethoxycarbonylimidazo[2,1-b][1,3]thiazol-6-yl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].N1=C2SC=CN2C(C(=O)OCC)=C1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 DDEBSQUTYSPZGA-UHFFFAOYSA-M 0.000 description 4
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- FGPNVCRMNYEMEP-UHFFFAOYSA-N 4-cyclopropyl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C2CC2)=C1 FGPNVCRMNYEMEP-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000001413 amino acids Chemical group 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 3
- KNQWMTMQTABJOV-UHFFFAOYSA-N 2-cyclopentyloxy-3-(difluoromethoxy)benzaldehyde Chemical compound FC(F)OC1=CC=CC(C=O)=C1OC1CCCC1 KNQWMTMQTABJOV-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 238000007239 Wittig reaction Methods 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 210000004379 membrane Anatomy 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- HHQJWDKIRXRTLS-UHFFFAOYSA-N n'-bromobutanediamide Chemical compound NC(=O)CCC(=O)NBr HHQJWDKIRXRTLS-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 230000002194 synthesizing effect Effects 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 2
- YXZFFTJAHVMMLF-UHFFFAOYSA-N 1-bromo-3-methylbutane Chemical compound CC(C)CCBr YXZFFTJAHVMMLF-UHFFFAOYSA-N 0.000 description 2
- DEPDDPLQZYCHOH-UHFFFAOYSA-N 1h-imidazol-2-amine Chemical compound NC1=NC=CN1 DEPDDPLQZYCHOH-UHFFFAOYSA-N 0.000 description 2
- IICDFWWJDOWCJA-VAWYXSNFSA-N 2-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylic acid Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CC=CC3=N2)C(O)=O)=C1OCC(C)(C)C IICDFWWJDOWCJA-VAWYXSNFSA-N 0.000 description 2
- RJTLQVKXLZOSLL-ZHACJKMWSA-N 2-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylic acid Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(O)=O)N2C=CC=CC2=N1 RJTLQVKXLZOSLL-ZHACJKMWSA-N 0.000 description 2
- AQONRRNROVXONL-MDZDMXLPSA-N 2-[(e)-2-[3-(difluoromethoxy)-2-(3-methylbutoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylic acid Chemical compound CC(C)CCOC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(O)=O)N2C=CC=CC2=N1 AQONRRNROVXONL-MDZDMXLPSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 2
- LUSFWEXIRSHBNN-UHFFFAOYSA-N 4-(trifluoromethyl)-1,3-oxazol-2-amine Chemical compound NC1=NC(C(F)(F)F)=CO1 LUSFWEXIRSHBNN-UHFFFAOYSA-N 0.000 description 2
- QCOWZNYRWUSFPN-UHFFFAOYSA-N 4-cyclobutyl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C2CCC2)=C1 QCOWZNYRWUSFPN-UHFFFAOYSA-N 0.000 description 2
- CUWZBHVYLVGOAB-UHFFFAOYSA-N 4-tert-butyl-1,3-thiazol-2-amine Chemical compound CC(C)(C)C1=CSC(N)=N1 CUWZBHVYLVGOAB-UHFFFAOYSA-N 0.000 description 2
- APBQBCIHZIGVGM-MDZDMXLPSA-N 6-[(e)-2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(O)=O)=C1OC1CCCC1 APBQBCIHZIGVGM-MDZDMXLPSA-N 0.000 description 2
- FFFBOKNRCBTGBB-BQYQJAHWSA-N 6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(O)=O)=C1OCC1CC1 FFFBOKNRCBTGBB-BQYQJAHWSA-N 0.000 description 2
- CKOGPVAHSLTGAI-CMDGGOBGSA-N 6-[(e)-2-[2-cyclopentyloxy-3-(difluoromethoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound N1=C2SC=CN2C(C(=O)O)=C1\C=C\C1=CC=CC(OC(F)F)=C1OC1CCCC1 CKOGPVAHSLTGAI-CMDGGOBGSA-N 0.000 description 2
- VXTGLFQIPSACSF-BQYQJAHWSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(O)=O)N2C=CSC2=N1 VXTGLFQIPSACSF-BQYQJAHWSA-N 0.000 description 2
- SYMKBOQLAWPRGG-VOTSOKGWSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-(3-methylbutoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound CC(C)CCOC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(O)=O)N2C=CSC2=N1 SYMKBOQLAWPRGG-VOTSOKGWSA-N 0.000 description 2
- PRWQTIYXQKRTJT-CMDGGOBGSA-N 6-[(e)-2-[3-(difluoromethoxy)-2-pentoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound CCCCCOC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(O)=O)N2C=CSC2=N1 PRWQTIYXQKRTJT-CMDGGOBGSA-N 0.000 description 2
- BCUCKOLNSPPDFF-BQYQJAHWSA-N 6-[(e)-2-[3-methoxy-2-(2-methylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(O)=O)=C1OCC(C)C BCUCKOLNSPPDFF-BQYQJAHWSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000005973 Carvone Substances 0.000 description 2
- 108091005462 Cation channels Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 2
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 101000633107 Homo sapiens Transient receptor potential cation channel subfamily V member 3 Proteins 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 108060008564 TRPV Proteins 0.000 description 2
- 102000003563 TRPV Human genes 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 230000003185 calcium uptake Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- NKBSVNAAVHCEMD-MDZDMXLPSA-N ethyl 2-[(e)-2-[3-(difluoromethoxy)-2-hydroxyphenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylate Chemical compound N1=C2C=CC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1O NKBSVNAAVHCEMD-MDZDMXLPSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000005241 heteroarylamino group Chemical group 0.000 description 2
- 102000052198 human TRPV3 Human genes 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012669 liquid formulation Substances 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- UVPCUABIQGQLEU-MDZDMXLPSA-N n-(4-cyclopropyl-1,3-thiazol-2-yl)-6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide Chemical compound CC(C)(C)COC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)NC=2SC=C(N=2)C2CC2)N2C=CSC2=N1 UVPCUABIQGQLEU-MDZDMXLPSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000007523 nucleic acids Chemical class 0.000 description 2
- 102000039446 nucleic acids Human genes 0.000 description 2
- 108020004707 nucleic acids Proteins 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Chemical group 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 102000038650 voltage-gated calcium channel activity Human genes 0.000 description 2
- 108091023044 voltage-gated calcium channel activity Proteins 0.000 description 2
- OTMZZGXWTKIEJF-UHFFFAOYSA-M (3-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].N1=C2C=CC=CN2C(C(=O)OCC)=C1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 OTMZZGXWTKIEJF-UHFFFAOYSA-M 0.000 description 1
- FBZRFGCSSPQVBB-UHFFFAOYSA-M (5-ethoxycarbonylimidazo[1,2-a]pyridin-2-yl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].C=1N2C(C(=O)OCC)=CC=CC2=NC=1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 FBZRFGCSSPQVBB-UHFFFAOYSA-M 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- YQEWVLFLXWNJMY-UHFFFAOYSA-N 1,3,4-oxadiazol-2-amine;1h-1,2,4-triazol-5-amine Chemical compound NC=1N=CNN=1.NC1=NN=CO1 YQEWVLFLXWNJMY-UHFFFAOYSA-N 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- JPBLHOJFMBOCAF-UHFFFAOYSA-N 1,3-benzoxazol-2-amine Chemical compound C1=CC=C2OC(N)=NC2=C1 JPBLHOJFMBOCAF-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- ACTKAGSPIFDCMF-UHFFFAOYSA-N 1,3-oxazol-2-amine Chemical compound NC1=NC=CO1 ACTKAGSPIFDCMF-UHFFFAOYSA-N 0.000 description 1
- MSSDTZLYNMFTKN-UHFFFAOYSA-N 1-Piperazinecarboxaldehyde Chemical compound O=CN1CCNCC1 MSSDTZLYNMFTKN-UHFFFAOYSA-N 0.000 description 1
- CQWYAXCOVZKLHY-UHFFFAOYSA-N 1-bromo-2,2-dimethylpropane Chemical compound CC(C)(C)CBr CQWYAXCOVZKLHY-UHFFFAOYSA-N 0.000 description 1
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical compound CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- NMIZONYLXCOHEF-UHFFFAOYSA-N 1h-imidazole-2-carboxamide Chemical class NC(=O)C1=NC=CN1 NMIZONYLXCOHEF-UHFFFAOYSA-N 0.000 description 1
- KYWMCFOWDYFYLV-UHFFFAOYSA-N 1h-imidazole-2-carboxylic acid Chemical compound OC(=O)C1=NC=CN1 KYWMCFOWDYFYLV-UHFFFAOYSA-N 0.000 description 1
- WSBSGFMROYPYPX-UHFFFAOYSA-N 2-(2,2-dimethylpropoxy)-3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1OCC(C)(C)C WSBSGFMROYPYPX-UHFFFAOYSA-N 0.000 description 1
- VBZBISQOWJYWCC-UHFFFAOYSA-N 2-(2-carboxypropan-2-yldiazenyl)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)N=NC(C)(C)C(O)=O VBZBISQOWJYWCC-UHFFFAOYSA-N 0.000 description 1
- VFWBDIPOMLBVTE-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1OCC1CC1 VFWBDIPOMLBVTE-UHFFFAOYSA-N 0.000 description 1
- JWYUFVNJZUSCSM-UHFFFAOYSA-N 2-aminobenzimidazole Chemical compound C1=CC=C2NC(N)=NC2=C1 JWYUFVNJZUSCSM-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- 150000003930 2-aminopyridines Chemical class 0.000 description 1
- APTMRLLOXPDHNL-UHFFFAOYSA-N 2-bromoethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCBr APTMRLLOXPDHNL-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- KVYXIZHHZDPYQE-UHFFFAOYSA-N 2-cyclopentyloxy-3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1OC1CCCC1 KVYXIZHHZDPYQE-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- AQCSCRYRCRORET-UHFFFAOYSA-N 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride Chemical compound Cl.C1NCCN2C(C(F)(F)F)=NN=C21 AQCSCRYRCRORET-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- LAMDDILOTVFRLH-VOTSOKGWSA-N 3-[(e)-2-phenylethenyl]imidazo[2,1-b][1,3]thiazole-2-carboxylic acid Chemical compound OC(=O)C=1SC2=NC=CN2C=1\C=C\C1=CC=CC=C1 LAMDDILOTVFRLH-VOTSOKGWSA-N 0.000 description 1
- WXNPZQIRDCDLJD-UHFFFAOYSA-N 3-chloro-5-(trifluoromethyl)pyridin-2-amine Chemical compound NC1=NC=C(C(F)(F)F)C=C1Cl WXNPZQIRDCDLJD-UHFFFAOYSA-N 0.000 description 1
- CYLWMLRTRHTPFH-UHFFFAOYSA-N 3-methoxy-2-(2-methylpropoxy)benzaldehyde Chemical compound COC1=CC=CC(C=O)=C1OCC(C)C CYLWMLRTRHTPFH-UHFFFAOYSA-N 0.000 description 1
- KKMZKOIZTSRIEM-UHFFFAOYSA-N 4-(2-amino-1,3-thiazol-4-yl)benzonitrile Chemical compound S1C(N)=NC(C=2C=CC(=CC=2)C#N)=C1 KKMZKOIZTSRIEM-UHFFFAOYSA-N 0.000 description 1
- XUJFOSLZQITUOI-UHFFFAOYSA-N 4-(trifluoromethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)F)C=C1 XUJFOSLZQITUOI-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- OUQMXTJYCAJLGO-UHFFFAOYSA-N 4-methyl-1,3-thiazol-2-amine Chemical compound CC1=CSC(N)=N1 OUQMXTJYCAJLGO-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- LGPVXXJBWWYOSL-UHFFFAOYSA-N 4-propan-2-yl-1,3-thiazol-2-amine Chemical compound CC(C)C1=CSC(N)=N1 LGPVXXJBWWYOSL-UHFFFAOYSA-N 0.000 description 1
- HUKBELGUWQLEFD-UHFFFAOYSA-N 5,6-dihydro-4h-cyclopenta[d][1,3]thiazol-2-amine Chemical compound C1CCC2=C1N=C(N)S2 HUKBELGUWQLEFD-UHFFFAOYSA-N 0.000 description 1
- QCCKBDNIBZPFCH-UHFFFAOYSA-N 5,6-dihydro-4h-cyclopenta[d][1,3]thiazole Chemical compound N1=CSC2=C1CCC2 QCCKBDNIBZPFCH-UHFFFAOYSA-N 0.000 description 1
- LTEUXHSAYOSFGQ-UHFFFAOYSA-N 5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(C(F)(F)F)S1 LTEUXHSAYOSFGQ-UHFFFAOYSA-N 0.000 description 1
- MBGFDWBCSFAVKS-CMDGGOBGSA-N 6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound COC1=CC=CC(\C=C\C2=C(N3C=CSC3=N2)C(O)=O)=C1OCC(C)(C)C MBGFDWBCSFAVKS-CMDGGOBGSA-N 0.000 description 1
- LWEUUGLVLIBMFA-BQYQJAHWSA-N 6-[(e)-2-[2-(cyclobutylmethoxy)-3-(difluoromethoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound N1=C2SC=CN2C(C(=O)O)=C1\C=C\C1=CC=CC(OC(F)F)=C1OCC1CCC1 LWEUUGLVLIBMFA-BQYQJAHWSA-N 0.000 description 1
- KDVBYUUGYXUXNL-UHFFFAOYSA-N 6-aminopyridine-3-carbonitrile Chemical compound NC1=CC=C(C#N)C=N1 KDVBYUUGYXUXNL-UHFFFAOYSA-N 0.000 description 1
- CJLUXPZQUXVJNF-UHFFFAOYSA-N 6-fluoro-1,3-benzothiazol-2-amine Chemical compound C1=C(F)C=C2SC(N)=NC2=C1 CJLUXPZQUXVJNF-UHFFFAOYSA-N 0.000 description 1
- BGSRFMFTXMPTSC-UHFFFAOYSA-N 6-fluoro-1,3-benzothiazole Chemical compound FC1=CC=C2N=CSC2=C1 BGSRFMFTXMPTSC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NCFFCKYFWJWBOR-UHFFFAOYSA-N C(C)C1=CN2C(S1)=NC(=C2)C=CC2=C(C(=CC=C2)OC(F)F)OC2CCCC2 Chemical compound C(C)C1=CN2C(S1)=NC(=C2)C=CC2=C(C(=CC=C2)OC(F)F)OC2CCCC2 NCFFCKYFWJWBOR-UHFFFAOYSA-N 0.000 description 1
- OJLSSMFICOMILU-YCPWADLHSA-N C[C@@H](N/C(/C(F)(F)F)=C\S)NC(c1c(/C=C/c(cccc2OC)c2OC2CCCC2)nc2[s]cc[n]12)=O Chemical compound C[C@@H](N/C(/C(F)(F)F)=C\S)NC(c1c(/C=C/c(cccc2OC)c2OC2CCCC2)nc2[s]cc[n]12)=O OJLSSMFICOMILU-YCPWADLHSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 208000012661 Dyskinesia Diseases 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010065390 Inflammatory pain Diseases 0.000 description 1
- 102000000589 Interleukin-1 Human genes 0.000 description 1
- 108010002352 Interleukin-1 Proteins 0.000 description 1
- 108090000862 Ion Channels Proteins 0.000 description 1
- 102000004310 Ion Channels Human genes 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 101100208031 Mus musculus Trpv3 gene Proteins 0.000 description 1
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 206010036376 Postherpetic Neuralgia Diseases 0.000 description 1
- FBESKDOFCKOHBL-UHFFFAOYSA-N S1C=2N(C=C1)C(=CN2)C(=O)NC=2SC=C(N2)C2CC2 Chemical compound S1C=2N(C=C1)C(=CN2)C(=O)NC=2SC=C(N2)C2CC2 FBESKDOFCKOHBL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000546339 Trioxys Species 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- NVSPJDGXKBDYIZ-UHFFFAOYSA-N [1,2,4]triazolo[4,3-a]pyrazine Chemical compound C1=NC=CN2C=NN=C21 NVSPJDGXKBDYIZ-UHFFFAOYSA-N 0.000 description 1
- YKNZTUQUXUXTLE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(C(F)(F)F)=C1 YKNZTUQUXUXTLE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 208000009621 actinic keratosis Diseases 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- AGSPXMVUFBBBMO-UHFFFAOYSA-N beta-aminopropionitrile Chemical compound NCCC#N AGSPXMVUFBBBMO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000004305 biphenyl Chemical group 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- FLHFTXCMKFVKRP-UHFFFAOYSA-N bromomethylcyclobutane Chemical compound BrCC1CCC1 FLHFTXCMKFVKRP-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009460 calcium influx Effects 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 125000005507 decahydroisoquinolyl group Chemical group 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 229940009976 deoxycholate Drugs 0.000 description 1
- KXGVEGMKQFWNSR-LLQZFEROSA-N deoxycholic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 KXGVEGMKQFWNSR-LLQZFEROSA-N 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- JLLFNWXHRYWYSM-UHFFFAOYSA-N ethyl 2-(bromomethyl)imidazo[1,2-a]pyridine-3-carboxylate Chemical compound C1=CC=CN2C(C(=O)OCC)=C(CBr)N=C21 JLLFNWXHRYWYSM-UHFFFAOYSA-N 0.000 description 1
- AAZAPSNAPPBNJD-BUHFOSPRSA-N ethyl 2-[(e)-2-[2-cyclopentyloxy-3-(difluoromethoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylate Chemical compound N1=C2C=CC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OC1CCCC1 AAZAPSNAPPBNJD-BUHFOSPRSA-N 0.000 description 1
- GWQJEEGGNHFKOJ-OUKQBFOZSA-N ethyl 2-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylate Chemical compound N1=C2C=CC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OCC(C)(C)C GWQJEEGGNHFKOJ-OUKQBFOZSA-N 0.000 description 1
- XYGZQUAPCRLJHV-VAWYXSNFSA-N ethyl 2-[(e)-2-[3-(difluoromethoxy)-2-(3-methylbutoxy)phenyl]ethenyl]imidazo[1,2-a]pyridine-3-carboxylate Chemical compound N1=C2C=CC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OCCC(C)C XYGZQUAPCRLJHV-VAWYXSNFSA-N 0.000 description 1
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 1
- FLAQFBICEAEEOA-UHFFFAOYSA-N ethyl 2-methylimidazo[1,2-a]pyridine-3-carboxylate Chemical compound C1=CC=CN2C(C(=O)OCC)=C(C)N=C21 FLAQFBICEAEEOA-UHFFFAOYSA-N 0.000 description 1
- RUNMRQIIEIASMK-UHFFFAOYSA-N ethyl 6-(bromomethyl)imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound S1C=CN2C(C(=O)OCC)=C(CBr)N=C21 RUNMRQIIEIASMK-UHFFFAOYSA-N 0.000 description 1
- GINAWBFBOXKCOO-VAWYXSNFSA-N ethyl 6-[(e)-2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC)=C1OC1CCCC1 GINAWBFBOXKCOO-VAWYXSNFSA-N 0.000 description 1
- NIDWYFADVHFVRZ-ZHACJKMWSA-N ethyl 6-[(e)-2-[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC)=C1OCC(C)(C)C NIDWYFADVHFVRZ-ZHACJKMWSA-N 0.000 description 1
- OHTQYUMGBHYSKO-MDZDMXLPSA-N ethyl 6-[(e)-2-[2-(cyclobutylmethoxy)-3-(difluoromethoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OCC1CCC1 OHTQYUMGBHYSKO-MDZDMXLPSA-N 0.000 description 1
- PQRTYPWETQYVPF-MDZDMXLPSA-N ethyl 6-[(e)-2-[2-(cyclopropylmethoxy)-3-methoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC)=C1OCC1CC1 PQRTYPWETQYVPF-MDZDMXLPSA-N 0.000 description 1
- XFSFCJIFGDLWBI-ZHACJKMWSA-N ethyl 6-[(e)-2-[2-cyclopentyloxy-3-(difluoromethoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OC1CCCC1 XFSFCJIFGDLWBI-ZHACJKMWSA-N 0.000 description 1
- XJBMFKJBJRZLPM-MDZDMXLPSA-N ethyl 6-[(e)-2-[3-(difluoromethoxy)-2-(2,2-dimethylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1OCC(C)(C)C XJBMFKJBJRZLPM-MDZDMXLPSA-N 0.000 description 1
- GHKKQVLQIADTPJ-VOTSOKGWSA-N ethyl 6-[(e)-2-[3-(difluoromethoxy)-2-hydroxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC(F)F)=C1O GHKKQVLQIADTPJ-VOTSOKGWSA-N 0.000 description 1
- JVRKPDAENKLSPM-ZHACJKMWSA-N ethyl 6-[(e)-2-[3-(difluoromethoxy)-2-pentoxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound CCCCCOC1=C(OC(F)F)C=CC=C1\C=C\C1=C(C(=O)OCC)N2C=CSC2=N1 JVRKPDAENKLSPM-ZHACJKMWSA-N 0.000 description 1
- YXSAGWHFUWBUQJ-MDZDMXLPSA-N ethyl 6-[(e)-2-[3-methoxy-2-(2-methylpropoxy)phenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound N1=C2SC=CN2C(C(=O)OCC)=C1\C=C\C1=CC=CC(OC)=C1OCC(C)C YXSAGWHFUWBUQJ-MDZDMXLPSA-N 0.000 description 1
- NSUFDDBQLKSSIN-UHFFFAOYSA-N ethyl 6-methylimidazo[2,1-b][1,3]thiazole-5-carboxylate Chemical compound S1C=CN2C(C(=O)OCC)=C(C)N=C21 NSUFDDBQLKSSIN-UHFFFAOYSA-N 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- ZTUJDPKOHPKRMO-UHFFFAOYSA-N hydron;2,2,2-trifluoroethanamine;chloride Chemical compound Cl.NCC(F)(F)F ZTUJDPKOHPKRMO-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical group C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 1
- DOGXPDFZEQXZDS-UHFFFAOYSA-N imidazo[1,2-a]pyridine-3-carboxylic acid Chemical compound C1=CC=CN2C(C(=O)O)=CN=C21 DOGXPDFZEQXZDS-UHFFFAOYSA-N 0.000 description 1
- ZGIABSKPSCMXFD-UHFFFAOYSA-N imidazo[2,1-b][1,3]thiazole-5-carboxylic acid Chemical compound S1C=CN2C(C(=O)O)=CN=C21 ZGIABSKPSCMXFD-UHFFFAOYSA-N 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007915 intraurethral administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 210000002510 keratinocyte Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000028161 membrane depolarization Effects 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- CRSOQBOWXPBRES-UHFFFAOYSA-N neopentane Chemical compound CC(C)(C)C CRSOQBOWXPBRES-UHFFFAOYSA-N 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000005060 octahydroindolyl group Chemical group N1(CCC2CCCCC12)* 0.000 description 1
- 125000005061 octahydroisoindolyl group Chemical group C1(NCC2CCCCC12)* 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- XFTQRUTUGRCSGO-UHFFFAOYSA-N pyrazin-2-amine Chemical compound NC1=CN=CC=N1 XFTQRUTUGRCSGO-UHFFFAOYSA-N 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 1
- OYRRZWATULMEPF-UHFFFAOYSA-N pyrimidin-4-amine Chemical compound NC1=CC=NC=N1 OYRRZWATULMEPF-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 108700021113 rat TRPV3 Proteins 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 238000007423 screening assay Methods 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 210000004927 skin cell Anatomy 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 210000003594 spinal ganglia Anatomy 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 150000004867 thiadiazoles Chemical class 0.000 description 1
- 125000006090 thiamorpholinyl sulfone group Chemical group 0.000 description 1
- 125000006089 thiamorpholinyl sulfoxide group Chemical group 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 229940100615 topical ointment Drugs 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 210000000427 trigeminal ganglion Anatomy 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Applications Claiming Priority (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IN2610/MUM/2008 | 2008-12-15 | ||
| IN2610MU2008 | 2008-12-15 | ||
| US14113308P | 2008-12-29 | 2008-12-29 | |
| US61/141,133 | 2008-12-29 | ||
| IN145MU2009 | 2009-01-22 | ||
| IN145/MUM/2009 | 2009-01-22 | ||
| US15024809P | 2009-02-05 | 2009-02-05 | |
| US61/150,248 | 2009-02-05 | ||
| IN1397MU2009 | 2009-06-10 | ||
| IN1397/MUM/2009 | 2009-06-10 | ||
| US22161509P | 2009-06-30 | 2009-06-30 | |
| US61/221,615 | 2009-06-30 | ||
| IN1730MU2009 | 2009-07-29 | ||
| IN1730/MUM/09 | 2009-07-29 | ||
| US23745609P | 2009-08-27 | 2009-08-27 | |
| US61/237,456 | 2009-08-27 | ||
| PCT/IB2009/007951 WO2010070452A1 (en) | 2008-12-15 | 2009-12-15 | Fused imidazole carboxamides as trpv3 modulators |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2012512151A JP2012512151A (ja) | 2012-05-31 |
| JP2012512151A5 true JP2012512151A5 (https=) | 2013-02-14 |
Family
ID=42241253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2011540235A Pending JP2012512151A (ja) | 2008-12-15 | 2009-12-15 | Trpv3モジュレーターとしての縮合イミダゾールカルボキサミド |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US8318928B2 (https=) |
| EP (1) | EP2367825A1 (https=) |
| JP (1) | JP2012512151A (https=) |
| AR (1) | AR076830A1 (https=) |
| AU (1) | AU2009329192A1 (https=) |
| CA (1) | CA2746077A1 (https=) |
| EA (1) | EA201190004A1 (https=) |
| GE (1) | GEP20146099B (https=) |
| MX (1) | MX2011006132A (https=) |
| NZ (1) | NZ595777A (https=) |
| TW (1) | TW201022283A (https=) |
| WO (1) | WO2010070452A1 (https=) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2009332651A1 (en) * | 2008-12-26 | 2011-12-01 | Glenmark Pharmaceuticals, S.A. | Fused imidazole derivatives as TRPV3 antagonist |
| PH12013500275A1 (en) | 2010-08-10 | 2017-08-23 | Abbvie Inc | Novel trpv3 modulators |
| WO2012072512A1 (en) * | 2010-11-29 | 2012-06-07 | Glaxo Group Limited | N-cyclobutyl-imidazopyridine or -pyrazolopyridine carboxamides as trpv1 antagonists |
| KR101834362B1 (ko) | 2011-03-18 | 2018-03-05 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | N-(3-카바모일페닐)-1h-피라졸-5-카복사미드 유도체 및 동물 해충을 구제하기 위한 그의 용도 |
| US9012651B2 (en) | 2011-03-24 | 2015-04-21 | Abbvie Inc. | TRPV3 modulators |
| JP2014510768A (ja) | 2011-04-11 | 2014-05-01 | グラクソ グループ リミテッド | Trpv1アンタゴニストとしてのn−シクロブチルイミダゾピリジンメチルアミン |
| WO2013062966A2 (en) | 2011-10-24 | 2013-05-02 | Abbvie Inc. | Novel trpv3 modulators |
| US9605002B2 (en) * | 2012-07-18 | 2017-03-28 | University Of Notre Dame Du Lac | 5,5-heteroaromatic anti-infective compounds |
| HRP20220636T1 (hr) | 2016-12-09 | 2022-07-22 | Denali Therapeutics Inc. | Spojevi korisni kao inhibitori ripk1 |
| US12030875B2 (en) | 2018-09-07 | 2024-07-09 | PIC Therapeutics, Inc. | EIF4E inhibitors and uses thereof |
| EP4096661B1 (en) | 2020-01-29 | 2025-04-02 | Kamari Pharma Ltd. | Compounds and compositions for use in treating skin disorders |
| AU2021230289A1 (en) | 2020-03-03 | 2022-09-29 | PIC Therapeutics, Inc. | eIF4E inhibitors and uses thereof |
| JP2024534127A (ja) | 2021-08-25 | 2024-09-18 | ピク セラピューティクス, インコーポレイテッド | eIF4E阻害剤及びその使用 |
| US12157732B2 (en) | 2021-08-25 | 2024-12-03 | PIC Therapeutics, Inc. | eIF4E inhibitors and uses thereof |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NO811630L (no) | 1980-05-29 | 1981-11-30 | Bayer Ag | Imidazoazolalkensyreamider, nye mellomprodukter for deres fremstilling, deres fremstilling og deres anvendelse som legemiddel |
| US5204352A (en) | 1987-09-29 | 1993-04-20 | The United States Of America As Represented By The Secretary Of The Army | Compounds exhibiting anti-parasitic activity and a method for their use |
| GB8820231D0 (en) * | 1988-08-25 | 1988-09-28 | Fujisawa Pharmaceutical Co | New benzazole compounds processes for preparation thereof & pharmaceutical composition comprising same |
| JPH02105085A (ja) | 1988-10-14 | 1990-04-17 | Komatsu Ltd | 磁気センサ |
| JPH07242666A (ja) | 1994-03-08 | 1995-09-19 | Fujisawa Pharmaceut Co Ltd | 複素環化合物 |
| WO1999051587A1 (en) | 1998-04-01 | 1999-10-14 | Ono Pharmaceutical Co., Ltd. | Fused thiophene derivatives and drugs containing the same as the active ingredient |
| US20040009537A1 (en) | 2002-01-11 | 2004-01-15 | Jack Roos | Methods of modulating and of identifying agents that modulate intracellular calcium |
| TWI372050B (en) | 2003-07-03 | 2012-09-11 | Astex Therapeutics Ltd | (morpholin-4-ylmethyl-1h-benzimidazol-2-yl)-1h-pyrazoles |
| US20060074124A1 (en) | 2003-09-12 | 2006-04-06 | Andrew Napper | Methods of treating a disorder |
| US20080145819A1 (en) | 2004-08-18 | 2008-06-19 | Robert Boettcher | Screw-in Enossal Dental Implant |
| JP2008523145A (ja) | 2004-12-13 | 2008-07-03 | イーライ リリー アンド カンパニー | リポキシゲナーゼ阻害剤としてのスピロ誘導体 |
| WO2007042906A1 (en) | 2005-10-07 | 2007-04-19 | Glenmark Pharmaceuticals S.A. | Substituted benzofused derivatives and their use as vanilloid receptor ligands |
| US7893260B2 (en) | 2005-11-04 | 2011-02-22 | Hydra Biosciences, Inc. | Substituted quinazolin-4-one compounds for antagonizing TRPV3 function |
| WO2008001101A2 (en) | 2006-06-29 | 2008-01-03 | Astex Therapeutics Limited | Pharmaceutical combinations |
| EP2049119A2 (en) | 2006-06-29 | 2009-04-22 | Astex Therapeutics Limited | Pharmaceutical combinations of 1-cyclopropyl-3-[3-(5-morphoolin-4-ylmethyl-1h-benzoimidazol-2-yl)-1h-1-pyrazol-4-yl]-urea |
| EP2049548A1 (en) | 2006-07-27 | 2009-04-22 | UCB Pharma, S.A. | Fused oxazoles & thiazoles as histamine h3- receptor ligands |
| WO2008033564A1 (en) | 2006-09-15 | 2008-03-20 | Hydra Biosciences Inc. | Compounds for modulating trpv3 function |
| EP2139894B1 (en) | 2007-03-19 | 2011-10-26 | AstraZeneca AB | 9-substituted-8-oxo-adenine compounds as toll-like receptor (tlr7) modulators |
| WO2008140750A1 (en) | 2007-05-10 | 2008-11-20 | Hydra Biosciences Inc. | Compounds for modulating trpv3 function |
-
2009
- 2009-12-11 US US12/636,213 patent/US8318928B2/en not_active Expired - Fee Related
- 2009-12-14 TW TW098142756A patent/TW201022283A/zh unknown
- 2009-12-15 MX MX2011006132A patent/MX2011006132A/es unknown
- 2009-12-15 CA CA2746077A patent/CA2746077A1/en not_active Abandoned
- 2009-12-15 AR ARP090104861A patent/AR076830A1/es not_active Application Discontinuation
- 2009-12-15 NZ NZ595777A patent/NZ595777A/xx not_active IP Right Cessation
- 2009-12-15 GE GEAP200912526A patent/GEP20146099B/en unknown
- 2009-12-15 EP EP09806128A patent/EP2367825A1/en not_active Withdrawn
- 2009-12-15 EA EA201190004A patent/EA201190004A1/ru unknown
- 2009-12-15 AU AU2009329192A patent/AU2009329192A1/en not_active Abandoned
- 2009-12-15 JP JP2011540235A patent/JP2012512151A/ja active Pending
- 2009-12-15 WO PCT/IB2009/007951 patent/WO2010070452A1/en not_active Ceased
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8318928B2 (en) | Fused imidazole carboxamides as TRPV3 modulators | |
| JP2012512151A5 (https=) | ||
| JP5461525B2 (ja) | Trpv3モジュレーターとしての縮合ピリミジノン化合物 | |
| AU2018202568B2 (en) | Heterocyclyl compounds as MEK inhibitors | |
| JP6181166B2 (ja) | ある種の2−(ピリジン−3−イル)チアゾール類の製造方法 | |
| RU2678305C1 (ru) | Производные имидазопиридина в качестве модуляторов активности tnf | |
| TW200808775A (en) | Fused phenyl amido heterocyclic compounds | |
| EP2411395A1 (en) | Furopyrimidinedione derivatives as trpa1 modulators | |
| WO2010109328A1 (en) | Isothiazolo-pyrimidinedione derivatives as trpa1 modulators | |
| JPH07267964A (ja) | 新規n−ヘテロ環状チエノチアジンカルボキシアミド、その製造方法及びその使用方法 | |
| JP2011507894A (ja) | プロリルヒドロキシラーゼ阻害剤 | |
| WO2013107283A1 (en) | Benzoheterocyclic compounds and use thereof | |
| JP2012514577A (ja) | Trpv3アンタゴニストとしての縮合イミダゾール誘導体 | |
| WO2008028118A1 (en) | 1h-indole-2-carboxylic acid derivatives useful as ppar modulators | |
| AU2023275930A1 (en) | New derivatives for treating trpm3 mediated disorders | |
| JP2025520081A (ja) | Trpm3媒介性障害を治療するためのインドリジン誘導体 | |
| KR20130042189A (ko) | Trpv3 조절제로서의 융합 이미다졸 카르복스아미드 | |
| TW201326148A (zh) | 做為trpv3拮抗劑的色烯酮衍生物 | |
| CN103159726A (zh) | 作为trpv3拮抗剂的色烯酮衍生物 | |
| TW201331193A (zh) | 做為trpv3拮抗劑的稠合咪唑衍生物 | |
| OA17133A (en) | Heterocyclyl compounds as MEK inhibitors | |
| TW201329089A (zh) | 做為trpv3調節劑的稠合嘧啶酮化合物 |