JP2006512472A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2006512472A5 JP2006512472A5 JP2005507914A JP2005507914A JP2006512472A5 JP 2006512472 A5 JP2006512472 A5 JP 2006512472A5 JP 2005507914 A JP2005507914 A JP 2005507914A JP 2005507914 A JP2005507914 A JP 2005507914A JP 2006512472 A5 JP2006512472 A5 JP 2006512472A5
- Authority
- JP
- Japan
- Prior art keywords
- nanofilm
- amphiphilic
- polymer component
- composition
- nanofilm composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002120 nanofilm Substances 0.000 claims description 577
- 229920000642 polymer Polymers 0.000 claims description 376
- 239000000203 mixture Substances 0.000 claims description 352
- 241000894007 species Species 0.000 claims description 128
- -1 polyethylene Chemical group 0.000 claims description 106
- 239000000758 substrate Substances 0.000 claims description 100
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 98
- 239000012071 phase Substances 0.000 claims description 84
- 230000035699 permeability Effects 0.000 claims description 50
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 36
- 238000001914 filtration Methods 0.000 claims description 25
- 239000007788 liquid Substances 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 25
- 239000007795 chemical reaction product Substances 0.000 claims description 21
- 230000003993 interaction Effects 0.000 claims description 21
- 150000001412 amines Chemical class 0.000 claims description 19
- 239000000178 monomer Substances 0.000 claims description 19
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 19
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 19
- 229920001451 Polypropylene glycol Polymers 0.000 claims description 17
- NIXOWILDQLNWCW-UHFFFAOYSA-M acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 150000002148 esters Chemical class 0.000 claims description 16
- 239000012530 fluid Substances 0.000 claims description 16
- 229910052740 iodine Inorganic materials 0.000 claims description 15
- 229920000515 polycarbonate Polymers 0.000 claims description 15
- 239000004417 polycarbonate Substances 0.000 claims description 15
- 229920000728 polyester Polymers 0.000 claims description 15
- QIQXTHQIDYTFRH-UHFFFAOYSA-N Stearic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 238000000576 coating method Methods 0.000 claims description 13
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 claims description 12
- HRPVXLWXLXDGHG-UHFFFAOYSA-N acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 12
- 229910052794 bromium Inorganic materials 0.000 claims description 12
- 239000011248 coating agent Substances 0.000 claims description 12
- 239000004698 Polyethylene (PE) Chemical group 0.000 claims description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N oxane Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 11
- 229920000573 polyethylene Chemical group 0.000 claims description 11
- 239000004695 Polyether sulfone Substances 0.000 claims description 10
- 239000002202 Polyethylene glycol Substances 0.000 claims description 10
- 229920001721 Polyimide Polymers 0.000 claims description 10
- 239000004642 Polyimide Substances 0.000 claims description 10
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 10
- 239000007789 gas Substances 0.000 claims description 10
- 229920002496 poly(ether sulfone) Polymers 0.000 claims description 10
- 229920001223 polyethylene glycol Polymers 0.000 claims description 10
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 10
- 239000010409 thin film Substances 0.000 claims description 10
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000002033 PVDF binder Substances 0.000 claims description 9
- 239000004952 Polyamide Substances 0.000 claims description 9
- 239000000017 hydrogel Substances 0.000 claims description 9
- 229920002647 polyamide Polymers 0.000 claims description 9
- 239000011528 polyamide (building material) Substances 0.000 claims description 9
- 229920003288 polysulfone Polymers 0.000 claims description 9
- 229920002635 polyurethane Polymers 0.000 claims description 9
- 239000004814 polyurethane Substances 0.000 claims description 9
- 239000004800 polyvinyl chloride Substances 0.000 claims description 9
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 9
- 229920002981 polyvinylidene fluoride Polymers 0.000 claims description 9
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 8
- 108010039918 Polylysine Proteins 0.000 claims description 8
- 229920001567 Vinyl ester Polymers 0.000 claims description 8
- 229920002678 cellulose Polymers 0.000 claims description 8
- 150000004676 glycans Polymers 0.000 claims description 8
- 239000007791 liquid phase Substances 0.000 claims description 8
- 229920000656 polylysine Polymers 0.000 claims description 8
- 229920001184 polypeptide Polymers 0.000 claims description 8
- 229920001282 polysaccharide Polymers 0.000 claims description 8
- 239000005017 polysaccharide Substances 0.000 claims description 8
- 150000004804 polysaccharides Polymers 0.000 claims description 8
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 8
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 8
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 8
- 239000004711 α-olefin Substances 0.000 claims description 8
- 229920000936 Agarose Polymers 0.000 claims description 7
- 235000021355 Stearic acid Nutrition 0.000 claims description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 7
- 150000001993 dienes Chemical class 0.000 claims description 7
- 150000002009 diols Chemical class 0.000 claims description 7
- 229920000058 polyacrylate Polymers 0.000 claims description 7
- 230000000379 polymerizing Effects 0.000 claims description 7
- 229920000023 polynucleotide Polymers 0.000 claims description 7
- 229920005862 polyol Polymers 0.000 claims description 7
- 150000003077 polyols Chemical class 0.000 claims description 7
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 7
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 7
- 239000011118 polyvinyl acetate Substances 0.000 claims description 7
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 7
- 239000008117 stearic acid Substances 0.000 claims description 7
- 229920002301 Cellulose acetate Polymers 0.000 claims description 6
- 239000004793 Polystyrene Substances 0.000 claims description 6
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 6
- 239000001913 cellulose Substances 0.000 claims description 6
- 229930016911 cinnamic acid Natural products 0.000 claims description 6
- 235000013985 cinnamic acid Nutrition 0.000 claims description 6
- MHZGKXUYDGKKIU-UHFFFAOYSA-N decan-1-amine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 claims description 6
- 229920000747 poly(lactic acid) polymer Polymers 0.000 claims description 6
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 6
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 6
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 6
- 229920001195 polyisoprene Polymers 0.000 claims description 6
- 239000002157 polynucleotide Substances 0.000 claims description 6
- 229920002223 polystyrene Polymers 0.000 claims description 6
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 6
- 229920000945 Amylopectin Polymers 0.000 claims description 5
- WMGFVAGNIYUEEP-WUYNJSITSA-N Amylopectin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](OC[C@@H]2[C@H]([C@H](O)[C@@H](O)[C@@H](O[C@@H]3[C@H](O[C@H](O)[C@H](O)[C@H]3O)CO)O2)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@H]1O WMGFVAGNIYUEEP-WUYNJSITSA-N 0.000 claims description 5
- 229920000856 Amylose Polymers 0.000 claims description 5
- DJHJJVWPFGHIPH-OODMECLYSA-N Chitin Chemical compound O[C@@H]1C(NC(=O)C)[C@H](O)OC(CO)[C@H]1COC[C@H]1C(NC(C)=O)[C@@H](O)[C@H](COC[C@H]2C([C@@H](O)[C@H](O)C(CO)O2)NC(C)=O)C(CO)O1 DJHJJVWPFGHIPH-OODMECLYSA-N 0.000 claims description 5
- 229920002101 Chitin Polymers 0.000 claims description 5
- 229920001661 Chitosan Polymers 0.000 claims description 5
- WQZGKKKJIJFFOK-GASJEMHNSA-N D-Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 5
- 229920002307 Dextran Polymers 0.000 claims description 5
- 229960001031 Glucose Drugs 0.000 claims description 5
- 229920002527 Glycogen Polymers 0.000 claims description 5
- BYSGBSNPRWKUQH-UJDJLXLFSA-N Glycogen Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@@H](O)[C@@H](O[C@@H]2[C@H](O[C@H](O)[C@H](O)[C@H]2O)CO)O1 BYSGBSNPRWKUQH-UJDJLXLFSA-N 0.000 claims description 5
- 229940096919 Glycogen Drugs 0.000 claims description 5
- 108090000288 Glycoproteins Proteins 0.000 claims description 5
- 102000003886 Glycoproteins Human genes 0.000 claims description 5
- 229920002683 Glycosaminoglycan Polymers 0.000 claims description 5
- 108010013639 Peptidoglycan Proteins 0.000 claims description 5
- 239000004697 Polyetherimide Substances 0.000 claims description 5
- 229920000954 Polyglycolide Polymers 0.000 claims description 5
- 229950008882 Polysorbate Drugs 0.000 claims description 5
- 108010067787 Proteoglycans Proteins 0.000 claims description 5
- 229920000320 RNA (poly(A)) Polymers 0.000 claims description 5
- 108020004412 RNA 3' Polyadenylation Signals Proteins 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 5
- 150000001720 carbohydrates Chemical class 0.000 claims description 5
- 239000008103 glucose Substances 0.000 claims description 5
- 229920000554 ionomer Polymers 0.000 claims description 5
- 230000001404 mediated Effects 0.000 claims description 5
- 229920000141 poly(maleic anhydride) Polymers 0.000 claims description 5
- 229920002401 polyacrylamide Polymers 0.000 claims description 5
- 229920001601 polyetherimide Polymers 0.000 claims description 5
- 239000004633 polyglycolic acid Substances 0.000 claims description 5
- 239000004626 polylactic acid Substances 0.000 claims description 5
- 229920000136 polysorbate Polymers 0.000 claims description 5
- WQZGKKKJIJFFOK-VFUOTHLCSA-N β-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 5
- 102100001249 ALB Human genes 0.000 claims description 4
- 101710027066 ALB Proteins 0.000 claims description 4
- 229940050528 albumin Drugs 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 150000003949 imides Chemical class 0.000 claims description 4
- 239000004615 ingredient Substances 0.000 claims description 4
- FZWBNHMXJMCXLU-BLAUPYHCSA-N isomaltotriose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)O1 FZWBNHMXJMCXLU-BLAUPYHCSA-N 0.000 claims description 4
- 108020004707 nucleic acids Proteins 0.000 claims description 4
- 150000007523 nucleic acids Chemical class 0.000 claims description 4
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 229940109239 Creatinine Drugs 0.000 claims description 3
- 229940092253 Ovalbumin Drugs 0.000 claims description 3
- 108010058846 Ovalbumin Proteins 0.000 claims description 3
- 238000005266 casting Methods 0.000 claims description 3
- DDRJAANPRJIHGJ-UHFFFAOYSA-N creatinine Chemical compound CN1CC(=O)NC1=N DDRJAANPRJIHGJ-UHFFFAOYSA-N 0.000 claims description 3
- 238000003618 dip coating Methods 0.000 claims description 3
- 238000009713 electroplating Methods 0.000 claims description 3
- 239000010954 inorganic particle Substances 0.000 claims description 3
- 238000004528 spin coating Methods 0.000 claims description 3
- 238000005507 spraying Methods 0.000 claims description 3
- 229940027941 Immunoglobulin G Drugs 0.000 claims description 2
- 102000004851 Immunoglobulin G Human genes 0.000 claims description 2
- 108090001095 Immunoglobulin G Proteins 0.000 claims description 2
- 102000036913 Myoglobin Human genes 0.000 claims description 2
- 108010062374 Myoglobin Proteins 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 claims description 2
- 239000007863 gel particle Substances 0.000 claims description 2
- 239000001307 helium Substances 0.000 claims description 2
- 229910052734 helium Inorganic materials 0.000 claims description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium(0) Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-L phosphate Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 claims description 2
- 230000003612 virological Effects 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 description 148
- 239000000243 solution Substances 0.000 description 115
- 238000005859 coupling reaction Methods 0.000 description 105
- 230000001808 coupling Effects 0.000 description 100
- 238000010168 coupling process Methods 0.000 description 100
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 89
- 239000011148 porous material Substances 0.000 description 89
- 229910052739 hydrogen Inorganic materials 0.000 description 73
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 70
- 125000005647 linker group Chemical group 0.000 description 60
- 239000010408 film Substances 0.000 description 55
- 125000000217 alkyl group Chemical group 0.000 description 52
- 239000001257 hydrogen Substances 0.000 description 52
- 239000012528 membrane Substances 0.000 description 51
- 125000004122 cyclic group Chemical group 0.000 description 49
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- 239000002904 solvent Substances 0.000 description 46
- 150000002678 macrocyclic compounds Chemical class 0.000 description 45
- 125000004429 atoms Chemical group 0.000 description 37
- 239000010410 layer Substances 0.000 description 35
- 235000019439 ethyl acetate Nutrition 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 34
- 239000007787 solid Substances 0.000 description 34
- 125000003118 aryl group Chemical group 0.000 description 31
- TWUQXVGHXWRUBR-UHFFFAOYSA-N diethyl propanediimidate;dihydrochloride Chemical compound Cl.Cl.CCOC(=N)CC(=N)OCC TWUQXVGHXWRUBR-UHFFFAOYSA-N 0.000 description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 30
- 239000002253 acid Substances 0.000 description 29
- 125000000753 cycloalkyl group Chemical group 0.000 description 27
- 238000002360 preparation method Methods 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- 125000001424 substituent group Chemical group 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 25
- 239000004215 Carbon black (E152) Substances 0.000 description 24
- 229910052757 nitrogen Inorganic materials 0.000 description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- 230000015572 biosynthetic process Effects 0.000 description 23
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 22
- 229910052799 carbon Inorganic materials 0.000 description 22
- 229910052710 silicon Inorganic materials 0.000 description 22
- 229910052717 sulfur Inorganic materials 0.000 description 22
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-Aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 21
- 238000005755 formation reaction Methods 0.000 description 21
- 229910052760 oxygen Inorganic materials 0.000 description 21
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 20
- 239000000126 substance Substances 0.000 description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 20
- 229910052736 halogen Inorganic materials 0.000 description 19
- 229910052751 metal Inorganic materials 0.000 description 19
- 239000002184 metal Substances 0.000 description 19
- 230000002829 reduced Effects 0.000 description 19
- 229910004298 SiO 2 Inorganic materials 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 239000000463 material Substances 0.000 description 18
- WQDUMFSSJAZKTM-UHFFFAOYSA-N sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 229910052698 phosphorus Inorganic materials 0.000 description 17
- 150000002367 halogens Chemical class 0.000 description 16
- 239000012044 organic layer Substances 0.000 description 16
- 238000000926 separation method Methods 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- 239000011780 sodium chloride Substances 0.000 description 16
- 229910052782 aluminium Inorganic materials 0.000 description 15
- 229910052796 boron Inorganic materials 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 150000001340 alkali metals Chemical class 0.000 description 14
- 150000001342 alkaline earth metals Chemical group 0.000 description 14
- 125000003277 amino group Chemical class 0.000 description 14
- 125000001072 heteroaryl group Chemical group 0.000 description 14
- 229920002454 poly(glycidyl methacrylate) polymer Polymers 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- REYJJPSVUYRZGE-UHFFFAOYSA-N stearylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 13
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 13
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 13
- LOUPRKONTZGTKE-LHHVKLHASA-N Quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 12
- 230000000295 complement Effects 0.000 description 12
- 239000008079 hexane Substances 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- 238000004483 ATR-FTIR spectroscopy Methods 0.000 description 11
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 11
- 229910052786 argon Inorganic materials 0.000 description 11
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 11
- 150000002500 ions Chemical class 0.000 description 11
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 238000001228 spectrum Methods 0.000 description 11
- 238000003860 storage Methods 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 229910052783 alkali metal Inorganic materials 0.000 description 10
- 238000000089 atomic force micrograph Methods 0.000 description 10
- 125000004432 carbon atoms Chemical group C* 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 10
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical compound C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 10
- 229920003250 poly(2-hydroxyethyl methacrylate) Polymers 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- WOBHKFSMXKNTIM-UHFFFAOYSA-N 2-hydroxyethyl 2-methylacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 9
- 230000037250 Clearance Effects 0.000 description 9
- MKRTXPORKIRPDG-UHFFFAOYSA-N Diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 125000001931 aliphatic group Chemical group 0.000 description 9
- 125000003545 alkoxy group Chemical group 0.000 description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 9
- 230000035512 clearance Effects 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 9
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 9
- 125000000623 heterocyclic group Chemical group 0.000 description 9
- PIICEJLVQHRZGT-UHFFFAOYSA-N 1,2-ethanediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- 238000007792 addition Methods 0.000 description 8
- 150000008064 anhydrides Chemical class 0.000 description 8
- LKYXEULZVGJVTG-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH] LKYXEULZVGJVTG-UHFFFAOYSA-N 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 description 8
- 230000002209 hydrophobic Effects 0.000 description 8
- 150000002739 metals Chemical class 0.000 description 8
- 238000000324 molecular mechanic Methods 0.000 description 8
- IMNFDUFMRHMDMM-UHFFFAOYSA-N n-heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 238000000518 rheometry Methods 0.000 description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 230000000875 corresponding Effects 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 150000002466 imines Chemical class 0.000 description 7
- 239000010703 silicon Substances 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- 125000003107 substituted aryl group Chemical group 0.000 description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000002835 absorbance Methods 0.000 description 6
- 238000000572 ellipsometry Methods 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 238000005259 measurement Methods 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 125000003367 polycyclic group Chemical group 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 229960001404 quinidine Drugs 0.000 description 6
- 238000000527 sonication Methods 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- ZLTWIJREHQCJJL-UHFFFAOYSA-N 1-trimethylsilylethanol Chemical compound CC(O)[Si](C)(C)C ZLTWIJREHQCJJL-UHFFFAOYSA-N 0.000 description 5
- ZNGINKJHQQQORD-UHFFFAOYSA-N 2-trimethylsilylethanol Chemical compound C[Si](C)(C)CCO ZNGINKJHQQQORD-UHFFFAOYSA-N 0.000 description 5
- 229920002873 Polyethylenimine Polymers 0.000 description 5
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 238000010511 deprotection reaction Methods 0.000 description 5
- 150000004985 diamines Chemical class 0.000 description 5
- 238000007598 dipping method Methods 0.000 description 5
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 5
- 125000001165 hydrophobic group Chemical group 0.000 description 5
- 230000000670 limiting Effects 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 230000037361 pathway Effects 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 230000001105 regulatory Effects 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 238000007142 ring opening reaction Methods 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 125000000547 substituted alkyl group Chemical group 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 230000002194 synthesizing Effects 0.000 description 5
- AGEZXYOZHKGVCM-UHFFFAOYSA-N Benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- ORTQZVOHEJQUHG-UHFFFAOYSA-L Copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N Di-tert-butyl dicarbonate Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M Lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N P-Toluenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 4
- 210000002381 Plasma Anatomy 0.000 description 4
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M Tetra-n-butylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 239000000539 dimer Substances 0.000 description 4
- 238000006345 epimerization reaction Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical group O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 125000005842 heteroatoms Chemical group 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 238000011065 in-situ storage Methods 0.000 description 4
- 230000000977 initiatory Effects 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 238000005580 one pot reaction Methods 0.000 description 4
- 125000000962 organic group Chemical group 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 239000002831 pharmacologic agent Substances 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 229920001308 poly(aminoacid) Polymers 0.000 description 4
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Substances [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 238000002390 rotary evaporation Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 238000007127 saponification reaction Methods 0.000 description 4
- 238000001878 scanning electron micrograph Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- SSJXIUAHEKJCMH-PHDIDXHHSA-N (1R,2R)-cyclohexane-1,2-diamine Chemical compound N[C@@H]1CCCC[C@H]1N SSJXIUAHEKJCMH-PHDIDXHHSA-N 0.000 description 3
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 3
- OEHFPZMUTXRLFE-UHFFFAOYSA-N 5-bromo-2-hydroxybenzene-1,3-dicarbaldehyde Chemical compound OC1=C(C=O)C=C(Br)C=C1C=O OEHFPZMUTXRLFE-UHFFFAOYSA-N 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N AI2O3 Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 230000036849 Clc Effects 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N Maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N Methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- JFNLZVQOOSMTJK-UHFFFAOYSA-N Norbornene Chemical compound C1C2CCC1C=C2 JFNLZVQOOSMTJK-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O Pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 229920001400 block copolymer Polymers 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- UGFAIRIUMAVXCW-UHFFFAOYSA-N carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 230000003197 catalytic Effects 0.000 description 3
- 239000000919 ceramic Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 230000003247 decreasing Effects 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000002848 electrochemical method Methods 0.000 description 3
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000006011 modification reaction Methods 0.000 description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 3
- 229940113083 morpholine Drugs 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 238000009832 plasma treatment Methods 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- KAESVJOAVNADME-UHFFFAOYSA-N pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000000717 retained Effects 0.000 description 3
- 150000003384 small molecules Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- WGGHTQJCLFQFTA-UHFFFAOYSA-N 1,2,3,3a,4,5-hexahydropentalene Chemical compound C1CC=C2CCCC21 WGGHTQJCLFQFTA-UHFFFAOYSA-N 0.000 description 2
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N 1,3-Cyclohexadiene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- DUXAVVSOUJIVFH-UHFFFAOYSA-N 1,3-diazabicyclo[2.2.1]heptane Chemical compound C1NC2CCN1C2 DUXAVVSOUJIVFH-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- ROFVEXUMMXZLPA-UHFFFAOYSA-N 2,2'-bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-Vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- JDXRCXYIZIUIKX-UHFFFAOYSA-N 3,5-diethyloxolan-2-one Chemical compound CCC1CC(CC)C(=O)O1 JDXRCXYIZIUIKX-UHFFFAOYSA-N 0.000 description 2
- VUIOWOPNGDTWES-UHFFFAOYSA-N 5-dodec-1-ynyl-2-hydroxybenzene-1,3-dicarbonyl chloride Chemical compound CCCCCCCCCCC#CC1=CC(C(Cl)=O)=C(O)C(C(Cl)=O)=C1 VUIOWOPNGDTWES-UHFFFAOYSA-N 0.000 description 2
- SNZSSCZJMVIOCR-UHFFFAOYSA-N 7-azabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1N2 SNZSSCZJMVIOCR-UHFFFAOYSA-N 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N Adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N Allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- MSHFRERJPWKJFX-UHFFFAOYSA-N Anisyl alcohol Chemical group COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N Anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N Benzophenone Chemical group C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 235000001258 Cinchona calisaya Nutrition 0.000 description 2
- 241000434299 Cinchona officinalis Species 0.000 description 2
- 239000004971 Cross linker Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N Cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N Cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N Cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N Decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N Diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N Itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 239000000232 Lipid Bilayer Substances 0.000 description 2
- 238000006683 Mannich reaction Methods 0.000 description 2
- 229920002367 Polyisobutene Polymers 0.000 description 2
- 102000016611 Proteoglycans Human genes 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N Pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N Pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 229960000948 Quinine Drugs 0.000 description 2
- SBYHFKPVCBCYGV-UHFFFAOYSA-N Quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 2
- 238000004639 Schlenk technique Methods 0.000 description 2
- 229920005654 Sephadex Polymers 0.000 description 2
- 239000012507 Sephadex™ Substances 0.000 description 2
- 229920002684 Sepharose Polymers 0.000 description 2
- 210000002832 Shoulder Anatomy 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N Silver nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N Silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L Sodium thiosulphate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N THP Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- 230000036526 Transport Rate Effects 0.000 description 2
- NGDCLPXRKSWRPY-UHFFFAOYSA-N Triptycene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C1C1=CC=CC=C12 NGDCLPXRKSWRPY-UHFFFAOYSA-N 0.000 description 2
- 239000003875 Wang resin Substances 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N [N-]=C=O Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 150000003926 acrylamides Chemical class 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical compound C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 description 2
- UTODCSRVEOLXKS-UHFFFAOYSA-N bicyclo[3.2.2]non-4-ene Chemical compound C1CC(CC2)CCC2=C1 UTODCSRVEOLXKS-UHFFFAOYSA-N 0.000 description 2
- GNTFBMAGLFYMMZ-UHFFFAOYSA-N bicyclo[3.2.2]nonane Chemical compound C1CC2CCC1CCC2 GNTFBMAGLFYMMZ-UHFFFAOYSA-N 0.000 description 2
- SIVKZPBURVINMX-UHFFFAOYSA-N bicyclo[3.3.1]non-4-ene Chemical compound C1CC=C2CCCC1C2 SIVKZPBURVINMX-UHFFFAOYSA-N 0.000 description 2
- WNTGVOIBBXFMLR-UHFFFAOYSA-N bicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1C2 WNTGVOIBBXFMLR-UHFFFAOYSA-N 0.000 description 2
- ZUDPATVLKVXKSZ-UHFFFAOYSA-N bicyclo[4.2.2]decane Chemical compound C1CC2CCC1CCCC2 ZUDPATVLKVXKSZ-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 150000001733 carboxylic acid esters Chemical group 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- 238000001212 derivatisation Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 125000003700 epoxy group Chemical class 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- FFLYUXVZEPLMCL-UHFFFAOYSA-N ethylchloranuidyl formate Chemical compound CC[Cl-]OC=O FFLYUXVZEPLMCL-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229920000578 graft polymer Polymers 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-O guanidinium Chemical compound NC(N)=[NH2+] ZRALSGWEFCBTJO-UHFFFAOYSA-O 0.000 description 2
- 229920000140 heteropolymer Polymers 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 125000000879 imine group Chemical group 0.000 description 2
- 238000010952 in-situ formation Methods 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 229910003480 inorganic solid Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- HUEBIMLTDXKIPR-UHFFFAOYSA-N methyl heptadecanoate Chemical compound CCCCCCCCCCCCCCCCC(=O)OC HUEBIMLTDXKIPR-UHFFFAOYSA-N 0.000 description 2
- 238000001471 micro-filtration Methods 0.000 description 2
- 239000002052 molecular layer Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 230000036961 partial Effects 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000011574 phosphorus Chemical group 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000767 polyaniline Polymers 0.000 description 2
- 229920001610 polycaprolactone Polymers 0.000 description 2
- 239000004632 polycaprolactone Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 229920005604 random copolymer Polymers 0.000 description 2
- 230000036159 relative stability Effects 0.000 description 2
- 230000002441 reversible Effects 0.000 description 2
- 238000007152 ring opening metathesis polymerisation reaction Methods 0.000 description 2
- 230000000630 rising Effects 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- PHICBFWUYUCFKS-UHFFFAOYSA-N spiro[4.4]nonane Chemical compound C1CCCC21CCCC2 PHICBFWUYUCFKS-UHFFFAOYSA-N 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- 230000000707 stereoselective Effects 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 238000004642 transportation engineering Methods 0.000 description 2
- 125000005580 triphenylene group Chemical group 0.000 description 2
- 238000000108 ultra-filtration Methods 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 229920003169 water-soluble polymer Polymers 0.000 description 2
- MYYLMIDEMAPSGH-RQJHMYQMSA-N (1R,6S)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid Chemical compound COC(=O)[C@H]1CC=CC[C@H]1C(O)=O MYYLMIDEMAPSGH-RQJHMYQMSA-N 0.000 description 1
- SSJXIUAHEKJCMH-WDSKDSINSA-N (1S,2S)-cyclohexane-1,2-diamine Chemical compound N[C@H]1CCCC[C@@H]1N SSJXIUAHEKJCMH-WDSKDSINSA-N 0.000 description 1
- MEXAGTSTSPYCEP-JEDNCBNOSA-N (2S)-2,6-diaminohexanoic acid;hydrobromide Chemical compound Br.NCCCC[C@H](N)C(O)=O MEXAGTSTSPYCEP-JEDNCBNOSA-N 0.000 description 1
- VENMDXUVHSKEIN-UTLUCORTSA-N (2S)-2-[[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(N)=NCCC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(O)=O VENMDXUVHSKEIN-UTLUCORTSA-N 0.000 description 1
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 1
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-Dichloroethene Chemical compound ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- AEBWATHAIVJLTA-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydropentalene Chemical compound C1CCC2CCCC21 AEBWATHAIVJLTA-UHFFFAOYSA-N 0.000 description 1
- KOMNUTZXSVSERR-UHFFFAOYSA-N 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione Chemical compound C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O KOMNUTZXSVSERR-UHFFFAOYSA-N 0.000 description 1
- GWYPDXLJACEENP-UHFFFAOYSA-N 1,3-Cycloheptadiene Chemical compound C1CC=CC=CC1 GWYPDXLJACEENP-UHFFFAOYSA-N 0.000 description 1
- QYCGBAJADAGLLK-UHFFFAOYSA-N 1-(cyclohepten-1-yl)cycloheptene Chemical compound C1CCCCC=C1C1=CCCCCC1 QYCGBAJADAGLLK-UHFFFAOYSA-N 0.000 description 1
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1-Dodecene Chemical compound CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 1
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 description 1
- DQJSFBCVEPQRLA-UHFFFAOYSA-N 1-methoxyethyl prop-2-enoate Chemical compound COC(C)OC(=O)C=C DQJSFBCVEPQRLA-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-tris(prop-2-enoxy)-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 description 1
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 1
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Acrylamido-2-methylpropane sulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 1
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 description 1
- SEFYJVFBMNOLBK-UHFFFAOYSA-N 2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane Chemical group C1OC1COCCOCCOCC1CO1 SEFYJVFBMNOLBK-UHFFFAOYSA-N 0.000 description 1
- MLMGJTAJUDSUKA-UHFFFAOYSA-N 2-ethenyl-1H-imidazole Chemical compound C=CC1=NC=CN1 MLMGJTAJUDSUKA-UHFFFAOYSA-N 0.000 description 1
- IGDLZDCWMRPMGL-UHFFFAOYSA-N 2-ethenylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(C=C)C(=O)C2=C1 IGDLZDCWMRPMGL-UHFFFAOYSA-N 0.000 description 1
- OMMMFIJGPKOCGG-UHFFFAOYSA-N 2-ethenyloctadecanoic acid Chemical compound CCCCCCCCCCCCCCCCC(C=C)C(O)=O OMMMFIJGPKOCGG-UHFFFAOYSA-N 0.000 description 1
- ZBOUXALQDLLARY-UHFFFAOYSA-N 2-hydroxy-5-methylbenzene-1,3-dicarbaldehyde Chemical compound CC1=CC(C=O)=C(O)C(C=O)=C1 ZBOUXALQDLLARY-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N 2-methyl-2-propenoic acid methyl ester Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- XEEYSDHEOQHCDA-UHFFFAOYSA-N 2-methylprop-2-ene-1-sulfonic acid Chemical compound CC(=C)CS(O)(=O)=O XEEYSDHEOQHCDA-UHFFFAOYSA-N 0.000 description 1
- 125000004352 2-phenylcyclohexyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- QWYTUBPAXJYCTH-UHFFFAOYSA-N 2-trimethylsilylethyl carbamate Chemical compound C[Si](C)(C)CCOC(N)=O QWYTUBPAXJYCTH-UHFFFAOYSA-N 0.000 description 1
- KFNGWPXYNSJXOP-UHFFFAOYSA-N 3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid Chemical compound CC(=C)C(=O)OCCCS(O)(=O)=O KFNGWPXYNSJXOP-UHFFFAOYSA-N 0.000 description 1
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N 3-Methyl-3-buten-2-one Chemical compound CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 description 1
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 1
- KBQVDAIIQCXKPI-UHFFFAOYSA-N 3-trimethoxysilylpropyl prop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C=C KBQVDAIIQCXKPI-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- PLBFWWFJXYCJDJ-UHFFFAOYSA-N 5-dodec-1-ynyl-2-hydroxybenzene-1,3-dicarbaldehyde Chemical compound CCCCCCCCCCC#CC1=CC(C=O)=C(O)C(C=O)=C1 PLBFWWFJXYCJDJ-UHFFFAOYSA-N 0.000 description 1
- JXYJKUBIBLOFRL-UHFFFAOYSA-N 5-dodecyl-2-methoxybenzene-1,3-dicarbaldehyde Chemical compound CCCCCCCCCCCCC1=CC(C=O)=C(OC)C(C=O)=C1 JXYJKUBIBLOFRL-UHFFFAOYSA-N 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N Acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- BTFJIXJJCSYFAL-UHFFFAOYSA-N Arachidyl alcohol Chemical compound CCCCCCCCCCCCCCCCCCCCO BTFJIXJJCSYFAL-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- NFBUTRVXMNWISH-UHFFFAOYSA-N C1(CCCCCC1)C1CCCCCC1.C12CCC(CC1)C2 Chemical compound C1(CCCCCC1)C1CCCCCC1.C12CCC(CC1)C2 NFBUTRVXMNWISH-UHFFFAOYSA-N 0.000 description 1
- NSOMUJIDZLDEOD-UHFFFAOYSA-N CC(O)[SiH3] Chemical compound CC(O)[SiH3] NSOMUJIDZLDEOD-UHFFFAOYSA-N 0.000 description 1
- AIYUHDOJVYHVIT-UHFFFAOYSA-M Caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 1
- 241000252506 Characiformes Species 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N Cycloheptane Chemical compound C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- CHVJITGCYZJHLR-UHFFFAOYSA-N Cycloheptatriene Chemical compound C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 1
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N Cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 1
- LHNSMWDERKGLJK-UHFFFAOYSA-N Cycloocta-1,3,6-triene Chemical compound C1C=CCC=CC=C1 LHNSMWDERKGLJK-UHFFFAOYSA-N 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N Cyclooctane Chemical compound C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- KDUIUFJBNGTBMD-VXMYFEMYSA-N Cyclooctatetraene Chemical compound C1=C\C=C/C=C\C=C1 KDUIUFJBNGTBMD-VXMYFEMYSA-N 0.000 description 1
- 238000006117 Diels-Alder cycloaddition reaction Methods 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M Diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- OVBJJZOQPCKUOR-UHFFFAOYSA-L EDTA disodium salt dihydrate Chemical compound O.O.[Na+].[Na+].[O-]C(=O)C[NH+](CC([O-])=O)CC[NH+](CC([O-])=O)CC([O-])=O OVBJJZOQPCKUOR-UHFFFAOYSA-L 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 230000036826 Excretion Effects 0.000 description 1
- QEWYKACRFQMRMB-UHFFFAOYSA-N Fluoroacetic acid Chemical class OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 1
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N Guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N Hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 229940021015 I.V. solution additive Amino Acids Drugs 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- 229920000106 Liquid crystal polymer Polymers 0.000 description 1
- 239000004977 Liquid-crystal polymers (LCPs) Substances 0.000 description 1
- 210000004185 Liver Anatomy 0.000 description 1
- 229920002521 Macromolecule Polymers 0.000 description 1
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N Methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N Methyl vinyl ketone Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N N',N'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N N-Vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinylpyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CNWVYEGPPMQTKA-UHFFFAOYSA-N N-octadecylprop-2-enamide Chemical compound CCCCCCCCCCCCCCCCCCNC(=O)C=C CNWVYEGPPMQTKA-UHFFFAOYSA-N 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M N-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- CHWKGJOTGCSFNF-UHFFFAOYSA-N Norbornene anhydride Chemical compound C1CC2C3C(=O)OC(=O)C3=C1C2 CHWKGJOTGCSFNF-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 210000003463 Organelles Anatomy 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L Palladium(II) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- KJFMBFZCATUALV-UHFFFAOYSA-N Phenolphthalein Chemical group C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N Phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N Phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N Potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N Propadiene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- VACCAVUAMIDAGB-UHFFFAOYSA-N Sulfamethizole Chemical compound S1C(C)=NN=C1NS(=O)(=O)C1=CC=C(N)C=C1 VACCAVUAMIDAGB-UHFFFAOYSA-N 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical class NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N TFA trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M Tetra-n-butylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N Tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 229920002725 Thermoplastic elastomer Polymers 0.000 description 1
- 231100000765 Toxin Toxicity 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N Tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N Triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N Trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N Vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N Vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- SBYMUDUGTIKLCR-VOTSOKGWSA-N [(E)-2-chloroethenyl]benzene Chemical compound Cl\C=C\C1=CC=CC=C1 SBYMUDUGTIKLCR-VOTSOKGWSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 238000010976 amide bond formation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 238000005102 attenuated total reflection Methods 0.000 description 1
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- AWTFUQLMGOBAHA-JHJVBQTASA-N benzyl N-[(1R,4S,6R)-4,6-diaminocyclohex-2-en-1-yl]carbamate Chemical compound C1=C[C@@H](N)C[C@@H](N)[C@@H]1NC(=O)OCC1=CC=CC=C1 AWTFUQLMGOBAHA-JHJVBQTASA-N 0.000 description 1
- XMSVKICKONKVNM-UHFFFAOYSA-N bicyclo[2.2.1]heptane-3,4-diamine Chemical compound C1CC2(N)C(N)CC1C2 XMSVKICKONKVNM-UHFFFAOYSA-N 0.000 description 1
- VIQRCOQXIHFJND-UHFFFAOYSA-N bicyclo[2.2.2]oct-2-ene Chemical compound C1CC2CCC1C=C2 VIQRCOQXIHFJND-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional Effects 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 1
- 229960002685 biotin Drugs 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- 239000011616 biotin Substances 0.000 description 1
- 230000000903 blocking Effects 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000010722 bromolactonization reaction Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- SOGAXMICEFXMKE-UHFFFAOYSA-N butyl 2-methylprop-2-enoate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 210000004027 cells Anatomy 0.000 description 1
- 229940098124 cesium chloride Drugs 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000005495 cold plasma Effects 0.000 description 1
- 230000000536 complexating Effects 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 230000002153 concerted Effects 0.000 description 1
- 229920001940 conductive polymer Polymers 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000005712 crystallization Effects 0.000 description 1
- 238000010192 crystallographic characterization Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ARUKYTASOALXFG-UHFFFAOYSA-N cycloheptylcycloheptane Chemical compound C1CCCCCC1C1CCCCCC1 ARUKYTASOALXFG-UHFFFAOYSA-N 0.000 description 1
- CRMAYNAXFWKCHJ-UHFFFAOYSA-N cyclohex-4-ene-1,3-diamine Chemical compound NC1CC=CC(N)C1 CRMAYNAXFWKCHJ-UHFFFAOYSA-N 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- PFURGBBHAOXLIO-UHFFFAOYSA-N cyclohexane-1,2-diol Chemical compound OC1CCCCC1O PFURGBBHAOXLIO-UHFFFAOYSA-N 0.000 description 1
- GEQHKFFSPGPGLN-UHFFFAOYSA-N cyclohexane-1,3-diamine Chemical compound NC1CCCC(N)C1 GEQHKFFSPGPGLN-UHFFFAOYSA-N 0.000 description 1
- 150000001934 cyclohexanes Chemical class 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- OIWOHHBRDFKZNC-UHFFFAOYSA-N cyclohexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1CCCCC1 OIWOHHBRDFKZNC-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KBLWLMPSVYBVDK-UHFFFAOYSA-N cyclohexyl prop-2-enoate Chemical compound C=CC(=O)OC1CCCCC1 KBLWLMPSVYBVDK-UHFFFAOYSA-N 0.000 description 1
- BMFYCFSWWDXEPB-UHFFFAOYSA-N cyclohexyl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1CCCCC1 BMFYCFSWWDXEPB-UHFFFAOYSA-N 0.000 description 1
- RRKODOZNUZCUBN-UHFFFAOYSA-N cycloocta-1,3-diene Chemical compound C1CCC=CC=CC1 RRKODOZNUZCUBN-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- URYYVOIYTNXXBN-UHFFFAOYSA-N cyclooctene Chemical compound [CH]1[CH]CCCCCC1 URYYVOIYTNXXBN-UHFFFAOYSA-N 0.000 description 1
- 239000004913 cyclooctene Substances 0.000 description 1
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 1
- VMFHCJPMKUTMMQ-UHFFFAOYSA-N cyclopenta-2,4-dien-1-yl(trimethyl)silane Chemical compound C[Si](C)(C)C1C=CC=C1 VMFHCJPMKUTMMQ-UHFFFAOYSA-N 0.000 description 1
- DHVIVNRYFOAZFF-UHFFFAOYSA-N cyclopenta-2,4-dien-1-ylmethoxymethylbenzene Chemical compound C1=CC=CC1COCC1=CC=CC=C1 DHVIVNRYFOAZFF-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 230000003111 delayed Effects 0.000 description 1
- 239000000412 dendrimer Substances 0.000 description 1
- 229920000736 dendritic polymer Polymers 0.000 description 1
- 238000010612 desalination reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 125000002897 diene group Chemical group 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- DRXGWTUAIWQOKN-UHFFFAOYSA-L dihydroxy(dioxo)molybdenum;phosphonic acid Chemical compound OP(O)=O.O[Mo](O)(=O)=O DRXGWTUAIWQOKN-UHFFFAOYSA-L 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- KZHJGOXRZJKJNY-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Si]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O KZHJGOXRZJKJNY-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000000909 electrodialysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002708 enhancing Effects 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- HPTMZNZYFRTOKS-UHFFFAOYSA-N ethenesulfinic acid Chemical compound OS(=O)C=C HPTMZNZYFRTOKS-UHFFFAOYSA-N 0.000 description 1
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 1
- HDSFLVZBTRAEEM-UHFFFAOYSA-N ethenyl 2,2,2-trichloroacetate Chemical compound ClC(Cl)(Cl)C(=O)OC=C HDSFLVZBTRAEEM-UHFFFAOYSA-N 0.000 description 1
- ZBGRMWIREQJHPK-UHFFFAOYSA-N ethenyl 2,2,2-trifluoroacetate Chemical class FC(F)(F)C(=O)OC=C ZBGRMWIREQJHPK-UHFFFAOYSA-N 0.000 description 1
- ZBCLTORTGNOIGM-UHFFFAOYSA-N ethenyl 2,2-dichloroacetate Chemical compound ClC(Cl)C(=O)OC=C ZBCLTORTGNOIGM-UHFFFAOYSA-N 0.000 description 1
- ONSHBCMUUXTPOJ-UHFFFAOYSA-N ethenyl 2,2-difluoroacetate Chemical class FC(F)C(=O)OC=C ONSHBCMUUXTPOJ-UHFFFAOYSA-N 0.000 description 1
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- GFJVXXWOPWLRNU-UHFFFAOYSA-N ethenyl formate Chemical compound C=COC=O GFJVXXWOPWLRNU-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N furane Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- FIKFOOMAUXPBJM-UHFFFAOYSA-N hepta-2,5-dienediamide Chemical compound NC(=O)C=CCC=CC(N)=O FIKFOOMAUXPBJM-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000005660 hydrophilic surface Effects 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 1
- 125000001905 inorganic group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229920000592 inorganic polymer Polymers 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 238000005657 iodolactonization reaction Methods 0.000 description 1
- 230000002427 irreversible Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000002462 isocyano group Chemical group *[N+]#[C-] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 238000011068 load Methods 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000003328 mesylation reaction Methods 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 238000006140 methanolysis reaction Methods 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N monochloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N n-butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- 239000002159 nanocrystal Substances 0.000 description 1
- 239000002086 nanomaterial Substances 0.000 description 1
- 239000002071 nanotube Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 230000001264 neutralization Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 150000002847 norbornane derivatives Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000000269 nucleophilic Effects 0.000 description 1
- NZIDBRBFGPQCRY-UHFFFAOYSA-N octyl 2-methylprop-2-enoate Chemical compound CCCCCCCCOC(=O)C(C)=C NZIDBRBFGPQCRY-UHFFFAOYSA-N 0.000 description 1
- 229940065472 octyl acrylate Drugs 0.000 description 1
- ANISOHQJBAQUQP-UHFFFAOYSA-N octyl prop-2-enoate Chemical compound CCCCCCCCOC(=O)C=C ANISOHQJBAQUQP-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- UJJLJRQIPMGXEZ-UHFFFAOYSA-M oxolane-2-carboxylate Chemical compound [O-]C(=O)C1CCCO1 UJJLJRQIPMGXEZ-UHFFFAOYSA-M 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- JLIDVCMBCGBIEY-UHFFFAOYSA-N pent-1-en-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 238000005373 pervaporation Methods 0.000 description 1
- 230000005501 phase interface Effects 0.000 description 1
- QIWKUEJZZCOPFV-UHFFFAOYSA-N phenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1=CC=CC=C1 QIWKUEJZZCOPFV-UHFFFAOYSA-N 0.000 description 1
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 1
- GCSHUYKULREZSJ-UHFFFAOYSA-N phenyl(pyridin-2-yl)methanone Chemical compound C=1C=CC=NC=1C(=O)C1=CC=CC=C1 GCSHUYKULREZSJ-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000008104 phosphatidylethanolamines Chemical class 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 230000002186 photoactivation Effects 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920000885 poly(2-vinylpyridine) Polymers 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229920001197 polyacetylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 229920000307 polymer substrate Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 238000005182 potential energy surface Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000024769 regulation of transport Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000003938 response to stress Effects 0.000 description 1
- 238000001223 reverse osmosis Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 150000003335 secondary amines Chemical group 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 230000001568 sexual Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N silicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 230000001340 slower Effects 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- YOQDYZUWIQVZSF-UHFFFAOYSA-N sodium borohydride Substances [BH4-].[Na+] YOQDYZUWIQVZSF-UHFFFAOYSA-N 0.000 description 1
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Inorganic materials [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 description 1
- ODGROJYWQXFQOZ-UHFFFAOYSA-N sodium;boron(1-) Chemical compound [B-].[Na+] ODGROJYWQXFQOZ-UHFFFAOYSA-N 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000004544 spot-on Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- SFXOHDOEOSCUCT-UHFFFAOYSA-M styrene;chloride Chemical compound [Cl-].C=CC1=CC=CC=C1 SFXOHDOEOSCUCT-UHFFFAOYSA-M 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 229960001663 sulfanilamide Drugs 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical class [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N tetrahydro-2H-thiopyran Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004634 thermosetting polymer Substances 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 230000001131 transforming Effects 0.000 description 1
- SGVPGVFMABKMOL-UHFFFAOYSA-N trimethoxysilylmethyl but-2-enoate Chemical compound CO[Si](OC)(OC)COC(=O)C=CC SGVPGVFMABKMOL-UHFFFAOYSA-N 0.000 description 1
- CBZAHNDHLWAZQC-UHFFFAOYSA-N tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium;hexafluorophosphate Chemical compound F[P-](F)(F)(F)(F)F.C1CCCN1[P+](N1CCCC1)(N1CCCC1)ON1C2=NC=CC=C2N=N1 CBZAHNDHLWAZQC-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N α-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US41158802P | 2002-09-17 | 2002-09-17 | |
US10/426,475 US20040106741A1 (en) | 2002-09-17 | 2003-04-29 | Nanofilm compositions with polymeric components |
PCT/US2003/027749 WO2005018013A2 (en) | 2002-09-17 | 2003-09-05 | Nanofilm compositions with polymeric components |
Publications (2)
Publication Number | Publication Date |
---|---|
JP2006512472A JP2006512472A (ja) | 2006-04-13 |
JP2006512472A5 true JP2006512472A5 (US08182695-20120522-C00240.png) | 2006-10-19 |
Family
ID=32396975
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP2005507914A Pending JP2006512472A (ja) | 2002-09-17 | 2003-09-05 | ポリマー成分を有するナノフィルム組成物 |
Country Status (6)
Families Citing this family (56)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US8527026B2 (en) | 1997-03-04 | 2013-09-03 | Dexcom, Inc. | Device and method for determining analyte levels |
US6001067A (en) | 1997-03-04 | 1999-12-14 | Shults; Mark C. | Device and method for determining analyte levels |
ATE409215T1 (de) | 1998-05-05 | 2008-10-15 | Massachusetts Inst Technology | Emittierende polymere und vorrichtungen diese polymere enthaltend |
US20050147534A1 (en) | 1998-05-05 | 2005-07-07 | Massachusetts Institute Of Technology | Emissive sensors and devices incorporating these sensors |
US20030032874A1 (en) | 2001-07-27 | 2003-02-13 | Dexcom, Inc. | Sensor head for use with implantable devices |
CN1646116A (zh) * | 2002-02-07 | 2005-07-27 | 科瓦伦特合伙责任有限公司 | 大环模块组合物 |
US20040034223A1 (en) * | 2002-02-07 | 2004-02-19 | Covalent Partners, Llc. | Amphiphilic molecular modules and constructs based thereon |
US7432371B2 (en) * | 2002-02-07 | 2008-10-07 | Covalent Partners, Llc | Nanofilm and membrane compositions |
US10022078B2 (en) | 2004-07-13 | 2018-07-17 | Dexcom, Inc. | Analyte sensor |
US20040126659A1 (en) * | 2002-09-10 | 2004-07-01 | Graetz Jason A. | High-capacity nanostructured silicon and lithium alloys thereof |
US20040106741A1 (en) * | 2002-09-17 | 2004-06-03 | Kriesel Joshua W. | Nanofilm compositions with polymeric components |
EP1648298A4 (en) | 2003-07-25 | 2010-01-13 | Dexcom Inc | OXYGEN-IMPROVED MEMBRANE SYSTEMS FOR IMPLANTABLE DEVICES |
EP1667965A2 (en) * | 2003-08-06 | 2006-06-14 | Covalent Partners, LLC | Bridged macrocyclic module compositions |
US7920906B2 (en) | 2005-03-10 | 2011-04-05 | Dexcom, Inc. | System and methods for processing analyte sensor data for sensor calibration |
US9247900B2 (en) | 2004-07-13 | 2016-02-02 | Dexcom, Inc. | Analyte sensor |
US7781102B2 (en) * | 2004-04-22 | 2010-08-24 | California Institute Of Technology | High-capacity nanostructured germanium-containing materials and lithium alloys thereof |
US8277713B2 (en) | 2004-05-03 | 2012-10-02 | Dexcom, Inc. | Implantable analyte sensor |
CA2571207C (en) | 2004-06-15 | 2014-08-05 | Dentsply International Inc. | Low shrinkage and low stress dental compositions |
CA2570341C (en) * | 2004-06-15 | 2012-12-18 | Dentsply International Inc. | Radical polymerizable macrocyclic resin compositions with low polymerization stress |
US7654956B2 (en) | 2004-07-13 | 2010-02-02 | Dexcom, Inc. | Transcutaneous analyte sensor |
US8617819B2 (en) * | 2004-09-17 | 2013-12-31 | Massachusetts Institute Of Technology | Polymers for analyte detection |
US20090246887A1 (en) * | 2005-01-07 | 2009-10-01 | Academia Sinica | Diamond Crystallites For Biotechnological Applications |
US8744546B2 (en) | 2005-05-05 | 2014-06-03 | Dexcom, Inc. | Cellulosic-based resistance domain for an analyte sensor |
US7671166B2 (en) * | 2005-11-22 | 2010-03-02 | Massachusetts Institute Of Technology | High internal free volume compositions for low-k dielectric and other applications |
US7863381B2 (en) * | 2006-03-08 | 2011-01-04 | 3M Innovative Properties Company | Polymer composites |
WO2007120381A2 (en) | 2006-04-14 | 2007-10-25 | Dexcom, Inc. | Analyte sensor |
US7678838B2 (en) * | 2006-08-04 | 2010-03-16 | University Of Memphis Research Foundation | Nanothin polymer films with selective pores and method of use thereof |
US8283423B2 (en) | 2006-09-29 | 2012-10-09 | Massachusetts Institute Of Technology | Polymer synthetic technique |
US8802447B2 (en) * | 2006-10-05 | 2014-08-12 | Massachusetts Institute Of Technology | Emissive compositions with internal standard and related techniques |
US20090215189A1 (en) | 2006-10-27 | 2009-08-27 | Massachusetts Institute Of Technology | Sensor of species including toxins and chemical warfare agents |
US7829155B1 (en) | 2006-11-22 | 2010-11-09 | The University Of Memphis Research Foundation | Nanothin polymer coatings containing thiol and methods of use thereof |
US11730407B2 (en) | 2008-03-28 | 2023-08-22 | Dexcom, Inc. | Polymer membranes for continuous analyte sensors |
WO2009121026A1 (en) * | 2008-03-28 | 2009-10-01 | Dexcom, Inc. | Polymer membranes for continuous analyte sensors |
US8583204B2 (en) | 2008-03-28 | 2013-11-12 | Dexcom, Inc. | Polymer membranes for continuous analyte sensors |
US8682408B2 (en) | 2008-03-28 | 2014-03-25 | Dexcom, Inc. | Polymer membranes for continuous analyte sensors |
EP2326944B1 (en) | 2008-09-19 | 2020-08-19 | Dexcom, Inc. | Particle-containing membrane and particulate electrode for analyte sensors |
TWI398353B (zh) * | 2009-03-02 | 2013-06-11 | Ind Tech Res Inst | 奈米纖維材料與脫鹽過濾材料 |
US8273306B2 (en) * | 2009-07-15 | 2012-09-25 | Kimberly-Clark Worldwide, Inc. | Color-changing materials and multiple component materials having a color-changing composition |
US8574673B2 (en) * | 2009-07-31 | 2013-11-05 | Nantero Inc. | Anisotropic nanotube fabric layers and films and methods of forming same |
US8128993B2 (en) * | 2009-07-31 | 2012-03-06 | Nantero Inc. | Anisotropic nanotube fabric layers and films and methods of forming same |
EP2628773B1 (en) * | 2010-10-14 | 2016-03-30 | LG Chem, Ltd. | Resin blend for melting process |
US9217693B2 (en) * | 2011-09-12 | 2015-12-22 | Saudi Arabian Oil Company | Nanostructured fluid sampling device |
JP6551641B2 (ja) * | 2014-05-21 | 2019-07-31 | 凸版印刷株式会社 | 構造体および構造体の製造方法 |
US10305052B2 (en) | 2014-07-15 | 2019-05-28 | Japan Science And Technology Agency | Triptycene derivative useful as material for forming self-assembled film, method for manufacturing said triptycene derivative, film using same, method for manufacturing said film, and electronic device using said method |
KR102562973B1 (ko) * | 2015-12-31 | 2023-08-02 | 엘지디스플레이 주식회사 | 표시장치 |
KR101808122B1 (ko) | 2016-08-08 | 2017-12-14 | 휴먼켐 주식회사 | 안티블락킹 입자를 포함한 이형필름 제조 방법 및 그 이형필름 |
CN107413210B (zh) * | 2017-05-17 | 2020-04-17 | 宁波聚仁塑化材料有限公司 | 一种多巴胺和葡萄糖改性交联聚酰亚胺纳滤膜的制备方法 |
KR102212128B1 (ko) * | 2018-05-10 | 2021-02-17 | 주식회사 엘지화학 | 역삼투막, 이의 제조방법 및 수처리 모듈 |
CN108854265A (zh) * | 2018-06-26 | 2018-11-23 | 桐乡守敬应用技术研究院有限公司 | 一种复合过滤材料及其制备方法 |
CN108721702B (zh) * | 2018-06-29 | 2021-06-29 | 江西理工大学 | 一种镁/左旋聚乳酸复合骨支架的制备方法 |
CN109192922B (zh) * | 2018-08-07 | 2021-06-29 | 格林美(无锡)能源材料有限公司 | 一种具有特殊结构的固态锂离子电池正极及其制备方法 |
KR102040496B1 (ko) * | 2018-08-14 | 2019-11-05 | 한국화학연구원 | 연속상 나노다공성 구조의 광확산 필름의 제조방법, 그 광확산 필름 및 이를 포함하는 광학장치 |
CN109942731B (zh) * | 2019-04-08 | 2021-04-27 | 武汉轻工大学 | 一种纳米金/聚甲基丙烯酸甲酯导电材料的制备方法 |
KR102538214B1 (ko) * | 2020-11-20 | 2023-05-31 | 고려대학교 산학협력단 | 바이러스 포집용 마스크 |
CN113509848B (zh) * | 2021-04-27 | 2023-03-21 | 北京工业大学 | 一种基于液-液界面制备聚醚嵌段酰胺渗透汽化复合膜的方法 |
CN113522037A (zh) * | 2021-07-21 | 2021-10-22 | 江苏盈天化学有限公司 | 一种渗透汽化四氢呋喃脱水复合膜的制备方法 |
Family Cites Families (118)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3847949A (en) * | 1970-05-12 | 1974-11-12 | Du Pont | Macrocyclic hetero imine complexing agents |
FR2155926B1 (US08182695-20120522-C00240.png) * | 1971-10-15 | 1973-11-30 | Cetrane Laboratoire | |
US4031111A (en) * | 1973-01-08 | 1977-06-21 | E. I. Du Pont De Nemours And Company | Macrocyclic hetero imine complexing agents |
US4155793A (en) * | 1977-11-21 | 1979-05-22 | General Electric Company | Continuous preparation of ultrathin polymeric membrane laminates |
CS213944B1 (en) * | 1980-04-24 | 1982-04-09 | Jaromir Petranek | Calcium/ii/-selective polymeric diaphragm |
US4997676A (en) * | 1982-02-26 | 1991-03-05 | Limitinstant Limited | Immobilized inorganic diffusion barriers and the use thereof in the separation of small molecular species from a solution |
US4554076A (en) * | 1982-08-18 | 1985-11-19 | Georgia Tech Research Corporation | Method of modifying membrane surface with oriented monolayers of amphiphilic compounds |
WO1984003054A1 (en) * | 1983-02-02 | 1984-08-16 | Memtec Ltd | Cross linked porous membranes |
US4438251A (en) * | 1983-05-16 | 1984-03-20 | Armstrong World Industries, Inc. | Polyurethane polymers comprising macrocyclic crown ethers in the polymer backbone |
SU1139730A1 (ru) | 1983-10-12 | 1985-02-15 | Ордена Ленина Институт Геохимии И Аналитической Химии Им.В.И.Вернадского | 1 @ ,12 @ -Тетрасульфо-1 @ ,12 @ -тетраокси-2,3,10,11,13,14,21,22-октааза-5,8,16,19-тетраокса-1,12 ди(2,7)нафта-4,9,15,20-тетра(1,2)фена-циклодокоза-2,10,13,21-тетраен в качестве реагента дл фотометрического определени берилли |
SU1139731A1 (ru) | 1983-10-12 | 1985-02-15 | Ордена Ленина Институт Геохимии И Аналитической Химии Им.В.И.Вернадского | 1 @ ,15 @ -Тетрасульфо-1 @ ,15 @ -тетраокси-2,3,13,14,16,17,27,28-октааза-5,8,11,19,22,25-гексаокса-1,15 ди(2,7)нафта-4,12,18,26 тетра(1,2)фена-циклооктакоза-2,13,16,27-тетраен в качестве реагента дл фотометрического определени бари |
EP0141668B1 (en) * | 1983-11-05 | 1989-03-15 | Akzo N.V. | Organoclay materials |
US4560599A (en) * | 1984-02-13 | 1985-12-24 | Marquette University | Assembling multilayers of polymerizable surfactant on a surface of a solid material |
FR2564004B1 (fr) * | 1984-05-10 | 1993-04-09 | Commissariat Energie Atomique | Procede de fabrication d'un film mince comportant au moins une couche monomoleculaire de molecules non amphiphiles |
US5362476A (en) * | 1984-10-18 | 1994-11-08 | Board Of Regents, The University Of Texas System | Alkyl phosphonate polyazamacrocyclic cheates for MRI |
SU1266849A1 (ru) | 1985-01-31 | 1986-10-30 | Ордена Ленина Институт Геохимии И Аналитической Химии Им.В.И.Вернадского | Макроциклические бисазорезорцины систем ундека,-тетрадека,гептадекадиена |
US5059510A (en) * | 1985-02-04 | 1991-10-22 | Hoechst Celanese Corp. | Media for optical information storage comprising an organic macrocyclic chromophore substituted with a film conferring organic substituent |
US5173365A (en) * | 1985-03-25 | 1992-12-22 | Nanofilm Corporation | Ultra-thin molecular film |
CA1290490C (en) * | 1985-11-20 | 1991-10-08 | Masakazu Uekita | Amphiphilic high polymer and process for producing the same |
US5023252A (en) * | 1985-12-04 | 1991-06-11 | Conrex Pharmaceutical Corporation | Transdermal and trans-membrane delivery of drugs |
US4722856A (en) * | 1986-01-02 | 1988-02-02 | Molecular Electronics Corporation | Method and apparatus for depositing monomolecular layers on a substrate |
CA1302675C (en) * | 1986-05-20 | 1992-06-09 | Masakazu Uekita | Thin film and device having the same |
US4948506A (en) * | 1986-07-07 | 1990-08-14 | Bend Research, Inc. | Physicochemically functional ultrathin films by interfacial polymerization |
US5069945A (en) * | 1986-10-20 | 1991-12-03 | Memtec America Corporation | Ultrapous thin-film membranes |
US4814082A (en) * | 1986-10-20 | 1989-03-21 | Memtec North America Corporation | Ultrafiltration thin film membranes |
US4808480A (en) * | 1986-11-25 | 1989-02-28 | Lehigh University | Polymerizable heterocyclic disulfide-based compounds and membranes made therefrom |
US4828917A (en) * | 1987-05-08 | 1989-05-09 | Basf Aktiengesellschaft | Layer of metallomacrocyclic polymer on substrate |
US5064956A (en) * | 1987-06-24 | 1991-11-12 | The Dow Chemical Company | Process for preparing mono-n-alkylated polyazamacrocycles |
US5489425A (en) * | 1987-06-24 | 1996-02-06 | The Dow Chemical Company | Functionalized polyamine chelants |
DE3724543A1 (de) * | 1987-07-24 | 1989-02-02 | Basf Ag | Verfahren zur herstellung von duennen schichten |
US5179213A (en) * | 1987-09-04 | 1993-01-12 | Brigham Young University | Macrocyclic ligands bonded to an inorganic support matrix and a process for selectively and quantitatively removing and concentrating ions present at low concentrations from mixtures thereof with other ions |
SU1532560A1 (ru) | 1988-04-22 | 1989-12-30 | Институт геохимии и аналитической химии им.В.И.Вернадского | Способ получени симметричных макроциклических олигоэфиров |
KR900701960A (ko) * | 1988-06-03 | 1990-12-05 | 한스 마크 | [1,1,1]프로펠란을 기본으로하는 화합물 및 제조방법 |
US5102798A (en) * | 1988-09-08 | 1992-04-07 | Allage Associates | Surface functionalized Langmuir-Blodgett films for immobilization of active moieties |
GB8922069D0 (en) * | 1989-09-29 | 1989-11-15 | Alcan Int Ltd | Separation devices incorporating porous anodic films |
US5798261A (en) * | 1989-10-31 | 1998-08-25 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Distributed pore chemistry in porous organic polymers |
US5368712A (en) * | 1989-11-02 | 1994-11-29 | Synporin Technologies, Inc. | Biologically mimetic synthetic ion channel transducers |
DE3938992A1 (de) * | 1989-11-21 | 1991-05-23 | Schering Ag | Kaskadenpolymer-gebundene komplexbildner, deren komplexe und konjugate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische mittel |
DE4012750A1 (de) * | 1990-04-21 | 1991-10-24 | Hoechst Ag | Ferroelektrisches fluessigkristalldisplay mit hohem kontrast und hoher helligkeit |
IL93020A (en) * | 1990-01-09 | 1995-06-29 | Yeda Res & Dev | Biosensors comprising a lipid bilayer doped with ion channels anchored to a recording electrode by bridging molecules |
US5143784A (en) * | 1990-05-10 | 1992-09-01 | Nec Corporation | Soluble calixarene derivative and films thereof |
CA2045965A1 (en) * | 1990-06-30 | 1991-12-31 | Hiroyoshi Kawakami | Oxygen-permeable polymeric membranes |
FR2666092B1 (fr) * | 1990-08-23 | 1993-12-03 | Commissariat A Energie Atomique | Membranes organiques bidimensionnelles et leurs procedes de preparation. |
DE4035378C2 (de) | 1990-11-07 | 2000-11-02 | Oeffentliche Pruefstelle Und T | Textiles Material sowie Verfahren zur Herstellung eines derartigen textilen Materials |
JPH06505477A (ja) | 1991-01-29 | 1994-06-23 | ジェネラブス テクノロジイズ,インコーポレイティド | 高環状化合物の抗血液凝固剤及び治療方法 |
DE4135847A1 (de) * | 1991-10-31 | 1993-05-06 | Bayer Ag, 5090 Leverkusen, De | Asymmetrische, semipermeable membranen aus aromatischen polykondensaten, verfahren zu ihrer herstellung und ihre verwendung |
CA2123133C (en) * | 1991-11-07 | 2005-01-04 | Michael J. Heller | Hybridization of polynucleotides conjugated with chromophores and fluorophores to generate donor-to-donor energy transfer system |
US5278051A (en) * | 1991-12-12 | 1994-01-11 | New York University | Construction of geometrical objects from polynucleotides |
US5237067A (en) * | 1992-02-04 | 1993-08-17 | Schumaker Robert R | Optoelectronic tautomeric compositions |
US5919369A (en) * | 1992-02-06 | 1999-07-06 | Hemocleanse, Inc. | Hemofiltration and plasmafiltration devices and methods |
US5788862A (en) * | 1992-05-13 | 1998-08-04 | Pall Corporation | Filtration medium |
US5342934A (en) * | 1992-06-19 | 1994-08-30 | The Trustees Of Columbia University In The City Of New York | Enantioselective receptor for amino acid derivatives, and other compounds |
JP3624315B2 (ja) * | 1992-07-29 | 2005-03-02 | バクスター、インターナショナル、インコーポレイテッド | 親水性表面を有する生物材料 |
US5410045A (en) * | 1992-08-04 | 1995-04-25 | Board Of Regents, The University Of Texas System | Rubyrin and related expanded porphyrins |
DE4226556A1 (de) * | 1992-08-11 | 1994-02-17 | Hoechst Ag | Modifizierter Polyzucker als Orientierungsschicht für Flüssigkristalldisplays |
US5231161A (en) * | 1992-10-22 | 1993-07-27 | General Electric Company | Method for preparation of macrocyclic poly(alkylene dicarboxylate) oligomers from bis(hydroxyalkyl) dicarboxylates |
DE4305970A1 (de) * | 1993-02-26 | 1994-09-01 | Hoechst Ag | Cyclische Strukturelemente enthaltende Silan-Koppler als Orientierungsfilme |
US5368889A (en) * | 1993-04-16 | 1994-11-29 | The Dow Chemical Company | Method of making thin film composite membranes |
US6001364A (en) * | 1993-05-05 | 1999-12-14 | Gryphon Sciences | Hetero-polyoxime compounds and their preparation by parallel assembly |
US5357029A (en) * | 1993-06-24 | 1994-10-18 | General Electric Co. | Macrocyclic polyimide oligomers and method for their preparation |
US5449761A (en) * | 1993-09-28 | 1995-09-12 | Cytogen Corporation | Metal-binding targeted polypeptide constructs |
GB9321545D0 (en) | 1993-10-19 | 1993-12-08 | Secr Defence | Sensors for neutral molecules |
AU704878B2 (en) * | 1994-01-05 | 1999-05-06 | Arqule, Inc. | Method of making polymers having specific properties |
US5561043A (en) * | 1994-01-31 | 1996-10-01 | Trustees Of Boston University | Self-assembling multimeric nucleic acid constructs |
US5831087A (en) * | 1994-03-02 | 1998-11-03 | Hoechst Celanese Corp. | Macrocyclic imide compounds |
WO1995024929A2 (en) * | 1994-03-15 | 1995-09-21 | Brown University Research Foundation | Polymeric gene delivery system |
EP0772619B2 (en) * | 1994-07-15 | 2010-12-08 | The University of Iowa Research Foundation | Immunomodulatory oligonucleotides |
GB9420390D0 (en) * | 1994-10-10 | 1994-11-23 | Nycomed Salutar Inc | Liposomal agents |
US5614099A (en) * | 1994-12-22 | 1997-03-25 | Nitto Denko Corporation | Highly permeable composite reverse osmosis membrane, method of producing the same, and method of using the same |
US5560151A (en) * | 1995-03-06 | 1996-10-01 | Polyceramics, Inc. | Building blocks forming hexagonal and pentagonal building units for modular structures |
US6076318A (en) * | 1995-03-06 | 2000-06-20 | Polyceramics, Inc. | Interlocking puzzle |
GB9504910D0 (en) * | 1995-03-10 | 1995-04-26 | Nycomed Imaging As | Compounds |
US6340588B1 (en) * | 1995-04-25 | 2002-01-22 | Discovery Partners International, Inc. | Matrices with memories |
DE19518624C1 (de) * | 1995-05-24 | 1996-11-21 | Akzo Nobel Nv | Synthetische Trennmembran |
GB9511396D0 (en) | 1995-06-06 | 1995-08-02 | British Nuclear Fuels Plc | Chemical complexes |
US6210551B1 (en) * | 1995-08-01 | 2001-04-03 | Australian Membrane And Biotechnology Research Institute | Composite membrane sensor |
US5876830A (en) * | 1995-09-08 | 1999-03-02 | Board Of Regents Of The University Of Colorado | Method of assembly of molecular-sized nets and scaffolding |
WO1997014740A1 (en) * | 1995-10-19 | 1997-04-24 | Receptagen Corporation | Discrete-length polyethylene glycols |
US5830539A (en) * | 1995-11-17 | 1998-11-03 | The State Of Oregon Acting By And Through The State Board Of Higher Education On Behalf Of The University Of Oregon | Methods for functionalizing and coating substrates and devices made according to the methods |
US20010009904A1 (en) * | 1997-12-30 | 2001-07-26 | Jon A. Wolff | Process of delivering a polynucleotide to a cell via the vascular system |
US6171497B1 (en) * | 1996-01-24 | 2001-01-09 | Nitto Denko Corporation | Highly permeable composite reverse osmosis membrane |
US5883246A (en) * | 1996-03-07 | 1999-03-16 | Qlt Phototherapeutics, Inc. | Synthesis of polypyrrolic macrocycles from meso-substituted tripyrrane compounds |
JP3681214B2 (ja) * | 1996-03-21 | 2005-08-10 | 日東電工株式会社 | 高透過性複合逆浸透膜 |
AU2440997A (en) * | 1996-04-05 | 1997-10-29 | Board Of Regents, The University Of Texas System | Calixpyrroles, calixpyridinopyrroles and calixpyridines |
US6072044A (en) * | 1996-04-26 | 2000-06-06 | New York University | Nanoconstructions of geometrical objects and lattices from antiparallel nucleic acid double crossover molecules |
US5695887A (en) * | 1996-05-09 | 1997-12-09 | Bell Communications Research, Inc. | Chelation treatment for reduced self-discharge in Li-ion batteries |
CA2256900A1 (en) * | 1996-05-29 | 1997-12-04 | Xiao-Ying Meng | Cationic polymer/lipid nucleic acid delivery vehicles |
US5852127A (en) * | 1996-07-09 | 1998-12-22 | Rensselner Polytechnic Institute | Modification of porous and non-porous materials using self-assembled monolayers |
DE19636337A1 (de) | 1996-08-30 | 1998-03-05 | Inst Angewandte Chemie Berlin | Polyazacalix[5]arene, Verfahren zu ihrer Herstellung und ihre Verwendung |
DE19646537A1 (de) | 1996-10-30 | 1998-05-07 | Inst Angewandte Chemie Berlin | Polyazacalix[6]arene, Verfahren zu ihrer Herstellung und ihre Verwendung |
US5677399A (en) * | 1996-11-07 | 1997-10-14 | Bridgestone Corporation | Synthesis of macrocyclic polymers with group IIA and IIB metal cyclic organometallic initiators |
EP0889080A1 (en) * | 1996-12-10 | 1999-01-07 | Daicel Chemical Industries, Ltd. | Porous films, process for producing the same, and laminate films and recording sheets made with the use of the porous films |
US5936100A (en) * | 1996-12-16 | 1999-08-10 | Studiengesellschaft Kohle Mbh | Synthesis of functionalized macrocycles by ring closing metathesis |
US5912069A (en) * | 1996-12-19 | 1999-06-15 | Sigma Laboratories Of Arizona | Metal nanolaminate composite |
DE19711078A1 (de) | 1997-01-05 | 1998-09-24 | Franz Dietrich Oeste | Organische Käfigverbindungen, Verfahren zu ihrer Herstellung und Anwendung |
US5908692A (en) * | 1997-01-23 | 1999-06-01 | Wisconsin Alumni Research Foundation | Ordered organic monolayers and methods of preparation thereof |
US6275866B1 (en) * | 1997-03-14 | 2001-08-14 | Mathsoft Engineering & Education, Inc. | Manipulation and coupling of object oriented components |
US6033773A (en) * | 1997-04-18 | 2000-03-07 | The Regents Of The University Of California | Polar self-assembled thin films for non-linear optical materials |
US6524613B1 (en) * | 1997-04-30 | 2003-02-25 | Regents Of The University Of Minnesota | Hepatocellular chimeraplasty |
US5919440A (en) * | 1997-05-05 | 1999-07-06 | Procter & Gamble Company | Personal care compositions containing an odor masking base |
US5933819C1 (en) * | 1997-05-23 | 2001-11-13 | Scripps Research Inst | Prediction of relative binding motifs of biologically active peptides and peptide mimetics |
DE69809122T2 (de) * | 1997-05-30 | 2003-04-03 | Canon Kk | Vorrichtung zur Herstellung Lagmuir-Blodgett-Filmen |
DE19808843C2 (de) * | 1998-03-03 | 2003-10-02 | Degussa | Verfahren zur Herstellung von makrocyclischen Estern |
DE19808844A1 (de) * | 1998-03-03 | 1999-09-09 | Huels Chemische Werke Ag | Verfahren zur Herstellung von makrocyclischen Estern |
NL1008789C2 (nl) | 1998-04-02 | 1999-10-05 | Stichting Tech Wetenschapp | Anion-complexerende verbinding, werkwijze voor de bereiding ervan, een ionselectief membraan alsmede een sensor voorzien van een dergelijke verbinding of membraan. |
US6271209B1 (en) * | 1998-04-03 | 2001-08-07 | Valentis, Inc. | Cationic lipid formulation delivering nucleic acid to peritoneal tumors |
US6048736A (en) * | 1998-04-29 | 2000-04-11 | Kosak; Kenneth M. | Cyclodextrin polymers for carrying and releasing drugs |
US6056903A (en) * | 1999-02-08 | 2000-05-02 | Osmonics, Inc. | Preparation of polyethersulfone membranes |
US6380347B1 (en) * | 1999-04-09 | 2002-04-30 | Honeywell International Inc. | Nanoporous polymers comprising macrocycles |
US6203850B1 (en) * | 1999-05-18 | 2001-03-20 | Neomecs Incorporated | Plasma-annealed porous polymers |
JP2001151904A (ja) * | 1999-09-17 | 2001-06-05 | Univ Tokyo | J会合体配向分散膜及びその製造方法 |
US6564288B2 (en) * | 2000-11-30 | 2003-05-13 | Hewlett-Packard Company | Memory controller with temperature sensors |
US7432371B2 (en) * | 2002-02-07 | 2008-10-07 | Covalent Partners, Llc | Nanofilm and membrane compositions |
US20040034223A1 (en) * | 2002-02-07 | 2004-02-19 | Covalent Partners, Llc. | Amphiphilic molecular modules and constructs based thereon |
CN1646116A (zh) * | 2002-02-07 | 2005-07-27 | 科瓦伦特合伙责任有限公司 | 大环模块组合物 |
WO2003072126A2 (de) * | 2002-02-28 | 2003-09-04 | Switch Biotech Ag | Verwendung eines fibroblastenwachstumsfaktor-bindeproteins zur behandlung und diagnose von diabetischen wundheilungsstörungen |
US20040106741A1 (en) * | 2002-09-17 | 2004-06-03 | Kriesel Joshua W. | Nanofilm compositions with polymeric components |
EP1667965A2 (en) * | 2003-08-06 | 2006-06-14 | Covalent Partners, LLC | Bridged macrocyclic module compositions |
-
2003
- 2003-04-29 US US10/426,475 patent/US20040106741A1/en not_active Abandoned
- 2003-09-05 WO PCT/US2003/027749 patent/WO2005018013A2/en active Search and Examination
- 2003-09-05 JP JP2005507914A patent/JP2006512472A/ja active Pending
- 2003-09-05 KR KR1020057004632A patent/KR20060056266A/ko not_active Application Discontinuation
- 2003-09-05 AU AU2003304453A patent/AU2003304453B2/en not_active Ceased
- 2003-09-05 EP EP03816729A patent/EP1573833A4/en not_active Withdrawn
-
2005
- 2005-08-10 US US11/202,322 patent/US7595368B2/en not_active Expired - Fee Related
Similar Documents
Publication | Publication Date | Title |
---|---|---|
JP2006512472A5 (US08182695-20120522-C00240.png) | ||
JP2006512472A (ja) | ポリマー成分を有するナノフィルム組成物 | |
US8182695B2 (en) | Bridged macrocyclic module compositions | |
US7432371B2 (en) | Nanofilm and membrane compositions | |
ZA200406351B (en) | Nanofilm and membrane compositions. | |
JP2011127133A (ja) | デンドリマーを結合させた基材 | |
KR20150073115A (ko) | 연결부가 작용기화된 블록 공중합체 | |
KR100686566B1 (ko) | 중합체 네트워크의 제조방법 | |
US20060128680A1 (en) | Macrocyclic module compositions | |
Basak et al. | Synthesis of PVDF-Based Graft Copolymeric Antifouling Membranes Showing Affinity-Driven Immobilization of Nucleobases | |
JP4688418B2 (ja) | ナノフィルムおよび膜組成物 | |
AU2003212973B2 (en) | Nanofilm and membrane compositions | |
Hale et al. | Carboxylated Nanospheres Using Cyclic Dipeptides as Removable Templates for Cation Binding | |
Hoffmann et al. | Photochemical fixation of structures in binary polymer brushes—influence of layer thickness and grafting method | |
US20050244898A1 (en) | Large-area two-dimensional non-adhesive cell arrays for sensing and cell-sorting applications | |
WO2002051917A1 (de) | Oberflachenfunktionalisiertes tragermaterial, verfahren fur seine herstellung sowie festphasensyntheseverfahren |