JP2005533018A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2005533018A5 JP2005533018A5 JP2004501419A JP2004501419A JP2005533018A5 JP 2005533018 A5 JP2005533018 A5 JP 2005533018A5 JP 2004501419 A JP2004501419 A JP 2004501419A JP 2004501419 A JP2004501419 A JP 2004501419A JP 2005533018 A5 JP2005533018 A5 JP 2005533018A5
- Authority
- JP
- Japan
- Prior art keywords
- optionally substituted
- alkyl
- oxo
- thia
- ene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229910052760 oxygen Inorganic materials 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 33
- 229910052717 sulfur Inorganic materials 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 claims description 3
- 125000006239 protecting group Chemical group 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 28
- -1 substituted Chemical class 0.000 claims 26
- 125000001072 heteroaryl group Chemical group 0.000 claims 21
- 150000001721 carbon Chemical group 0.000 claims 12
- 125000005842 heteroatom Chemical group 0.000 claims 11
- FYZUENZXIZCLAZ-UHFFFAOYSA-N 2-methylhept-2-enoic acid Chemical compound CCCCC=C(C)C(O)=O FYZUENZXIZCLAZ-UHFFFAOYSA-N 0.000 claims 9
- 238000006664 bond formation reaction Methods 0.000 claims 9
- 229920006395 saturated elastomer Polymers 0.000 claims 9
- 125000003003 spiro group Chemical group 0.000 claims 9
- 125000004432 carbon atom Chemical group C* 0.000 claims 6
- 125000003107 substituted aryl group Chemical group 0.000 claims 6
- ZIHYVLFLVDRNED-UHFFFAOYSA-M sodium;2-methylhept-2-enoate Chemical compound [Na+].CCCCC=C(C)C([O-])=O ZIHYVLFLVDRNED-UHFFFAOYSA-M 0.000 claims 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 3
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims 3
- 239000003782 beta lactam antibiotic agent Substances 0.000 claims 3
- 125000002619 bicyclic group Chemical group 0.000 claims 3
- 125000005326 heteroaryloxy alkyl group Chemical group 0.000 claims 3
- 125000000623 heterocyclic group Chemical group 0.000 claims 3
- 238000001727 in vivo Methods 0.000 claims 3
- 229910052757 nitrogen Inorganic materials 0.000 claims 3
- 239000002132 β-lactam antibiotic Substances 0.000 claims 3
- 229940124586 β-lactam antibiotics Drugs 0.000 claims 3
- 208000035143 Bacterial infection Diseases 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 125000005018 aryl alkenyl group Chemical group 0.000 claims 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- 125000005325 aryloxy aryl group Chemical group 0.000 claims 2
- 125000004104 aryloxy group Chemical group 0.000 claims 2
- 208000022362 bacterial infectious disease Diseases 0.000 claims 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 125000002950 monocyclic group Chemical group 0.000 claims 2
- 159000000000 sodium salts Chemical class 0.000 claims 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims 2
- FNBVVWRNKCSCSF-JKLGPDONSA-N (5r,6e)-6-[(5-benzyl-6-oxobenzo[b][1,4]benzoxazepin-3-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound N1([C@@H]2SC=C1C(=O)O)C(=O)\C2=C/C(C=C12)=CC=C1OC1=CC=CC=C1C(=O)N2CC1=CC=CC=C1 FNBVVWRNKCSCSF-JKLGPDONSA-N 0.000 claims 1
- ZQZVENIYZGCSFN-VYLZPFMQSA-N (5r,6z)-6-(imidazo[2,1-b][1,3]benzothiazol-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound N1=C2SC3=CC=CC=C3N2C=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O ZQZVENIYZGCSFN-VYLZPFMQSA-N 0.000 claims 1
- SBFSPMJWFBHKNG-GHXNOFRVSA-N (6z)-6-(imidazo[1,2-a]quinolin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound N1=C2C=CC3=CC=CC=C3N2C=C1/C=C1/C(=O)N2C1SC=C2C(=O)O SBFSPMJWFBHKNG-GHXNOFRVSA-N 0.000 claims 1
- OPXDMOAEUDFAOG-UITAMQMPSA-N (6z)-6-(imidazo[2,1-b][1,3]benzothiazol-6-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2N3C=CN=C3SC2=CC(/C=C2/C(=O)N3C2SC=C3C(=O)O)=C1 OPXDMOAEUDFAOG-UITAMQMPSA-N 0.000 claims 1
- CCFXGLVYZSKCJY-UITAMQMPSA-N (6z)-7-oxo-6-(5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CCCC(SC2=N3)=C1N2C=C3/C=C1/C(=O)N2C1SC=C2C(=O)O CCFXGLVYZSKCJY-UITAMQMPSA-N 0.000 claims 1
- LVDAGEHCAGXUMS-UITAMQMPSA-N (6z)-7-oxo-6-([1,3]thiazolo[3,2-a]benzimidazol-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C2=NC3=CC=CC=C3N2C=C1/C=C1/C(=O)N2C1SC=C2C(=O)O LVDAGEHCAGXUMS-UITAMQMPSA-N 0.000 claims 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000002877 alkyl aryl group Chemical group 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000005530 alkylenedioxy group Chemical group 0.000 claims 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims 1
- NRUCVQIWTLYXSP-LJYDOUJQSA-M chembl1744422 Chemical compound [Na+].C1OCCC2=C1OC1=CC(/C=C3/C(=O)N4[C@@H]3SC=C4C(=O)[O-])=NN12 NRUCVQIWTLYXSP-LJYDOUJQSA-M 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims 1
- 125000005553 heteroaryloxy group Chemical group 0.000 claims 1
- 125000005226 heteroaryloxycarbonyl group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- BKUCIVDIKGZGTK-BUROSNQKSA-M sodium (5R,6Z)-6-[(7-methoxy-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].COC1=NC2=NC(\C=C/3C(N4C(=CS[C@@H]4\3)C([O-])=O)=O)=CN2C2=C1CCC2 BKUCIVDIKGZGTK-BUROSNQKSA-M 0.000 claims 1
- ZESZLEMSBMCYOR-MBZBDMRWSA-M sodium (5R,6Z)-6-[(7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].CC1=NC2=NC(\C=C/3C(N4C(=CS[C@@H]4\3)C([O-])=O)=O)=NN2C2=C1CCC2 ZESZLEMSBMCYOR-MBZBDMRWSA-M 0.000 claims 1
- GZRSRPHLBHFTEC-PZUHYBIVSA-M sodium (5R,6Z)-7-oxo-6-[[7-(2-phenylmethoxyethoxy)-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]methylidene]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].N1([C@@H]2SC=C1C(=O)[O-])C(=O)\C2=C\C(N=C1N=2)=CN1C=1CCCC=1C=2OCCOCC1=CC=CC=C1 GZRSRPHLBHFTEC-PZUHYBIVSA-M 0.000 claims 1
- YSKWYZQJXLHMKR-PKCBAQMVSA-M sodium;(5r,6z)-6-[(5-methyl-6,7,8,9-tetrahydro-[1,2,4]triazolo[1,5-a]quinazolin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1CCCC2=C1N1N=C(\C=C/3C(N4C(=CS[C@@H]4\3)C([O-])=O)=O)N=C1N=C2C YSKWYZQJXLHMKR-PKCBAQMVSA-M 0.000 claims 1
- FGXZACXOKMJBSZ-DKKQRQGYSA-M sodium;(5r,6z)-6-[(6-ethoxycarbonyl-7,8-dihydro-5h-pyrazolo[1,2][1,3]oxazolo[2,3-a]pyridin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1N(C(=O)OCC)CCC2=C1OC1=CC(\C=C/3C(N4C(=CS[C@@H]4\3)C([O-])=O)=O)=NN21 FGXZACXOKMJBSZ-DKKQRQGYSA-M 0.000 claims 1
- NPWRPTZITOUBFZ-NCFGLPCCSA-M sodium;(5r,6z)-7-oxo-6-(5,6,7,8-tetrahydropyrazolo[5,1-b][1,3]benzoxazol-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1CCCC2=C1OC1=CC(/C=C3/C(=O)N4[C@@H]3SC=C4C(=O)[O-])=NN12 NPWRPTZITOUBFZ-NCFGLPCCSA-M 0.000 claims 1
- YTTDMRAHJMTSGT-UHPXVVQNSA-M sodium;(6z)-6-(5h-imidazo[2,1-a]isoindol-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1=CC=C2C3=NC(/C=C4/C(=O)N5C4SC=C5C(=O)[O-])=CN3CC2=C1 YTTDMRAHJMTSGT-UHPXVVQNSA-M 0.000 claims 1
- GDDZRTPUGYRYNK-UYTGOYFPSA-M sodium;(6z)-7-oxo-6-(5,6,7,8-tetrahydroimidazo[1,2][1,2,4]triazolo[2,4-a]pyridin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1CCCC2=NC3=NC(/C=C4/C(=O)N5C4SC=C5C(=O)[O-])=CN3N21 GDDZRTPUGYRYNK-UYTGOYFPSA-M 0.000 claims 1
- 125000005017 substituted alkenyl group Chemical group 0.000 claims 1
- 125000004426 substituted alkynyl group Chemical group 0.000 claims 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37705102P | 2002-05-01 | 2002-05-01 | |
| PCT/US2003/013451 WO2003093280A1 (en) | 2002-05-01 | 2003-04-30 | Heterotricyclyl 6-alkylidene-penems as βετα-lactamase inhibitors |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2005533018A JP2005533018A (ja) | 2005-11-04 |
| JP2005533018A5 true JP2005533018A5 (enExample) | 2010-03-04 |
| JP4472515B2 JP4472515B2 (ja) | 2010-06-02 |
Family
ID=29401436
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2004501419A Expired - Lifetime JP4472515B2 (ja) | 2002-05-01 | 2003-04-30 | ベータ−ラクタマーゼ阻害剤としてのヘテロトリサイクリル−６−アルキリデン−ペネム |
Country Status (23)
| Country | Link |
|---|---|
| US (3) | US7018997B2 (enExample) |
| EP (1) | EP1499622B1 (enExample) |
| JP (1) | JP4472515B2 (enExample) |
| KR (1) | KR20050007366A (enExample) |
| CN (1) | CN100506825C (enExample) |
| AR (1) | AR039475A1 (enExample) |
| AT (1) | ATE425169T1 (enExample) |
| AU (1) | AU2003239325B8 (enExample) |
| BR (1) | BR0309878A (enExample) |
| CA (1) | CA2483562C (enExample) |
| DE (1) | DE60326562D1 (enExample) |
| DK (1) | DK1499622T3 (enExample) |
| EC (1) | ECSP045405A (enExample) |
| ES (1) | ES2322951T3 (enExample) |
| IL (1) | IL164898A0 (enExample) |
| MX (1) | MXPA04010662A (enExample) |
| NO (1) | NO20044550L (enExample) |
| NZ (1) | NZ536181A (enExample) |
| RU (1) | RU2004135086A (enExample) |
| TW (1) | TW200404809A (enExample) |
| UA (1) | UA78312C2 (enExample) |
| WO (1) | WO2003093280A1 (enExample) |
| ZA (1) | ZA200409691B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR039774A1 (es) * | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| AR039476A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039475A1 (es) | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| AU2006285308A1 (en) * | 2005-07-27 | 2007-03-08 | Wyeth | Tricyclic 6-alkylidene-penem beta-lactamase inhibitors and beta-lactam antibiotic combination: a broad spectrum antibiotic |
| RU2008102912A (ru) * | 2005-07-27 | 2009-09-10 | Вайет (Us) | Сочетание ингибиторов бетта-лактазмы бициклического 6-алкилиденпенема с бетта-лактанным антибиотиком: антибиотик широкого спектра |
| GT200600380A (es) * | 2005-08-24 | 2007-03-29 | Proceso para la preparacion de inhibidores de beta-lactamasa | |
| US20100063023A1 (en) * | 2008-09-10 | 2010-03-11 | Wyeth | Bicyclic and Tricyclic Substituted 6-Methylidene Carbapenems as Broad Spectrum Beta-Lactamase Inhibitors |
| US20110288063A1 (en) * | 2010-05-19 | 2011-11-24 | Naeja Pharmaceutical Inc. | Novel fused bridged bicyclic heteroaryl substituted 6-alkylidene penems as potent beta-lactamase inhibitors |
| KR20240036571A (ko) | 2021-07-15 | 2024-03-20 | 제넨테크, 인크. | 치료 화합물 및 방법 |
Family Cites Families (122)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US470395A (en) * | 1892-03-08 | hannum | ||
| US474771A (en) * | 1892-05-10 | Telethermometer | ||
| GB1257034A (enExample) * | 1968-03-25 | 1971-12-15 | ||
| US3644825A (en) * | 1969-12-31 | 1972-02-22 | Texas Instruments Inc | Magnetic detection system for detecting movement of an object utilizing signals derived from two orthogonal pickup coils |
| US3821469A (en) * | 1972-05-15 | 1974-06-28 | Amperex Electronic Corp | Graphical data device |
| US3868565A (en) * | 1973-07-30 | 1975-02-25 | Jack Kuipers | Object tracking and orientation determination means, system and process |
| US4017858A (en) * | 1973-07-30 | 1977-04-12 | Polhemus Navigation Sciences, Inc. | Apparatus for generating a nutating electromagnetic field |
| US3983474A (en) * | 1975-02-21 | 1976-09-28 | Polhemus Navigation Sciences, Inc. | Tracking and determining orientation of object using coordinate transformation means, system and process |
| US4054881A (en) * | 1976-04-26 | 1977-10-18 | The Austin Company | Remote object position locater |
| DE2718804C3 (de) * | 1977-04-27 | 1979-10-31 | Karlheinz Prof. Dr. 3000 Hannover Renner | Vorrichtung zur PositionierungskontroUe von Patienten und/oder Bestrahlungsquellen |
| US4182312A (en) * | 1977-05-20 | 1980-01-08 | Mushabac David R | Dental probe |
| US4206067A (en) * | 1978-10-02 | 1980-06-03 | Chevron Research Company | Thermally stabilized erosion-inhibited functional fluids containing perhalometal compounds and an organic base |
| US4256112A (en) * | 1979-02-12 | 1981-03-17 | David Kopf Instruments | Head positioner |
| US4341220A (en) * | 1979-04-13 | 1982-07-27 | Pfizer Inc. | Stereotactic surgery apparatus and method |
| US4314251A (en) * | 1979-07-30 | 1982-02-02 | The Austin Company | Remote object position and orientation locater |
| US4608977A (en) * | 1979-08-29 | 1986-09-02 | Brown Russell A | System using computed tomography as for selective body treatment |
| US4319136A (en) * | 1979-11-09 | 1982-03-09 | Jinkins J Randolph | Computerized tomography radiograph data transfer cap |
| US4328548A (en) * | 1980-04-04 | 1982-05-04 | The Austin Company | Locator for source of electromagnetic radiation having unknown structure or orientation |
| US4346384A (en) * | 1980-06-30 | 1982-08-24 | The Austin Company | Remote object position and orientation locator |
| DE3176517D1 (en) | 1980-04-24 | 1987-12-17 | Beecham Group Plc | Beta-lactam compounds, their preparation and use |
| US4688037A (en) * | 1980-08-18 | 1987-08-18 | Mcdonnell Douglas Corporation | Electromagnetic communications and switching system |
| US4638798A (en) * | 1980-09-10 | 1987-01-27 | Shelden C Hunter | Stereotactic method and apparatus for locating and treating or removing lesions |
| US4506676A (en) * | 1982-09-10 | 1985-03-26 | Duska Alois A | Radiographic localization technique |
| EP0120613A1 (en) | 1983-03-02 | 1984-10-03 | Beecham Group Plc | Penem derivatives and precursors |
| US4651732A (en) * | 1983-03-17 | 1987-03-24 | Frederick Philip R | Three-dimensional light guidance system for invasive procedures |
| US4613866A (en) * | 1983-05-13 | 1986-09-23 | Mcdonnell Douglas Corporation | Three dimensional digitizer with electromagnetic coupling |
| NL8302228A (nl) * | 1983-06-22 | 1985-01-16 | Optische Ind De Oude Delft Nv | Meetstelsel voor het onder gebruikmaking van een op driehoeksmeting berustend principe, contactloos meten van een door een oppervlakcontour van een objectvlak gegeven afstand tot een referentieniveau. |
| DE3342675A1 (de) * | 1983-11-25 | 1985-06-05 | Fa. Carl Zeiss, 7920 Heidenheim | Verfahren und vorrichtung zur beruehrungslosen vermessung von objekten |
| US4753528A (en) * | 1983-12-13 | 1988-06-28 | Quantime, Inc. | Laser archery distance device |
| GB8402086D0 (en) | 1984-01-26 | 1984-02-29 | Beecham Group Plc | Compounds |
| FI82471C (fi) | 1984-01-26 | 1991-03-11 | Beecham Group Plc | Foerfarande foer framstaellning av farmakologiskt aktiva 6-metylenpenemderivater. |
| EP0150984B1 (en) | 1984-01-30 | 1991-09-11 | Pfizer Inc. | 6-(substituted) methylenepenicillanic and 6-(substituted) hydroxymethylpenicillanic acids and derivatives thereof |
| US4841967A (en) * | 1984-01-30 | 1989-06-27 | Chang Ming Z | Positioning device for percutaneous needle insertion |
| US4583538A (en) * | 1984-05-04 | 1986-04-22 | Onik Gary M | Method and apparatus for stereotaxic placement of probes in the body utilizing CT scanner localization |
| EP0167050A1 (en) | 1984-06-21 | 1986-01-08 | Beecham Group Plc | Clavulanate compounds, their preparation and use and intermediates thereof |
| US4617925A (en) * | 1984-10-01 | 1986-10-21 | Laitinen Lauri V | Adapter for definition of the position of brain structures |
| US4618975A (en) * | 1984-12-21 | 1986-10-21 | At&T Technologies, Inc. | Method and apparatus for analyzing a porous nonhomogeneous cylindrical object |
| US4838265A (en) * | 1985-05-24 | 1989-06-13 | Cosman Eric R | Localization device for probe placement under CT scanner imaging |
| SE447848B (sv) * | 1985-06-14 | 1986-12-15 | Anders Bengtsson | Instrument for metning av ytors topografi |
| US4805615A (en) * | 1985-07-02 | 1989-02-21 | Carol Mark P | Method and apparatus for performing stereotactic surgery |
| GB8518422D0 (en) | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518416D0 (en) * | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518421D0 (en) * | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| US4737032A (en) * | 1985-08-26 | 1988-04-12 | Cyberware Laboratory, Inc. | Surface mensuration sensor |
| US4737794A (en) * | 1985-12-09 | 1988-04-12 | Mcdonnell Douglas Corporation | Method and apparatus for determining remote object orientation and position |
| US4742356A (en) * | 1985-12-09 | 1988-05-03 | Mcdonnell Douglas Corporation | Method and apparatus for determining remote object orientation and position |
| ATE159021T1 (de) | 1986-01-17 | 1997-10-15 | Beecham Group Plc | Verfahren zur herstellung von penem derivaten und zwischenprodukte zu dieser herstellung |
| SE469321B (sv) * | 1986-04-14 | 1993-06-21 | Joenkoepings Laens Landsting | Saett och anordning foer att framstaella en modifierad tredimensionell avbildning av ett elastiskt deformerbart foeremaal |
| US4821731A (en) * | 1986-04-25 | 1989-04-18 | Intra-Sonix, Inc. | Acoustic image system and method |
| US4822163A (en) * | 1986-06-26 | 1989-04-18 | Robotic Vision Systems, Inc. | Tracking vision sensor |
| US4723544A (en) * | 1986-07-09 | 1988-02-09 | Moore Robert R | Hemispherical vectoring needle guide for discolysis |
| US4733969A (en) * | 1986-09-08 | 1988-03-29 | Cyberoptics Corporation | Laser probe for determining distance |
| US4761072A (en) * | 1986-09-30 | 1988-08-02 | Diffracto Ltd. | Electro-optical sensors for manual control |
| US4750487A (en) * | 1986-11-24 | 1988-06-14 | Zanetti Paul H | Stereotactic frame |
| US4891369A (en) * | 1986-12-03 | 1990-01-02 | Taiho Pharmaceutical Company, Limited | 2β-Substituted-methylpenicillanic acid derivatives, and salts and esters thereof |
| DE3703422A1 (de) * | 1987-02-05 | 1988-08-18 | Zeiss Carl Fa | Optoelektronischer abstandssensor |
| US4745290A (en) * | 1987-03-19 | 1988-05-17 | David Frankel | Method and apparatus for use in making custom shoes |
| US4804261A (en) * | 1987-03-27 | 1989-02-14 | Kirschen David G | Anti-claustrophobic glasses |
| US4809694A (en) * | 1987-05-19 | 1989-03-07 | Ferrara Vincent L | Biopsy guide |
| DE3717871C3 (de) * | 1987-05-27 | 1995-05-04 | Georg Prof Dr Schloendorff | Verfahren und Vorrichtung zum reproduzierbaren optischen Darstellen eines chirururgischen Eingriffes |
| US4836778A (en) * | 1987-05-26 | 1989-06-06 | Vexcel Corporation | Mandibular motion monitoring system |
| DE3725375A1 (de) * | 1987-07-31 | 1989-02-09 | Bayer Ag | Stabile oxapenem-3-carbonsaeuren |
| US4829373A (en) * | 1987-08-03 | 1989-05-09 | Vexcel Corporation | Stereo mensuration apparatus |
| US4931056A (en) * | 1987-09-04 | 1990-06-05 | Neurodynamics, Inc. | Catheter guide apparatus for perpendicular insertion into a cranium orifice |
| JPS6472736A (en) * | 1987-09-14 | 1989-03-17 | Toshiba Corp | Mri apparatus |
| GB8724566D0 (en) | 1987-10-20 | 1987-11-25 | Roussel Lab Ltd | Chemical compounds |
| US4991579A (en) * | 1987-11-10 | 1991-02-12 | Allen George S | Method and apparatus for providing related images over time of a portion of the anatomy using fiducial implants |
| US5027818A (en) * | 1987-12-03 | 1991-07-02 | University Of Florida | Dosimetric technique for stereotactic radiosurgery same |
| GB8729614D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| GB8729613D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| US4869247A (en) * | 1988-03-11 | 1989-09-26 | The University Of Virginia Alumni Patents Foundation | Video tumor fighting system |
| US5099846A (en) * | 1988-12-23 | 1992-03-31 | Hardy Tyrone L | Method and apparatus for video presentation from a variety of scanner imaging sources |
| US5098426A (en) * | 1989-02-06 | 1992-03-24 | Phoenix Laser Systems, Inc. | Method and apparatus for precision laser surgery |
| US5197476A (en) * | 1989-03-16 | 1993-03-30 | Christopher Nowacki | Locating target in human body |
| US5285787A (en) * | 1989-09-12 | 1994-02-15 | Kabushiki Kaisha Toshiba | Apparatus for calculating coordinate data of desired point in subject to be examined |
| EP0427358B1 (en) * | 1989-11-08 | 1996-03-27 | George S. Allen | Mechanical arm for and interactive image-guided surgical system |
| NZ237202A (en) | 1990-02-23 | 1994-01-26 | Bristol Myers Squibb Co | Composition containing beta-lactam antibiotic and cationic oligopeptide |
| US5224049A (en) * | 1990-04-10 | 1993-06-29 | Mushabac David R | Method, system and mold assembly for use in preparing a dental prosthesis |
| US5107839A (en) * | 1990-05-04 | 1992-04-28 | Pavel V. Houdek | Computer controlled stereotaxic radiotherapy system and method |
| US5017139A (en) * | 1990-07-05 | 1991-05-21 | Mushabac David R | Mechanical support for hand-held dental/medical instrument |
| US5193106A (en) * | 1990-08-28 | 1993-03-09 | Desena Danforth | X-ray identification marker |
| EP0931516B1 (en) * | 1990-10-19 | 2008-08-20 | St. Louis University | Surgical probe locating system for head use |
| US5480439A (en) * | 1991-02-13 | 1996-01-02 | Lunar Corporation | Method for periprosthetic bone mineral density measurement |
| US5279309A (en) * | 1991-06-13 | 1994-01-18 | International Business Machines Corporation | Signaling device and method for monitoring positions in a surgical operation |
| GB9116236D0 (en) | 1991-07-27 | 1991-09-11 | Smithkline Beecham Plc | Novel compounds |
| US5207688A (en) * | 1991-10-31 | 1993-05-04 | Medco, Inc. | Noninvasive head fixation method and apparatus |
| US5330485A (en) * | 1991-11-01 | 1994-07-19 | Clayman David A | Cerebral instrument guide frame and procedures utilizing it |
| US5230623A (en) * | 1991-12-10 | 1993-07-27 | Radionics, Inc. | Operating pointer with interactive computergraphics |
| US5306271A (en) * | 1992-03-09 | 1994-04-26 | Izi Corporation | Radiation therapy skin markers |
| US5299253A (en) * | 1992-04-10 | 1994-03-29 | Akzo N.V. | Alignment system to overlay abdominal computer aided tomography and magnetic resonance anatomy with single photon emission tomography |
| US5389101A (en) * | 1992-04-21 | 1995-02-14 | University Of Utah | Apparatus and method for photogrammetric surgical localization |
| GB9222700D0 (en) * | 1992-10-29 | 1992-12-09 | Smithkline Beecham Plc | Chemical compounds |
| US5517990A (en) * | 1992-11-30 | 1996-05-21 | The Cleveland Clinic Foundation | Stereotaxy wand and tool guide |
| US5309913A (en) * | 1992-11-30 | 1994-05-10 | The Cleveland Clinic Foundation | Frameless stereotaxy system |
| US5799099A (en) * | 1993-02-12 | 1998-08-25 | George S. Allen | Automatic technique for localizing externally attached fiducial markers in volume images of the head |
| US5730130A (en) * | 1993-02-12 | 1998-03-24 | Johnson & Johnson Professional, Inc. | Localization cap for fiducial markers |
| US5483961A (en) * | 1993-03-19 | 1996-01-16 | Kelly; Patrick J. | Magnetic field digitizer for stereotactic surgery |
| DE69431875T2 (de) * | 1993-04-22 | 2003-05-28 | Image Guided Technologies, Inc. | Anordnung zur bestimmung der gegenseitigen lage von körpern |
| US5738096A (en) * | 1993-07-20 | 1998-04-14 | Biosense, Inc. | Cardiac electromechanics |
| US5391199A (en) * | 1993-07-20 | 1995-02-21 | Biosense, Inc. | Apparatus and method for treating cardiac arrhythmias |
| FR2709656B1 (fr) * | 1993-09-07 | 1995-12-01 | Deemed Int Sa | Installation pour opération de microchirurgie assistée par ordinateur et procédés mis en Óoeuvre par ladite installation. |
| DE9314075U1 (de) * | 1993-09-17 | 1994-01-20 | DWL Elektronische Systeme GmbH, 78354 Sipplingen | Vorrichtung zur Aufnahme wenigstens einer sonographischen Sonde |
| US5558091A (en) * | 1993-10-06 | 1996-09-24 | Biosense, Inc. | Magnetic determination of position and orientation |
| US5446548A (en) * | 1993-10-08 | 1995-08-29 | Siemens Medical Systems, Inc. | Patient positioning and monitoring system |
| US5394875A (en) * | 1993-10-21 | 1995-03-07 | Lewis; Judith T. | Automatic ultrasonic localization of targets implanted in a portion of the anatomy |
| GB9326248D0 (en) | 1993-12-23 | 1994-02-23 | Smithkline Beecham Plc | Pharmaceutical formulations |
| ES2206502T3 (es) | 1994-04-25 | 2004-05-16 | Smithkline Beecham Plc | Formulaciones farmaceuticas que contienen un penem inhibidor de beta-lactamasa en combinacion con un antibiotico de beta-lactama y su uso en el tratamiento de infecciones bacterianas. |
| US5600330A (en) * | 1994-07-12 | 1997-02-04 | Ascension Technology Corporation | Device for measuring position and orientation using non-dipole magnet IC fields |
| US5769861A (en) * | 1995-09-28 | 1998-06-23 | Brainlab Med. Computersysteme Gmbh | Method and devices for localizing an instrument |
| OA11666A (en) * | 1998-10-15 | 2004-12-08 | Sarawak Medichem Pharmaceuticals Inc | Method and composition for treating and preventingtuberculosis. |
| GB9928290D0 (en) * | 1999-12-01 | 2000-01-26 | Univ Belfast | Process for preparing ambient temperature ionic liquids |
| EP1199077A1 (en) * | 2000-10-19 | 2002-04-24 | Amura Limited | Stable compositions of oxapenem-3-carboxylic acids by Co-lyophilisation with pharmaceutical carriers |
| GB0106428D0 (en) * | 2001-03-15 | 2001-05-02 | Amura Ltd | Antibacterial composition |
| AR039774A1 (es) * | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR039476A1 (es) | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039475A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| AR046041A1 (es) * | 2003-10-03 | 2005-11-23 | Aventis Pharma Inc | Procedimiento para la preparacion de compuestos heterociclicos n-amino sustituidos |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| AU2006285308A1 (en) * | 2005-07-27 | 2007-03-08 | Wyeth | Tricyclic 6-alkylidene-penem beta-lactamase inhibitors and beta-lactam antibiotic combination: a broad spectrum antibiotic |
| RU2008102912A (ru) * | 2005-07-27 | 2009-09-10 | Вайет (Us) | Сочетание ингибиторов бетта-лактазмы бициклического 6-алкилиденпенема с бетта-лактанным антибиотиком: антибиотик широкого спектра |
-
2003
- 2003-04-28 AR ARP030101469A patent/AR039475A1/es not_active Application Discontinuation
- 2003-04-29 TW TW092110031A patent/TW200404809A/zh unknown
- 2003-04-30 CN CNB038097192A patent/CN100506825C/zh not_active Expired - Fee Related
- 2003-04-30 RU RU2004135086/04A patent/RU2004135086A/ru not_active Application Discontinuation
- 2003-04-30 UA UA20041109780A patent/UA78312C2/uk unknown
- 2003-04-30 EP EP03733911A patent/EP1499622B1/en not_active Expired - Lifetime
- 2003-04-30 NZ NZ536181A patent/NZ536181A/en unknown
- 2003-04-30 DK DK03733911T patent/DK1499622T3/da active
- 2003-04-30 BR BR0309878-8A patent/BR0309878A/pt not_active IP Right Cessation
- 2003-04-30 CA CA2483562A patent/CA2483562C/en not_active Expired - Fee Related
- 2003-04-30 AU AU2003239325A patent/AU2003239325B8/en not_active Ceased
- 2003-04-30 KR KR10-2004-7017588A patent/KR20050007366A/ko not_active Withdrawn
- 2003-04-30 WO PCT/US2003/013451 patent/WO2003093280A1/en not_active Ceased
- 2003-04-30 MX MXPA04010662A patent/MXPA04010662A/es active IP Right Grant
- 2003-04-30 DE DE60326562T patent/DE60326562D1/de not_active Expired - Lifetime
- 2003-04-30 ES ES03733911T patent/ES2322951T3/es not_active Expired - Lifetime
- 2003-04-30 JP JP2004501419A patent/JP4472515B2/ja not_active Expired - Lifetime
- 2003-04-30 AT AT03733911T patent/ATE425169T1/de not_active IP Right Cessation
- 2003-05-01 US US10/427,427 patent/US7018997B2/en not_active Expired - Fee Related
-
2004
- 2004-10-22 NO NO20044550A patent/NO20044550L/no not_active Application Discontinuation
- 2004-10-28 IL IL16489804A patent/IL164898A0/xx unknown
- 2004-10-29 EC EC2004005405A patent/ECSP045405A/es unknown
- 2004-11-30 ZA ZA200409691A patent/ZA200409691B/xx unknown
-
2005
- 2005-11-18 US US11/283,288 patent/US20060074064A1/en not_active Abandoned
-
2008
- 2008-08-07 US US12/187,707 patent/US7691842B2/en not_active Expired - Fee Related
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2011500774A5 (enExample) | ||
| RU2412171C2 (ru) | Новое соединение пиперазина и его применение в качестве ингибитора hcv полимеразы | |
| JP2005533018A5 (enExample) | ||
| JP2005533017A5 (enExample) | ||
| US20240166669A1 (en) | Quinazoline amine derivatives as kras inhibitors | |
| KR20150100879A (ko) | Ａ2ａ 길항제 성질을 갖는 헤테로비시클로-치환된-[1,2,4]트리아졸로[1,5-ｃ]퀴나졸린-5-아민 화합물 | |
| JPWO2023018810A5 (enExample) | ||
| WO2011035518A1 (zh) | 嘧啶衍生物和类似物及其制备方法和用途 | |
| CA2600832A1 (en) | Hiv integrase inhibitors | |
| JP2017503867A5 (enExample) | ||
| JP2013519707A5 (enExample) | ||
| RU2003116895A (ru) | Производные бензодиазепина в качестве модуляторов а рецептора гамк | |
| JP2014513139A5 (enExample) | ||
| CA2954189A1 (en) | 2-amino-pyrido[2,3-d]pyrimidin-7(8h)-one derivatives as cdk inhibitors and uses thereof | |
| RU2004135082A (ru) | Бициклические 6-алкилиденпенемы в качестве ингибиторов в-лактамаз | |
| KR20100024932A (ko) | 비사이클로아닐린 유도체 | |
| JP2009536189A5 (enExample) | ||
| RU2004135086A (ru) | Гетероциклил-6-алкилиденпенемы в качестве ингибиторов бета-лактамазы | |
| US20230143612A1 (en) | Substituted 1,1'-biphenyl compounds and methods using same | |
| JP2008542376A5 (enExample) | ||
| CA2474823A1 (en) | Heteroaryl substituted 2-pyridinyl and 2-pyrimidinyl-6,7,8,9-tetrahydropyrimido[1,2-a] pyrimidin-4-one derivatives | |
| JP2010539169A (ja) | ヒスタミンｈ４受容体のチエノ−及びフロ−ピリミジン調節物質 | |
| CA2607151A1 (en) | Hiv integrase inhibitors | |
| WO2013042035A4 (en) | Heterocyclic compounds as inhibitors of fatty acid biosynthesis for bacterial infections | |
| AU2006287938A1 (en) | Tricyclic 6-alkylidene-penems as class-D beta-Lactamases inhibitors |