IL34052A - Manufacture of anthelmintic compounds - Google Patents
Manufacture of anthelmintic compoundsInfo
- Publication number
- IL34052A IL34052A IL34052A IL3405266A IL34052A IL 34052 A IL34052 A IL 34052A IL 34052 A IL34052 A IL 34052A IL 3405266 A IL3405266 A IL 3405266A IL 34052 A IL34052 A IL 34052A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- compound
- hydroxy
- reaction
- aziridine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 109
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- 230000000507 anthelmentic effect Effects 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 74
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 58
- 238000000034 method Methods 0.000 claims description 57
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 48
- -1 hydroxyrnethyl Chemical group 0.000 claims description 34
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 26
- 239000002253 acid Substances 0.000 claims description 24
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 22
- 125000004423 acyloxy group Chemical group 0.000 claims description 15
- 239000003960 organic solvent Substances 0.000 claims description 15
- 239000007795 chemical reaction product Substances 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 230000002140 halogenating effect Effects 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 7
- 239000001117 sulphuric acid Substances 0.000 claims description 7
- 235000011149 sulphuric acid Nutrition 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 4
- 239000007791 liquid phase Substances 0.000 claims description 4
- 238000000746 purification Methods 0.000 claims description 4
- DTEAMMSJXLXUOQ-UHFFFAOYSA-N 1-hydroxyaziridine Chemical class ON1CC1 DTEAMMSJXLXUOQ-UHFFFAOYSA-N 0.000 claims description 3
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 230000026030 halogenation Effects 0.000 claims description 3
- 238000005658 halogenation reaction Methods 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 150000002118 epoxides Chemical class 0.000 claims 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- 125000000335 thiazolyl group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 56
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 52
- 239000000047 product Substances 0.000 description 44
- 238000003756 stirring Methods 0.000 description 40
- 238000003786 synthesis reaction Methods 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- 239000000203 mixture Substances 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 230000015572 biosynthetic process Effects 0.000 description 26
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 24
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- 238000001816 cooling Methods 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 15
- 238000002474 experimental method Methods 0.000 description 14
- 235000002639 sodium chloride Nutrition 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- MPGQQQKGAXDBDN-UHFFFAOYSA-N 1,3-thiazolidin-3-ium;chloride Chemical compound Cl.C1CSCN1 MPGQQQKGAXDBDN-UHFFFAOYSA-N 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 235000017550 sodium carbonate Nutrition 0.000 description 12
- 229910000029 sodium carbonate Inorganic materials 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 238000004821 distillation Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 229940122930 Alkalising agent Drugs 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- 238000005481 NMR spectroscopy Methods 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000013078 crystal Substances 0.000 description 8
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- HXCSOQNQZVYAJC-UHFFFAOYSA-N 2-(2-amino-4,5-dihydro-1,3-thiazol-3-ium-3-yl)-1-phenylethanol;chloride Chemical compound Cl.C=1C=CC=CC=1C(O)CN1CCSC1=N HXCSOQNQZVYAJC-UHFFFAOYSA-N 0.000 description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 7
- 238000004566 IR spectroscopy Methods 0.000 description 7
- 150000001541 aziridines Chemical class 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 150000002924 oxiranes Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000012535 impurity Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 235000013601 eggs Nutrition 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000003495 polar organic solvent Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 241001494479 Pecora Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229960004132 diethyl ether Drugs 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- UMXQKYKVTFWGDS-UHFFFAOYSA-N 1,3-thiazolidine;dihydrochloride Chemical compound Cl.Cl.C1CSCN1 UMXQKYKVTFWGDS-UHFFFAOYSA-N 0.000 description 2
- UTHQDRBQLOYOFO-UHFFFAOYSA-N 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol Chemical compound C=1C=CC=CC=1C(O)CN1CCSC1=N UTHQDRBQLOYOFO-UHFFFAOYSA-N 0.000 description 2
- PRXIDJYGMHLZDW-UHFFFAOYSA-N 2-(4-hexyl-2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol;hydrochloride Chemical compound Cl.CCCCCCC1CSC(=N)N1CC(O)C1=CC=CC=C1 PRXIDJYGMHLZDW-UHFFFAOYSA-N 0.000 description 2
- LYWIFGDFJLWXHK-UHFFFAOYSA-N 2-(aziridin-1-yl)-1-phenylethanol Chemical compound C=1C=CC=CC=1C(O)CN1CC1 LYWIFGDFJLWXHK-UHFFFAOYSA-N 0.000 description 2
- HXDLWJWIAHWIKI-UHFFFAOYSA-N 2-hydroxyethyl acetate Chemical compound CC(=O)OCCO HXDLWJWIAHWIKI-UHFFFAOYSA-N 0.000 description 2
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 241000238680 Rhipicephalus microplus Species 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000000740 bleeding effect Effects 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- UFBBWLWUIISIPW-UHFFFAOYSA-N imidazo[2,1-b][1,3]thiazole Chemical class C1=CSC2=NC=CN21 UFBBWLWUIISIPW-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 2
- OOCCDEMITAIZTP-QPJJXVBHSA-N (E)-cinnamyl alcohol Chemical compound OC\C=C\C1=CC=CC=C1 OOCCDEMITAIZTP-QPJJXVBHSA-N 0.000 description 1
- APMHRYRHZJQTSA-UHFFFAOYSA-N 1-(2-imino-1,3-thiazolidin-3-yl)-3-phenylsulfanylpropan-2-ol;hydrochloride Chemical compound Cl.C1CSC(=N)N1CC(O)CSC1=CC=CC=C1 APMHRYRHZJQTSA-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- MYBWNWNBXBBZKW-UHFFFAOYSA-N 2-(phenylsulfanylmethyl)oxirane Chemical compound C1OC1CSC1=CC=CC=C1 MYBWNWNBXBBZKW-UHFFFAOYSA-N 0.000 description 1
- OZDGMOYKSFPLSE-UHFFFAOYSA-N 2-Methylaziridine Chemical compound CC1CN1 OZDGMOYKSFPLSE-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- KTRZJULHTZAXIS-UHFFFAOYSA-N 2-thiophen-2-yloxirane Chemical compound C1OC1C1=CC=CS1 KTRZJULHTZAXIS-UHFFFAOYSA-N 0.000 description 1
- SLSPULKVKMZFGW-UHFFFAOYSA-N 3-(2-chloro-2-phenylethyl)-1,3-thiazolidin-2-imine;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(Cl)CN1CCSC1=N SLSPULKVKMZFGW-UHFFFAOYSA-N 0.000 description 1
- YGQMTLYPYKQIFV-UHFFFAOYSA-N 3-(aziridin-1-yl)propane-1,2-diol Chemical compound OCC(O)CN1CC1 YGQMTLYPYKQIFV-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- 101000903594 Haloarcula argentinensis Cruxhalorhodopsin-1 Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LIMFPAAAIVQRRD-BCGVJQADSA-N N-[2-[(3S,4R)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine Chemical compound F[C@H]1CN(CC[C@H]1OC)C1=NC=CC(=N1)NC=1N=CC2=C(C=CC(=C2C=1)C(C)C)N1[C@@H]([C@H](C1)CS(=O)(=O)C)C LIMFPAAAIVQRRD-BCGVJQADSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LAZPBGZRMVRFKY-UHFFFAOYSA-N Tetramisole hydrochloride Chemical compound Cl.N1=C2SCCN2CC1C1=CC=CC=C1 LAZPBGZRMVRFKY-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- ONXFNBOZJKXCNC-ZJSXRUAMSA-N [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxy-1,1-dioxothian-4-yl)methanone Chemical compound OC1(CCS(=O)(=O)CC1)C(=O)N1CC[C@@]2([C@H]1CCc1cc(ccc21)C(F)(C(F)(F)F)C(F)(F)F)S(=O)(=O)c1ccc(F)cc1 ONXFNBOZJKXCNC-ZJSXRUAMSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- IZBYBANKJXOIRN-UHFFFAOYSA-N ethylthiourea dihydrochloride Chemical compound Cl.Cl.C(C)NC(S)=N IZBYBANKJXOIRN-UHFFFAOYSA-N 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- UVNXNSUKKOLFBM-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=CSC2=NC=CN21 UVNXNSUKKOLFBM-UHFFFAOYSA-N 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002913 oxalic acids Chemical class 0.000 description 1
- SMPAPEKFGLKOIC-UHFFFAOYSA-N oxolane;hydrochloride Chemical compound Cl.C1CCOC1 SMPAPEKFGLKOIC-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003567 thiocyanates Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- XJVIPPHGDPEDJL-UHFFFAOYSA-N thiourea;hydrochloride Chemical compound Cl.NC(N)=S XJVIPPHGDPEDJL-UHFFFAOYSA-N 0.000 description 1
- 238000006257 total synthesis reaction Methods 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
- C07D203/10—Radicals substituted by singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU61653/65A AU409983B2 (en) | 1965-07-19 | 1965-07-19 | Process for the manufacture of thia zolidines and thiazolidines produced thereby |
| AU6193165 | 1965-07-26 | ||
| AU6341565 | 1965-08-31 | ||
| AU6378665 | 1965-09-08 | ||
| US56509266A | 1966-07-14 | 1966-07-14 | |
| US00240773A US3828061A (en) | 1965-07-19 | 1972-04-03 | Multi-step process for preparing 2,3,5,6-tetrahydroimidazo(2,1-b)thiazoles |
| US240827A US3862166A (en) | 1965-07-19 | 1972-04-03 | Certain 3-haloethyl-2-iminothiazolidine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL34052A true IL34052A (en) | 1970-08-19 |
Family
ID=27560622
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34052A IL34052A (en) | 1965-07-19 | 1966-07-11 | Manufacture of anthelmintic compounds |
| IL34051A IL34051A (en) | 1965-07-19 | 1966-07-11 | Process of manufacture of thiazolidines |
| IL26123A IL26123A (en) | 1965-07-19 | 1966-07-11 | Process of manufacture of aziridines |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34051A IL34051A (en) | 1965-07-19 | 1966-07-11 | Process of manufacture of thiazolidines |
| IL26123A IL26123A (en) | 1965-07-19 | 1966-07-11 | Process of manufacture of aziridines |
Country Status (14)
| Country | Link |
|---|---|
| US (4) | US3759937A (ro) |
| AU (1) | AU409983B2 (ro) |
| BE (1) | BE684340A (ro) |
| BR (1) | BR6681363D0 (ro) |
| CH (2) | CH562233A5 (ro) |
| CS (2) | CS155143B2 (ro) |
| DE (3) | DE1795651C3 (ro) |
| DK (1) | DK125996B (ro) |
| FR (1) | FR1502712A (ro) |
| GB (3) | GB1131799A (ro) |
| IL (3) | IL34052A (ro) |
| NL (1) | NL6610166A (ro) |
| SE (2) | SE370078B (ro) |
| YU (2) | YU32997B (ro) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| OA04567A (fr) * | 1972-11-30 | 1980-05-31 | Rhone Poulenc Sa | Nouveaux dérivés de l'imidazo (2,1-b) thiazole et leur préparation. |
| GB1475891A (en) * | 1973-06-18 | 1977-06-10 | American Cyanamid Co | Method of preparing dl-or l-tetramisole and acid addition salts thereof |
| US4107170A (en) * | 1975-10-29 | 1978-08-15 | American Cyanamid Company | Method of preparing dl 6-phenyl-2,3,5,6-tetrahydroimidazo-[2,1-b]thiazole and acid addition salts thereof |
| GB1533347A (en) * | 1976-10-22 | 1978-11-22 | Pfizer Ltd | Anthelmintic compounds |
| CA2028756A1 (en) * | 1989-11-24 | 1991-05-25 | Alfons H. M. Raeymaekers | Immunostimulating 6-aryl-5,6-dihydro-imidazo[2,1-b]thiazole derivatives |
| US6291370B1 (en) * | 1999-09-01 | 2001-09-18 | Harodite Industries, Inc. | Chopped fiberglass laminate for automotive headliners and method of fabrication |
| ATE498404T1 (de) * | 2003-12-09 | 2011-03-15 | Novo Nordisk As | Regulierung der nahrungspräferenz mit glp-1- agonisten |
| JP2008501765A (ja) * | 2004-06-11 | 2008-01-24 | ノボ ノルディスク アクティーゼルスカブ | Glp−1アゴニストを用いた薬剤誘発性肥満の中和 |
| CN111377949B (zh) * | 2020-03-18 | 2021-05-14 | 山东国邦药业有限公司 | 一种四咪唑游离碱制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3624099A (en) * | 1965-10-05 | 1971-11-30 | American Cyanamid Co | Process of preparing 2 -imino-{60 phenyl 3-thiazolidineethanol acid salts |
| US3679696A (en) * | 1965-10-05 | 1972-07-25 | American Cyanamid Co | METHOD OF PREPARING d1 6-PHENYL-2,3,5,6-TETRAHYDROIMIDAZO {8 2,1-b{9 -THIAZOLE HYDROCHLORIDE |
| US3642809A (en) * | 1965-10-05 | 1972-02-15 | American Cyanamid Co | Method for producing 2 3 5 6-tetra hydroimidazo-(2 1-b)thiazoles |
| US3547996A (en) * | 1965-10-05 | 1970-12-15 | American Cyanamid Co | Di 2 - (2 - ((beta - hydroxyphenethyl)amino)ethyl) - 2 - thiopseudourea and hydrochloride salt thereof |
| US3297708A (en) * | 1965-10-06 | 1967-01-10 | American Cyanamid Co | Method of preparing thiazolidines |
| NL129632C (ro) * | 1965-12-10 |
-
1965
- 1965-07-19 AU AU61653/65A patent/AU409983B2/en not_active Expired
-
1966
- 1966-07-04 GB GB33971/67A patent/GB1131799A/en not_active Expired
- 1966-07-04 GB GB33972/67A patent/GB1131800A/en not_active Expired
- 1966-07-04 GB GB29834/66A patent/GB1131798A/en not_active Expired
- 1966-07-11 IL IL34052A patent/IL34052A/en unknown
- 1966-07-11 IL IL34051A patent/IL34051A/xx unknown
- 1966-07-11 IL IL26123A patent/IL26123A/xx unknown
- 1966-07-13 DE DE1795651A patent/DE1795651C3/de not_active Expired
- 1966-07-13 DE DE19661695249 patent/DE1695249A1/de active Pending
- 1966-07-13 DE DE19661795650 patent/DE1795650A1/de active Pending
- 1966-07-14 US US00565092A patent/US3759937A/en not_active Expired - Lifetime
- 1966-07-18 SE SE13384/68A patent/SE370078B/xx unknown
- 1966-07-18 SE SE9822/66A patent/SE323382B/xx unknown
- 1966-07-18 BR BR181363/66A patent/BR6681363D0/pt unknown
- 1966-07-18 FR FR69792A patent/FR1502712A/fr not_active Expired
- 1966-07-19 YU YU1401/66A patent/YU32997B/xx unknown
- 1966-07-19 NL NL6610166A patent/NL6610166A/xx unknown
- 1966-07-19 CH CH1104069A patent/CH562233A5/xx not_active IP Right Cessation
- 1966-07-19 CS CS348072*1A patent/CS155143B2/cs unknown
- 1966-07-19 CH CH1040966A patent/CH490376A/de not_active IP Right Cessation
- 1966-07-19 CS CS487666A patent/CS155142B2/cs unknown
- 1966-07-19 BE BE684340D patent/BE684340A/xx unknown
-
1969
- 1969-09-17 DK DK496169AA patent/DK125996B/da unknown
-
1971
- 1971-12-08 US US206155A patent/US3927097A/en not_active Expired - Lifetime
-
1972
- 1972-04-03 US US00240773A patent/US3828061A/en not_active Expired - Lifetime
- 1972-04-03 US US240827A patent/US3862166A/en not_active Expired - Lifetime
-
1973
- 1973-03-13 YU YU00654/73A patent/YU65473A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1131800A (en) | 1968-10-30 |
| DE1695249A1 (de) | 1970-09-17 |
| DE1795650A1 (de) | 1973-05-24 |
| DK125996B (da) | 1973-05-28 |
| AU409983B2 (en) | 1970-12-31 |
| YU140166A (en) | 1975-08-31 |
| BR6681363D0 (pt) | 1973-12-27 |
| GB1131798A (en) | 1968-10-30 |
| DE1795651B2 (de) | 1979-01-04 |
| CH562233A5 (ro) | 1975-05-30 |
| DE1795651A1 (de) | 1973-04-12 |
| DE1795652A1 (de) | 1972-10-26 |
| IL34051A (en) | 1970-08-19 |
| SE370078B (ro) | 1974-09-30 |
| BE684340A (ro) | 1967-01-19 |
| DE1795651C3 (de) | 1979-09-13 |
| DE1795652B2 (de) | 1977-01-20 |
| CH490376A (de) | 1970-05-15 |
| YU32997B (en) | 1976-03-31 |
| YU65473A (en) | 1982-05-31 |
| SE323382B (ro) | 1970-05-04 |
| NL6610166A (ro) | 1967-01-20 |
| US3862166A (en) | 1975-01-21 |
| US3759937A (en) | 1973-09-18 |
| IL26123A (en) | 1970-08-19 |
| FR1502712A (fr) | 1967-11-24 |
| GB1131799A (en) | 1968-10-30 |
| US3927097A (en) | 1975-12-16 |
| CS155143B2 (ro) | 1974-05-30 |
| CS155142B2 (ro) | 1974-05-30 |
| US3828061A (en) | 1974-08-06 |
| AU6165365A (en) | 1968-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3960949A (en) | 1,2-Biguanides | |
| FI62529B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara etnolaminderivat | |
| CA2585084A1 (en) | Tetracyclic indole derivatives as antiviral agents | |
| CA1047042A (en) | Thienyl and thietyl compounds | |
| HU184259B (en) | Process for producing 2-imidazoline derivatives | |
| IL34052A (en) | Manufacture of anthelmintic compounds | |
| KR860000320B1 (ko) | N-치환 아지리딘-2-카르복실산 유도체의 제조방법 | |
| US3988464A (en) | Cyclopropylamines as pharmaceuticals | |
| US4059588A (en) | Process for preparing 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole | |
| US9908846B2 (en) | Composition, synthesis, and use of new arylsulfonyl isonitriles | |
| US3547937A (en) | Certain 4-thiazolecarboxamidines | |
| US3850946A (en) | 3-thiazol-5'-oxy-aminopropanol cardiovascular agents | |
| US3850947A (en) | 3-thiazol-4'-oxy-aminopropanol cardiovascular agents | |
| US4826861A (en) | Novel heterocyclic compounds substituted with an amino group, their processes of manufacture and the pharmaceutical compositions containing them | |
| JPH0115506B2 (ro) | ||
| US3624099A (en) | Process of preparing 2 -imino-{60 phenyl 3-thiazolidineethanol acid salts | |
| HU198915B (en) | Process for producing new 2-thiazolidinone derivatives and pharmaceutical compositions containing them | |
| JPS6391374A (ja) | 炭酸水素イミダゾリウム | |
| Touimi Benjelloun et al. | 5‐aminothiazolium salts as potential cyclic azomethine ylides: Base‐induced cycloaddition reactions with aryl, alkyl, and benzoyl isothiocyanates | |
| US3391152A (en) | Methods of preparing thiadiazoles | |
| US4118501A (en) | Thiazolidine derivatives | |
| US3432520A (en) | Preparation of 2-imidazolone derivatives by catalytic cyclization | |
| FI67212B (fi) | Foerfarande foer framstaellning av nya saosom laekemedel anvaendbara aziridin-derivat | |
| US4156735A (en) | Thiazolidine derivatives | |
| US3519643A (en) | Sulfonylurea derivatives |