IE50865B1 - Process for the preparation of 3'-bromo-substituted deacetoxycephalosporanic acid sulphoxide derivatives - Google Patents
Process for the preparation of 3'-bromo-substituted deacetoxycephalosporanic acid sulphoxide derivativesInfo
- Publication number
- IE50865B1 IE50865B1 IE286/81A IE28681A IE50865B1 IE 50865 B1 IE50865 B1 IE 50865B1 IE 286/81 A IE286/81 A IE 286/81A IE 28681 A IE28681 A IE 28681A IE 50865 B1 IE50865 B1 IE 50865B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- trimethylsilyl
- mmoles
- oxide
- cephem
- Prior art date
Links
- -1 deacetoxycephalosporanic acid sulphoxide derivatives Chemical class 0.000 title claims abstract description 33
- 238000000034 method Methods 0.000 title claims description 51
- 238000002360 preparation method Methods 0.000 title claims description 8
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000003960 organic solvent Substances 0.000 claims abstract description 4
- 238000011065 in-situ storage Methods 0.000 claims abstract description 3
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 126
- 238000005893 bromination reaction Methods 0.000 claims description 82
- 230000031709 bromination Effects 0.000 claims description 80
- 239000003795 chemical substances by application Substances 0.000 claims description 76
- 239000000203 mixture Substances 0.000 claims description 72
- 239000002253 acid Substances 0.000 claims description 55
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 54
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical group C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 claims description 46
- 150000001875 compounds Chemical class 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 9
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 8
- 238000006884 silylation reaction Methods 0.000 claims description 8
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims description 6
- RPVBFFYNFVTCBX-UHFFFAOYSA-N 1-trimethylsilylazepan-2-one Chemical compound C[Si](C)(C)N1CCCCCC1=O RPVBFFYNFVTCBX-UHFFFAOYSA-N 0.000 claims description 5
- MSPCIZMDDUQPGJ-UHFFFAOYSA-N N-methyl-N-(trimethylsilyl)trifluoroacetamide Chemical compound C[Si](C)(C)N(C)C(=O)C(F)(F)F MSPCIZMDDUQPGJ-UHFFFAOYSA-N 0.000 claims description 5
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 5
- DGIJAZGPLFOQJE-UHFFFAOYSA-N trimethylsilyl n-trimethylsilylcarbamate Chemical compound C[Si](C)(C)NC(=O)O[Si](C)(C)C DGIJAZGPLFOQJE-UHFFFAOYSA-N 0.000 claims description 5
- DJDBZHRIKZSDOX-UHFFFAOYSA-N trimethylsilyl n-trimethylsilylsulfamate Chemical compound C[Si](C)(C)NS(=O)(=O)O[Si](C)(C)C DJDBZHRIKZSDOX-UHFFFAOYSA-N 0.000 claims description 5
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- BLUMSOONSFWPGU-UHFFFAOYSA-N n-trimethylsilylbenzamide Chemical compound C[Si](C)(C)NC(=O)C1=CC=CC=C1 BLUMSOONSFWPGU-UHFFFAOYSA-N 0.000 claims description 4
- UJXZOGCYFWARKH-UHFFFAOYSA-N n-trimethylsilylbenzenesulfonamide Chemical compound C[Si](C)(C)NS(=O)(=O)C1=CC=CC=C1 UJXZOGCYFWARKH-UHFFFAOYSA-N 0.000 claims description 4
- 239000001117 sulphuric acid Substances 0.000 claims description 4
- 235000011149 sulphuric acid Nutrition 0.000 claims description 4
- YUWVMABNHZEMGO-UHFFFAOYSA-N 1-trimethylsilylpyrrolidine-2,5-dione Chemical compound C[Si](C)(C)N1C(=O)CCC1=O YUWVMABNHZEMGO-UHFFFAOYSA-N 0.000 claims description 3
- ASABUEJOVHOJSW-UHFFFAOYSA-N 2,2,2-trichloro-n-trimethylsilylacetamide Chemical compound C[Si](C)(C)NC(=O)C(Cl)(Cl)Cl ASABUEJOVHOJSW-UHFFFAOYSA-N 0.000 claims description 3
- AUKCYOUETBBMFV-UHFFFAOYSA-N 3-trimethylsilyl-1,3-oxazolidin-2-one Chemical compound C[Si](C)(C)N1CCOC1=O AUKCYOUETBBMFV-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 claims description 3
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 claims description 3
- FSJQEJPDCPNWLC-UHFFFAOYSA-N ethyl n-trimethylsilylcarbamate Chemical compound CCOC(=O)N[Si](C)(C)C FSJQEJPDCPNWLC-UHFFFAOYSA-N 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 3
- YBADLXQNJCMBKR-UHFFFAOYSA-N (4-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-N 0.000 claims description 2
- GJNCXCPHNRATIQ-UHFFFAOYSA-N 1-bromoazepan-2-one Chemical compound BrN1CCCCCC1=O GJNCXCPHNRATIQ-UHFFFAOYSA-N 0.000 claims description 2
- JTTBJCQUBWXUHW-UHFFFAOYSA-N 2,2-dimethyl-n-trimethylsilylpropanamide Chemical compound CC(C)(C)C(=O)N[Si](C)(C)C JTTBJCQUBWXUHW-UHFFFAOYSA-N 0.000 claims description 2
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 claims description 2
- UGTLNHLTOZDVCT-UHFFFAOYSA-N 3-bromo-4,4-dimethyl-1,3-oxazolidin-2-one Chemical compound CC1(C)COC(=O)N1Br UGTLNHLTOZDVCT-UHFFFAOYSA-N 0.000 claims description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 claims description 2
- XLSYAWHCTYEHRB-UHFFFAOYSA-N 4-nitro-n-trimethylsilylbenzamide Chemical compound C[Si](C)(C)NC(=O)C1=CC=C([N+]([O-])=O)C=C1 XLSYAWHCTYEHRB-UHFFFAOYSA-N 0.000 claims description 2
- XCOBLONWWXQEBS-KPKJPENVSA-N N,O-bis(trimethylsilyl)trifluoroacetamide Chemical compound C[Si](C)(C)O\C(C(F)(F)F)=N\[Si](C)(C)C XCOBLONWWXQEBS-KPKJPENVSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000004202 carbamide Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 235000019253 formic acid Nutrition 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000003949 imides Chemical class 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- FRCLVJBDJNNNGI-UHFFFAOYSA-N n,n-bis(trimethylsilyl)formamide Chemical compound C[Si](C)(C)N(C=O)[Si](C)(C)C FRCLVJBDJNNNGI-UHFFFAOYSA-N 0.000 claims description 2
- GYAAKRVFWOWPPA-UHFFFAOYSA-N n-acetyl-n-trimethylsilylacetamide Chemical compound CC(=O)N(C(C)=O)[Si](C)(C)C GYAAKRVFWOWPPA-UHFFFAOYSA-N 0.000 claims description 2
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical compound NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 claims description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 2
- SIOVKLKJSOKLIF-HJWRWDBZSA-N trimethylsilyl (1z)-n-trimethylsilylethanimidate Chemical compound C[Si](C)(C)OC(/C)=N\[Si](C)(C)C SIOVKLKJSOKLIF-HJWRWDBZSA-N 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims 2
- PBQJFYWCFSNZAL-UHFFFAOYSA-N 1-bromoimidazolidine-2,4-dione Chemical compound BrN1CC(=O)NC1=O PBQJFYWCFSNZAL-UHFFFAOYSA-N 0.000 claims 1
- SZFQJJPRLABCKB-UHFFFAOYSA-N 1-trimethylsilylimidazolidine-2,4-dione Chemical compound C[Si](C)(C)N1CC(=O)NC1=O SZFQJJPRLABCKB-UHFFFAOYSA-N 0.000 claims 1
- QKSGIGXOKHZCQZ-UHFFFAOYSA-N 2-chloro-2-phenylacetic acid Chemical compound OC(=O)C(Cl)C1=CC=CC=C1 QKSGIGXOKHZCQZ-UHFFFAOYSA-N 0.000 claims 1
- ZRAPHEBMDYQXKR-UHFFFAOYSA-N 2-trimethylsilylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N([Si](C)(C)C)C(=O)C2=C1 ZRAPHEBMDYQXKR-UHFFFAOYSA-N 0.000 claims 1
- QTDORDRKRNHFAS-UHFFFAOYSA-N 3-bromo-1,3-oxazolidin-2-one Chemical compound BrN1CCOC1=O QTDORDRKRNHFAS-UHFFFAOYSA-N 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 1
- AKRJDKUHSNFQQC-UHFFFAOYSA-N diethoxy-trimethylsilylimino-trimethylsilyloxy-$l^{5}-phosphane Chemical compound CCOP(OCC)(O[Si](C)(C)C)=N[Si](C)(C)C AKRJDKUHSNFQQC-UHFFFAOYSA-N 0.000 claims 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 claims 1
- 229940091173 hydantoin Drugs 0.000 claims 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims 1
- 229940124530 sulfonamide Drugs 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 7
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 abstract description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 258
- 239000000243 solution Substances 0.000 description 98
- 238000010992 reflux Methods 0.000 description 52
- 239000000725 suspension Substances 0.000 description 40
- PHIMLNXVWFHTLQ-MYXBAGLQSA-N (6r)-3-methyl-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2=O)C)C(O)=O)NC(=O)CC1=CC=CC=C1 PHIMLNXVWFHTLQ-MYXBAGLQSA-N 0.000 description 35
- SDXAAZSIHFTITI-GVMQWFMMSA-N trimethylsilyl (6r)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)O[Si](C)(C)C)NC(=O)CC1=CC=CC=C1 SDXAAZSIHFTITI-GVMQWFMMSA-N 0.000 description 25
- 238000003756 stirring Methods 0.000 description 22
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- HRZNDPUIXBTALJ-GGKQNVFXSA-N (6r)-7-benzamido-3-methyl-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2=O)C)C(O)=O)NC(=O)C1=CC=CC=C1 HRZNDPUIXBTALJ-GGKQNVFXSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 238000005481 NMR spectroscopy Methods 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- WSDHYKRPZXLCDH-HNAYCGQISA-N trimethylsilyl (6r)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)O[Si](C)(C)C)NC(=O)C1=CC=CC=C1 WSDHYKRPZXLCDH-HNAYCGQISA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- KRUQDZRWZXUUAD-UHFFFAOYSA-N bis(trimethylsilyl) sulfate Chemical compound C[Si](C)(C)OS(=O)(=O)O[Si](C)(C)C KRUQDZRWZXUUAD-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 229930186147 Cephalosporin Natural products 0.000 description 5
- 229930182555 Penicillin Natural products 0.000 description 5
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 5
- 229940124587 cephalosporin Drugs 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 5
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 5
- 229910052721 tungsten Inorganic materials 0.000 description 5
- 239000010937 tungsten Substances 0.000 description 5
- MDLVBAPTXLJSFJ-FSTVUMLOSA-N (6r)-7-formamido-3-methyl-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O=S1CC(C)=C(C(O)=O)N2C(=O)C(NC=O)[C@H]21 MDLVBAPTXLJSFJ-FSTVUMLOSA-N 0.000 description 4
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000001780 cephalosporins Chemical class 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- 230000001678 irradiating effect Effects 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- RFVYWXRGKHMFFO-JNKNCIAKSA-N (6r)-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS(=O)[C@@H]2CC(=O)N12 RFVYWXRGKHMFFO-JNKNCIAKSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- UWIYOAXTJCLKQB-BPVMPSCISA-N (6r)-4-acetamido-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O=S1C(NC(=O)C)C=C(C(O)=O)N2C(=O)C[C@H]21 UWIYOAXTJCLKQB-BPVMPSCISA-N 0.000 description 2
- QHJAVRPYCXAFCF-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)imidazolidine-2,4-dione Chemical compound C[Si](C)(C)N1CC(=O)N([Si](C)(C)C)C1=O QHJAVRPYCXAFCF-UHFFFAOYSA-N 0.000 description 2
- YWYQYHSKOJIBGE-UHFFFAOYSA-N 1-bromo-4,4-dimethylpiperidine-2,6-dione Chemical compound CC1(C)CC(=O)N(Br)C(=O)C1 YWYQYHSKOJIBGE-UHFFFAOYSA-N 0.000 description 2
- MARXMDRWROUXMD-UHFFFAOYSA-N 2-bromoisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Br)C(=O)C2=C1 MARXMDRWROUXMD-UHFFFAOYSA-N 0.000 description 2
- GCBXXRPFVSAYKI-UHFFFAOYSA-N 2-trimethylsilyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione Chemical compound C1CCCC2C(=O)N([Si](C)(C)C)C(=O)C21 GCBXXRPFVSAYKI-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000007256 debromination reaction Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- KGIRVDITHCHNFA-XDVAXFRJSA-N methyl (6r)-7-benzamido-3-methyl-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(C)=C(N2C1=O)C(=O)OC)NC(=O)C1=CC=CC=C1 KGIRVDITHCHNFA-XDVAXFRJSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000012088 reference solution Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- JLDFIXATROODCR-UITTUKNJSA-N trimethylsilyl (6r)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)O[Si](C)(C)C)NC(=O)COC1=CC=CC=C1 JLDFIXATROODCR-UITTUKNJSA-N 0.000 description 2
- MBLQASMQZQFFEF-MBFPDIRUSA-N trimethylsilyl (6r)-3-(bromomethyl)-7-formamido-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C[Si](C)(C)OC(=O)C1=C(CBr)CS(=O)[C@@H]2C(NC=O)C(=O)N12 MBLQASMQZQFFEF-MBFPDIRUSA-N 0.000 description 2
- ONIZMZZGAOMHGI-ZFNKEMRRSA-N (6R)-5,8-dioxo-4-[(2-phenylacetyl)amino]-5lambda4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1(=CC=CC=C1)CC(=O)NC1S([C@H]2N(C(=C1)C(=O)O)C(C2)=O)=O ONIZMZZGAOMHGI-ZFNKEMRRSA-N 0.000 description 1
- UYUPBMSHAHJMCD-QQDRFEGGSA-N (6r)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)O)NC(=O)CC1=CC=CC=C1 UYUPBMSHAHJMCD-QQDRFEGGSA-N 0.000 description 1
- YEUHJYYVALFIRT-QQDRFEGGSA-N (6r)-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2=O)C)C(O)=O)NC(=O)COC1=CC=CC=C1 YEUHJYYVALFIRT-QQDRFEGGSA-N 0.000 description 1
- CIPQGGYPCPIDBB-WPZCJLIBSA-N (6r)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(O)=O)NC(=O)CC1=CC=CC=C1 CIPQGGYPCPIDBB-WPZCJLIBSA-N 0.000 description 1
- IUJAAIZKRJJZGQ-UHFFFAOYSA-N 2-(2-chlorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1Cl IUJAAIZKRJJZGQ-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 1
- 101100225969 Aquifex aeolicus (strain VF5) era gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GJFUQYHXEKDPJY-SBXXRYSUSA-N N-[(6R)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NC1[C@@H]2N(C=C(CS2)C)C1=O GJFUQYHXEKDPJY-SBXXRYSUSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FNXLCIKXHOPCKH-UHFFFAOYSA-N bromamine Chemical class BrN FNXLCIKXHOPCKH-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
- 229960003866 cefaloridine Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- 125000001271 cephalosporin group Chemical group 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000000386 donor Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000000852 hydrogen donor Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- XEPHLSFFPLIQCJ-MPSNEDHUSA-N methyl (6r)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)OC)NC(=O)CC1=CC=CC=C1 XEPHLSFFPLIQCJ-MPSNEDHUSA-N 0.000 description 1
- IIAHVPSHRHOJGC-OISMKLOYSA-N methyl (6r)-3-(bromomethyl)-7-formamido-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound COC(=O)C1=C(CBr)CS(=O)[C@@H]2C(NC=O)C(=O)N12 IIAHVPSHRHOJGC-OISMKLOYSA-N 0.000 description 1
- MJXSIICFHFRUHI-MPSNEDHUSA-N methyl (6r)-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(C)=C(N2C1=O)C(=O)OC)NC(=O)COC1=CC=CC=C1 MJXSIICFHFRUHI-MPSNEDHUSA-N 0.000 description 1
- ZJUMIPRITUTNBQ-ZUHMNMGQSA-N methyl (6r)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)OC)NC(=O)C1=CC=CC=C1 ZJUMIPRITUTNBQ-ZUHMNMGQSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- QHUOBLDKFGCVCG-UHFFFAOYSA-N n-methyl-n-trimethylsilylacetamide Chemical compound CC(=O)N(C)[Si](C)(C)C QHUOBLDKFGCVCG-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 150000003961 organosilicon compounds Chemical class 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000010966 qNMR Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229960001866 silicon dioxide Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- GKIUEOYVBPCFJP-UHFFFAOYSA-N trimethyl(1-trimethylsilylethyl)silane Chemical compound C[Si](C)(C)C(C)[Si](C)(C)C GKIUEOYVBPCFJP-UHFFFAOYSA-N 0.000 description 1
- ZQPKVWJEAXGPQP-UHFFFAOYSA-N trimethylsilyl n,n-bis(trimethylsilyl)sulfamate Chemical compound C[Si](C)(C)OS(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C ZQPKVWJEAXGPQP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1896—Compounds having one or more Si-O-acyl linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/02—Preparation
- C07D501/04—Preparation from compounds already containing the ring or condensed ring systems, e.g. by dehydrogenation of the ring, by introduction, elimination or modification of substituents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Lubricants (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Saccharide Compounds (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8004925A GB2069482B (en) | 1980-02-14 | 1980-02-14 | Process for the preparation of 3'-bromosubstituted deacetoxycephalosporanic acid sulphoxide derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE810286L IE810286L (en) | 1981-08-14 |
| IE50865B1 true IE50865B1 (en) | 1986-08-06 |
Family
ID=10511335
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE286/81A IE50865B1 (en) | 1980-02-14 | 1981-02-13 | Process for the preparation of 3'-bromo-substituted deacetoxycephalosporanic acid sulphoxide derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4366315A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0034394B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS56128788A (cg-RX-API-DMAC7.html) |
| KR (1) | KR840002161B1 (cg-RX-API-DMAC7.html) |
| AT (1) | ATE8788T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU538523B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1177065A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3165149D1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK55981A (cg-RX-API-DMAC7.html) |
| ES (1) | ES499412A0 (cg-RX-API-DMAC7.html) |
| FI (1) | FI71938C (cg-RX-API-DMAC7.html) |
| GB (1) | GB2069482B (cg-RX-API-DMAC7.html) |
| GR (1) | GR73846B (cg-RX-API-DMAC7.html) |
| HU (1) | HU185239B (cg-RX-API-DMAC7.html) |
| IE (1) | IE50865B1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL61988A (cg-RX-API-DMAC7.html) |
| NO (1) | NO160078C (cg-RX-API-DMAC7.html) |
| PT (1) | PT72444B (cg-RX-API-DMAC7.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU566944B2 (en) * | 1983-10-07 | 1987-11-05 | Gist-Brocades N.V. | Preparation of 3-cephem derivatives |
| JPS60169486A (ja) * | 1984-02-10 | 1985-09-02 | Yamanouchi Pharmaceut Co Ltd | 7−アミノ−3−置換メチル−3−セフエム−4−カルボン酸およびその低級アルキルシリル誘導体の製造法 |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| US5604222A (en) * | 1993-12-27 | 1997-02-18 | Lupin Laboratories, Ltd. | Method for the preparation of 2-chloro sulfinyl azetidinones |
| US5578721A (en) * | 1994-07-11 | 1996-11-26 | Lupin Laboratories Limited | Process for preparation of 3-exomethylene cepham sulfoxide esters |
| US7525659B2 (en) * | 2003-01-15 | 2009-04-28 | Negevtech Ltd. | System for detection of water defects |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1326531A (en) | 1969-08-26 | 1973-08-15 | Glaxo Lab Ltd | Cephalosporin compounds |
| US3922268A (en) * | 1969-12-08 | 1975-11-25 | Lilly Co Eli | 3-Halomethyl-{66 {hu 3-Cephalosporin esters |
| BE789291A (fr) | 1971-09-30 | 1973-03-26 | Bristol Myers Co | Composes intermediaires pour la synthese des cephalosporines |
| US4182870A (en) * | 1977-09-07 | 1980-01-08 | Gist-Brocades N.V. | Preparation of 3-bromomethyl-3-cephem sulfoxides |
| IL59395A (en) * | 1979-03-06 | 1983-07-31 | Gist Brocades Nv | Bromo-substituted deacetoxycephalosporin derivatives and their preparation |
| US4223135A (en) * | 1979-03-19 | 1980-09-16 | Bristol-Myers Company | Production of cephalosporins |
-
1980
- 1980-02-14 GB GB8004925A patent/GB2069482B/en not_active Expired
-
1981
- 1981-01-22 AU AU66549/81A patent/AU538523B2/en not_active Ceased
- 1981-01-26 IL IL61988A patent/IL61988A/xx unknown
- 1981-02-03 PT PT72444A patent/PT72444B/pt not_active IP Right Cessation
- 1981-02-10 NO NO810452A patent/NO160078C/no unknown
- 1981-02-10 DK DK55981A patent/DK55981A/da not_active Application Discontinuation
- 1981-02-12 HU HU81348A patent/HU185239B/hu not_active IP Right Cessation
- 1981-02-12 GR GR64110A patent/GR73846B/el unknown
- 1981-02-12 KR KR1019810000422A patent/KR840002161B1/ko not_active Expired
- 1981-02-12 FI FI810431A patent/FI71938C/fi not_active IP Right Cessation
- 1981-02-13 US US06/234,545 patent/US4366315A/en not_active Expired - Fee Related
- 1981-02-13 CA CA000370844A patent/CA1177065A/en not_active Expired
- 1981-02-13 AT AT81200174T patent/ATE8788T1/de active
- 1981-02-13 DE DE8181200174T patent/DE3165149D1/de not_active Expired
- 1981-02-13 ES ES499412A patent/ES499412A0/es active Granted
- 1981-02-13 IE IE286/81A patent/IE50865B1/en not_active IP Right Cessation
- 1981-02-13 JP JP1998581A patent/JPS56128788A/ja active Granted
- 1981-02-13 EP EP81200174A patent/EP0034394B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| KR830005241A (ko) | 1983-08-03 |
| FI810431L (fi) | 1981-08-15 |
| NO160078B (no) | 1988-11-28 |
| HU185239B (en) | 1984-12-28 |
| AU538523B2 (en) | 1984-08-16 |
| PT72444A (en) | 1981-03-01 |
| EP0034394A2 (en) | 1981-08-26 |
| ES8202025A1 (es) | 1982-01-01 |
| EP0034394A3 (en) | 1981-11-25 |
| US4366315A (en) | 1982-12-28 |
| FI71938B (fi) | 1986-11-28 |
| GB2069482A (en) | 1981-08-26 |
| IE810286L (en) | 1981-08-14 |
| ES499412A0 (es) | 1982-01-01 |
| FI71938C (fi) | 1987-03-09 |
| NO160078C (no) | 1989-03-08 |
| AU6654981A (en) | 1981-08-20 |
| IL61988A0 (en) | 1981-02-27 |
| JPS6360759B2 (cg-RX-API-DMAC7.html) | 1988-11-25 |
| EP0034394B1 (en) | 1984-08-01 |
| GB2069482B (en) | 1984-04-04 |
| IL61988A (en) | 1984-03-30 |
| JPS56128788A (en) | 1981-10-08 |
| CA1177065A (en) | 1984-10-30 |
| KR840002161B1 (ko) | 1984-11-24 |
| DK55981A (da) | 1981-08-15 |
| DE3165149D1 (en) | 1984-09-06 |
| GR73846B (cg-RX-API-DMAC7.html) | 1984-05-07 |
| PT72444B (en) | 1982-01-29 |
| ATE8788T1 (de) | 1984-08-15 |
| NO810452L (no) | 1981-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE50929B1 (en) | Process for 3-iodomethyl cephalosporins | |
| US5132419A (en) | Process for the preparation of 7-amino-3-((z)-1-propen-1yl)-3-cephem-4-carboxylic acid | |
| JPS6027677B2 (ja) | 7−置換又は非置換アミノ−3−置換チオメチルセフエムカルボン酸類の新規製造法 | |
| IE50865B1 (en) | Process for the preparation of 3'-bromo-substituted deacetoxycephalosporanic acid sulphoxide derivatives | |
| IE43845B1 (en) | 4-thia-1-azabicyclo/4.2.0/oct-2-ene derivatives | |
| CA1052769A (en) | Process for preparing cefazolin | |
| HU177432B (en) | Process for preparing 3-halomethyl-cephem derivatives | |
| JPH09504306A (ja) | グリタリル7−aca誘導体とその調整のためのプロセス | |
| EP0015629B1 (en) | New intermediates for the preparation of cephalosporins and process for the preparation of the intermediates | |
| US4160091A (en) | Process for preparation of 3-halo-3-methylcephams | |
| WO1999020631A1 (en) | Process for producing 3-cephem compounds | |
| JPH0521912B2 (cg-RX-API-DMAC7.html) | ||
| EP0907654A1 (en) | De-esterification process | |
| JP2602669B2 (ja) | 2β−ハロゲノ置換メチルペニシリン誘導体の製造法 | |
| NO160660B (no) | Fremgangsmaate for fremstilling av penicillin- eller cefalosporiniminohalogenider. | |
| Barendse et al. | Synthesis of the β-lactamase indicators cefesone and nitrocefin | |
| US6063918A (en) | Process for preparing 2-isocephem derivatives | |
| JPS5965094A (ja) | セフアロスポリン化合物の製造法 | |
| KR830000566B1 (ko) | 3-할로메틸 세펨의 제조방법 | |
| US5977352A (en) | Process for preparing 3-norcephem compounds | |
| JPH11228452A (ja) | ハロゲン化剤及び水酸基のハロゲン化方法 | |
| JPS6135198B2 (cg-RX-API-DMAC7.html) | ||
| KR840002142B1 (ko) | 7α-메톡시세팔로스포린 유도체의 제조방법 | |
| EP0160564A2 (en) | Process for preparing cephalosporin compounds | |
| JPS5998088A (ja) | オキサセフアロスポリン類 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |