IE43013B1 - Polytriazine compounds - Google Patents
Polytriazine compoundsInfo
- Publication number
- IE43013B1 IE43013B1 IE1368/76A IE136876A IE43013B1 IE 43013 B1 IE43013 B1 IE 43013B1 IE 1368/76 A IE1368/76 A IE 1368/76A IE 136876 A IE136876 A IE 136876A IE 43013 B1 IE43013 B1 IE 43013B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- compound
- alkyl
- hydrogen
- synthetic polymer
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 62
- -1 2,2,6,6- tetramethyl - 4 - piperidyl Chemical group 0.000 claims abstract description 38
- 238000000034 method Methods 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229920000642 polymer Polymers 0.000 claims description 14
- 229920001059 synthetic polymer Polymers 0.000 claims description 13
- 150000002431 hydrogen Chemical group 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000000732 arylene group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 239000004743 Polypropylene Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000005936 piperidyl group Chemical group 0.000 claims description 4
- 229920001155 polypropylene Polymers 0.000 claims description 4
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 150000007529 inorganic bases Chemical class 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 4
- 239000004698 Polyethylene Substances 0.000 claims 1
- 125000006193 alkinyl group Chemical group 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract description 42
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 abstract description 6
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 abstract description 6
- 150000000182 1,3,5-triazines Chemical class 0.000 abstract 1
- UIGMDMOGAQFIQT-UHFFFAOYSA-N 2,4-dichloro-6-(2,6-dimethylphenoxy)-1,3,5-triazine Chemical compound CC1=CC=CC(C)=C1OC1=NC(Cl)=NC(Cl)=N1 UIGMDMOGAQFIQT-UHFFFAOYSA-N 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N methyl pentane Natural products CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 239000000835 fiber Substances 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 7
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007810 chemical reaction solvent Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000012261 resinous substance Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 101150052863 THY1 gene Proteins 0.000 description 3
- 230000001588 bifunctional effect Effects 0.000 description 3
- 239000004611 light stabiliser Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical group O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 238000004512 die casting Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- QKUFMUWMMWFBFB-UHFFFAOYSA-N 1,2,2,3,3-pentamethylpiperidin-4-amine Chemical compound CN1CCC(N)C(C)(C)C1(C)C QKUFMUWMMWFBFB-UHFFFAOYSA-N 0.000 description 1
- IXJJELULBDAIMY-UHFFFAOYSA-N 1,2,5,6-tetrahydrotriazine Chemical compound C1CC=NNN1 IXJJELULBDAIMY-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- LSXIGJFEKWYYOS-UHFFFAOYSA-N 2,2,6,6-tetramethyl-4-octylpiperidin-1-amine Chemical compound CCCCCCCCC1CC(C)(C)N(N)C(C)(C)C1 LSXIGJFEKWYYOS-UHFFFAOYSA-N 0.000 description 1
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 1
- QIJIUJYANDSEKG-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-amine Chemical compound CC(C)(C)CC(C)(C)N QIJIUJYANDSEKG-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- IJVRPNIWWODHHA-UHFFFAOYSA-N 2-cyanoprop-2-enoic acid Chemical class OC(=O)C(=C)C#N IJVRPNIWWODHHA-UHFFFAOYSA-N 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- ZGMQLPDXPUINCQ-UHFFFAOYSA-N 3,3,5-trimethylcyclohexan-1-amine Chemical compound CC1CC(N)CC(C)(C)C1 ZGMQLPDXPUINCQ-UHFFFAOYSA-N 0.000 description 1
- PRWJPWSKLXYEPD-UHFFFAOYSA-N 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)CC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C PRWJPWSKLXYEPD-UHFFFAOYSA-N 0.000 description 1
- XOUQAVYLRNOXDO-UHFFFAOYSA-N 6-tert-butyl-m-cresol Natural products CC1=CC=C(C(C)(C)C)C(O)=C1 XOUQAVYLRNOXDO-UHFFFAOYSA-N 0.000 description 1
- 241000125205 Anethum Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 101000654316 Centruroides limpidus Beta-toxin Cll2 Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 101100055261 Mus musculus Aldh2 gene Proteins 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 241001387976 Pera Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 101150114468 TUB1 gene Proteins 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- 241000244317 Tillandsia usneoides Species 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- JVQXFLGVYCKJMV-UHFFFAOYSA-N [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2,2,3,3-tetrakis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C(C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C(=O)OCC(CO)(CO)CO)(C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 JVQXFLGVYCKJMV-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- BJFLSHMHTPAZHO-UHFFFAOYSA-N benzotriazole Chemical compound [CH]1C=CC=C2N=NN=C21 BJFLSHMHTPAZHO-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- BFMWUTJWRPECCL-UHFFFAOYSA-N decyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 BFMWUTJWRPECCL-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- OFXVCLLHEWMVEQ-UHFFFAOYSA-N n,n'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine Chemical compound C1C(C)(C)NC(C)(C)CC1NCCNC1CC(C)(C)NC(C)(C)C1 OFXVCLLHEWMVEQ-UHFFFAOYSA-N 0.000 description 1
- UKJARPDLRWBRAX-UHFFFAOYSA-N n,n'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine Chemical compound C1C(C)(C)NC(C)(C)CC1NCCCCCCNC1CC(C)(C)NC(C)(C)C1 UKJARPDLRWBRAX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- JMWUYEFBFUCSAK-UHFFFAOYSA-L nickel(2+);octadecanoate Chemical class [Ni+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O JMWUYEFBFUCSAK-UHFFFAOYSA-L 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000013849 propane Nutrition 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- JZNDMMGBXUYFNQ-UHFFFAOYSA-N tris(dodecylsulfanyl)phosphane Chemical compound CCCCCCCCCCCCSP(SCCCCCCCCCCCC)SCCCCCCCCCCCC JZNDMMGBXUYFNQ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/02—Polyamines
- C08G73/0273—Polyamines containing heterocyclic moieties in the main chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/0622—Polycondensates containing six-membered rings, not condensed with other rings, with nitrogen atoms as the only ring hetero atoms
- C08G73/0638—Polycondensates containing six-membered rings, not condensed with other rings, with nitrogen atoms as the only ring hetero atoms with at least three nitrogen atoms in the ring
- C08G73/0644—Poly(1,3,5)triazines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Artificial Filaments (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT52527/75A IT1052501B (it) | 1975-12-04 | 1975-12-04 | Composti politriazinici utilizzabili per la stabilizzazione di polimeri sintetici e procedimento per la loro preparazione |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43013L IE43013L (en) | 1977-06-04 |
| IE43013B1 true IE43013B1 (en) | 1980-12-03 |
Family
ID=11277205
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1368/76A IE43013B1 (en) | 1975-12-04 | 1976-06-23 | Polytriazine compounds |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4086204A (ref) |
| JP (1) | JPS5271486A (ref) |
| AT (1) | AT350276B (ref) |
| AU (1) | AU504244B2 (ref) |
| BE (1) | BE847239A (ref) |
| CA (1) | CA1085835A (ref) |
| DE (1) | DE2636144C3 (ref) |
| DK (1) | DK167016B1 (ref) |
| ES (1) | ES453955A1 (ref) |
| FR (1) | FR2333821A1 (ref) |
| GB (1) | GB1496635A (ref) |
| HK (1) | HK23879A (ref) |
| IE (1) | IE43013B1 (ref) |
| IT (1) | IT1052501B (ref) |
| LU (1) | LU75879A1 (ref) |
| NL (1) | NL167429C (ref) |
| SU (1) | SU686628A3 (ref) |
| ZA (1) | ZA767186B (ref) |
Families Citing this family (151)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4161592A (en) * | 1976-07-08 | 1979-07-17 | Ciba-Geigy Corporation | Piperidinyl-s-triazines |
| US4256627A (en) * | 1977-11-08 | 1981-03-17 | Ciba-Geigy Corporation | Novel light stabilizers for plastics |
| US4234707A (en) * | 1977-11-10 | 1980-11-18 | Ciba-Geigy Corporation | Polymeric light stabilizers for plastics |
| EP0002754B1 (de) * | 1977-12-30 | 1983-05-18 | Ciba-Geigy Ag | Neue Polyalkylpiperidinderivate von s-Triazinen, ihre Verwendung zum Stabilisieren von Kunststoffen und die so stabilisierten Kunststoffe |
| EP0003542B1 (de) * | 1978-02-08 | 1981-11-25 | Ciba-Geigy Ag | Neue Polyalkylpiperidinderivate von s-Triazinen, ihre Verwendung als Stabilisatoren für Polymere und die so stabilisierten Polymere |
| EP0006213B1 (de) * | 1978-06-21 | 1982-09-01 | Ciba-Geigy Ag | Lichtstabilisierung von sauerkatalysierten Einbrennlacken |
| JPS554331A (en) * | 1978-06-24 | 1980-01-12 | Sankyo Co Ltd | Piperidine-spiro-hydantoin derivative |
| US4315859A (en) * | 1979-01-15 | 1982-02-16 | Ciba-Geigy Corporation | 1,3,5-Triazines containing at least one piperidine radical |
| DE2961017D1 (en) * | 1979-01-29 | 1981-12-24 | Ciba Geigy Ag | Piperidyl-triazine derivatives, process for their production, their use as stabilizers for polymers and the polymers stabilized therewith |
| US4288593A (en) * | 1979-02-06 | 1981-09-08 | Ciba-Geigy Corporation | Polyalkylpiperidine derivatives of s-triazines |
| US4297492A (en) * | 1979-03-23 | 1981-10-27 | Ciba-Geigy Corporation | Phenolic-1,3,5-triazines |
| JPS564639A (en) * | 1979-06-23 | 1981-01-19 | Sankyo Co Ltd | Stabilizer for high-molecular material |
| DE2933078A1 (de) * | 1979-08-16 | 1981-03-26 | Hoechst Ag, 65929 Frankfurt | Neue triazinderivate, ihre herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
| DE2944729A1 (de) * | 1979-11-06 | 1981-05-14 | Hoechst Ag, 6000 Frankfurt | Neue triazinstabilisatoren |
| US4314001A (en) * | 1980-03-03 | 1982-02-02 | Sterling Drug Inc. | Novel polymeric compounds, processes and methods of use |
| US4347352A (en) * | 1980-03-03 | 1982-08-31 | Sterling Drug Inc. | Novel polymeric compounds, processes and methods of use |
| US4370443A (en) * | 1980-03-03 | 1983-01-25 | Sterling Drug Inc. | Novel polymeric compounds, processes and methods of use |
| DE3022453A1 (de) * | 1980-06-14 | 1982-01-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von mikrokapseln |
| DE3022896A1 (de) * | 1980-06-19 | 1981-12-24 | Hoechst Ag, 6000 Frankfurt | Polytriazinylamine, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
| IT1151035B (it) * | 1980-07-31 | 1986-12-17 | Chimosa Chimica Organica Spa | Piperidil-derivati di copolimeri triazinici,processi per la loro preparazione e composizioni stabilizzate che li comprendono |
| DE3045839A1 (de) * | 1980-12-05 | 1982-07-08 | Hoechst Ag, 6000 Frankfurt | Poly-bis-triazinylamine, verfahren zu ihrer herstellung, ihre verwendung zum stabilisieren von synthetischen polymeren und die so stabilisierten polymeren |
| DE3111209A1 (de) * | 1981-03-21 | 1982-09-30 | Hoechst Ag, 6000 Frankfurt | Hochmolekulare piperidingruppenhaltige ester und urethane, verfahren zu ihrer herstellung, ihre verwendung als stabilisatoren fuer polymere sowie diese verbindungen enthaltende polymere |
| DE3113455A1 (de) * | 1981-04-03 | 1982-10-21 | Hoechst Ag, 6000 Frankfurt | Poly-bis-triazinylimide, ihre herstellung, ihre verwendung als lichtschutzmittel fuer polymere sowie die mit ihnen stabilisierten polymeren |
| US4616051A (en) * | 1981-05-04 | 1986-10-07 | Uniroyal Chemical Company, Inc. | Combination of phenolic antioxidant and stabilizer for use in organic material |
| DE3117964A1 (de) * | 1981-05-07 | 1982-11-25 | Hoechst Ag, 6000 Frankfurt | Poly-bis-triazinylaminotriazinylamine, ihre herstellung, ihre verwendung als lichtschutzmittel fuer kunststoffe und mit ihnen stabilisierte kunststoffe |
| DE3118962A1 (de) * | 1981-05-13 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Durch piperidylgruppen substituierte phophazene, verfahren zu ihrer herstellung, ihre verwendung als stabilisatoren und die mit ihnen stabilisierten polymermassen |
| US4413093A (en) * | 1981-07-20 | 1983-11-01 | American Cyanamid Company | Method of stabilizing a polymer from degradation by UV radiation |
| US4400505A (en) * | 1981-07-20 | 1983-08-23 | American Cyanamid Company | Triazinyl-piperidines as light stabilizers for polymers |
| US4435555A (en) | 1981-07-20 | 1984-03-06 | American Cyanamid Company | Novel polymeric light stabilizers for polymers |
| US4386177A (en) * | 1981-07-20 | 1983-05-31 | American Cyanamid Company | Light stabilizers for polymers containing hindered piperidinyl-substituted 1,3,5 triazine groups |
| US4331586A (en) * | 1981-07-20 | 1982-05-25 | American Cyanamid Company | Novel light stabilizers for polymers |
| IT1195277B (it) * | 1981-10-02 | 1988-10-12 | Chimosa Chimica Organica Spa | Piperidil derivati di composti triazinici macrociclici,aventi attivita' stabilizzante per i polimeri e processi per la loro preparazione |
| EP0080431B1 (de) * | 1981-10-16 | 1986-09-24 | Ciba-Geigy Ag | Synergistisches Gemisch von niedermolekularen und hochmolekularen Polyalkylpiperidinen |
| DE3143920A1 (de) * | 1981-11-05 | 1983-05-11 | Degussa Ag, 6000 Frankfurt | Neue bismelamine |
| JPS5892660A (ja) * | 1981-11-27 | 1983-06-02 | Adeka Argus Chem Co Ltd | ピペリジルアミン化合物 |
| EP0085523B1 (en) * | 1982-01-29 | 1987-11-11 | The Wiggins Teape Group Limited | Photographic base papers |
| US4480092A (en) * | 1982-02-19 | 1984-10-30 | The B. F. Goodrich Company | Alkylated polyalkylenepolyamines, substituted oxo-piperazinyl-triazines |
| US4562246A (en) * | 1982-04-08 | 1985-12-31 | American Cyanamid Company | Essentially linear, thermoplastic poly (amino-s-triazines)s and process for the production thereof |
| JPS58179240A (ja) * | 1982-04-15 | 1983-10-20 | Mitsubishi Petrochem Co Ltd | 成形体の表面処理方法 |
| US4492791A (en) * | 1982-05-04 | 1985-01-08 | Ciba-Geigy Corporation | Process for the preparation of polyaminotriazines |
| IT1152192B (it) * | 1982-05-19 | 1986-12-31 | Apital Prod Ind | Composti per stabilizzare i polimeri |
| EP0101411B1 (de) * | 1982-08-11 | 1989-01-25 | Ciba-Geigy Ag | Verfahren zur chemischen Bindung von Stabilisatoren an Polymere |
| DE3375431D1 (en) * | 1982-11-18 | 1988-02-25 | Ciba Geigy Ag | Colour-photographic recording material |
| JPS59126439A (ja) * | 1983-01-10 | 1984-07-21 | Adeka Argus Chem Co Ltd | 安定化高分子材料組成物 |
| IT1164214B (it) * | 1983-05-09 | 1987-04-08 | Chimosa Chimica Organica Spa | Composti polimerici contenenti radicali piperidinici,processo per la loro preparazione e loro impiego quali stabilizzanti per polimeri sintetici |
| IT1163815B (it) * | 1983-07-19 | 1987-04-08 | Chimosa Chimica Organica Spa | Composti polimerici contenenti radicali piperidinici processo per la loro preparazione e loro impiego quali stabilizzanti per polimeri sintetici |
| IT1163814B (it) * | 1983-07-19 | 1987-04-08 | Chimosa Chimica Organica Spa | Composti polimerici contenenti radicali piperidinici e triazinici,processo per la loro preparazione e loro impiego quali stabilizzanti per polimeri sintetici |
| IT1169843B (it) * | 1983-09-23 | 1987-06-03 | Chimosa Chimica Organica Spa | Composti polimerici contenenti radicali piperidinici, processo per la loro preparazione e loro impiego quali stabilizzanti per polimeri sintetici |
| US4696959A (en) * | 1983-09-26 | 1987-09-29 | Ppg Industries, Inc. | Modified piperidines as ultraviolet light stabilizers |
| JPS60188958A (ja) * | 1984-03-08 | 1985-09-26 | Sumitomo Chem Co Ltd | 静電荷像現像用トナ− |
| US4965301A (en) * | 1984-12-03 | 1990-10-23 | Phillips Petroleum Company | Stabilization of polyolefins |
| JPS6218444A (ja) * | 1985-07-16 | 1987-01-27 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| US4629752A (en) | 1985-07-22 | 1986-12-16 | The B. F. Goodrich Company | Substituted oxo-piperazinyl-triazines and UV light stabilized compositions |
| JPS6250342A (ja) * | 1985-08-30 | 1987-03-05 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| US4762872A (en) * | 1985-11-01 | 1988-08-09 | The B. F. Goodrich Company | Oligomeric light stabilizers with substituted piperidine ends |
| US4746692A (en) * | 1986-05-05 | 1988-05-24 | Shell Oil Company | Polyolefin compositions for use with water systems |
| IT1204389B (it) * | 1986-06-16 | 1989-03-01 | Ciba Geigy Spa | Derivati triazinici di piperidinilammidine atti all'impiego come stabilizzanti per polimeri sintetici |
| US4863981A (en) * | 1986-06-30 | 1989-09-05 | Ciba-Geigy Corporation | Synergistic mixture of stabilizers |
| IT1197853B (it) * | 1986-08-07 | 1988-12-21 | Ciba Geigy Spa | Composti politriazinici contenenti gruppi piperidinilammidinici e loro impiego come stabilizzanti per polimeri |
| US4985479A (en) * | 1986-11-27 | 1991-01-15 | Sumitomo Chemical Company, Ltd. | Stabilized polyolefin composition |
| IT1215455B (it) * | 1987-05-05 | 1990-02-14 | Ciba Geigy Spa | Composizione stabilizzante per polietilene comprendente composti contenenti gruppi piperidinici e composti metallici |
| US4751073A (en) * | 1987-06-03 | 1988-06-14 | Olin Corporation | Selected 2,2,6,6-tetraalkyl-4-piperidinyl derivatives and their use as light stabilizers |
| US4812500A (en) * | 1987-09-30 | 1989-03-14 | Shell Oil Company | Polyolefin compositions for water pipes and for wire and cable coatings |
| NL8702473A (nl) * | 1987-10-16 | 1989-05-16 | Gen Electric | Polymeermengsel met polyfenyleenether, sterisch gehinder amine en epoxyverbinding en daaruit gevormde voorwerpen. |
| US5210119A (en) * | 1987-10-16 | 1993-05-11 | General Electric Company | Polymer mixture comprising polyphenylene ether, sterically hindered amine and epoxy compound and articles manufactured therefrom |
| IT1223405B (it) * | 1987-12-04 | 1990-09-19 | Ciba Geigy Spa | Procedimento per la metilazione di composti triazinici contenenti gruppi 2,2,6,6 tetrametilpiperidinici |
| AU621082B2 (en) * | 1988-02-08 | 1992-03-05 | Ciba-Geigy Ag | Tetramethylpiperidino-s-triazines |
| US5000917A (en) * | 1988-02-29 | 1991-03-19 | Phillips Petroleum Company | Corrosion inhibition of polymethylphenthene |
| US5066460A (en) * | 1988-02-29 | 1991-11-19 | Phillips Petroleum Company | Corrosion inhibition of polymethylpentene |
| US4968736A (en) * | 1988-02-29 | 1990-11-06 | Willcox Kenneth W | Corrosion inhibition of polymethylpentene |
| US4793972A (en) * | 1988-02-29 | 1988-12-27 | Phillips Petroleum Company | Corrosion inhibition of polymethylpentene |
| CS270846B1 (en) * | 1988-08-29 | 1990-08-14 | Vass Frantisek | New polyaminotriazines and method of their preparation |
| US4981964A (en) * | 1988-12-15 | 1991-01-01 | Ici Americas Inc. | Oligomeric polyesters and polyamides containing dipiperidyl triazine groups |
| JP3041823B2 (ja) * | 1989-09-09 | 2000-05-15 | クラリアント ファイナンス(ビーブイアイ)リミティド | 合成ポリアミドおよびそれらの塩 |
| DE3932912A1 (de) * | 1989-10-03 | 1991-04-11 | Sandoz Ag | Sterisch gehinderte aminogruppen enthaltende synthetische polyamide |
| IT1237129B (it) * | 1989-11-10 | 1993-05-18 | Valerio Borzatta | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1237541B (it) * | 1989-12-28 | 1993-06-08 | Ciba Geigy | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| US5066696A (en) * | 1990-02-12 | 1991-11-19 | Rohm And Haas Company | Polymers stabilized against light and heat degradation |
| IT1248698B (it) * | 1990-06-06 | 1995-01-26 | Ciba Geigy Spa | Composti piepridin-triazinici contenenti gruppi silossanici,atti all'impiego come stabilizzanti per materiali organici |
| US5324834A (en) * | 1990-06-13 | 1994-06-28 | Ciba-Geigy Corporation | Piperidine-triazine co-oligomers for use as stabilizers for organic materials |
| JP2903739B2 (ja) * | 1990-06-29 | 1999-06-14 | 住友化学工業株式会社 | N,n′−ビス(2,2,6,6−テトラメチル−4−ピペリジル)アルカンジアミンの製造法 |
| IT1246170B (it) * | 1990-07-24 | 1994-11-16 | Ciba Geigy Spa | Composizione stabilizzante per polipropilene comprendente composti triazinici contenenti gruppi piperidinici e composti metallici |
| IT1243374B (it) * | 1990-07-27 | 1994-06-10 | Ciba Geigy Spa | Composti piperidin-triazinici contenenti gruppi tetraidrofuranici o tetraidropiranici atti all'impiego come stabilizzanti per materiali organici |
| US5256787A (en) * | 1990-09-03 | 1993-10-26 | Ciba-Geigy Corporation | Tri-piperdine compounds as stabilizers for organic materials |
| IT1243433B (it) * | 1990-10-03 | 1994-06-10 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| JP2520984B2 (ja) * | 1991-02-27 | 1996-07-31 | 三菱化学エムケーブイ株式会社 | 農業用ポリオレフィン系樹脂フィルム |
| US5149723A (en) * | 1991-03-22 | 1992-09-22 | E. I. Du Pont De Nemours And Company | Stabilized polyacetal compositions containing a mixture of hals having tertiary functionality |
| JPH05156094A (ja) * | 1991-12-11 | 1993-06-22 | Sumitomo Chem Co Ltd | 安定化ポリオレフィン組成物 |
| IT1254689B (it) * | 1992-04-14 | 1995-09-28 | Cooligomeri piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. | |
| EP0570337B1 (de) * | 1992-05-13 | 1998-03-18 | Ciba SC Holding AG | Stabilisierte chlorhaltige Polymerzusammensetzungen |
| JPH06228308A (ja) * | 1992-12-29 | 1994-08-16 | Internatl Business Mach Corp <Ibm> | トリアジン重合体およびその使用 |
| IT1263892B (it) * | 1993-02-11 | 1996-09-05 | Graziano Vignali | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| US5449777A (en) * | 1993-07-08 | 1995-09-12 | Ciba-Geigy Corporation | Phenolic s-triazines |
| TW302377B (ref) | 1993-12-24 | 1997-04-11 | Sumitomo Chemical Co | |
| FR2717809B1 (fr) * | 1994-03-24 | 1997-09-19 | Sandoz Sa | Dérivés de la s-triazine, leur préparation et leur utilisation comme absorbeurs UV. |
| ES2148464T5 (es) * | 1994-10-28 | 2005-06-16 | Ciba Specialty Chemicals Holding Inc. | Mezcla de estabilizadores sinergicos. |
| EP0709426B2 (de) | 1994-10-28 | 2005-01-05 | Ciba SC Holding AG | Synergistisches Stabilisatorgemisch |
| TW401437B (en) * | 1995-02-10 | 2000-08-11 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW358820B (en) | 1995-04-11 | 1999-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW360678B (en) * | 1995-05-03 | 1999-06-11 | Ciba Sc Holding Ag | Synergistic stabilizer mixture for polyolefins |
| US5603885A (en) * | 1995-07-06 | 1997-02-18 | E. I. Du Pont De Nemours And Company | Process for the preparation of nonwoven fibrous sheets |
| IT1275584B1 (it) * | 1995-07-21 | 1997-08-06 | 3V Sigma Spa | Composizioni per la stabilizzazione di polimeri sintetici |
| TW390897B (en) * | 1995-07-21 | 2000-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| US6046304A (en) * | 1995-12-04 | 2000-04-04 | Ciba Specialty Chemicals Corporation | Block oligomers containing 2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| EP0782994B1 (en) * | 1995-12-04 | 2003-02-05 | Ciba SC Holding AG | Block oligomers containing 2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| ES2128978B1 (es) * | 1996-04-01 | 2000-03-01 | Ciba Sc Holding Ag | Derivados de politriazina que contienen grupos de polialquilpiperidiniloxilo o polialquilpiperidinilamino. |
| IT1293418B1 (it) * | 1996-07-09 | 1999-03-01 | Sumitomo Chemical Co | Poliamminotriazina, suo procedimento di produzione ed utilizzo |
| ES2239348T3 (es) * | 1996-07-17 | 2005-09-16 | Ciba Specialty Chemicals Holding Inc. | Estabilizadores de larga duracion, resistentes al ozono. |
| DE69719004T2 (de) | 1996-12-24 | 2003-07-24 | Ciba Speciality Chemicals Holding Inc., Basel | Triazinverbindungen die 2,2,6,6-Tetramethyl-4-piperidingruppen enthalten als Stabilisatoren für organische Materialen |
| TW589341B (en) | 1997-05-27 | 2004-06-01 | Ciba Sc Holding Ag | Block oligomers containing 1-hydrocarbyloxy-2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| AU7072698A (en) | 1997-05-27 | 1998-12-30 | Ciba Specialty Chemicals Holding Inc. | Block oligomers containing 1-hydrocarbyloxy-2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| US6492440B1 (en) | 1997-05-27 | 2002-12-10 | Ciba Specialty Chemicals Corporation | Block oligomers containing 1-hydrocarbyloxy-2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
| TW509683B (en) * | 1997-05-27 | 2002-11-11 | Ciba Sc Holding Ag | Triazine derivatives containing 2,2,6,6-tetramethyl-4-piperidyl groups |
| TW428008B (en) | 1997-05-27 | 2001-04-01 | Ciba Sc Holding Ag | Block oligomers containing 1-hydrocarbyloxy-2,2,6,6-tetramethy1-4-piperidyl groups as stabilizers for organic materials |
| TW491872B (en) * | 1997-05-27 | 2002-06-21 | Ciba Sc Holding Ag | Block oligomers containing l-hydrocarbyloxy-2,2,6,6-tetramethyl-4- piperidyl groups as stabilizers for lower polyolefin |
| IT1292040B1 (it) * | 1997-05-30 | 1999-01-25 | Ciba Spec Chem Spa | Processo per la preparazione di prodotti politriazinici contenenti gruppi 2,2,6,6-tetrametil-4-piperidile |
| CA2312999A1 (en) * | 1997-12-08 | 1999-06-17 | Cytec Technology Corp. | Morpholino end-capped, hindered amine substituted aminotriazine and their use as light stabilizers |
| MX283566B (es) * | 2000-05-31 | 2011-02-01 | Ciba Sc Holding Ag | Mezclas estabilizadoras. |
| US6433088B1 (en) | 2000-08-04 | 2002-08-13 | Equistar Chemicals, Lp | Clear and printable polypropylene films |
| US6514626B1 (en) | 2000-08-28 | 2003-02-04 | Pechiney Emballage Flexible Europe | Dienophile additives to polyvinylidene chloride copolymers |
| US6355733B1 (en) | 2000-10-13 | 2002-03-12 | Equistar Chemicals, Lp | Polyethylene blends and films |
| ITMI20012085A1 (it) | 2000-10-17 | 2003-04-09 | Ciba Sc Holding Ag | Polpropilene metallocene stabilizzato |
| US6545156B1 (en) | 2000-11-03 | 2003-04-08 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6727300B2 (en) | 2000-11-03 | 2004-04-27 | Cytec Technology Corp. | Polymeric articles containing hindered amine light stabilizers based on multi-functional carbonyl compounds |
| US6414155B1 (en) | 2000-11-03 | 2002-07-02 | Cytec Technology Corp. | Oligomeric hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6492521B2 (en) | 2000-11-03 | 2002-12-10 | Cytec Technology Corp. | Hindered amine light stabilizers based on multi-functional carbonyl compounds and methods of making same |
| US6465645B1 (en) * | 2001-04-17 | 2002-10-15 | Ciba Specialty Chemicals Corporation | Long chain hindered amines and compositions stabilized therewith |
| US6613841B2 (en) | 2002-01-28 | 2003-09-02 | Equistar Chemicals, Lp | Preparation of machine direction oriented polyethylene films |
| US20030225191A1 (en) | 2002-04-12 | 2003-12-04 | Francois Gugumus | Stabilizer mixtures |
| US6649698B1 (en) | 2002-05-17 | 2003-11-18 | Equistar Chemicals, Lp | Polyethylene blends |
| WO2003102068A2 (en) * | 2002-05-30 | 2003-12-11 | Ciba Specialty Chemicals Holdings Inc. | Stabilized articles |
| US20030236325A1 (en) * | 2002-05-30 | 2003-12-25 | Michela Bonora | Agricultural articles |
| US6903162B2 (en) * | 2003-07-01 | 2005-06-07 | Equistar Chemicals, Lp | Preparation of polyethylene films |
| US7175918B2 (en) * | 2004-04-27 | 2007-02-13 | Equistar Chemicals, Lp | Polyolefin compositions |
| US7608327B2 (en) * | 2005-12-20 | 2009-10-27 | Equistar Chemicals, Lp | High tear strength film |
| KR20090089314A (ko) * | 2006-11-27 | 2009-08-21 | 시바 홀딩 인코포레이티드 | 풍화에 대하여 안정화된 역청 또는 아스팔트 조성물 |
| ITMI20080739A1 (it) * | 2008-04-23 | 2009-10-24 | 3V Sigma Spa | Ammine stericamente impedite oligomeriche e loro uso come stabilizzanti per polimeri |
| ITMI20080747A1 (it) * | 2008-04-24 | 2009-10-25 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| EP2130854B1 (en) | 2008-05-09 | 2016-10-19 | MCA Technologies GMBH | Polytriazinyl compounds as flame retardants and light stabilizers |
| IT1393333B1 (it) | 2009-02-09 | 2012-04-20 | 3V Sigma Spa | Nuove ammine stericamente impedite e loro uso come stabilizzanti per polimeri |
| EP2467878A1 (en) | 2009-08-18 | 2012-06-27 | Basf Se | An uv-stabilized photovoltaic module |
| US20110045265A1 (en) | 2009-08-20 | 2011-02-24 | Haley Jeffrey C | Polyolefin composition and film thereof |
| IT1399477B1 (it) | 2010-03-15 | 2013-04-19 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| US8637607B2 (en) | 2010-07-28 | 2014-01-28 | Equistar Chemicals, Lp | Polyethylene blends and films |
| IT1403086B1 (it) | 2010-10-28 | 2013-10-04 | 3V Sigma Spa | Nuove ammine stericamente impedite polimeriche e loro uso come stabilizzanti per polimeri |
| ITMI20110802A1 (it) | 2011-05-10 | 2012-11-11 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| SA116370295B1 (ar) | 2015-02-20 | 2016-12-06 | باسف اس اى | رقائق، وأشرطة وفتائل أحادية من البولي أوليفين مثبتة للضوء |
| EP3328928B1 (en) | 2015-07-27 | 2020-12-16 | Basf Se | An additive mixture |
| IT201700073726A1 (it) | 2017-06-30 | 2018-12-30 | 3V Sigma Spa | Ammine impedite polimeriche |
| IT201700078234A1 (it) | 2017-07-11 | 2019-01-11 | 3V Sigma Spa | Ammine impedite |
| EP4301731B1 (en) | 2021-03-05 | 2025-10-08 | Basf Se | Process for preparing n,n'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2640047A (en) * | 1951-05-10 | 1953-05-26 | American Cyanamid Co | Reaction products of a polyhalogenated compound and a triazine derivative and methods of preparing the same |
| GB930674A (en) * | 1960-03-22 | 1963-07-10 | Artrite Resins Ltd | Polymeric compounds containing s-triazine nuclei |
| US3297639A (en) * | 1963-02-05 | 1967-01-10 | Lewellyn G Picklesimer | Polyethers of triazine and polyhydric aromatic compounds |
| US3301797A (en) * | 1964-03-06 | 1967-01-31 | American Cyanamid Co | Linear triazine polymers |
| DE1670529C3 (de) * | 1966-07-13 | 1974-01-10 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Substituierte s-Triazine |
| US3576805A (en) * | 1969-05-22 | 1971-04-27 | American Cyanamid Co | N**2,n**4,n**6-trisubstituted melamines |
| US3850918A (en) * | 1970-06-17 | 1974-11-26 | Ciba Geigy Corp | 2-amino-4,6-disalicyloyl-hydrazino-s-triazines |
| GB1393551A (en) * | 1972-04-21 | 1975-05-07 | Ciba Geigy Ag | Piperidine derivatives |
| DE2246106C2 (de) * | 1972-09-20 | 1983-02-24 | Bayer Ag, 5090 Leverkusen | s-Triazinringe enthaltende hochmolekulare Polycarbonate |
| DE2360709A1 (de) * | 1973-12-06 | 1975-06-12 | Bayer Ag | S-triazin-vorpolymerisaten |
-
1975
- 1975-12-04 IT IT52527/75A patent/IT1052501B/it active
-
1976
- 1976-06-21 DK DK277576A patent/DK167016B1/da not_active IP Right Cessation
- 1976-06-23 US US05/699,162 patent/US4086204A/en not_active Expired - Lifetime
- 1976-06-23 IE IE1368/76A patent/IE43013B1/en unknown
- 1976-06-24 CA CA255,636A patent/CA1085835A/en not_active Expired
- 1976-06-29 GB GB27099/76A patent/GB1496635A/en not_active Expired
- 1976-07-14 SU SU762382814A patent/SU686628A3/ru active
- 1976-07-22 JP JP51086679A patent/JPS5271486A/ja active Granted
- 1976-08-11 DE DE2636144A patent/DE2636144C3/de not_active Expired
- 1976-08-26 FR FR7625805A patent/FR2333821A1/fr active Granted
- 1976-09-27 NL NL7610694.A patent/NL167429C/xx not_active IP Right Cessation
- 1976-09-27 LU LU75879A patent/LU75879A1/xx unknown
- 1976-10-13 BE BE171479A patent/BE847239A/xx not_active IP Right Cessation
- 1976-11-26 AU AU20023/76A patent/AU504244B2/en not_active Expired
- 1976-12-02 ZA ZA767186A patent/ZA767186B/xx unknown
- 1976-12-03 AT AT897476A patent/AT350276B/de active
- 1976-12-03 ES ES453955A patent/ES453955A1/es not_active Expired
-
1979
- 1979-04-04 HK HK238/79A patent/HK23879A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2636144B2 (de) | 1979-10-31 |
| LU75879A1 (ref) | 1977-05-06 |
| JPS5742087B2 (ref) | 1982-09-07 |
| US4086204A (en) | 1978-04-25 |
| ES453955A1 (es) | 1978-02-01 |
| AU2002376A (en) | 1978-06-01 |
| IT1052501B (it) | 1981-07-20 |
| NL167429B (nl) | 1981-07-16 |
| FR2333821B1 (ref) | 1978-05-05 |
| ATA897476A (de) | 1978-10-15 |
| DE2636144C3 (de) | 1980-07-10 |
| IE43013L (en) | 1977-06-04 |
| HK23879A (en) | 1979-04-12 |
| GB1496635A (en) | 1977-12-30 |
| FR2333821A1 (fr) | 1977-07-01 |
| DE2636144A1 (de) | 1977-06-08 |
| AU504244B2 (en) | 1979-10-04 |
| DK167016B1 (da) | 1993-08-16 |
| ZA767186B (en) | 1977-11-30 |
| AT350276B (de) | 1979-05-25 |
| CA1085835A (en) | 1980-09-16 |
| JPS5271486A (en) | 1977-06-14 |
| DK277576A (da) | 1977-06-05 |
| SU686628A3 (ru) | 1979-09-15 |
| NL167429C (nl) | 1981-12-16 |
| BE847239A (fr) | 1977-01-31 |
| NL7610694A (nl) | 1977-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE43013B1 (en) | Polytriazine compounds | |
| US4263434A (en) | Piperidyl-triazine derivatives | |
| US4459395A (en) | Piperidyl derivatives of triazine copolymers, processes for their preparation and stabilized composition containing these derivatives | |
| US4477615A (en) | Polypiperidinyl stabilizing agents for polymer materials | |
| US4331586A (en) | Novel light stabilizers for polymers | |
| US3925376A (en) | Piperidine derivatives | |
| US4161592A (en) | Piperidinyl-s-triazines | |
| EP0209871B1 (en) | Substituted oxo-piperazinyl-triazines and uv light stabilized compositions | |
| JPS649995B2 (ref) | ||
| US4086207A (en) | Polyurea compounds which improve the light stability of polymers | |
| TW200530313A (en) | Flame retardant compositions | |
| EP1094094A1 (en) | Polymeric material composition | |
| TW201016769A (en) | Flame retardant compositions with polymeric dispersing agents | |
| GB1580940A (en) | Stabilisers for synthetic polymers and a process for their preparation | |
| US4400505A (en) | Triazinyl-piperidines as light stabilizers for polymers | |
| JP2799588B2 (ja) | ビス―ピペリジル―トリアジン環によって部分的に置換されたポリアミン類 | |
| JPH04288074A (ja) | 有機材料用の安定剤として使用するためのピペリジン−トリアジン化合物 | |
| US4238388A (en) | Derivatives of 1,3,5-triazacycloheptane-2,4-dione and their use as polymer stabilizers | |
| US4096206A (en) | Flame-retardant triazines | |
| KR960012369B1 (ko) | 2,2,6,6-테트라메틸피페리딘으로부터 유도되는 트리아진 화합물 | |
| EP0005441B1 (de) | Aminodibenzoxaphosphorine, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| US4461861A (en) | Polymer compositions stabilized with triazinyl-piperidine compounds | |
| GB2183235A (en) | Substituted benzylhydroxylamines and their use as stabilizers | |
| US4151356A (en) | 5-Triazin-2-yl phosphonates | |
| CA1260937A (en) | Light stabilizers for polymers |