HUT56366A - Process for producing diazobicycloamine derivatives - Google Patents
Process for producing diazobicycloamine derivatives Download PDFInfo
- Publication number
- HUT56366A HUT56366A HU906520A HU652090A HUT56366A HU T56366 A HUT56366 A HU T56366A HU 906520 A HU906520 A HU 906520A HU 652090 A HU652090 A HU 652090A HU T56366 A HUT56366 A HU T56366A
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- protecting group
- diazabicyclo
- group
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 102
- 238000002360 preparation method Methods 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 125000006239 protecting group Chemical group 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 14
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 14
- 230000002378 acidificating effect Effects 0.000 claims description 13
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 12
- 229910052794 bromium Inorganic materials 0.000 claims description 12
- 125000004970 halomethyl group Chemical group 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 9
- 239000005977 Ethylene Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 claims description 9
- 238000007363 ring formation reaction Methods 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 238000010511 deprotection reaction Methods 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- HIACNNDCIUUION-UHFFFAOYSA-N 2,3-dihydro-1h-pyrrolo[3,4-c]pyridine Chemical class N1=CC=C2CNCC2=C1 HIACNNDCIUUION-UHFFFAOYSA-N 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- 230000002152 alkylating effect Effects 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000000543 intermediate Substances 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- QSPOJWMZYOMAEI-UHFFFAOYSA-N ethyl n-[(ethoxycarbonylamino)methyl]carbamate Chemical compound CCOC(=O)NCNC(=O)OCC QSPOJWMZYOMAEI-UHFFFAOYSA-N 0.000 claims description 2
- 238000006077 hetero Diels-Alder cycloaddition reaction Methods 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 238000010992 reflux Methods 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 20
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- -1 which is C 1-4 Chemical group 0.000 description 19
- 238000005160 1H NMR spectroscopy Methods 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 13
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 10
- 235000019253 formic acid Nutrition 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 102100035593 POU domain, class 2, transcription factor 1 Human genes 0.000 description 9
- 101710084414 POU domain, class 2, transcription factor 1 Proteins 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 230000000844 anti-bacterial effect Effects 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 8
- 150000007660 quinolones Chemical class 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- BLTXQAIMJKGVPV-UHFFFAOYSA-N 1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole;dihydrobromide Chemical compound Br.Br.C1NCC2=C1CNC2 BLTXQAIMJKGVPV-UHFFFAOYSA-N 0.000 description 5
- GJZKNORRVIUCCH-UHFFFAOYSA-N 1,4-dibromo-2,3-bis(bromomethyl)but-2-ene Chemical group BrCC(CBr)=C(CBr)CBr GJZKNORRVIUCCH-UHFFFAOYSA-N 0.000 description 5
- 239000003242 anti bacterial agent Substances 0.000 description 5
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 5
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 5
- NMASXYCNDJMMFR-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NMASXYCNDJMMFR-UHFFFAOYSA-N 0.000 description 4
- GSDSWSVVBLHKDQ-UHFFFAOYSA-N 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=C2)=O)=C3N2C(C)COC3=C1N1CCN(C)CC1 GSDSWSVVBLHKDQ-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 241000192125 Firmicutes Species 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 150000002825 nitriles Chemical group 0.000 description 4
- 229960001699 ofloxacin Drugs 0.000 description 4
- 229940072132 quinolone antibacterials Drugs 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229960003405 ciprofloxacin Drugs 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 0 *N1CC(CNC2)=C2C1 Chemical compound *N1CC(CNC2)=C2C1 0.000 description 2
- PRGFKWSAKQKRQN-UHFFFAOYSA-N 2,3,4,5,6,7-hexahydro-1h-pyrrolo[3,4-c]pyridine Chemical compound C1CNCC2=C1CNC2 PRGFKWSAKQKRQN-UHFFFAOYSA-N 0.000 description 2
- LGAFXTOPHMOXEP-UHFFFAOYSA-N 2,5-bis-(4-methylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CN(C2)S(=O)(=O)C=3C=CC(C)=CC=3)=C2C1 LGAFXTOPHMOXEP-UHFFFAOYSA-N 0.000 description 2
- WGOFRQKKWLZRDA-UHFFFAOYSA-N 2,5-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole;dihydrobromide Chemical compound Br.Br.C1N(C)CC2=C1CN(C)C2 WGOFRQKKWLZRDA-UHFFFAOYSA-N 0.000 description 2
- OUYLPBAISPSRBV-UHFFFAOYSA-N 2-[4-(bromomethyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]ethanamine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CCN)=C(CBr)C1 OUYLPBAISPSRBV-UHFFFAOYSA-N 0.000 description 2
- NLNRRQCTHBQXJB-UHFFFAOYSA-N 2-methyl-1,3,4,5,6,7-hexahydropyrrolo[3,4-c]pyridine;dihydrobromide Chemical compound Br.Br.C1NCCC2=C1CN(C)C2 NLNRRQCTHBQXJB-UHFFFAOYSA-N 0.000 description 2
- CDKLGIKXEOZRFG-UHFFFAOYSA-N 2-methyl-5-(4-methylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole Chemical compound C1N(C)CC(C2)=C1CN2S(=O)(=O)C1=CC=C(C)C=C1 CDKLGIKXEOZRFG-UHFFFAOYSA-N 0.000 description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 2
- UJSLOZAVHMSQNG-UHFFFAOYSA-N 4-oxo-3h-quinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=C2C(=O)C(C(=O)O)C=NC2=C1 UJSLOZAVHMSQNG-UHFFFAOYSA-N 0.000 description 2
- MMURJENLPISZNE-UHFFFAOYSA-N 5-benzyl-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine;hydrobromide Chemical compound Br.C1CC(CNC2)=C2CN1CC1=CC=CC=C1 MMURJENLPISZNE-UHFFFAOYSA-N 0.000 description 2
- CZHRFUDWFSPUIX-UHFFFAOYSA-N 5-methyl-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine;dihydrobromide Chemical compound Br.Br.C1N(C)CCC2=C1CNC2 CZHRFUDWFSPUIX-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000191940 Staphylococcus Species 0.000 description 2
- 241000194017 Streptococcus Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 2
- 229960003085 meticillin Drugs 0.000 description 2
- OGJPXUAPXNRGGI-UHFFFAOYSA-N norfloxacin Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 OGJPXUAPXNRGGI-UHFFFAOYSA-N 0.000 description 2
- 229960001180 norfloxacin Drugs 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KGLCNBOXQUHILF-UHFFFAOYSA-N 1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole Chemical compound C1NCC2=C1CNC2 KGLCNBOXQUHILF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VGLXMPFLZLVDQN-UHFFFAOYSA-N 1-(bromomethyl)-2,5-dihydropyrrole Chemical compound BrCN1CC=CC1 VGLXMPFLZLVDQN-UHFFFAOYSA-N 0.000 description 1
- RFZHFIFSQNIHAI-UHFFFAOYSA-N 1-cyclopropyl-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(F)=C2C(=O)C(C(=O)O)=CN1C1CC1 RFZHFIFSQNIHAI-UHFFFAOYSA-N 0.000 description 1
- QDUGGYAKXPEHDR-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-4-oxo-7-(2,3,4,6-tetrahydro-1h-pyrrolo[3,4-c]pyrrol-5-yl)quinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CC4=C(CNC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 QDUGGYAKXPEHDR-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- MOSBJQRMGQQHGY-UHFFFAOYSA-N 2,3,4,5,6,7-hexahydro-1h-pyrrolo[3,4-c]pyridine;dihydrobromide Chemical compound Br.Br.C1CNCC2=C1CNC2 MOSBJQRMGQQHGY-UHFFFAOYSA-N 0.000 description 1
- OZUCUCKQZLWFON-UHFFFAOYSA-N 2,3-bis(bromomethyl)buta-1,3-diene Chemical compound BrCC(=C)C(=C)CBr OZUCUCKQZLWFON-UHFFFAOYSA-N 0.000 description 1
- PNLKVCQVHLKYFZ-UHFFFAOYSA-N 2,5-dimethyl-3,4,6,7-tetrahydro-1h-pyrrolo[3,4-c]pyridine;dihydrobromide Chemical compound Br.Br.C1N(C)CCC2=C1CN(C)C2 PNLKVCQVHLKYFZ-UHFFFAOYSA-N 0.000 description 1
- USPASZHJABQYSZ-UHFFFAOYSA-N 2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7-hexahydropyrrolo[3,4-c]pyridine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CNCC2)=C2C1 USPASZHJABQYSZ-UHFFFAOYSA-N 0.000 description 1
- JGXMQVRCAJCSHJ-UHFFFAOYSA-N 2-[4-(bromomethyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-3-yl]acetonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CC#N)=C(CBr)C1 JGXMQVRCAJCSHJ-UHFFFAOYSA-N 0.000 description 1
- KOALCPAXCCKZBA-UHFFFAOYSA-N 2-methyl-1,3,4,5,6,7-hexahydropyrrolo[3,4-c]pyridine;dihydrochloride Chemical compound Cl.Cl.C1NCCC2=C1CN(C)C2 KOALCPAXCCKZBA-UHFFFAOYSA-N 0.000 description 1
- WYHGXYZJLUANMJ-UHFFFAOYSA-N 3,4-bis(bromomethyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CBr)=C(CBr)C1 WYHGXYZJLUANMJ-UHFFFAOYSA-N 0.000 description 1
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- CQPUZLMNORVQPG-UHFFFAOYSA-N 5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C(N)=C(F)C(F)=C(F)C=2N1C1CC1 CQPUZLMNORVQPG-UHFFFAOYSA-N 0.000 description 1
- PNZAQLRQCZTQIH-UHFFFAOYSA-N 5-benzyl-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine;dihydrobromide Chemical compound Br.Br.C1CC(CNC2)=C2CN1CC1=CC=CC=C1 PNZAQLRQCZTQIH-UHFFFAOYSA-N 0.000 description 1
- BKCNVICHZVKDSS-UHFFFAOYSA-N 5-benzyl-2-(4-methylphenyl)sulfonyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-c]pyridine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CN(CC=2C=CC=CC=2)CC2)=C2C1 BKCNVICHZVKDSS-UHFFFAOYSA-N 0.000 description 1
- PATXLKRUTNOVTN-UHFFFAOYSA-N 5-ethyl-2,3,4,6-tetrahydro-1h-pyrrolo[3,4-c]pyrrole;dihydrobromide Chemical compound Br.Br.C1N(CC)CC2=C1CNC2 PATXLKRUTNOVTN-UHFFFAOYSA-N 0.000 description 1
- BOXYFYGBSAVVIE-UHFFFAOYSA-N 5-methyl-2,3,4,6-tetrahydro-1h-pyrrolo[3,4-c]pyrrole;dihydrobromide Chemical compound Br.Br.C1N(C)CC2=C1CNC2 BOXYFYGBSAVVIE-UHFFFAOYSA-N 0.000 description 1
- QFCMBRXRVQRSSF-UHFFFAOYSA-N C1NCC2C1CNC2 Chemical compound C1NCC2C1CNC2 QFCMBRXRVQRSSF-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- GDRVVUCKWUUWRZ-UHFFFAOYSA-N FC1=C(N2CC3=C(CCNC3)C2)C(F)=CC(C(C=C2)=O)=C1N2C1CC1 Chemical compound FC1=C(N2CC3=C(CCNC3)C2)C(F)=CC(C(C=C2)=O)=C1N2C1CC1 GDRVVUCKWUUWRZ-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- HGSUCAFFNZULEG-UHFFFAOYSA-N OC(=O)NCNC(O)=O.CCOC(=O)NCNC(=O)OCC Chemical compound OC(=O)NCNC(O)=O.CCOC(=O)NCNC(=O)OCC HGSUCAFFNZULEG-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241001115903 Raphus cucullatus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- IGLOYLMJLRCIMZ-UHFFFAOYSA-N ethyl 2-methyl-3,4,6,7-tetrahydro-1h-pyrrolo[3,4-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OCC)CCC2=C1CN(C)C2 IGLOYLMJLRCIMZ-UHFFFAOYSA-N 0.000 description 1
- HAHFYBHZZWNMHT-UHFFFAOYSA-N ethyl 4,5-bis(bromomethyl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound CCOC(=O)N1CCC(CBr)=C(CBr)C1 HAHFYBHZZWNMHT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 208000000143 urethritis Diseases 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1019890015204A KR910009331B1 (ko) | 1989-10-23 | 1989-10-23 | 디아자비시클로아민 화합물과 그의 제조방법 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU906520D0 HU906520D0 (en) | 1991-04-29 |
| HUT56366A true HUT56366A (en) | 1991-08-28 |
Family
ID=19290921
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU906520A HUT56366A (en) | 1989-10-23 | 1990-10-20 | Process for producing diazobicycloamine derivatives |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5089621A (index.php) |
| EP (1) | EP0424852A1 (index.php) |
| JP (1) | JPH03193779A (index.php) |
| KR (1) | KR910009331B1 (index.php) |
| CN (1) | CN1051177A (index.php) |
| CA (1) | CA2028205A1 (index.php) |
| FI (1) | FI905173A7 (index.php) |
| HU (1) | HUT56366A (index.php) |
| IL (1) | IL96090A0 (index.php) |
| IN (1) | IN171604B (index.php) |
| YU (1) | YU198190A (index.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR940001770B1 (ko) * | 1991-10-15 | 1994-03-05 | 재단법인 한국화학연구소 | 불포화 아자비시클로아민 화합물과 그의 제조방법 |
| DE4339134A1 (de) * | 1993-11-16 | 1995-05-18 | Bayer Ag | 1-(2-Fluorcyclopropyl)-chinolon- und -naphthyridoncarbonsäure-Derivate |
| US5457121A (en) * | 1994-09-02 | 1995-10-10 | Eli Lilly And Company | Cis-hexahydro-5-(1,2,3,4-tetrahydro-2-naphthalenyl)pyrrolo<3,4-c>pyrroles as inhibitors of serotonin reuptake |
| WO2016046837A1 (en) | 2014-09-22 | 2016-03-31 | Cadila Healthcare Limited | An improved process for preparation of pyrrolo[3,4- c] pyrrole compounds and intermediates thereof |
| MD3483164T2 (ro) | 2017-03-20 | 2020-07-31 | Forma Therapeutics Inc | Compoziții pirolopirolice ca activatori ai piruvat kinazei (PKR) |
| US10675274B2 (en) | 2018-09-19 | 2020-06-09 | Forma Therapeutics, Inc. | Activating pyruvate kinase R |
| WO2020061255A1 (en) | 2018-09-19 | 2020-03-26 | Forma Therapeutics, Inc. | Activating pyruvate kinase r |
| AU2020349555A1 (en) | 2019-09-19 | 2022-04-07 | Forma Therapeutics, Inc. | Activating Pyruvate Kinase R |
| US12128035B2 (en) | 2021-03-19 | 2024-10-29 | Novo Nordisk Health Care Ag | Activating pyruvate kinase R |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
| JP2844079B2 (ja) * | 1988-05-23 | 1999-01-06 | 塩野義製薬株式会社 | ピリドンカルボン酸系抗菌剤 |
-
1989
- 1989-10-23 KR KR1019890015204A patent/KR910009331B1/ko not_active Expired
-
1990
- 1990-09-19 IN IN745/MAS/90A patent/IN171604B/en unknown
- 1990-10-19 FI FI905173A patent/FI905173A7/fi not_active Application Discontinuation
- 1990-10-19 US US07/598,888 patent/US5089621A/en not_active Expired - Fee Related
- 1990-10-20 HU HU906520A patent/HUT56366A/hu unknown
- 1990-10-22 CA CA002028205A patent/CA2028205A1/en not_active Abandoned
- 1990-10-22 YU YU198190A patent/YU198190A/sh unknown
- 1990-10-22 JP JP2282069A patent/JPH03193779A/ja active Pending
- 1990-10-22 EP EP90120242A patent/EP0424852A1/en not_active Withdrawn
- 1990-10-22 CN CN90108666A patent/CN1051177A/zh active Pending
- 1990-10-23 IL IL96090A patent/IL96090A0/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU198190A (sh) | 1993-05-28 |
| HU906520D0 (en) | 1991-04-29 |
| FI905173A7 (fi) | 1991-04-24 |
| EP0424852A1 (en) | 1991-05-02 |
| CA2028205A1 (en) | 1991-04-24 |
| CN1051177A (zh) | 1991-05-08 |
| KR910009331B1 (ko) | 1991-11-11 |
| KR910007932A (ko) | 1991-05-30 |
| US5089621A (en) | 1992-02-18 |
| IN171604B (index.php) | 1992-11-21 |
| JPH03193779A (ja) | 1991-08-23 |
| FI905173A0 (fi) | 1990-10-19 |
| IL96090A0 (en) | 1991-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Matsumoto et al. | 1, 4-Dihydro-4-oxopyridinecarboxylic acids as antibacterial agents. 2. Synthesis and structure-activity relationships of 1, 6, 7-trisubstituted 1, 4-dihydro-4-oxo-1, 8-naphthyridine-3-carboxylic acids, including enoxacin, a new antibacterial agent | |
| KR910009330B1 (ko) | 항균작용을 갖는 퀴놀린계 화합물과 그의 제조방법 | |
| CZ192892A3 (en) | Derivatives of 7-azaisoindolinyl-quinolonecarboxylic and naphthyridonecarboxylic acids | |
| NO170335B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive diazabicykloalkyl-kinolon-karboksylsyrer | |
| CS246065B2 (en) | Method of new 7-substituted cyclic aminonaphthyridine-,quinoline-and benzoxazinecarboxylic acids production | |
| EP0690862B1 (en) | Quinolone derivatives and processes for preparing the same | |
| PL192461B1 (pl) | Sposób wytwarzania pochodnych kwasu 3-chinolonokarboksylowego | |
| NO166080B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 5,6,8-trifluorkinoliner. | |
| US6313299B1 (en) | Quinolone carboxylic acid derivatives | |
| HUT56366A (en) | Process for producing diazobicycloamine derivatives | |
| KR910009333B1 (ko) | 항균작용을 갖는 퀴놀린계 화합물과 그의 제조방법 | |
| WO1994025464A1 (en) | Novel quinolone carboxylic acid derivatives and process for preparing the same | |
| FI70219B (fi) | Foerfarande foer framstaellning av en beta-laktamantibiotikumfoerening | |
| FI94959C (fi) | Menetelmä valmistaa 2,3,4,5-tetrahydro-5-metyyli-1-/(5-metyyli-1H-imidatsol-4-yyli)-metyyli)/-1H-pyrido/4,3-b/-indol-1-onia | |
| KR100245982B1 (ko) | 신규한 퀴놀론카르복실산 유도체 | |
| KR19990082534A (ko) | 피리돈카르복실산 유도체 및 그 합성중간체 | |
| JP2552101B2 (ja) | 新規ピリドンカルボン酸誘導体及びその調製方法 | |
| JPH08253480A (ja) | 1,6−ナフチリドンカルボン酸誘導体 | |
| JPH08509457A (ja) | 新規ジアザビシクロアルケン類及びそれらの調製方法 | |
| CS235545B2 (cs) | Způsob přípravy derivátů 1-ethyl nebo vinyl-6-halogen-1,4-dihydro-4- oxo-7-/1 -piperazinyl/-!,8-nafthyridinu | |
| JPH07278139A (ja) | 新規なキノロンカルボン酸誘導体およびその製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DFC9 | Refusal of application |