HU212783B - Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds - Google Patents
Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds Download PDFInfo
- Publication number
- HU212783B HU212783B HU908447A HU844790A HU212783B HU 212783 B HU212783 B HU 212783B HU 908447 A HU908447 A HU 908447A HU 844790 A HU844790 A HU 844790A HU 212783 B HU212783 B HU 212783B
- Authority
- HU
- Hungary
- Prior art keywords
- hydrogen
- formula
- feed
- compound
- preparation
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 36
- 238000000034 method Methods 0.000 title claims description 14
- -1 thiobenzoyl Chemical group 0.000 title description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 230000004584 weight gain Effects 0.000 claims abstract description 12
- 235000019786 weight gain Nutrition 0.000 claims abstract description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 5
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract description 4
- 150000002431 hydrogen Chemical class 0.000 claims abstract 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 14
- 235000013312 flour Nutrition 0.000 claims description 13
- 241001465754 Metazoa Species 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 240000008042 Zea mays Species 0.000 claims description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 8
- 239000003674 animal food additive Substances 0.000 claims description 8
- 235000010469 Glycine max Nutrition 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 6
- 235000005822 corn Nutrition 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 6
- 235000021307 Triticum Nutrition 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 235000007319 Avena orientalis Nutrition 0.000 claims description 3
- 244000075850 Avena orientalis Species 0.000 claims description 3
- 235000019733 Fish meal Nutrition 0.000 claims description 3
- 240000005979 Hordeum vulgare Species 0.000 claims description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 claims description 3
- 240000004658 Medicago sativa Species 0.000 claims description 3
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 claims description 3
- 235000007238 Secale cereale Nutrition 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000004467 fishmeal Substances 0.000 claims description 3
- 235000013372 meat Nutrition 0.000 claims description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 244000068988 Glycine max Species 0.000 claims description 2
- 244000082988 Secale cereale Species 0.000 claims description 2
- 235000013339 cereals Nutrition 0.000 claims description 2
- 235000012054 meals Nutrition 0.000 claims description 2
- 244000098338 Triticum aestivum Species 0.000 claims 1
- 239000000654 additive Substances 0.000 claims 1
- 230000029936 alkylation Effects 0.000 claims 1
- 238000005804 alkylation reaction Methods 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims 1
- 235000013311 vegetables Nutrition 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 15
- 230000000694 effects Effects 0.000 abstract description 5
- 150000003839 salts Chemical class 0.000 abstract description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 2
- 208000021017 Weight Gain Diseases 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 abstract 1
- AEKJTLISCSMKLR-UHFFFAOYSA-N morpholin-4-yl(phenyl)methanethione Chemical class C=1C=CC=CC=1C(=S)N1CCOCC1 AEKJTLISCSMKLR-UHFFFAOYSA-N 0.000 abstract 1
- 239000000843 powder Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 229940088594 vitamin Drugs 0.000 description 6
- 229930003231 vitamin Natural products 0.000 description 6
- 235000013343 vitamin Nutrition 0.000 description 6
- 239000011782 vitamin Substances 0.000 description 6
- 150000003722 vitamin derivatives Chemical class 0.000 description 6
- 241000282887 Suidae Species 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 235000012424 soybean oil Nutrition 0.000 description 5
- 239000003549 soybean oil Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 239000001506 calcium phosphate Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000011573 trace mineral Substances 0.000 description 4
- 235000013619 trace mineral Nutrition 0.000 description 4
- BCZXFFBUYPCTSJ-UHFFFAOYSA-L Calcium propionate Chemical compound [Ca+2].CCC([O-])=O.CCC([O-])=O BCZXFFBUYPCTSJ-UHFFFAOYSA-L 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 235000006708 antioxidants Nutrition 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 3
- 235000010331 calcium propionate Nutrition 0.000 description 3
- 239000004330 calcium propionate Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 3
- 229940038472 dicalcium phosphate Drugs 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 2
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 2
- DYJXODUYQQLNDC-UHFFFAOYSA-N 4-hexoxy-3-methoxybenzaldehyde Chemical compound CCCCCCOC1=CC=C(C=O)C=C1OC DYJXODUYQQLNDC-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- 235000019743 Choline chloride Nutrition 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 2
- 229930003270 Vitamin B Natural products 0.000 description 2
- 229930003427 Vitamin E Natural products 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 2
- 229960003178 choline chloride Drugs 0.000 description 2
- 235000005687 corn oil Nutrition 0.000 description 2
- 239000002285 corn oil Substances 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 244000144972 livestock Species 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004334 sorbic acid Substances 0.000 description 2
- 235000010199 sorbic acid Nutrition 0.000 description 2
- 229940075582 sorbic acid Drugs 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- DKZBBWMURDFHNE-UHFFFAOYSA-N trans-coniferylaldehyde Natural products COC1=CC(C=CC=O)=CC=C1O DKZBBWMURDFHNE-UHFFFAOYSA-N 0.000 description 2
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 2
- 235000019155 vitamin A Nutrition 0.000 description 2
- 239000011719 vitamin A Substances 0.000 description 2
- 235000019156 vitamin B Nutrition 0.000 description 2
- 239000011720 vitamin B Substances 0.000 description 2
- QYSXJUFSXHHAJI-YRZJJWOYSA-N vitamin D3 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-YRZJJWOYSA-N 0.000 description 2
- 235000019165 vitamin E Nutrition 0.000 description 2
- 229940046009 vitamin E Drugs 0.000 description 2
- 239000011709 vitamin E Substances 0.000 description 2
- 229940045997 vitamin a Drugs 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- GVJHHUAWPYXKBD-IEOSBIPESA-N α-tocopherol Chemical compound OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 2
- ZUTVKAFCCXLAFA-UHFFFAOYSA-N (3-bromo-4-hexoxy-5-methoxyphenyl)-morpholin-4-ylmethanethione Chemical compound C1=C(OC)C(OCCCCCC)=C(Br)C=C1C(=S)N1CCOCC1 ZUTVKAFCCXLAFA-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- PBLNBZIONSLZBU-UHFFFAOYSA-N 1-bromododecane Chemical compound CCCCCCCCCCCCBr PBLNBZIONSLZBU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- CUJRPSORSFJHKO-UHFFFAOYSA-N 3-bromo-4-hexoxy-5-methoxybenzaldehyde Chemical compound CCCCCCOC1=C(Br)C=C(C=O)C=C1OC CUJRPSORSFJHKO-UHFFFAOYSA-N 0.000 description 1
- KLSHZDPXXKAHIJ-UHFFFAOYSA-N 3-bromo-4-hydroxy-5-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(Br)=C1O KLSHZDPXXKAHIJ-UHFFFAOYSA-N 0.000 description 1
- WSBKJKOGWBWHQX-UHFFFAOYSA-N 3-bromo-5-methoxy-4-prop-1-ynoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(Br)=C1OC#CC WSBKJKOGWBWHQX-UHFFFAOYSA-N 0.000 description 1
- QWVVBLVJWOIDJX-UHFFFAOYSA-N 4-(3-bromo-4-hydroxy-5-methoxyphenyl)morpholine-3-carbothialdehyde Chemical compound BrC=1C=C(C=C(C1O)OC)N1C(COCC1)C=S QWVVBLVJWOIDJX-UHFFFAOYSA-N 0.000 description 1
- VXTSMWMZUJWZAT-UHFFFAOYSA-N 4-(3-bromo-5-methoxy-4-prop-1-ynoxyphenyl)morpholine-3-carbothialdehyde Chemical compound BrC=1C=C(C=C(C1OC#CC)OC)N1C(COCC1)C=S VXTSMWMZUJWZAT-UHFFFAOYSA-N 0.000 description 1
- BERFDQAMXIBOHM-UHFFFAOYSA-N 4-Ethoxy-3-methoxybenzaldehyde Chemical group CCOC1=CC=C(C=O)C=C1OC BERFDQAMXIBOHM-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010064571 Gene mutation Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- MJVAVZPDRWSRRC-UHFFFAOYSA-N Menadione Chemical compound C1=CC=C2C(=O)C(C)=CC(=O)C2=C1 MJVAVZPDRWSRRC-UHFFFAOYSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229940087168 alpha tocopherol Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 description 1
- 229960003563 calcium carbonate Drugs 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- IDAGXRIGDWCIET-SDFKWCIISA-L disodium;(2s,3s,4s,5r)-2,3,4,5-tetrahydroxyhexanedioate Chemical compound [Na+].[Na+].[O-]C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O IDAGXRIGDWCIET-SDFKWCIISA-L 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 235000018927 edible plant Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 210000000232 gallbladder Anatomy 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 229910000150 monocalcium phosphate Inorganic materials 0.000 description 1
- 235000019691 monocalcium phosphate Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 235000020183 skimmed milk Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229960000984 tocofersolan Drugs 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- MVOUIYUWRXPNKD-UHFFFAOYSA-N tritiozine Chemical compound COC1=C(OC)C(OC)=CC(C(=S)N2CCOCC2)=C1 MVOUIYUWRXPNKD-UHFFFAOYSA-N 0.000 description 1
- WQYRHRAZNNRDIA-UHFFFAOYSA-N vanitiolide Chemical compound C1=C(O)C(OC)=CC(C(=S)N2CCOCC2)=C1 WQYRHRAZNNRDIA-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 235000015099 wheat brans Nutrition 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 235000004835 α-tocopherol Nutrition 0.000 description 1
- 239000002076 α-tocopherol Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/194—Radicals derived from thio- or thiono carboxylic acids
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S426/00—Food or edible material: processes, compositions, and products
- Y10S426/807—Poultry or ruminant feed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Fodder In General (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU908447A HU212783B (en) | 1990-12-22 | 1990-12-22 | Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds |
| US07/802,236 US5254547A (en) | 1990-12-22 | 1991-12-04 | Thioacid amide derivatives and fodder compositions containing the same |
| JP3354052A JPH05148252A (ja) | 1990-12-22 | 1991-12-19 | チオ酸アミド誘導体、その製造法、およびそれを含んでなる飼料組成物 |
| CS913984A CS398491A3 (en) | 1990-12-22 | 1991-12-20 | Derivatives of a thioacid amide and dry feedstuff mixtures comprising saidderivatives |
| PL29289991A PL292899A1 (en) | 1990-12-22 | 1991-12-20 | Fodder compositions for use in farming animals as well as compositions in the form of fodder additives, premixtures and ready-to-use fodder containing novel isoquinoline derivatives and method of obtaining such compositions |
| SU915010473A RU2060995C1 (ru) | 1990-12-22 | 1991-12-20 | Амидные производные тиокислоты и кормовые составы для применения в животноводстве |
| YU196891A YU47734B (sh) | 1990-12-22 | 1991-12-20 | Derivati tioacid amida i krmni preparati koji sadrže isti |
| CA002058273A CA2058273A1 (en) | 1990-12-22 | 1991-12-20 | Thioacid amide derivatives and fodder compositions containing the same |
| ZA9110048A ZA9110048B (en) | 1990-12-22 | 1991-12-20 | Thioacid amide derivatives and fodder compositions containing the same |
| GB9127064A GB2250989B (en) | 1990-12-22 | 1991-12-20 | Thioacid amide derivatives and fodder compositions containing the same |
| KR1019910023811A KR920012059A (ko) | 1990-12-22 | 1991-12-21 | 티오산 아미드 유도체와 이를 함유하는 사료 조성물 |
| CN91111844A CN1062728A (zh) | 1990-12-22 | 1991-12-23 | 硫代酰胺衍生物以及含有硫代酰胺衍生物的饲料组合物 |
| DE69105108T DE69105108D1 (de) | 1990-12-22 | 1991-12-23 | Substituierte N-[Phenyl-(thioxomethyl)]-morpholinderivate, Verfahren zu ihrer Herstellung, diese enthaltende Zusammensetzung und ihre Verwendung. |
| EP91121881A EP0492484B1 (en) | 1990-12-22 | 1991-12-23 | Substituted N-[phenyl-(thioxomethyl)]-morpholine derivatives, a process for preparing them as well as compositions containing these compounds and the use of them |
| AT91121881T ATE113941T1 (de) | 1990-12-22 | 1991-12-23 | Substituierte n-(phenyl-(thioxomethyl)>- morpholinderivate, verfahren zu ihrer herstellung, diese enthaltende zusammensetzung und ihre verwendung. |
| TW081100090A TW208000B (enExample) | 1990-12-22 | 1992-01-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU908447A HU212783B (en) | 1990-12-22 | 1990-12-22 | Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU908447D0 HU908447D0 (en) | 1991-07-29 |
| HUT62279A HUT62279A (en) | 1993-04-28 |
| HU212783B true HU212783B (en) | 1996-11-28 |
Family
ID=10972618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU908447A HU212783B (en) | 1990-12-22 | 1990-12-22 | Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5254547A (enExample) |
| EP (1) | EP0492484B1 (enExample) |
| JP (1) | JPH05148252A (enExample) |
| KR (1) | KR920012059A (enExample) |
| CN (1) | CN1062728A (enExample) |
| AT (1) | ATE113941T1 (enExample) |
| CA (1) | CA2058273A1 (enExample) |
| CS (1) | CS398491A3 (enExample) |
| DE (1) | DE69105108D1 (enExample) |
| GB (1) | GB2250989B (enExample) |
| HU (1) | HU212783B (enExample) |
| PL (1) | PL292899A1 (enExample) |
| RU (1) | RU2060995C1 (enExample) |
| TW (1) | TW208000B (enExample) |
| YU (1) | YU47734B (enExample) |
| ZA (1) | ZA9110048B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW409035B (en) * | 1997-06-04 | 2000-10-21 | Gist Brocades Bv | Starch-based enzyme granulates |
| PT990026E (pt) * | 1997-06-04 | 2004-08-31 | Basf Ag | Composicoes de fitase com actividade elevada |
| CN102702053A (zh) * | 2012-06-25 | 2012-10-03 | 四川大学 | 一种在水相中制备硫代酰胺衍生物的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1043955B (it) * | 1970-07-31 | 1980-02-29 | Isf Spa | Tioamidi dell acido siringo 4 sostituito e loro preparazione |
| JPS5612316A (en) * | 1979-07-09 | 1981-02-06 | Kureha Chem Ind Co Ltd | Remedy for peptic ulcer, containing morpholine derivative |
| US4495185A (en) * | 1981-11-12 | 1985-01-22 | Imperial Chemical Industries, Plc | 1,2,4-Triazin-3(2H) ones |
| US4489074A (en) * | 1982-11-12 | 1984-12-18 | Imperial Chemical Industries, Plc | 1,3,4-Thiadiazin-2-ones |
| JPS6012316A (ja) * | 1983-07-02 | 1985-01-22 | Iseki & Co Ltd | 農用トラクタ−のフアイナルケ−ス |
-
1990
- 1990-12-22 HU HU908447A patent/HU212783B/hu not_active IP Right Cessation
-
1991
- 1991-12-04 US US07/802,236 patent/US5254547A/en not_active Expired - Fee Related
- 1991-12-19 JP JP3354052A patent/JPH05148252A/ja active Pending
- 1991-12-20 GB GB9127064A patent/GB2250989B/en not_active Expired - Fee Related
- 1991-12-20 YU YU196891A patent/YU47734B/sh unknown
- 1991-12-20 CA CA002058273A patent/CA2058273A1/en not_active Abandoned
- 1991-12-20 CS CS913984A patent/CS398491A3/cs unknown
- 1991-12-20 ZA ZA9110048A patent/ZA9110048B/xx unknown
- 1991-12-20 RU SU915010473A patent/RU2060995C1/ru active
- 1991-12-20 PL PL29289991A patent/PL292899A1/xx unknown
- 1991-12-21 KR KR1019910023811A patent/KR920012059A/ko not_active Withdrawn
- 1991-12-23 DE DE69105108T patent/DE69105108D1/de not_active Expired - Lifetime
- 1991-12-23 CN CN91111844A patent/CN1062728A/zh active Pending
- 1991-12-23 AT AT91121881T patent/ATE113941T1/de not_active IP Right Cessation
- 1991-12-23 EP EP91121881A patent/EP0492484B1/en not_active Expired - Lifetime
-
1992
- 1992-01-07 TW TW081100090A patent/TW208000B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| KR920012059A (ko) | 1992-07-25 |
| EP0492484A1 (en) | 1992-07-01 |
| PL292899A1 (en) | 1992-11-02 |
| HUT62279A (en) | 1993-04-28 |
| TW208000B (enExample) | 1993-06-21 |
| CN1062728A (zh) | 1992-07-15 |
| CS398491A3 (en) | 1992-07-15 |
| JPH05148252A (ja) | 1993-06-15 |
| ZA9110048B (en) | 1992-09-30 |
| GB9127064D0 (en) | 1992-02-19 |
| ATE113941T1 (de) | 1994-11-15 |
| YU47734B (sh) | 1996-01-08 |
| GB2250989A (en) | 1992-06-24 |
| US5254547A (en) | 1993-10-19 |
| RU2060995C1 (ru) | 1996-05-27 |
| HU908447D0 (en) | 1991-07-29 |
| EP0492484B1 (en) | 1994-11-09 |
| CA2058273A1 (en) | 1992-06-23 |
| DE69105108D1 (de) | 1994-12-15 |
| YU196891A (sh) | 1994-01-20 |
| GB2250989B (en) | 1994-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL137173B1 (en) | Method of obtaining novel quinoxalin-2-ilo-ethylene ketones and fodder composition,in particular in the form offodder concentrate,ready fodder or fodder additive,containing them | |
| US3974277A (en) | 2-[2-(5-Nitro-2-furyl)vinyl]-4-(anilino)quinazolines as growth promotants and feed efficiency enhancing agents | |
| HU212783B (en) | Process for producing new thiobenzoyl morpholide derivatives and weight increasing agents comprising such compounds | |
| US4587261A (en) | Cycloalkane derivatives and fodder compositions containing the same | |
| EP0492483B1 (en) | Compositions containing 1 or more N-[phenyl-(thioxomethyl)]-morpholine derivative(s) and the use of these compounds | |
| US3973021A (en) | 2-[2-(5-Nitro-2-furyl)vinyl]-4-(phydroxyanilino)quinazoline as a bactericide | |
| US4570002A (en) | Carbazic acid derivatives | |
| US3970648A (en) | 2-[2-(5-Nitro-2-furyl)vinyl]-4-(anilino)quinazolines | |
| US4511717A (en) | 2-Hydroxymethyl-quinoxaline-1,4-dioxide derivatives, a process for preparing same and compositions containing same | |
| US4806667A (en) | Promoting production of useful livestock with silylated aminophenylethylamine derivatives | |
| CA1241011A (en) | Monosilylated aminophenylethylamine derivatives, a process for their preparation, and their use for promoting growth | |
| US4883907A (en) | Carbazates | |
| US4510146A (en) | Growth-promoting feed and drink | |
| US4824670A (en) | Carbazates | |
| IL23409A (en) | New animal feed compositions comprising a phthalazinone derivative | |
| US4505917A (en) | Feed compositions containing a (1-oxo-2-pyridyl) disulfide | |
| PL129087B1 (en) | Process for preparing novel derivatives of 5,10-dioxide of pyridazin /4,5-b/ quinoxaline and agent for use in farming,containing those derivatives | |
| US3373032A (en) | Estrogenic compounds and animal growth promoters | |
| PL130660B1 (en) | Process for preparing novel derivatives of methylquinoxaline 1,4-dioxide | |
| JPS597158A (ja) | シスタミン誘導体 | |
| DD282914A5 (de) | Verfahren zur herstellung von (2-thienyl-methyl)-thioharnstoffderivaten | |
| CS258130B2 (cs) | Krmná přísada | |
| IL27951A (en) | Carboxy substituted 6(6'-oxo-10'-hydroxy-undec-1'-enyl)-2,4-dihydroxy benzoic acid lactone,derivatives thereof and animal feed compositions containing them | |
| DE3543637A1 (de) | Neue aminophenylethylamin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als leistungsfoerderer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |