HU200445B - Process for production of substituated derivatives of azobyciclo-carbonic acid and medical compositions containing them - Google Patents
Process for production of substituated derivatives of azobyciclo-carbonic acid and medical compositions containing them Download PDFInfo
- Publication number
- HU200445B HU200445B HU851399A HU139985A HU200445B HU 200445 B HU200445 B HU 200445B HU 851399 A HU851399 A HU 851399A HU 139985 A HU139985 A HU 139985A HU 200445 B HU200445 B HU 200445B
- Authority
- HU
- Hungary
- Prior art keywords
- oxo
- dihydro
- diazabicyclo
- ethyl
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 21
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 title description 57
- 150000001875 compounds Chemical class 0.000 claims abstract description 112
- -1 p-aminobenzyl Chemical group 0.000 claims abstract description 74
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 31
- 239000001257 hydrogen Substances 0.000 claims abstract description 31
- 239000002253 acid Substances 0.000 claims abstract description 26
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 18
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 4
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 238000002360 preparation method Methods 0.000 claims description 19
- 239000008194 pharmaceutical composition Substances 0.000 claims description 10
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 229910052731 fluorine Chemical group 0.000 claims description 4
- 239000011737 fluorine Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- AHPALVNYJYICFF-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 AHPALVNYJYICFF-UHFFFAOYSA-N 0.000 claims description 3
- RLBUUKCKRXIPKN-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F RLBUUKCKRXIPKN-UHFFFAOYSA-N 0.000 claims description 3
- OYURSKSJKOIXFH-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F OYURSKSJKOIXFH-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- PZHCKDXFQXLHEJ-UHFFFAOYSA-N 1-cyclopropyl-7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3C4CCN(C4)CC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 PZHCKDXFQXLHEJ-UHFFFAOYSA-N 0.000 claims description 2
- AKLKDHLCSQCLFE-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 AKLKDHLCSQCLFE-UHFFFAOYSA-N 0.000 claims description 2
- WUUUAEZMNSYLMU-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2)CC2C1 WUUUAEZMNSYLMU-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000006502 nitrobenzyl group Chemical group 0.000 claims description 2
- QMLVECGLEOSESV-RYUDHWBXSA-N Danofloxacin Chemical compound C([C@@H]1C[C@H]2CN1C)N2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 QMLVECGLEOSESV-RYUDHWBXSA-N 0.000 claims 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- RMJXPJFRSSZUAS-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-4-oxo-7-(2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-5-yl)quinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2C(C)C)CC2C1 RMJXPJFRSSZUAS-UHFFFAOYSA-N 0.000 claims 1
- XTOAZNBJDQNMEG-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2C)CC2C1 XTOAZNBJDQNMEG-UHFFFAOYSA-N 0.000 claims 1
- SXDPMFRPUKIDEV-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[5-(2-hydroxyethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2CCO)CC2C1 SXDPMFRPUKIDEV-UHFFFAOYSA-N 0.000 claims 1
- PFDUXKLQTAEQFI-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2)CC2C1 PFDUXKLQTAEQFI-UHFFFAOYSA-N 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 11
- 239000000543 intermediate Substances 0.000 abstract description 5
- 125000001188 haloalkyl group Chemical group 0.000 abstract description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 2
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- 150000001768 cations Chemical class 0.000 abstract 1
- 125000001153 fluoro group Chemical group F* 0.000 abstract 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 96
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 74
- 239000000243 solution Substances 0.000 description 59
- 239000011541 reaction mixture Substances 0.000 description 46
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 44
- 239000007787 solid Substances 0.000 description 40
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 35
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- 238000001914 filtration Methods 0.000 description 17
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- FKKUVCHFRDLBHN-UHFFFAOYSA-N 1-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 FKKUVCHFRDLBHN-UHFFFAOYSA-N 0.000 description 6
- LJYJAEQCLXAHFQ-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(Cl)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 LJYJAEQCLXAHFQ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- NMASXYCNDJMMFR-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NMASXYCNDJMMFR-UHFFFAOYSA-N 0.000 description 5
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- ZHVULPDNOFUIML-UHFFFAOYSA-N octane;hydrochloride Chemical compound Cl.CCCCCCCC ZHVULPDNOFUIML-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 4
- SKYHBWSFRMRRRT-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SKYHBWSFRMRRRT-UHFFFAOYSA-N 0.000 description 3
- SUGOFCVKWPWSEE-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3C4CCC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SUGOFCVKWPWSEE-UHFFFAOYSA-N 0.000 description 3
- OXNJPSZQVRRXPL-UHFFFAOYSA-N 1-ethenyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(C=C)C2=C1F OXNJPSZQVRRXPL-UHFFFAOYSA-N 0.000 description 3
- MHFJYVWFBPABTI-UHFFFAOYSA-N 1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHFJYVWFBPABTI-UHFFFAOYSA-N 0.000 description 3
- SFKRXQKJTIYUAG-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(F)=C1F SFKRXQKJTIYUAG-UHFFFAOYSA-N 0.000 description 3
- MYIPGNFIOPNJBA-UHFFFAOYSA-N 2,5-diazabicyclo[2.2.2]octane;dihydrochloride Chemical compound Cl.Cl.C1NC2CCC1NC2 MYIPGNFIOPNJBA-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- IRSOAAANOYUKCN-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 IRSOAAANOYUKCN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- KWDVJYLIAJHEOW-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(F)C(F)=C1F KWDVJYLIAJHEOW-UHFFFAOYSA-N 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- KIMVTSGNCBGHES-UHFFFAOYSA-N octane;dihydrochloride Chemical compound Cl.Cl.CCCCCCCC KIMVTSGNCBGHES-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-VENIDDJXSA-N palladium-100 Chemical compound [100Pd] KDLHZDBZIXYQEI-VENIDDJXSA-N 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 2
- RFZHFIFSQNIHAI-UHFFFAOYSA-N 1-cyclopropyl-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(F)=C2C(=O)C(C(=O)O)=CN1C1CC1 RFZHFIFSQNIHAI-UHFFFAOYSA-N 0.000 description 2
- PYUYOHBLLNRUOF-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-4,7-dioxo-8h-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(O)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 PYUYOHBLLNRUOF-UHFFFAOYSA-N 0.000 description 2
- ZWLNNJUVRYMXIQ-UHFFFAOYSA-N 1-cyclopropyl-7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CCN(C4)CC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ZWLNNJUVRYMXIQ-UHFFFAOYSA-N 0.000 description 2
- VADITGKOLHEOQU-UHFFFAOYSA-N 1-cyclopropyl-7-ethylsulfanyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C=C(F)C(SCC)=NC=2N1C1CC1 VADITGKOLHEOQU-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- CFPCKNVBSYLJHT-UHFFFAOYSA-N 3-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1N(C)CC2CCC1N2 CFPCKNVBSYLJHT-UHFFFAOYSA-N 0.000 description 2
- JSTMHFGSAKLXGM-UHFFFAOYSA-N 7-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CC2CC1CN2CC1=CC=CC=C1 JSTMHFGSAKLXGM-UHFFFAOYSA-N 0.000 description 2
- OXNZWNNMJBOZQO-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OXNZWNNMJBOZQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- ONQDAESGZUODFI-UHFFFAOYSA-N ethyl 6,7,8-trifluoro-4-oxo-1h-quinoline-3-carboxylate Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)OCC)=CNC2=C1F ONQDAESGZUODFI-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- KFSOYEAOVNOZNU-UHFFFAOYSA-N n-(8-benzyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine Chemical compound C1C(=NO)CC2CCC1N2CC1=CC=CC=C1 KFSOYEAOVNOZNU-UHFFFAOYSA-N 0.000 description 2
- VGXNWKNOHCFGHG-UHFFFAOYSA-N n-(8-benzyl-8-azabicyclo[3.2.1]octan-5-yl)acetamide;hydrochloride Chemical compound Cl.C1CCC2(NC(=O)C)CCC1N2CC1=CC=CC=C1 VGXNWKNOHCFGHG-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 235000012431 wafers Nutrition 0.000 description 2
- 125000006594 (C1-C3) alkylsulfony group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- MYDNVFCTSSCDGA-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane;dihydrochloride Chemical compound Cl.Cl.C1CC2CCN1NC2 MYDNVFCTSSCDGA-UHFFFAOYSA-N 0.000 description 1
- YLPCXVWMHNNQGI-UHFFFAOYSA-N 1,2-diazabicyclo[3.2.1]octane Chemical compound C1C2CCN1NCC2 YLPCXVWMHNNQGI-UHFFFAOYSA-N 0.000 description 1
- CTBNEKSAJTWOFM-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1C2CCN1CCN2 CTBNEKSAJTWOFM-UHFFFAOYSA-N 0.000 description 1
- CGXLVFZJJOXEDF-UHFFFAOYSA-N 1,8-naphthyridine-3-carboxylic acid Chemical compound N1=CC=CC2=CC(C(=O)O)=CN=C21 CGXLVFZJJOXEDF-UHFFFAOYSA-N 0.000 description 1
- 150000005058 1,8-naphthyridines Chemical class 0.000 description 1
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 1
- ASJKGAIQMDQIAG-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-5-nitro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C([N+]([O-])=O)=C2C(=O)C(C(=O)O)=CN1C1CC1 ASJKGAIQMDQIAG-UHFFFAOYSA-N 0.000 description 1
- KNEXGVPHPGXAGF-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 KNEXGVPHPGXAGF-UHFFFAOYSA-N 0.000 description 1
- QXVMVAPREYZESC-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(3-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1CC(N2)CCC2C1C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 QXVMVAPREYZESC-UHFFFAOYSA-N 0.000 description 1
- ITXLERDKFZOJPO-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1CC2CC1CN2C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 ITXLERDKFZOJPO-UHFFFAOYSA-N 0.000 description 1
- JONGFFILGKVWNM-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.CN1CC2CC1CN2C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 JONGFFILGKVWNM-UHFFFAOYSA-N 0.000 description 1
- ZAUANQQDABCHSO-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1C(CN2)CCC1C2C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 ZAUANQQDABCHSO-UHFFFAOYSA-N 0.000 description 1
- QECDWOQXTKHMBF-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-[5-[(4-nitrophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CC(N(C4)CC=4C=CC(=CC=4)[N+]([O-])=O)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 QECDWOQXTKHMBF-UHFFFAOYSA-N 0.000 description 1
- GJJXKPIDTURQKI-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.CN1CC2CC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=NC=1N2C1CC1 GJJXKPIDTURQKI-UHFFFAOYSA-N 0.000 description 1
- SJVAERFHRGRASE-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound CN1C(CN2)CCC1C2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=NC=1N2C1CC1 SJVAERFHRGRASE-UHFFFAOYSA-N 0.000 description 1
- PZNKYJGKNINWNB-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-[5-(2-hydroxyethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound OCCN1CC2CCC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=NC=1N2C1CC1 PZNKYJGKNINWNB-UHFFFAOYSA-N 0.000 description 1
- OGZODYXEGYHQOP-UHFFFAOYSA-N 1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1CN(C(=O)OCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2C1CC1 OGZODYXEGYHQOP-UHFFFAOYSA-N 0.000 description 1
- AMFZGKIUFJNGMU-UHFFFAOYSA-N 1-cyclopropyl-7-ethylsulfonyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C=C(F)C(S(=O)(=O)CC)=NC=2N1C1CC1 AMFZGKIUFJNGMU-UHFFFAOYSA-N 0.000 description 1
- RXCCQLQPDKMONZ-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N(C2)C)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F RXCCQLQPDKMONZ-UHFFFAOYSA-N 0.000 description 1
- SPIYPEDQWGWRMN-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound N1CC(N2C)CCC2C1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F SPIYPEDQWGWRMN-UHFFFAOYSA-N 0.000 description 1
- ZMAOHHOIKHBICV-UHFFFAOYSA-N 1-ethyl-7-ethylsulfanyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound CCN1C=C(C(O)=O)C(=O)C2=C1N=C(SCC)C(F)=C2 ZMAOHHOIKHBICV-UHFFFAOYSA-N 0.000 description 1
- PTCFWANOHXDFOH-UHFFFAOYSA-N 1-ethyl-7-ethylsulfonyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(S(=O)(=O)CC)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 PTCFWANOHXDFOH-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- ABUFEAKDTQPJQZ-UHFFFAOYSA-N 2,2-diethylbutane-1,1,1-triol Chemical compound CCC(CC)(CC)C(O)(O)O ABUFEAKDTQPJQZ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical compound CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 1
- JQGBMYKEWLSLCI-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-6-nitrobenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=C(F)C(F)=C1[N+]([O-])=O JQGBMYKEWLSLCI-UHFFFAOYSA-N 0.000 description 1
- RUGZVPRCKQMYAZ-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-6-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=C(F)C(F)=C(F)C(F)=C1C(Cl)=O RUGZVPRCKQMYAZ-UHFFFAOYSA-N 0.000 description 1
- ISYQWKOXKGJREA-UHFFFAOYSA-N 2,5-diazabicyclo[2.2.1]heptane;dihydrobromide Chemical compound Br.Br.C1NC2CNC1C2 ISYQWKOXKGJREA-UHFFFAOYSA-N 0.000 description 1
- HMPSJIXTSNMAGA-UHFFFAOYSA-N 2-(2,3,4,5-tetrafluorobenzoyl)butanoic acid Chemical compound CCC(C(O)=O)C(=O)C1=CC(F)=C(F)C(F)=C1F HMPSJIXTSNMAGA-UHFFFAOYSA-N 0.000 description 1
- SOMPEQIPSQFVMO-UHFFFAOYSA-N 2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide Chemical compound Br.Br.C1C(NC2)CC2N1CC1=CC=CC=C1 SOMPEQIPSQFVMO-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CFLBIADORGSMCX-UHFFFAOYSA-N 2h-1,4-benzoxazine-6-carboxylic acid Chemical class O1CC=NC2=CC(C(=O)O)=CC=C21 CFLBIADORGSMCX-UHFFFAOYSA-N 0.000 description 1
- DVLSQHLXPRYYRC-UHFFFAOYSA-N 5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound COC=C1C(=O)OC(C)(C)OC1=O DVLSQHLXPRYYRC-UHFFFAOYSA-N 0.000 description 1
- CQPUZLMNORVQPG-UHFFFAOYSA-N 5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C(N)=C(F)C(F)=C(F)C=2N1C1CC1 CQPUZLMNORVQPG-UHFFFAOYSA-N 0.000 description 1
- MEXUTNIFSHFQRG-UHFFFAOYSA-N 6,7,12,13-tetrahydro-5h-indolo[2,3-a]pyrrolo[3,4-c]carbazol-5-one Chemical compound C12=C3C=CC=C[C]3NC2=C2NC3=CC=C[CH]C3=C2C2=C1C(=O)NC2 MEXUTNIFSHFQRG-UHFFFAOYSA-N 0.000 description 1
- ISAQBIWYAQHPKI-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1CN(C2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 ISAQBIWYAQHPKI-UHFFFAOYSA-N 0.000 description 1
- QFUYXGJHDFNPSY-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C(C(C(C(=O)O)=CN2C=C)=O)C2=C1F QFUYXGJHDFNPSY-UHFFFAOYSA-N 0.000 description 1
- VRCCUOOWKGTOJO-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1 VRCCUOOWKGTOJO-UHFFFAOYSA-N 0.000 description 1
- LCVGANIDPZSEMC-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C(C(C(C(=O)O)=CN2CCF)=O)C2=C1F LCVGANIDPZSEMC-UHFFFAOYSA-N 0.000 description 1
- BQDVLIDLHOSQHC-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical class N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 BQDVLIDLHOSQHC-UHFFFAOYSA-N 0.000 description 1
- XPFHGOVBHNSRAE-UHFFFAOYSA-N 7-[5-[(4-aminophenyl)methyl]-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=CC(N)=CC=C1CN1C(CN2C=3C(=CC=4C(=O)C(C(O)=O)=CN(C=4N=3)C3CC3)F)CCC2C1 XPFHGOVBHNSRAE-UHFFFAOYSA-N 0.000 description 1
- VCJHKCJPMHDQJO-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-1,8-naphthyridin-4-one Chemical compound FC1=C(Cl)N=C2N(CC)C=CC(=O)C2=C1 VCJHKCJPMHDQJO-UHFFFAOYSA-N 0.000 description 1
- VTTPHBIBXCPVID-UHFFFAOYSA-N 7-pyridin-2-ylquinoline Chemical class N1=CC=CC=C1C1=CC=C(C=CC=N2)C2=C1 VTTPHBIBXCPVID-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XNZIHVKLRKGFBS-UHFFFAOYSA-N 8-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1NCC2CCC1N2C XNZIHVKLRKGFBS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- QLIOYIHFVRXRNS-UHFFFAOYSA-N CCC(C(O)=O)C(=O)C1=C(F)C(F)=C(F)C(F)=C1F Chemical compound CCC(C(O)=O)C(=O)C1=C(F)C(F)=C(F)C(F)=C1F QLIOYIHFVRXRNS-UHFFFAOYSA-N 0.000 description 1
- LMPOXXYDERFNAM-UHFFFAOYSA-N Cl.C12=NC(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 Chemical compound Cl.C12=NC(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 LMPOXXYDERFNAM-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- VIIYJRYORKDEHU-UHFFFAOYSA-N N-(8-azabicyclo[3.2.1]octan-1-yl)acetamide hydrochloride Chemical compound Cl.C(C)(=O)NC12CCCC(CC1)N2 VIIYJRYORKDEHU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000588777 Providencia rettgeri Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241001221452 Staphylococcus faecalis Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 150000005130 benzoxazines Chemical class 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- NJSUFZNXBBXAAC-UHFFFAOYSA-N ethanol;toluene Chemical compound CCO.CC1=CC=CC=C1 NJSUFZNXBBXAAC-UHFFFAOYSA-N 0.000 description 1
- FGICMAMEHORFNK-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 FGICMAMEHORFNK-UHFFFAOYSA-N 0.000 description 1
- IVGVYVLHVPTBLC-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(=O)OCC)=CN2C1CC1 IVGVYVLHVPTBLC-UHFFFAOYSA-N 0.000 description 1
- HISNMGFYFJXXJW-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1F HISNMGFYFJXXJW-UHFFFAOYSA-N 0.000 description 1
- YYHMZHRWVGIDPJ-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-nitropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1[N+]([O-])=O YYHMZHRWVGIDPJ-UHFFFAOYSA-N 0.000 description 1
- OQLZLQOQVVLZGK-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1F OQLZLQOQVVLZGK-UHFFFAOYSA-N 0.000 description 1
- UXAXHZHNGAGNFU-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-nitropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1[N+]([O-])=O UXAXHZHNGAGNFU-UHFFFAOYSA-N 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ACCBVLDMNMOXDN-UHFFFAOYSA-N heptane;hydrobromide Chemical compound Br.CCCCCCC ACCBVLDMNMOXDN-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- PFGVNLZDWRZPJW-OPAMFIHVSA-N otamixaban Chemical compound C([C@@H](C(=O)OC)[C@@H](C)NC(=O)C=1C=CC(=CC=1)C=1C=C[N+]([O-])=CC=1)C1=CC=CC(C(N)=N)=C1 PFGVNLZDWRZPJW-OPAMFIHVSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PVMKPXIEIWFYDX-UHFFFAOYSA-M sodium;2,3,4,5-tetrafluorobenzoate Chemical compound [Na+].[O-]C(=O)C1=CC(F)=C(F)C(F)=C1F PVMKPXIEIWFYDX-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000007885 tablet disintegrant Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- GCRNGPNGNJSZCC-UHFFFAOYSA-N tert-butyl 3-amino-3a,4,6,6a-tetrahydro-1h-pyrrolo[3,4-c]pyrazole-5-carboxylate Chemical compound N1N=C(N)C2CN(C(=O)OC(C)(C)C)CC21 GCRNGPNGNJSZCC-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Food Preservation Except Freezing, Refrigeration, And Drying (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60093484A | 1984-04-16 | 1984-04-16 | |
| US06/708,565 US4571396A (en) | 1984-04-16 | 1985-03-11 | Antibacterial agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT37759A HUT37759A (en) | 1986-02-28 |
| HU200445B true HU200445B (en) | 1990-06-28 |
Family
ID=27083756
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU851399A HU200445B (en) | 1984-04-16 | 1985-04-15 | Process for production of substituated derivatives of azobyciclo-carbonic acid and medical compositions containing them |
| HU90805A HU201554B (en) | 1984-04-16 | 1985-04-15 | Process for producing diazabicyclooctyl- or -heptylpyridobenz-oxazinecarboxylic acid derivatives and pharmaceutical compositions comprising same |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU90805A HU201554B (en) | 1984-04-16 | 1985-04-15 | Process for producing diazabicyclooctyl- or -heptylpyridobenz-oxazinecarboxylic acid derivatives and pharmaceutical compositions comprising same |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4571396A (enFirst) |
| EP (1) | EP0159174B1 (enFirst) |
| JP (1) | JPH072739B2 (enFirst) |
| KR (1) | KR900003494B1 (enFirst) |
| AR (1) | AR240830A1 (enFirst) |
| AU (1) | AU566984B2 (enFirst) |
| CA (1) | CA1340695C (enFirst) |
| DE (1) | DE3584463D1 (enFirst) |
| DK (1) | DK172796B1 (enFirst) |
| ES (1) | ES8607969A1 (enFirst) |
| FI (1) | FI83872C (enFirst) |
| GR (1) | GR850933B (enFirst) |
| HU (2) | HU200445B (enFirst) |
| IE (1) | IE57803B1 (enFirst) |
| IL (1) | IL74882A (enFirst) |
| NO (1) | NO162560C (enFirst) |
| NZ (1) | NZ211796A (enFirst) |
| OA (1) | OA07995A (enFirst) |
| PH (1) | PH21385A (enFirst) |
| PT (1) | PT80299B (enFirst) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4822801A (en) * | 1984-07-20 | 1989-04-18 | Warner-Lambert Company | 4-oxo-1,4-dihydroquinoline-3-carboxylic acid derivative as antibacterial agents |
| US5097032A (en) * | 1984-07-20 | 1992-03-17 | Warner-Lambert Company | Antibacterial agents - II |
| IE58742B1 (en) * | 1984-07-20 | 1993-11-05 | Warner Lambert Co | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7h-pyrido[1,2,3-de] [1,4]benzoxauine-6-carboxylic acids; sibstituted-5-amino-6-6fluoro-4-oxo.1,4-dihydroquinoline-3 carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1.8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds |
| DE3441788A1 (de) * | 1984-11-15 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Alkyl-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| FR2574404B1 (fr) * | 1984-12-12 | 1987-04-24 | Provesan Sa | Derives 1-substitues de l'acide 6-fluoro-7-(pyrrol-1-yl)-1,4-dihydro-4-oxoquinoleine-3-carboxylique, leur preparation et leur application en tant que medicaments |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| US4684648A (en) * | 1985-05-10 | 1987-08-04 | Otsuka Pharmaceutical Company Limited | Antimicrobial 1-substituted phenyl-4-oxoquinoline-3-carboxylic acid compounds and compositions thereof |
| DE3522405A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | 1,8-verbrueckte 4-chinolon-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel und ihre verwendung zur herstellung von arzneimitteln |
| DE3522406A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | Verfahren zur herstellung von 1,8-verbrueckten 4-chinolon-3-carbonsaeuren |
| JPH0635457B2 (ja) * | 1985-06-28 | 1994-05-11 | 杏林製薬株式会社 | ピリドンカルボン酸誘導体およびその製造方法 |
| IN166416B (enFirst) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| AU594983B2 (en) * | 1985-10-29 | 1990-03-22 | Dainippon Pharmaceutical Co. Ltd. | Novel quinoline derivatives and processes for preparation thereof |
| DE3601567A1 (de) * | 1986-01-21 | 1987-07-23 | Bayer Ag | 7-(azabicycloalkyl)-chinoloncarbonsaeure- und -naphthyridon-carbonsaeure-derivate |
| DE3606698A1 (de) * | 1986-03-01 | 1987-09-03 | Bayer Ag | 7-(1-pyrrolidinyl)-chinoloncarbonsaeure -derivate |
| US5153204A (en) * | 1986-03-01 | 1992-10-06 | Bayer Aktiengesellschaft | 7-(1-Pyrrolidinyl)-quinolonecarboxylic acid derivatives |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| EP0242789A3 (en) * | 1986-04-25 | 1990-09-05 | Dainippon Pharmaceutical Co., Ltd. | Novel quinoline derivates and processes for preparation thereof |
| US4777253A (en) * | 1986-04-25 | 1988-10-11 | Abbott Laboratories | Process for preparation of racemate and optically active ofloxacin and related derivatives |
| GB8612137D0 (en) * | 1986-05-19 | 1986-06-25 | Fujisawa Pharmaceutical Co | Quinolone compounds |
| ATE58538T1 (de) * | 1986-07-04 | 1990-12-15 | Chemie Linz Gmbh | 4-chinolon-3-carbonsaeurederivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate. |
| US4965273A (en) * | 1986-10-08 | 1990-10-23 | Bristol-Myers Company | Certain 1-tertiary-butyl-naphthyridone carboxylic acid derivatives anti-bacterial agents |
| NZ222047A (en) * | 1986-10-08 | 1991-01-29 | Bristol Myers Co | Quinoline - or naphthyridine - carboxylic acid anti-bacterial agents |
| ZA877471B (en) * | 1986-10-08 | 1988-04-05 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acid antibacterial agents |
| DE3639465A1 (de) * | 1986-11-18 | 1988-05-19 | Hoechst Ag | Optisch aktive gyrasehemmer, ihre herstellung und verwendung als antibiotika |
| US5563138A (en) * | 1987-04-16 | 1996-10-08 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| JP2640967B2 (ja) * | 1987-04-30 | 1997-08-13 | 大日本製薬株式会社 | キノロンカルボン酸誘導体およびその塩 |
| WO1989000158A1 (en) * | 1987-07-02 | 1989-01-12 | Pfizer Inc. | Bridged-diazabicycloalkyl quinolone carboxylic acids and esters |
| JPS6419069A (en) * | 1987-07-14 | 1989-01-23 | Dainippon Pharmaceutical Co | Production of polyhalogenoquinoline derivative |
| US4923879A (en) * | 1987-07-31 | 1990-05-08 | Warner-Lambert Company | 1,8-Naphthyridines and their use as antibacterial agents |
| US4992546A (en) * | 1987-07-31 | 1991-02-12 | Warner-Lambert Company | Process for preparing 6,8-diazabicyclo[3.2.2]nonane derivatives |
| US4968799A (en) * | 1987-07-31 | 1990-11-06 | Warner-Lambert Company | Antibacterial agents |
| US4962108A (en) * | 1987-07-31 | 1990-10-09 | Warner-Lambert Company | Antibacterial quinoline compounds |
| US4780468A (en) * | 1987-08-07 | 1988-10-25 | Warner-Lambert Company | 8-trifluoromethyl quinolones as antibacterial agents |
| US4851418A (en) * | 1987-08-21 | 1989-07-25 | Warner-Lambert Company | Naphthyridine antibacterial agents containing an α-amino acid in the side chain of the 7-substituent |
| US4929613A (en) * | 1987-08-26 | 1990-05-29 | Warner-Lambert Company | Antibacterial agents |
| US5075319A (en) * | 1987-09-08 | 1991-12-24 | Sterling Drug Inc. | Pyridinyl-quinolone compounds, their preparation and use |
| IT1222833B (it) * | 1987-10-06 | 1990-09-12 | Mediolanum Farmaceutici Srl | Derivati pirido benzotiazinici dotati di elevata attivita' antibatterica e di elevata biodisponibilita' tissutale |
| US4880814A (en) * | 1987-11-13 | 1989-11-14 | Abbott Laboratories | 7-cycloalkyl naphthyridines |
| WO1989005643A1 (en) * | 1987-12-18 | 1989-06-29 | Pfizer Inc. | Heterocyclic-substituted quinoline-carboxylic acids |
| US4920120A (en) | 1988-01-25 | 1990-04-24 | Warner-Lambert Company | Antibacterial agents |
| US5585491A (en) * | 1988-01-25 | 1996-12-17 | Otsuka Pharmaceutical Co., Ltd. | Antibacterial agents |
| JP2844079B2 (ja) * | 1988-05-23 | 1999-01-06 | 塩野義製薬株式会社 | ピリドンカルボン酸系抗菌剤 |
| DE3906365A1 (de) * | 1988-07-15 | 1990-01-18 | Bayer Ag | 7-(1-pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsaeure-derivate, verfahren sowie substituierte (oxa)diazabicyclooctane und -nonane als zwischenprodukte zu ihrer herstellung, und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| US5147873A (en) * | 1988-08-23 | 1992-09-15 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| WO1990002123A1 (en) * | 1988-08-23 | 1990-03-08 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| US4895943A (en) * | 1988-10-25 | 1990-01-23 | Pfizer Inc. | Preparation of 1,4-diazabicyclo(3.2.2)nonane |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| US5036153A (en) * | 1989-05-11 | 1991-07-30 | Braish Tamim F | Preparation of 2,5-diazabicyclo[2.2.1]heptanes and intermediates |
| US5214051A (en) * | 1989-08-01 | 1993-05-25 | Pfizer Inc. | Thiazolyl and oxazolyl[5,4-c]piperidyl-substituted quinolone-carboxylic acid and related analogs thereof having antibacterial properties are disclosed |
| US5385913A (en) * | 1989-10-06 | 1995-01-31 | Pfizer Inc. | 1,4-dihydro-4-oxo-3-quinoline derivatives as selectively toxic mammalian antibacterial agents |
| FI921475A7 (fi) * | 1989-10-06 | 1992-04-03 | Pfizer | 1,4-dihydro-4-okso-3-kinoliinijohdannaisia selektiivisesti toksisina n isäkkään antibakteerisina aineina |
| DE69020694T2 (de) * | 1989-11-28 | 1996-01-18 | Syntex Inc | Tricyclische Verbindungen. |
| JP2514136B2 (ja) * | 1990-05-02 | 1996-07-10 | アボツト・ラボラトリーズ | キノリジノン型化合物 |
| US5308843A (en) * | 1990-09-11 | 1994-05-03 | Sterling Drug Inc. | Method of inhibiting mammalian topoisomerase II and malignant cell growth in mammals, with substituted (S)-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4 ]-benzoxazine(and-benzothiazine)-6-carboxylic acids |
| EP0641339B1 (en) * | 1991-06-19 | 1999-09-15 | Pfizer Inc. | Azaspiro quinolone antibacterial agents |
| US5527910A (en) * | 1992-12-30 | 1996-06-18 | Cheil Foods & Chemicals, Inc. | Pyridone carboxylic acid compounds and their uses for treating infectious diseases caused by bacteria |
| GB2291421A (en) * | 1994-07-16 | 1996-01-24 | Pfizer | A process for preparing a quinoline carboxylic acid |
| JPH08213881A (ja) * | 1995-02-02 | 1996-08-20 | Fujitsu Ltd | 周波数制御回路 |
| TW519542B (en) * | 1996-09-27 | 2003-02-01 | Daiichi Seiyaku Co | Bicyclic amine derivative |
| SE0003795D0 (sv) * | 2000-10-20 | 2000-10-20 | Astrazeneca Ab | Pharmaceutically useful compounds |
| MXPA05002621A (es) * | 2002-09-10 | 2005-05-05 | Pfizer Prod Inc | Compuestos diazabiciclos utiles en el tratamiento de transtornos del sistema nervioso central y otros trastornos. |
| CA2617532A1 (en) | 2005-08-04 | 2007-02-15 | Sirtris Pharmaceuticals, Inc. | Imidazo [2,1-b] thiazole derivatives as sirtuin modulating compounds |
| GB0713602D0 (en) * | 2007-07-12 | 2007-08-22 | Syngenta Participations Ag | Chemical compounds |
| DK2336125T3 (da) * | 2008-04-11 | 2013-04-08 | Janssen Pharmaceutica Nv | Thiazolopyridin-2-yloxy-phenyl- og thioazolopyrazin-2-yloxy-phenyl-aminer som modulatorer af leukotrien-A4-hydrolase |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3907808A (en) * | 1971-05-17 | 1975-09-23 | Sterling Drug Inc | 1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives |
| US3753993A (en) * | 1971-05-17 | 1973-08-21 | Sterling Drug Inc | 1,4-dihydro-4-oxo-7-pyridyl-3-quinoline-carboxylic acid derivatives |
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| US4292317A (en) * | 1977-09-20 | 1981-09-29 | Laboratorie Roger Bellon | 1,4-Dihydro-quinoline-3-carboxylic acid derivatives, process for their preparation and compositions containing them |
| AR223983A1 (es) * | 1978-08-25 | 1981-10-15 | Dainippon Pharmaceutical Co | Un procedimiento para-preparar derivados de acido 6-halogeno-4-oxo-7-(1-piperazinil)-1,8-naftiridin-3-carboxilico |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
| JPS5649382A (en) * | 1979-09-28 | 1981-05-02 | Dainippon Pharmaceut Co Ltd | 6-fluoro-7-cyclic amino-1,8-naphthylidine derivative and its salt |
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| NO156828C (no) * | 1980-11-10 | 1987-12-02 | Otsuka Pharma Co Ltd | Analogifremgangsm te for fremstilling av antibakterielt virksomme benzoheterocykliske forbindelser. |
| JPS57149286A (en) * | 1981-03-13 | 1982-09-14 | Dai Ichi Seiyaku Co Ltd | 8-aminopyrido(1,2,3-de)(1,4)banzoxazine derivative |
| JPS57203085A (en) * | 1981-06-09 | 1982-12-13 | Dai Ichi Seiyaku Co Ltd | 1,8-cyclic substituted quinoline derivative |
| JPS5872589A (ja) * | 1981-10-28 | 1983-04-30 | Dai Ichi Seiyaku Co Ltd | ピリド〔1,2,3−de〕〔1,4〕ベンゾオキサジン誘導体 |
| JPS58109181A (ja) * | 1981-12-23 | 1983-06-29 | Akira Ito | 浮遊物回収装置 |
| JPS58225092A (ja) * | 1982-06-25 | 1983-12-27 | Dai Ichi Seiyaku Co Ltd | ピリド〔1,2,3−de〕〔1,4〕ベンゾオキサジン−6−カルボン酸誘導体 |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
-
1985
- 1985-03-11 US US06/708,565 patent/US4571396A/en not_active Expired - Lifetime
- 1985-03-20 IE IE715/85A patent/IE57803B1/en not_active IP Right Cessation
- 1985-03-25 CA CA000477394A patent/CA1340695C/en not_active Expired - Fee Related
- 1985-04-09 EP EP85302479A patent/EP0159174B1/en not_active Expired - Lifetime
- 1985-04-09 DE DE8585302479T patent/DE3584463D1/de not_active Expired - Fee Related
- 1985-04-09 AU AU40920/85A patent/AU566984B2/en not_active Ceased
- 1985-04-10 AR AR300026A patent/AR240830A1/es active
- 1985-04-11 IL IL74882A patent/IL74882A/xx unknown
- 1985-04-12 FI FI851471A patent/FI83872C/fi not_active IP Right Cessation
- 1985-04-15 DK DK198501696A patent/DK172796B1/da not_active IP Right Cessation
- 1985-04-15 NO NO851501A patent/NO162560C/no not_active IP Right Cessation
- 1985-04-15 PH PH32139A patent/PH21385A/en unknown
- 1985-04-15 HU HU851399A patent/HU200445B/hu not_active IP Right Cessation
- 1985-04-15 ES ES542239A patent/ES8607969A1/es not_active Expired
- 1985-04-15 JP JP60078623A patent/JPH072739B2/ja not_active Expired - Fee Related
- 1985-04-15 NZ NZ211796A patent/NZ211796A/en unknown
- 1985-04-15 HU HU90805A patent/HU201554B/hu not_active IP Right Cessation
- 1985-04-16 KR KR1019850002550A patent/KR900003494B1/ko not_active Expired
- 1985-04-16 GR GR850933A patent/GR850933B/el unknown
- 1985-04-16 OA OA58571A patent/OA07995A/xx unknown
- 1985-04-16 PT PT80299A patent/PT80299B/pt unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU200445B (en) | Process for production of substituated derivatives of azobyciclo-carbonic acid and medical compositions containing them | |
| AU674272B2 (en) | Intermediates for the manufacture of 6-fluoro-1,4-dihydro-4-oxo-3-quinoline carboxylic acids | |
| AU669502B2 (en) | Quinolone- and naphthyridone-carboxylic acid derivatives | |
| CZ667886A3 (en) | Substituted bridged diazabicycloalkyl quinolonecarboxylic acids, process of their preparation and pharmaceutical compositions in which they are contained | |
| JPS63104974A (ja) | 抗細菌剤 | |
| CS246065B2 (en) | Method of new 7-substituted cyclic aminonaphthyridine-,quinoline-and benzoxazinecarboxylic acids production | |
| IE850386L (en) | Antibacterial agents | |
| JPS62169789A (ja) | 7−(アザビシクロアルキル)−キノロンカルボン酸及び−ナフチリドンカルボン酸誘導体 | |
| HU219581B (hu) | Új piridon-karbonsav-származékok, eljárás előállításukra, ezeket tartalmazó gyógyszerkészítmények, valamint intermedierek | |
| US4923879A (en) | 1,8-Naphthyridines and their use as antibacterial agents | |
| US4962108A (en) | Antibacterial quinoline compounds | |
| JPH08225567A (ja) | キノロン−及びナフチリドンカルボン酸誘導体 | |
| US5585491A (en) | Antibacterial agents | |
| JPS61221174A (ja) | キノリン‐3‐カルボン酸抗菌剤の改良された製法 | |
| US4992546A (en) | Process for preparing 6,8-diazabicyclo[3.2.2]nonane derivatives | |
| US4968799A (en) | Antibacterial agents | |
| US4663457A (en) | 1-cyclopropyl-6,7-dihalo-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid and their esters, useful as intermediates for preparing the 7-amine substituted naphthyridines | |
| CA2443307C (en) | Quinolone- and naphthyridone-carboxylic acid derivatives | |
| IE19970856A1 (en) | 7-(1-Pyrrolidinyl)-3-quinolone and naphthyridone carboxylic acid derivatives, method for their preparation and for substituted mono- and bicyclic pyrrolidine intermediates, and their antibacterial and feed additive compositions | |
| PH27114A (en) | Antibacterial agents II |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |