HU198713B - Process for producing ergolin derivatives and pharmaceutical compositions containing them as active components - Google Patents
Process for producing ergolin derivatives and pharmaceutical compositions containing them as active components Download PDFInfo
- Publication number
- HU198713B HU198713B HU841656A HU165684A HU198713B HU 198713 B HU198713 B HU 198713B HU 841656 A HU841656 A HU 841656A HU 165684 A HU165684 A HU 165684A HU 198713 B HU198713 B HU 198713B
- Authority
- HU
- Hungary
- Prior art keywords
- methyl
- ergoline
- formula
- preparation
- hydrogen
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 9
- 238000000034 method Methods 0.000 title claims description 38
- 238000002360 preparation method Methods 0.000 claims abstract description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 27
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 52
- 239000001257 hydrogen Substances 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims 2
- 238000006482 condensation reaction Methods 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000008024 pharmaceutical diluent Substances 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- 150000003839 salts Chemical class 0.000 abstract description 4
- 239000004215 Carbon black (E152) Substances 0.000 abstract 2
- 229930195733 hydrocarbon Natural products 0.000 abstract 2
- 150000002430 hydrocarbons Chemical class 0.000 abstract 2
- 101100244083 Arabidopsis thaliana PKL gene Proteins 0.000 abstract 1
- 229940030600 antihypertensive agent Drugs 0.000 abstract 1
- 239000002220 antihypertensive agent Substances 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 description 22
- -1 npropyl Chemical group 0.000 description 19
- 239000000047 product Substances 0.000 description 12
- IXCCQSTVBSTCLP-PSOPSSQASA-N [(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical group C1=CC([C@H]2C[C@@H](CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 IXCCQSTVBSTCLP-PSOPSSQASA-N 0.000 description 11
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 9
- VLMFXUIQFJZBBS-FDQGKXFDSA-N methyl 3-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methylamino]propanoate Chemical compound C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)CNCCC(=O)OC)=C3C2=CNC3=C1 VLMFXUIQFJZBBS-FDQGKXFDSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000035488 systolic blood pressure Effects 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 229960002474 hydralazine Drugs 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- IXCCQSTVBSTCLP-SKNXHYNKSA-N [(6ar,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical compound C1=CC([C@H]2CC(CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 IXCCQSTVBSTCLP-SKNXHYNKSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000003276 anti-hypertensive effect Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 238000002203 pretreatment Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- KOMHDDJQJLCNRL-UKRRQHHQSA-N [(6ar,10ar)-7-methyl-6,6a,8,10a-tetrahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical compound C1=CC([C@H]2C=C(CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 KOMHDDJQJLCNRL-UKRRQHHQSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000004720 fertilization Effects 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- USOYXLZSDZHWQF-XXHWGDKOSA-N 1-[[(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5a-yl]methyl]imidazolidine-2,4-dione Chemical compound O=C1N(CC(N1)=O)CC12C[C@H]3NCCC[C@@H]3C=3C=CC=C(N=C1)C=32 USOYXLZSDZHWQF-XXHWGDKOSA-N 0.000 description 1
- HTTUYLAYORPFBE-GDBMZVCRSA-N 1-[[(6ar,10ar)-7-methyl-6,6a,8,10a-tetrahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound CN([C@H]1[C@@H](C=2C=CC=C3NC=C(C=23)C1)C=1)CC=1CN1CC(=O)NC1=O HTTUYLAYORPFBE-GDBMZVCRSA-N 0.000 description 1
- KJDYXAKORTZCLE-RRBXVBTKSA-N 1-[[(6ar,9r,10as)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound C([C@@H]1C[C@]2([C@H](N(C)C1)CC=1C3=C2C=CC=C3NC=1)OC)N1CC(=O)NC1=O KJDYXAKORTZCLE-RRBXVBTKSA-N 0.000 description 1
- VXIHQTMCLKWCBN-SGIREYDYSA-N 1-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound C([C@@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C)N1CC(=O)NC1=O VXIHQTMCLKWCBN-SGIREYDYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 102000003946 Prolactin Human genes 0.000 description 1
- 108010057464 Prolactin Proteins 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 206010043087 Tachyphylaxis Diseases 0.000 description 1
- SLIAHCBIFMULSW-FPZHHAFBSA-N [(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-5a-yl]methanamine Chemical compound NCC12C[C@H]3N(CCC[C@@H]3C=3C=CC=C(N=C1)C32)C SLIAHCBIFMULSW-FPZHHAFBSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- QOSXQPJDPYCNGQ-FDQGKXFDSA-N ethyl 2-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methylamino]acetate Chemical compound C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)CNCC(=O)OCC)=C3C2=CNC3=C1 QOSXQPJDPYCNGQ-FDQGKXFDSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000008601 oleoresin Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229940097325 prolactin Drugs 0.000 description 1
- 230000035485 pulse pressure Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838311679A GB8311679D0 (en) | 1983-04-28 | 1983-04-28 | Ergoline derivatives |
| GB838314816A GB8314816D0 (en) | 1983-05-27 | 1983-05-27 | Ergoline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT34024A HUT34024A (en) | 1985-01-28 |
| HU198713B true HU198713B (en) | 1989-11-28 |
Family
ID=26285978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU841656A HU198713B (en) | 1983-04-28 | 1984-04-27 | Process for producing ergolin derivatives and pharmaceutical compositions containing them as active components |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4690929A (enFirst) |
| EP (1) | EP0126968B1 (enFirst) |
| KR (1) | KR900008696B1 (enFirst) |
| AU (1) | AU556968B2 (enFirst) |
| CA (1) | CA1205801A (enFirst) |
| DE (1) | DE3475709D1 (enFirst) |
| DK (1) | DK162996C (enFirst) |
| ES (1) | ES8506031A1 (enFirst) |
| FI (1) | FI81349C (enFirst) |
| GR (1) | GR79575B (enFirst) |
| HU (1) | HU198713B (enFirst) |
| IE (1) | IE57240B1 (enFirst) |
| IL (1) | IL71633A (enFirst) |
| NO (1) | NO161562C (enFirst) |
| PH (1) | PH21123A (enFirst) |
| PT (1) | PT78496B (enFirst) |
| SU (1) | SU1327788A3 (enFirst) |
| YU (1) | YU43357B (enFirst) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8714767D0 (en) * | 1987-06-24 | 1987-07-29 | Erba Farmitalia | Egoline derivatives |
| NL8400333A (nl) * | 1983-02-16 | 1984-09-17 | Sandoz Ag | Moederkoornalkaloiden, hun bereiding en hun toepassing. |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
| DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
| GB8617907D0 (en) * | 1986-07-22 | 1986-08-28 | Erba Farmitalia | Tetracyclic indole derivatives |
| GB8702364D0 (en) * | 1987-02-03 | 1987-03-11 | Erba Farmitalia | Ergolinyl heterocycles |
| DK338789A (da) * | 1988-07-15 | 1990-01-16 | Schering Ag | 2-substituerede ergolinylurinstofderivater og fremgangsmaade til fremstilling deraf, deres anvendelse som laegemidler samt mellemprodukter til fremstilling deraf |
| RU2074857C1 (ru) * | 1990-01-25 | 1997-03-10 | Фармиталиа Карло Эрба С.Р.Л. | Способ получения производных эрголина |
| GB9006772D0 (en) * | 1990-03-27 | 1990-05-23 | Erba Carlo Spa | 4-piperidinyl-ergoline derivatives |
| DK0628042T3 (da) * | 1992-12-24 | 2001-11-12 | Pharmacia & Upjohn Spa | Serotoninerge ergolinderivater |
| CN101481405A (zh) | 2001-06-08 | 2009-07-15 | 研究及应用科学协会股份有限公司 | 生长激素释放抑制因子-多巴胺嵌合类似物 |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
| CN104768565B (zh) | 2012-11-01 | 2017-04-26 | 益普生制药股份有限公司 | 促生长素抑制素类似物及其二聚体 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE622316A (enFirst) * | 1961-09-11 | |||
| SE393615B (sv) * | 1971-05-19 | 1977-05-16 | Sandoz Ag | Forfarande for framstellning av 6-metyl-8 beta-ureidometyl-ergolener |
| NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| DE2456930A1 (de) * | 1974-12-02 | 1976-08-12 | Tesch Kg E | Elektronisches zeitspeicherrelais |
| CH615181A5 (en) * | 1975-05-21 | 1980-01-15 | Sandoz Ag | Process for the preparation of novel ergolene derivatives |
| GB2056437A (en) * | 1979-08-07 | 1981-03-18 | Erba Farmitalia | Secoergoline derivatives |
| DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
| DD154897A1 (de) * | 1980-12-02 | 1982-04-28 | Seifert Karlheinz Dipl Chem Dr | Verfahren zur herstellung von 8-substituierten ergolinen |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
-
1984
- 1984-04-23 PH PH30590A patent/PH21123A/en unknown
- 1984-04-24 DE DE8484104568T patent/DE3475709D1/de not_active Expired
- 1984-04-24 SU SU843728545A patent/SU1327788A3/ru active
- 1984-04-24 EP EP84104568A patent/EP0126968B1/en not_active Expired
- 1984-04-24 CA CA000452664A patent/CA1205801A/en not_active Expired
- 1984-04-25 ES ES531906A patent/ES8506031A1/es not_active Expired
- 1984-04-25 IL IL71633A patent/IL71633A/xx not_active IP Right Cessation
- 1984-04-25 FI FI841631A patent/FI81349C/fi not_active IP Right Cessation
- 1984-04-26 US US06/604,041 patent/US4690929A/en not_active Expired - Fee Related
- 1984-04-26 PT PT78496A patent/PT78496B/pt not_active IP Right Cessation
- 1984-04-26 GR GR74511A patent/GR79575B/el unknown
- 1984-04-26 NO NO841657A patent/NO161562C/no unknown
- 1984-04-26 IE IE1018/84A patent/IE57240B1/en not_active IP Right Cessation
- 1984-04-26 YU YU742/84A patent/YU43357B/xx unknown
- 1984-04-27 HU HU841656A patent/HU198713B/hu not_active IP Right Cessation
- 1984-04-27 AU AU27421/84A patent/AU556968B2/en not_active Ceased
- 1984-04-27 DK DK212784A patent/DK162996C/da not_active IP Right Cessation
- 1984-04-27 KR KR1019840002271A patent/KR900008696B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4690929A (en) | 1987-09-01 |
| YU43357B (en) | 1989-06-30 |
| IE57240B1 (en) | 1992-06-17 |
| PT78496B (en) | 1986-07-22 |
| KR900008696B1 (ko) | 1990-11-27 |
| FI841631A7 (enFirst) | 1984-10-29 |
| SU1327788A3 (ru) | 1987-07-30 |
| FI841631A0 (enFirst) | 1984-04-25 |
| CA1205801A (en) | 1986-06-10 |
| NO841657L (no) | 1984-10-29 |
| NO161562B (no) | 1989-05-22 |
| AU2742184A (en) | 1984-11-01 |
| HUT34024A (en) | 1985-01-28 |
| EP0126968B1 (en) | 1988-12-21 |
| ES531906A0 (es) | 1985-06-01 |
| IL71633A (en) | 1987-12-20 |
| DK212784A (da) | 1984-10-29 |
| YU74284A (en) | 1986-10-31 |
| NO161562C (no) | 1989-08-30 |
| GR79575B (enFirst) | 1984-10-30 |
| PH21123A (en) | 1987-07-27 |
| FI81349B (fi) | 1990-06-29 |
| DK212784D0 (da) | 1984-04-27 |
| PT78496A (en) | 1984-05-01 |
| DK162996C (da) | 1992-06-01 |
| FI81349C (fi) | 1990-10-10 |
| EP0126968A1 (en) | 1984-12-05 |
| IL71633A0 (en) | 1984-07-31 |
| DK162996B (da) | 1992-01-06 |
| KR840008353A (ko) | 1984-12-14 |
| ES8506031A1 (es) | 1985-06-01 |
| AU556968B2 (en) | 1986-11-27 |
| DE3475709D1 (en) | 1989-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100717489B1 (ko) | 피리도피리미디논 화합물, 이의 제조 방법 및 이를함유하는 약제 조성물 | |
| HU198713B (en) | Process for producing ergolin derivatives and pharmaceutical compositions containing them as active components | |
| CA1157470A (en) | Imidazo[1,2,a]pyridine derivatives useful in therapy and their preparations | |
| US4675321A (en) | Substituted pyrimidines useful as calcium channel blockers | |
| FI86425C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 6-benzoxazinyl- och 6-benzotiazinyl-2,3,4,5- tetrahydropyridazin-3-oner. | |
| WO2007129111A1 (en) | Diazepine derivatives as 5-ht2a antagonists | |
| US4609494A (en) | 5-acetyl-3,4,5,6-tetrahydro-4-oxo-2,6-methano-2H-1,3,5-benzothiazocine(benzodiazocine)-11-carboxylates useful as calcium channel blockers | |
| HU201955B (en) | Process for producing new ribofuranuronic acid derivatives and pharmaceutical compositions comprising such compounds | |
| CS232000B2 (en) | Manufacturing process of new ergoline derovatives | |
| US4581172A (en) | Substituted pyrimido[6,1-a]isoquinolin-4-ones,pyrimido[6,1-a]benzozepin-4-ones and pyrimido[6,1-a]benzodiazepin-4-ones useful for prevention of thromboses and treating hypertension | |
| US4801590A (en) | Pyrido(1,8)naphthyridinones, and their use as pharmaceuticals | |
| US3985752A (en) | 6-Methyl-8-(substituted) methylergolines | |
| US3960847A (en) | 9-Substituted-4-oxopyrido(1,2-α)pyrimidine-3-carboxylic acids and derivatives thereof | |
| US3819627A (en) | 1-substituted-3,4-dihydro-2(1h)-quinazolinones | |
| US4372956A (en) | 5, 10-Dihydroimidazo[2,1-b]quinazolines and pharmaceutical compositions containing them | |
| AU651171B2 (en) | Oxazinobenzazole compounds | |
| EP0277625A2 (en) | Tetrahydropyrido[3',4':4,5]pyrrolo[2,3-c]quinolines, intermediates and a process for the preparation thereof and their use as hypotensive agents | |
| EP0039920B1 (en) | Triazaloquinoxalin-1,4-diones | |
| HU192728B (en) | Process for producing 4-oxo-pyrido/2,3-d/pyrimidine derivatives and pharmaceutical compositions containing them | |
| CS245790B2 (cs) | Způsob výroby derivátů ergolinu | |
| US4800200A (en) | 4,8-dihydro-8-arylisoxazolo[4,3-e][1,4]-oxazepin-5(6H)-ones | |
| FI83869B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara ergolinderivat. | |
| IE61136B1 (en) | Tetracyclic indole derivatives | |
| IE48176B1 (en) | Ergot peptide alkaloid derivatives,processes for their preparation and pharmaceutical compositions containing them | |
| US4481204A (en) | E-Homo-eburnane derivatives, process for their preparation, and pharmaceutical compositions containing these compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |