HU189978B - Fungicide and plant growth regulating compositions containing triazole and imidazole derivatives as active substances - Google Patents
Fungicide and plant growth regulating compositions containing triazole and imidazole derivatives as active substances Download PDFInfo
- Publication number
- HU189978B HU189978B HU811617A HU161781A HU189978B HU 189978 B HU189978 B HU 189978B HU 811617 A HU811617 A HU 811617A HU 161781 A HU161781 A HU 161781A HU 189978 B HU189978 B HU 189978B
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- formula
- active ingredient
- phenyl
- compounds
- Prior art date
Links
- 230000000855 fungicidal effect Effects 0.000 title claims abstract description 13
- 239000000203 mixture Substances 0.000 title claims description 114
- 150000003852 triazoles Chemical class 0.000 title claims description 4
- 230000008635 plant growth Effects 0.000 title abstract description 14
- 230000001105 regulatory effect Effects 0.000 title abstract description 12
- 239000013543 active substance Substances 0.000 title description 5
- 239000000417 fungicide Substances 0.000 title description 4
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 title description 4
- 150000002460 imidazoles Chemical class 0.000 title description 2
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 75
- 150000002148 esters Chemical class 0.000 claims abstract description 10
- 239000002253 acid Substances 0.000 claims abstract description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 38
- 239000004480 active ingredient Substances 0.000 claims description 35
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 21
- -1 alkyl phenols Chemical class 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 13
- 239000007787 solid Substances 0.000 claims description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- 239000002480 mineral oil Substances 0.000 claims description 9
- 235000010446 mineral oil Nutrition 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 239000007859 condensation product Substances 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 5
- 239000001632 sodium acetate Substances 0.000 claims description 5
- 235000017281 sodium acetate Nutrition 0.000 claims description 5
- 239000004094 surface-active agent Substances 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 4
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 4
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- XQIJIALOJPIKGX-UHFFFAOYSA-N naphthalene 1,2-oxide Chemical compound C1=CC=C2C3OC3C=CC2=C1 XQIJIALOJPIKGX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 3
- 239000000454 talc Substances 0.000 claims description 3
- 229910052623 talc Inorganic materials 0.000 claims description 3
- 239000002562 thickening agent Substances 0.000 claims description 3
- 229920002554 vinyl polymer Chemical group 0.000 claims description 3
- 239000005648 plant growth regulator Substances 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims 1
- 125000004188 dichlorophenyl group Chemical group 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 239000005556 hormone Substances 0.000 claims 1
- 229940088597 hormone Drugs 0.000 claims 1
- 150000003871 sulfonates Chemical class 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 abstract description 7
- 150000003839 salts Chemical class 0.000 abstract description 6
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 239000002184 metal Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 55
- 241000196324 Embryophyta Species 0.000 description 52
- 239000000047 product Substances 0.000 description 37
- 239000000243 solution Substances 0.000 description 32
- 238000009472 formulation Methods 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 22
- 230000012010 growth Effects 0.000 description 20
- 238000002360 preparation method Methods 0.000 description 19
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 238000011282 treatment Methods 0.000 description 14
- 239000007921 spray Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000006185 dispersion Substances 0.000 description 10
- 239000008187 granular material Substances 0.000 description 10
- 239000012312 sodium hydride Substances 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 241000209140 Triticum Species 0.000 description 9
- 235000021307 Triticum Nutrition 0.000 description 9
- 208000015181 infectious disease Diseases 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000012141 concentrate Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 241000233866 Fungi Species 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 6
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 6
- 244000105624 Arachis hypogaea Species 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- 240000007594 Oryza sativa Species 0.000 description 6
- 235000007164 Oryza sativa Nutrition 0.000 description 6
- 229910052573 porcelain Inorganic materials 0.000 description 6
- 235000009566 rice Nutrition 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 241001480061 Blumeria graminis Species 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- 206010061217 Infestation Diseases 0.000 description 5
- 235000011430 Malus pumila Nutrition 0.000 description 5
- 235000015103 Malus silvestris Nutrition 0.000 description 5
- 239000003463 adsorbent Substances 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 235000020232 peanut Nutrition 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 244000070406 Malus silvestris Species 0.000 description 4
- 241000315044 Passalora arachidicola Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 241000607479 Yersinia pestis Species 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- BBXXLROWFHWFQY-UHFFFAOYSA-N ethirimol Chemical compound CCCCC1=C(C)NC(NCC)=NC1=O BBXXLROWFHWFQY-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000003337 fertilizer Substances 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 150000004795 grignard reagents Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 230000009105 vegetative growth Effects 0.000 description 4
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 4
- LYUGYMQIWOXZBT-UHFFFAOYSA-N 1-[(2-tert-butyloxiran-2-yl)methyl]-1,2,4-triazole Chemical compound C1=NC=NN1CC1(C(C)(C)C)CO1 LYUGYMQIWOXZBT-UHFFFAOYSA-N 0.000 description 3
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 235000016068 Berberis vulgaris Nutrition 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- 239000007818 Grignard reagent Substances 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 3
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 3
- 235000011613 Pinus brutia Nutrition 0.000 description 3
- 241000018646 Pinus brutia Species 0.000 description 3
- 241001337928 Podosphaera leucotricha Species 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 235000002595 Solanum tuberosum Nutrition 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 230000001276 controlling effect Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- 230000009036 growth inhibition Effects 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 238000003801 milling Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 3
- 239000002420 orchard Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- UWCXGQLUAITTNP-UHFFFAOYSA-N 1,3-dichloro-2-(4-chlorophenyl)propan-2-ol Chemical compound ClCC(O)(CCl)C1=CC=C(Cl)C=C1 UWCXGQLUAITTNP-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- PRPINYUDVPFIRX-UHFFFAOYSA-N 1-naphthaleneacetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CC=CC2=C1 PRPINYUDVPFIRX-UHFFFAOYSA-N 0.000 description 2
- UAXSQPGVLVBHGO-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-1-imidazol-1-yl-3-(1,2,4-triazol-1-yl)propan-2-ol Chemical compound C1=NC=NN1CC(C=1C(=CC(Cl)=CC=1)Cl)(O)CN1C=CN=C1 UAXSQPGVLVBHGO-UHFFFAOYSA-N 0.000 description 2
- IMFXVSXXEXNDFD-UHFFFAOYSA-N 2-(4-chlorophenyl)-1,3-bis(1h-1,2,4-triazol-5-yl)propan-2-ol Chemical compound N1=CNN=C1CC(C=1C=CC(Cl)=CC=1)(O)CC=1N=CNN=1 IMFXVSXXEXNDFD-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 241000371644 Curvularia ravenelii Species 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- 206010017533 Fungal infection Diseases 0.000 description 2
- 241000223218 Fusarium Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 240000005561 Musa balbisiana Species 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- 241000233626 Plasmopara Species 0.000 description 2
- 241000209048 Poa Species 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000221300 Puccinia Species 0.000 description 2
- 241001123569 Puccinia recondita Species 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 241000228452 Venturia inaequalis Species 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- DKWOHBPRFZIUQL-UHFFFAOYSA-N dimethyl-methylidene-oxo-$l^{6}-sulfane Chemical compound C[S+](C)([CH2-])=O DKWOHBPRFZIUQL-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 235000021049 nutrient content Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- BPLKQGGAXWRFOE-UHFFFAOYSA-M trimethylsulfoxonium iodide Chemical compound [I-].C[S+](C)(C)=O BPLKQGGAXWRFOE-UHFFFAOYSA-M 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- JIRHAGAOHOYLNO-UHFFFAOYSA-N (3-cyclopentyloxy-4-methoxyphenyl)methanol Chemical compound COC1=CC=C(CO)C=C1OC1CCCC1 JIRHAGAOHOYLNO-UHFFFAOYSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- CSVFWMMPUJDVKH-UHFFFAOYSA-N 1,1-dichloropropan-2-one Chemical compound CC(=O)C(Cl)Cl CSVFWMMPUJDVKH-UHFFFAOYSA-N 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RZECTPIFKMXYNH-UHFFFAOYSA-N 1,3-dichloro-2-(2,4-dichlorophenyl)propan-2-ol Chemical compound ClCC(O)(CCl)C1=CC=C(Cl)C=C1Cl RZECTPIFKMXYNH-UHFFFAOYSA-N 0.000 description 1
- LBOBESSDSGODDD-UHFFFAOYSA-N 1,3-dichloro-2-(chloromethyl)benzene Chemical compound ClCC1=C(Cl)C=CC=C1Cl LBOBESSDSGODDD-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- LGOLYAISTNZXFF-UHFFFAOYSA-N 1-(1h-1,2,4-triazol-5-yl)-2-(1h-1,2,4-triazol-5-ylmethyl)hexan-2-ol Chemical compound N1=CNN=C1CC(O)(CCCC)CC=1N=CNN=1 LGOLYAISTNZXFF-UHFFFAOYSA-N 0.000 description 1
- PZBPKYOVPCNPJY-UHFFFAOYSA-N 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C(OCC=C)CN1C=NC=C1 PZBPKYOVPCNPJY-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- FPKUQWXFHKJHML-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)hexan-2-ol Chemical compound CCCCC(O)(CCl)CCl FPKUQWXFHKJHML-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- LMKGTXQQGWLDMA-UHFFFAOYSA-N 1-imidazol-1-yl-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol Chemical compound C(C)(C)(C)C(CN1C=NC=C1)(CN1N=CN=C1)O LMKGTXQQGWLDMA-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- YNCPXBIZAPNQIJ-UHFFFAOYSA-N 1h-imidazole;sodium Chemical compound [Na].C1=CNC=N1 YNCPXBIZAPNQIJ-UHFFFAOYSA-N 0.000 description 1
- ZMZGFLUUZLELNE-UHFFFAOYSA-N 2,3,5-triiodobenzoic acid Chemical compound OC(=O)C1=CC(I)=CC(I)=C1I ZMZGFLUUZLELNE-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- ZQKJCBDCOGLKCQ-UHFFFAOYSA-N 2,4-dichloro-1-iodobenzene Chemical compound ClC1=CC=C(I)C(Cl)=C1 ZQKJCBDCOGLKCQ-UHFFFAOYSA-N 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- DOIPZJGDIKHEPS-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-5-yl)propan-2-ol Chemical compound N1N=C(N=C1)CC(C)(O)C1=C(C=C(C=C1)Cl)Cl DOIPZJGDIKHEPS-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- GXBXVRSEWWTWCK-UHFFFAOYSA-N 2-(chloromethyl)-2-(2,4-dichlorophenyl)oxirane Chemical compound C=1C=C(Cl)C=C(Cl)C=1C1(CCl)CO1 GXBXVRSEWWTWCK-UHFFFAOYSA-N 0.000 description 1
- VYWPPRLJNVHPEU-UHFFFAOYSA-N 2-chloro-1-(2,4-dichlorophenyl)ethanone Chemical compound ClCC(=O)C1=CC=C(Cl)C=C1Cl VYWPPRLJNVHPEU-UHFFFAOYSA-N 0.000 description 1
- QZYRWMQFPSNCRF-UHFFFAOYSA-N 2-chloro-2-(4-chloro-3h-1,2,4-triazol-2-yl)-1-phenylethanone Chemical compound C=1C=CC=CC=1C(=O)C(Cl)N1CN(Cl)C=N1 QZYRWMQFPSNCRF-UHFFFAOYSA-N 0.000 description 1
- ZVZQKNVMDKSGGF-UHFFFAOYSA-N 2-ethylsulfanylethoxy-dimethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCSCCOP(=S)(OC)OC ZVZQKNVMDKSGGF-UHFFFAOYSA-N 0.000 description 1
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 description 1
- RZCJYMOBWVJQGV-UHFFFAOYSA-N 2-naphthyloxyacetic acid Chemical compound C1=CC=CC2=CC(OCC(=O)O)=CC=C21 RZCJYMOBWVJQGV-UHFFFAOYSA-N 0.000 description 1
- YPUQGPFHHIGOKM-UHFFFAOYSA-N 2-nonyl-3-octylphenol Chemical compound CCCCCCCCCC1=C(O)C=CC=C1CCCCCCCC YPUQGPFHHIGOKM-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- ZOZNCWLGMUEPQI-UHFFFAOYSA-N 3,3-dimethyl-1-(1,2,4-triazol-1-yl)-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol Chemical compound N1(N=CN=C1)CC(CN1N=CN=C1)(O)C(C)(C)C ZOZNCWLGMUEPQI-UHFFFAOYSA-N 0.000 description 1
- FMWWRALTYIWZEB-UHFFFAOYSA-N 3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound CC(C)(C)C(=O)CN1C=NC=N1 FMWWRALTYIWZEB-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- 241001184547 Agrostis capillaris Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000009051 Ambrosia paniculata var. peruviana Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- 235000003276 Apios tuberosa Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 1
- 235000011330 Armoracia rusticana Nutrition 0.000 description 1
- 240000003291 Armoracia rusticana Species 0.000 description 1
- 235000003097 Artemisia absinthium Nutrition 0.000 description 1
- 240000001851 Artemisia dracunculus Species 0.000 description 1
- 235000017731 Artemisia dracunculus ssp. dracunculus Nutrition 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 241000512259 Ascophyllum nodosum Species 0.000 description 1
- 229930192334 Auxin Natural products 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 235000004936 Bromus mango Nutrition 0.000 description 1
- 239000005742 Bupirimate Substances 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N Carbendazim Natural products C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241001157813 Cercospora Species 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000005747 Chlorothalonil Substances 0.000 description 1
- 241000723353 Chrysanthemum Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 235000005633 Chrysanthemum balsamita Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 241000222233 Colletotrichum musae Species 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 239000005752 Copper oxychloride Substances 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 241001551134 Cynosurus Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 240000004585 Dactylis glomerata Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 235000009355 Dianthus caryophyllus Nutrition 0.000 description 1
- 240000006497 Dianthus caryophyllus Species 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 240000005717 Dioscorea alata Species 0.000 description 1
- 235000002723 Dioscorea alata Nutrition 0.000 description 1
- 235000007056 Dioscorea composita Nutrition 0.000 description 1
- 235000009723 Dioscorea convolvulacea Nutrition 0.000 description 1
- 235000005362 Dioscorea floribunda Nutrition 0.000 description 1
- 235000004868 Dioscorea macrostachya Nutrition 0.000 description 1
- 235000005361 Dioscorea nummularia Nutrition 0.000 description 1
- 235000005360 Dioscorea spiculiflora Nutrition 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241000508723 Festuca rubra Species 0.000 description 1
- AIKKULXCBHRFOS-UHFFFAOYSA-N Formothion Chemical compound COP(=S)(OC)SCC(=O)N(C)C=O AIKKULXCBHRFOS-UHFFFAOYSA-N 0.000 description 1
- 229930191978 Gibberellin Natural products 0.000 description 1
- 239000005562 Glyphosate Substances 0.000 description 1
- 239000005795 Imazalil Substances 0.000 description 1
- 235000006350 Ipomoea batatas var. batatas Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- 239000005983 Maleic hydrazide Substances 0.000 description 1
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 1
- 244000081841 Malus domestica Species 0.000 description 1
- 235000014826 Mangifera indica Nutrition 0.000 description 1
- 240000007228 Mangifera indica Species 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 1
- NWBJYWHLCVSVIJ-UHFFFAOYSA-N N-benzyladenine Chemical compound N=1C=NC=2NC=NC=2C=1NCC1=CC=CC=C1 NWBJYWHLCVSVIJ-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 241000234479 Narcissus Species 0.000 description 1
- 241000498271 Necator Species 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 240000004370 Pastinaca sativa Species 0.000 description 1
- 235000017769 Pastinaca sativa subsp sativa Nutrition 0.000 description 1
- 241001507673 Penicillium digitatum Species 0.000 description 1
- 241000122123 Penicillium italicum Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 241001123559 Puccinia hordei Species 0.000 description 1
- 241001123583 Puccinia striiformis Species 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 241001515786 Rhynchosporium Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 235000009184 Spondias indica Nutrition 0.000 description 1
- 244000087212 Stenotaphrum Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 239000005842 Thiophanate-methyl Substances 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241000722921 Tulipa gesneriana Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241001668516 Xanthomonas citri subsp. malvacearum Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000001138 artemisia absinthium Substances 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 239000002363 auxin Substances 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- DSKJPMWIHSOYEA-UHFFFAOYSA-N bupirimate Chemical compound CCCCC1=C(C)N=C(NCC)N=C1OS(=O)(=O)N(C)C DSKJPMWIHSOYEA-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 239000006013 carbendazim Substances 0.000 description 1
- JNPZQRQPIHJYNM-UHFFFAOYSA-N carbendazim Chemical compound C1=C[CH]C2=NC(NC(=O)OC)=NC2=C1 JNPZQRQPIHJYNM-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HKMOPYJWSFRURD-UHFFFAOYSA-N chloro hypochlorite;copper Chemical compound [Cu].ClOCl HKMOPYJWSFRURD-UHFFFAOYSA-N 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- CJHXCRMKMMBYJQ-UHFFFAOYSA-N dimethirimol Chemical compound CCCCC1=C(C)NC(N(C)C)=NC1=O CJHXCRMKMMBYJQ-UHFFFAOYSA-N 0.000 description 1
- 235000004879 dioscorea Nutrition 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000004492 dustable powder Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229960002125 enilconazole Drugs 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010413 gardening Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003448 gibberellin Substances 0.000 description 1
- IXORZMNAPKEEDV-OBDJNFEBSA-N gibberellin A3 Chemical class C([C@@]1(O)C(=C)C[C@@]2(C1)[C@H]1C(O)=O)C[C@H]2[C@]2(C=C[C@@H]3O)[C@H]1[C@]3(C)C(=O)O2 IXORZMNAPKEEDV-OBDJNFEBSA-N 0.000 description 1
- 229940097068 glyphosate Drugs 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- OXHDYFKENBXUEM-UHFFFAOYSA-N glyphosine Chemical compound OC(=O)CN(CP(O)(O)=O)CP(O)(O)=O OXHDYFKENBXUEM-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 208000037824 growth disorder Diseases 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000003617 indole-3-acetic acid Substances 0.000 description 1
- JTEDVYBZBROSJT-UHFFFAOYSA-N indole-3-butyric acid Chemical compound C1=CC=C2C(CCCC(=O)O)=CNC2=C1 JTEDVYBZBROSJT-UHFFFAOYSA-N 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- CIEXPHRYOLIQQD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-2-furoylalaninate Chemical compound CC=1C=CC=C(C)C=1N(C(C)C(=O)OC)C(=O)C1=CC=CO1 CIEXPHRYOLIQQD-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000029553 photosynthesis Effects 0.000 description 1
- 238000010672 photosynthesis Methods 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000010152 pollination Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- FBQQHUGEACOBDN-UHFFFAOYSA-N quinomethionate Chemical compound N1=C2SC(=O)SC2=NC2=CC(C)=CC=C21 FBQQHUGEACOBDN-UHFFFAOYSA-N 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 235000012045 salad Nutrition 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- BLFQGGGGFNSJKA-XHXSRVRCSA-N sertraline hydrochloride Chemical compound Cl.C1([C@@H]2CC[C@@H](C3=CC=CC=C32)NC)=CC=C(Cl)C(Cl)=C1 BLFQGGGGFNSJKA-XHXSRVRCSA-N 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- UYXAHRLPUPVSNJ-UHFFFAOYSA-N sodium;2h-triazole Chemical compound [Na].C=1C=NNN=1 UYXAHRLPUPVSNJ-UHFFFAOYSA-N 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 238000004162 soil erosion Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000005082 stem growth Effects 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical group COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- RROQIUMZODEXOR-UHFFFAOYSA-N triforine Chemical compound O=CNC(C(Cl)(Cl)Cl)N1CCN(C(NC=O)C(Cl)(Cl)Cl)CC1 RROQIUMZODEXOR-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
- C07C29/40—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones with compounds containing carbon-to-metal bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8017959 | 1980-06-02 | ||
| GB8109923 | 1981-03-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189978B true HU189978B (en) | 1986-08-28 |
Family
ID=26275707
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU811617A HU189978B (en) | 1980-06-02 | 1981-06-01 | Fungicide and plant growth regulating compositions containing triazole and imidazole derivatives as active substances |
| HU813158A HU194839B (en) | 1980-06-02 | 1981-06-01 | Process for production of derivatives of triasole and imidasole and medical preparatives containing such compounds |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU813158A HU194839B (en) | 1980-06-02 | 1981-06-01 | Process for production of derivatives of triasole and imidasole and medical preparatives containing such compounds |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US4416682A (show.php) |
| EP (2) | EP0044605B1 (show.php) |
| AU (1) | AU541154B2 (show.php) |
| CA (1) | CA1170263A (show.php) |
| DE (1) | DE3173759D1 (show.php) |
| DK (1) | DK154645C (show.php) |
| ES (1) | ES8300098A1 (show.php) |
| FI (1) | FI75341C (show.php) |
| GB (1) | GB2078719B (show.php) |
| GR (1) | GR73701B (show.php) |
| HK (1) | HK86087A (show.php) |
| HU (2) | HU189978B (show.php) |
| IE (1) | IE51284B1 (show.php) |
| IL (1) | IL62957A (show.php) |
| MY (1) | MY8700629A (show.php) |
| NO (1) | NO158538C (show.php) |
| NZ (1) | NZ197136A (show.php) |
| SG (1) | SG46987G (show.php) |
| YU (1) | YU42689B (show.php) |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5395942A (en) * | 1980-06-02 | 1995-03-07 | Zeneca Limited | Heterocyclic compounds |
| US5466821A (en) * | 1981-03-18 | 1995-11-14 | Zeneca Limited | Heterocyclic compounds |
| DE3111238A1 (de) * | 1981-03-21 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| EP0069442B1 (en) * | 1981-06-06 | 1985-02-20 | Pfizer Limited | Antifungal agents, processes for their preparation, and pharmaceutical compositions containing them |
| DK157135C (da) * | 1982-04-07 | 1990-04-02 | Pfizer | Analogifremgangsmaade til fremstilling af 1,2,4-triazol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf |
| GR79307B (show.php) * | 1982-06-09 | 1984-10-22 | Pfizer | |
| US4510148A (en) * | 1982-06-12 | 1985-04-09 | Pfizer Inc. | 2-Heterocyclic-1,3-bis(1H-1,2,4-triazol-1-yl)-propan-2-ols as antifungal agents |
| DE3232647A1 (de) * | 1982-09-02 | 1984-03-08 | Bayer Ag, 5090 Leverkusen | Substituierte tert.-butanol-derivate, verfahren zu ihrer herstellung und diese enthaltende antimykotische mittel |
| DE3235935A1 (de) * | 1982-09-29 | 1984-03-29 | Bayer Ag, 5090 Leverkusen | Azolylbutanole |
| JPS5998073A (ja) * | 1982-11-02 | 1984-06-06 | フアイザ−・コ−ポレ−シヨン | トリアゾ−ル系抗真菌剤 |
| US4466974A (en) * | 1982-11-16 | 1984-08-21 | Pfizer Inc. | Bistriazole antifungal agents |
| GB8301699D0 (en) * | 1983-01-21 | 1983-02-23 | Pfizer Ltd | Antifungal agents |
| GB8301678D0 (en) * | 1983-01-21 | 1983-02-23 | Ici Plc | Heterocyclic compounds |
| GB8302500D0 (en) * | 1983-01-29 | 1983-03-02 | Pfizer Ltd | Antifungal agents |
| GB8305377D0 (en) * | 1983-02-25 | 1983-03-30 | Pfizer Ltd | Antifungal agents |
| DE3307218A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte diazolylalkyl-carbinole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
| DE3307216A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| DE3307217A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte 1,3-diazolyl-2-propanole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
| GB8306351D0 (en) * | 1983-03-08 | 1983-04-13 | Ici Plc | Azole fungicides |
| US4992454A (en) * | 1983-03-16 | 1991-02-12 | Pfizer Inc. | Antifungal 1,3-bis (1H-1,2,4-triazol-1-yl)-2-aryl butan-2-ols and derivatives thereof |
| DK159205C (da) * | 1983-03-16 | 1991-03-04 | Pfizer | Bis(triazol)alkanol-forbindelser, anvendelse af disse, farmaceutiske praeparater og landbrugsfungicider indeholdende disse og fremgangsmaade til behandling af planter eller froe, som har en svampeinfektion |
| EP0122452A1 (en) * | 1983-03-18 | 1984-10-24 | Schering Corporation | Triazolyl- and imidazolyl-substituted fluoroalkane derivatives, process for their preparation and pharmaceutical compositions containing them |
| DE3311702A1 (de) * | 1983-03-30 | 1984-10-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, verfahren zu ihrer herstellung und deren verwendung |
| DE3313073A1 (de) * | 1983-04-12 | 1984-10-18 | Bayer Ag, 5090 Leverkusen | 1-azolyl-3-pyrazolyl-2-propanol-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| GB8313235D0 (en) * | 1983-05-13 | 1983-06-22 | Pfizer Ltd | Antifungal agents |
| US4482564A (en) * | 1983-06-03 | 1984-11-13 | Schering Corporation | Triazolyl-substituted propane derivatives |
| DE3325313A1 (de) * | 1983-07-13 | 1985-01-31 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, deren herstellung und verwendung |
| DE3342692A1 (de) | 1983-11-25 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von ss-hydroxyethyl-(1,2,4-triazol)-derivaten |
| ATE33982T1 (de) * | 1983-12-20 | 1988-05-15 | Ciba Geigy Ag | Mikrobizide. |
| US4483863A (en) * | 1984-01-20 | 1984-11-20 | Pfizer Inc. | Triazole antifungal agents |
| US4602030A (en) * | 1984-05-24 | 1986-07-22 | Chevron Research Company | Fungicidal 2-substituted-1-(1-imidazolyl)-propyl aryl sulfides, sulfoxides and sulfones |
| IE58738B1 (en) * | 1984-09-05 | 1993-11-03 | Ici Plc | Antifungal azole compounds |
| DK476385A (da) * | 1984-10-19 | 1986-04-20 | Schering Corp | 1,3-bis(1h-1,2,4-triazol-1-yl)-2-flour-2-(2,4-difluorphenyl)propan, antifungale midler indeholdende denne forbindelse, og fremgangsmaade til fremstilling af denne forbindelse |
| DE3440117A1 (de) * | 1984-11-02 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Substituierte azolylcyclopropyl-azolylmethyl-carbinol-derivate |
| CN1008735B (zh) | 1984-11-02 | 1990-07-11 | 拜尔公司 | 以取代的氮杂茂基甲基-环丙基-甲醇衍生物为活性成分的组合物 |
| DE3440114A1 (de) * | 1984-11-02 | 1986-05-07 | Bayer Ag, 5090 Leverkusen | Antimykotische mittel |
| GB8614712D0 (en) * | 1986-06-17 | 1986-07-23 | Ici Plc | Heterocyclic compounds |
| DE3732384A1 (de) * | 1987-09-25 | 1989-04-06 | Bayer Ag | Bisazolyl-hydroxyalkyl-derivate enthaltende antimykotische mittel |
| DE3803833A1 (de) * | 1988-02-09 | 1989-08-17 | Bayer Ag | Substituierte azolylmethyloxirane |
| US4987144A (en) * | 1989-05-02 | 1991-01-22 | Ss Pharmaceutical Co., Ltd. | 1,3-bis(1,2,4-triazol-1-yl)2-(4-trifluoromethylphenyl)propan-2-ol useful for the prevention and/or treatment of deep-seated mycosis |
| GB9002375D0 (en) * | 1990-02-02 | 1990-04-04 | Pfizer Ltd | Triazole antifungal agents |
| DE4027608A1 (de) * | 1990-08-31 | 1992-03-05 | Bayer Ag | Verfahren zur herstellung von 1-chlor-2-(1-chlor-cyclopropyl)-3-(2-chlor-phenyl)-propan-2-ol und/oder 2-(1-chlor-cyclopropyl)-2-(2-chlor-benzyl)-oxiran |
| DE4134125C2 (de) * | 1991-10-15 | 1995-02-02 | Mack Chem Pharm | Triazol-Derivate enthaltende pharmazeutische Zusammensetzungen zur rektalen Applikation |
| EP0548553A1 (en) * | 1991-11-25 | 1993-06-30 | Takeda Chemical Industries, Ltd. | Optically active azole compounds, their production and use |
| GB9307924D0 (en) * | 1993-04-16 | 1993-06-02 | Zeneca Ltd | Chrial synthesis |
| CA2106032C (en) * | 1993-09-13 | 1995-11-07 | Gamini Weeratunga | Methods for the manufacture of fluconazole and forms thereof, intermediates useful in the manufacture thereof, and combinations comprising fluconazole |
| HU212458B (en) * | 1993-09-23 | 1996-06-28 | Richter Gedeon Vegyeszet | New silyloxypropane derivatives substituted with triazole or imidazole pharmaceutical compositions containing them and process for producing them |
| NZ270418A (en) | 1994-02-07 | 1997-09-22 | Eisai Co Ltd | Polycyclic triazole & imidazole derivatives, antifungal compositions |
| CA2139079C (en) * | 1994-12-23 | 1996-05-28 | K.S. Keshava Murthy | Commercial process for the manufacture of fluconazole and intermediates useful in the manufacture thereof |
| US5665751A (en) * | 1995-06-07 | 1997-09-09 | The Procter & Gamble Company | Pharmaceutical composition for inhibiting the growth of cancers |
| US5770616A (en) * | 1995-06-07 | 1998-06-23 | The Procter & Gamble Company | Pharmaceutical composition for inhibiting the growth of cancers |
| US6200992B1 (en) | 1995-06-07 | 2001-03-13 | The Procter & Gamble Company | Pharmaceutical composition for inhibiting the growth of cancers |
| US5908855A (en) * | 1996-07-16 | 1999-06-01 | The Procter & Gamble Company | Compositions for treating viral infections |
| GB9605705D0 (en) | 1996-03-19 | 1996-05-22 | Pfizer Ltd | Therapeutic agents |
| DE19617282A1 (de) * | 1996-04-30 | 1997-11-06 | Bayer Ag | Triazolyl-mercaptide |
| DE19617461A1 (de) | 1996-05-02 | 1997-11-06 | Bayer Ag | Acylmercapto-triazolyl-Derivate |
| DE19619544A1 (de) | 1996-05-15 | 1997-11-20 | Bayer Ag | Triazolyl-Disulfide |
| DE19620408A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Mercapto-imidazolyl-Derivate |
| DE19620590A1 (de) * | 1996-05-22 | 1997-11-27 | Bayer Ag | Sulfonyl-mercapto-triazolyl-Derivate |
| RU2141955C1 (ru) * | 1997-06-04 | 1999-11-27 | Санкт-Петербургский государственный университет технологии и дизайна | Способ получения бис-1,2-(1,2,4-триазол-1-ил)этана |
| WO2003079972A2 (en) | 2002-02-22 | 2003-10-02 | New River Parmaceuticals Inc. | Active agent delivery systems and methods for protecting and administering active agents |
| RU2260591C2 (ru) * | 2001-03-23 | 2005-09-20 | Рихтер Гедеон Ведьесети Дьяр Рт. | Способ синтеза моногидрата флуконазола, способ синтеза кристаллической модификации ii флуконазола (варианты) и способ синтеза кристаллической модификации i флуконазола |
| HU226886B1 (en) | 2001-03-23 | 2010-01-28 | Richter Gedeon Nyrt | Novel process for preparing fluconazole monohydrate |
| US6951654B2 (en) * | 2001-03-27 | 2005-10-04 | Galen (Chemicals) Limited | Intravaginal drug delivery devices for the administration of an antimicrobial agent |
| WO2002078451A1 (en) * | 2001-03-30 | 2002-10-10 | Premier Botanicals Ltd. | Pesticidal compositions from prunus |
| CN100451007C (zh) * | 2006-10-12 | 2009-01-14 | 杭州宇龙化工有限公司 | 含芳醚双三氮唑类化合物及其用途 |
| EA201491036A1 (ru) * | 2011-11-25 | 2014-11-28 | Байер Интеллектуэль Проперти Гмбх | Производные 2-йодимидазола |
| CN102657179B (zh) * | 2012-04-26 | 2014-04-23 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与肟菌酯的杀菌组合物 |
| CN102696621B (zh) * | 2012-05-30 | 2013-06-12 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与丙硫菌唑的杀菌组合物 |
| CN102696623B (zh) * | 2012-06-21 | 2013-07-03 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与丙环唑的杀菌组合物 |
| CN102696625B (zh) * | 2012-06-28 | 2013-06-12 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与啶氧菌酯的杀菌组合物及其用途 |
| CN102696626B (zh) * | 2012-07-10 | 2013-07-03 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与咯菌腈的杀菌组合物 |
| WO2014124850A1 (en) | 2013-02-14 | 2014-08-21 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2813499A1 (en) | 2013-06-12 | 2014-12-17 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014198557A1 (en) * | 2013-06-12 | 2014-12-18 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| WO2014198553A1 (en) * | 2013-06-12 | 2014-12-18 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| CN104604888B (zh) * | 2015-02-16 | 2016-07-06 | 杭州宇龙化工有限公司 | 一种含有苯醚双唑与恶唑菌酮的杀菌组合物 |
| GB201610724D0 (en) | 2016-06-20 | 2016-08-03 | Univ Dundee | Anti-infective agents |
| RU182577U1 (ru) * | 2017-09-27 | 2018-08-23 | Общество с ограниченной ответственностью "Гамма" | Упаковка для хранения и транспортировки формованных композиций для моделирования и лепки |
| CN108849919B (zh) * | 2018-06-06 | 2021-01-29 | 长江大学 | 抗真菌医药在农作物病害防治上的新用途 |
| MX2020014203A (es) | 2018-06-21 | 2021-05-27 | Yumanity Therapeutics Inc | Composiciones y métodos para el tratamiento y la prevención de trastornos neurológicos. |
| CN119350304A (zh) * | 2023-02-15 | 2025-01-24 | 中国人民解放军海军军医大学 | 一种具有光响应活性的抗真菌化合物及其应用 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE168941C (show.php) * | ||||
| DE1238888B (de) * | 1965-05-14 | 1967-04-20 | Dynamit Nobel Ag | Verfahren zur Herstellung von hoeher chlorierten Alkoholen |
| US2061377A (en) * | 1934-06-25 | 1936-11-17 | Shell Dev | Conversion of polyhalogenated alcohols |
| DE2255290A1 (de) * | 1972-11-11 | 1974-05-22 | Bayer Ag | Cyclische aminale aromatischer aldehyde |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| GB1535777A (en) * | 1975-08-26 | 1978-12-13 | Ici Ltd | Imidazole and 1,2,4-triazole compounds and their use as pesticides |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
| GB1533706A (en) * | 1976-03-01 | 1978-11-29 | Ici Ltd | Fungicidal imidazoles and 1,2,4-triazoles |
| DE2613167A1 (de) * | 1976-03-27 | 1977-10-06 | Bayer Ag | Oximcarbamate, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematozide |
| DE2628421A1 (de) * | 1976-06-24 | 1978-01-05 | Bayer Ag | Antimikrobielle mittel |
| ZA774497B (en) * | 1976-07-29 | 1978-06-28 | Ici Ltd | Processes and compositions for combating fungi |
| DE2645496A1 (de) * | 1976-10-08 | 1978-04-13 | Bayer Ag | (1-phenyl-2-triazolyl-aethyl)-thioaether-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide und wachstumsregulatoren |
| NZ186369A (en) * | 1977-02-08 | 1980-03-05 | Ici Ltd | Method of regulating plant growth |
| JPS6053018B2 (ja) * | 1977-09-07 | 1985-11-22 | 住友化学工業株式会社 | アゾ−ル系化合物、その製造法および該化合物からなる殺菌剤 |
| DE2851116A1 (de) * | 1978-11-25 | 1980-06-12 | Bayer Ag | Hydroxyethyl-azole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE3061554D1 (en) * | 1979-02-16 | 1983-02-17 | Bayer Ag | 1-vinyltriazole derivatives, process for their preparation and their use as growth regulating agents and fungicides |
| DE2908378A1 (de) * | 1979-03-03 | 1980-09-11 | Hoechst Ag | Derivate des 1,2,4-triazols |
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| IL60470A0 (en) * | 1979-07-04 | 1980-09-16 | Pfizer | Imidazole derivatives,their preparation and pharmaceutical compositions containing them |
-
1981
- 1981-05-07 GB GB8114008A patent/GB2078719B/en not_active Expired
- 1981-05-14 EP EP81302146A patent/EP0044605B1/en not_active Expired
- 1981-05-14 IE IE1078/81A patent/IE51284B1/en not_active IP Right Cessation
- 1981-05-14 DE DE8181302146T patent/DE3173759D1/de not_active Expired
- 1981-05-14 EP EP83110074A patent/EP0111658B1/en not_active Expired
- 1981-05-18 NZ NZ197136A patent/NZ197136A/en unknown
- 1981-05-20 AU AU70877/81A patent/AU541154B2/en not_active Expired
- 1981-05-22 CA CA000378094A patent/CA1170263A/en not_active Expired
- 1981-05-25 IL IL62957A patent/IL62957A/xx unknown
- 1981-06-01 HU HU811617A patent/HU189978B/hu unknown
- 1981-06-01 GR GR65111A patent/GR73701B/el unknown
- 1981-06-01 YU YU1392/81A patent/YU42689B/xx unknown
- 1981-06-01 NO NO811843A patent/NO158538C/no not_active IP Right Cessation
- 1981-06-01 HU HU813158A patent/HU194839B/hu unknown
- 1981-06-01 FI FI811686A patent/FI75341C/fi not_active IP Right Cessation
- 1981-06-02 US US06/269,581 patent/US4416682A/en not_active Expired - Lifetime
- 1981-06-02 DK DK242581A patent/DK154645C/da not_active IP Right Cessation
- 1981-06-02 ES ES502710A patent/ES8300098A1/es not_active Expired
-
1983
- 1983-09-12 US US06/531,244 patent/US4523019A/en not_active Expired - Lifetime
-
1987
- 1987-05-26 SG SG46987A patent/SG46987G/en unknown
- 1987-11-19 HK HK860/87A patent/HK86087A/en not_active IP Right Cessation
- 1987-12-30 MY MY629/87A patent/MY8700629A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK154645C (da) | 1989-05-08 |
| YU42689B (en) | 1988-10-31 |
| GB2078719A (en) | 1982-01-13 |
| FI75341C (fi) | 1988-06-09 |
| CA1170263A (en) | 1984-07-03 |
| HK86087A (en) | 1987-11-27 |
| SG46987G (en) | 1987-08-28 |
| IE811078L (en) | 1981-12-02 |
| FI75341B (fi) | 1988-02-29 |
| EP0111658A2 (en) | 1984-06-27 |
| NZ197136A (en) | 1984-07-06 |
| IE51284B1 (en) | 1986-11-26 |
| AU541154B2 (en) | 1984-12-20 |
| GR73701B (show.php) | 1984-04-03 |
| US4416682A (en) | 1983-11-22 |
| NO158538C (no) | 1988-09-28 |
| US4523019A (en) | 1985-06-11 |
| YU139281A (en) | 1984-02-29 |
| MY8700629A (en) | 1987-12-31 |
| GB2078719B (en) | 1984-04-26 |
| ES502710A0 (es) | 1982-10-01 |
| FI811686L (fi) | 1981-12-03 |
| IL62957A (en) | 1986-12-31 |
| EP0044605B1 (en) | 1986-02-12 |
| HU194839B (en) | 1988-03-28 |
| ES8300098A1 (es) | 1982-10-01 |
| DE3173759D1 (de) | 1986-03-27 |
| EP0044605A1 (en) | 1982-01-27 |
| DK154645B (da) | 1988-12-05 |
| NO811843L (no) | 1981-12-03 |
| NO158538B (no) | 1988-06-20 |
| AU7087781A (en) | 1981-12-10 |
| EP0111658A3 (en) | 1984-12-19 |
| DK242581A (da) | 1981-12-03 |
| EP0111658B1 (en) | 1986-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189978B (en) | Fungicide and plant growth regulating compositions containing triazole and imidazole derivatives as active substances | |
| EP0243983B1 (en) | Heterocyclic compounds | |
| US4931082A (en) | Triazole derivatives useful as plant growth regulating agents | |
| HU191529B (en) | Fungicide and plant growth regulating compositions containing triazole derivatives as active substances and process for preparing the active substances | |
| HU189225B (en) | Fungicide compositions with regulating activity for growth of plants and process for producing tetrahydrofurfuryl-azole derivatives as active agents | |
| US4871389A (en) | Heterocyclic compounds | |
| JPH0413348B2 (show.php) | ||
| US4684396A (en) | Triazole and imidazole compounds useful as plant growth regulators and fungicides | |
| US4634466A (en) | Triazoles and use as fungicides and plant growth regulators | |
| US4923502A (en) | Triazolyl ethanol derivatives as plant growth regulators | |
| US4999043A (en) | Triazolylmethyl tert-butyl carbinol derivatives which have plant growth regulating properties | |
| EP0086917A1 (en) | Heterocyclic compounds useful as pesticides and processes for making them | |
| EP0212841B1 (en) | Substituted hydroxybutynyl azoles as plant growth regulators | |
| JPS6337102B2 (show.php) | ||
| EP0120609B1 (en) | Fungicidal azolyl-ethyl-phosphonate derivatives | |
| EP0199474A2 (en) | Substituted triazolyl butanoates as plant growth regulators | |
| US5466821A (en) | Heterocyclic compounds | |
| GB2158071A (en) | 3-(imidazolyl or triazolyl)-2-hydroxy-propyl phosphonic acid derivatives | |
| US5272130A (en) | Fungicidal and plant growth regulating triazole alkynyl ethers | |
| DK162523B (da) | Triazolforbindelser | |
| JPH0437828B2 (show.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HPC4 | Succession in title of patentee |
Owner name: ZENECA LTD. OF IMPERIAL CHEMICAL HOUSE, GB |