HU189595B - Process for production of new imidazolo /1,2-a/ piridins and pirazins - Google Patents
Process for production of new imidazolo /1,2-a/ piridins and pirazins Download PDFInfo
- Publication number
- HU189595B HU189595B HU822071A HU207182A HU189595B HU 189595 B HU189595 B HU 189595B HU 822071 A HU822071 A HU 822071A HU 207182 A HU207182 A HU 207182A HU 189595 B HU189595 B HU 189595B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- group
- compounds
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 38
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 159
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 6
- 150000005234 imidazo[1,2-a]pyridines Chemical class 0.000 claims abstract description 5
- 150000003216 pyrazines Chemical class 0.000 claims abstract description 4
- -1 mesyloxy, tosyloxy Chemical group 0.000 claims description 37
- 238000002360 preparation method Methods 0.000 claims description 37
- 229910052739 hydrogen Inorganic materials 0.000 claims description 36
- 239000001257 hydrogen Substances 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 30
- 230000002829 reductive effect Effects 0.000 claims description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical group 0.000 claims description 18
- 239000007858 starting material Substances 0.000 claims description 18
- 239000004480 active ingredient Substances 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 7
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- IFBTWYVUMXMJBS-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyrazin-3-amine Chemical compound N=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=CC=C1 IFBTWYVUMXMJBS-UHFFFAOYSA-N 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 238000007239 Wittig reaction Methods 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 235000010288 sodium nitrite Nutrition 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 claims description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- LOYDZPBTPYPEFJ-UHFFFAOYSA-N 2,3-dimethyl-8-(2-phenylethenyl)imidazo[1,2-a]pyridine Chemical compound C=1C=CN2C(C)=C(C)N=C2C=1C=CC1=CC=CC=C1 LOYDZPBTPYPEFJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000005905 mesyloxy group Chemical group 0.000 claims description 2
- 230000009935 nitrosation Effects 0.000 claims description 2
- 238000007034 nitrosation reaction Methods 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 claims description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims 4
- 125000001246 bromo group Chemical group Br* 0.000 claims 3
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims 3
- 239000003085 diluting agent Substances 0.000 claims 3
- 125000002346 iodo group Chemical group I* 0.000 claims 3
- 125000006239 protecting group Chemical group 0.000 claims 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims 2
- 239000000945 filler Substances 0.000 claims 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- 230000002152 alkylating effect Effects 0.000 claims 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 claims 1
- 150000002430 hydrocarbons Chemical group 0.000 claims 1
- MBVAHHOKMIRXLP-UHFFFAOYSA-N imidazo[1,2-a]pyrazine Chemical group C1=CN=CC2=NC=CN21 MBVAHHOKMIRXLP-UHFFFAOYSA-N 0.000 claims 1
- 208000025865 Ulcer Diseases 0.000 abstract description 4
- 230000001120 cytoprotective effect Effects 0.000 abstract description 3
- 230000001262 anti-secretory effect Effects 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 138
- 239000000243 solution Substances 0.000 description 69
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 59
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- 239000000203 mixture Substances 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 239000010410 layer Substances 0.000 description 25
- 239000007787 solid Substances 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 239000003921 oil Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 239000000284 extract Substances 0.000 description 13
- 238000001914 filtration Methods 0.000 description 13
- VNHBYKHXBCYPBJ-UHFFFAOYSA-N 5-ethynylimidazo[1,2-a]pyridine Chemical compound C#CC1=CC=CC2=NC=CN12 VNHBYKHXBCYPBJ-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 208000007107 Stomach Ulcer Diseases 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 9
- 241000700159 Rattus Species 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 230000002496 gastric effect Effects 0.000 description 9
- 201000005917 gastric ulcer Diseases 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000009858 acid secretion Effects 0.000 description 6
- 235000019445 benzyl alcohol Nutrition 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 210000002784 stomach Anatomy 0.000 description 6
- 239000000829 suppository Substances 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000002027 dichloromethane extract Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 239000008215 water for injection Substances 0.000 description 5
- KOIFCCJCKCEVPV-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyrazine Chemical compound C12=NC(C)=CN2C=CN=C1OCC1=CC=CC=C1 KOIFCCJCKCEVPV-UHFFFAOYSA-N 0.000 description 4
- BARSEKTZFIILTJ-UHFFFAOYSA-N 3-chloro-4-oxopentanenitrile Chemical compound CC(=O)C(Cl)CC#N BARSEKTZFIILTJ-UHFFFAOYSA-N 0.000 description 4
- GXWNSJYVSIJRLS-UHFFFAOYSA-N 6-bromo-8-methylimidazo[1,2-a]pyrazine Chemical compound CC1=NC(Br)=CN2C=CN=C12 GXWNSJYVSIJRLS-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 208000027418 Wounds and injury Diseases 0.000 description 4
- 230000000767 anti-ulcer Effects 0.000 description 4
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 208000000718 duodenal ulcer Diseases 0.000 description 4
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical group ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- YYZYILOUKSPGIR-UHFFFAOYSA-N (2-methylimidazo[1,2-a]pyridin-8-yl)methanol Chemical compound C1=CC=C(CO)C2=NC(C)=CN21 YYZYILOUKSPGIR-UHFFFAOYSA-N 0.000 description 3
- KAWUTCFJCFNBHR-UHFFFAOYSA-N 2-methyl-3-nitroso-8-(2-phenylethenyl)imidazo[1,2-a]pyridine Chemical compound C=1C=CN2C(N=O)=C(C)N=C2C=1C=CC1=CC=CC=C1 KAWUTCFJCFNBHR-UHFFFAOYSA-N 0.000 description 3
- MJBOKVIKSYZBHM-UHFFFAOYSA-N 2-methyl-3-nitroso-8-phenylmethoxyimidazo[1,2-a]pyrazine Chemical compound N=1C=CN2C(N=O)=C(C)N=C2C=1OCC1=CC=CC=C1 MJBOKVIKSYZBHM-UHFFFAOYSA-N 0.000 description 3
- NEAKUWYCNOISFI-UHFFFAOYSA-N 2-methylimidazo[1,2-a]pyridine-8-carbaldehyde Chemical compound C1=CC=C(C=O)C2=NC(C)=CN21 NEAKUWYCNOISFI-UHFFFAOYSA-N 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- DQLFOAVCYJZTTR-UHFFFAOYSA-N 8-(chloromethyl)-2-methylimidazo[1,2-a]pyridine Chemical compound C1=CC=C(CCl)C2=NC(C)=CN21 DQLFOAVCYJZTTR-UHFFFAOYSA-N 0.000 description 3
- ZZPUXAQVYFAAMQ-UHFFFAOYSA-N 8-chloro-2-methylimidazo[1,2-a]pyrazine Chemical compound C1=CN=C(Cl)C2=NC(C)=CN21 ZZPUXAQVYFAAMQ-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 229940099112 cornstarch Drugs 0.000 description 3
- 230000027119 gastric acid secretion Effects 0.000 description 3
- 208000014674 injury Diseases 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 229940057838 polyethylene glycol 4000 Drugs 0.000 description 3
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 3
- 229920000053 polysorbate 80 Polymers 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000008213 purified water Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- MPJPSTPDXXNBGF-ASTDGNLGSA-N 2,3-dimethyl-8-[(e)-2-phenylethenyl]imidazo[1,2-a]pyridine;hydrochloride Chemical compound Cl.C=1C=CN2C(C)=C(C)N=C2C=1\C=C\C1=CC=CC=C1 MPJPSTPDXXNBGF-ASTDGNLGSA-N 0.000 description 2
- USFVWRVQNMXIIZ-UHFFFAOYSA-N 2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyrazine Chemical compound N=1C=CN2C(C)=C(C)N=C2C=1OCC1=CC=CC=C1 USFVWRVQNMXIIZ-UHFFFAOYSA-N 0.000 description 2
- BECVAYJCTKQHEG-UHFFFAOYSA-N 2,3-dimethylimidazo[1,2-a]pyridine-8-carbaldehyde Chemical compound O=CC1=CC=CN2C(C)=C(C)N=C21 BECVAYJCTKQHEG-UHFFFAOYSA-N 0.000 description 2
- NXMFJCRMSDRXLD-UHFFFAOYSA-N 2-aminopyridine-3-carbaldehyde Chemical compound NC1=NC=CC=C1C=O NXMFJCRMSDRXLD-UHFFFAOYSA-N 0.000 description 2
- IRUQZZZROURFAO-UHFFFAOYSA-N 2-methyl-8-(2-phenylethenyl)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1C=CC1=CC=CC=C1 IRUQZZZROURFAO-UHFFFAOYSA-N 0.000 description 2
- IDPIRTJWDLJYMK-UHFFFAOYSA-N 2-methyl-8-(2-phenylethenyl)imidazo[1,2-a]pyridine Chemical compound C12=NC(C)=CN2C=CC=C1C=CC1=CC=CC=C1 IDPIRTJWDLJYMK-UHFFFAOYSA-N 0.000 description 2
- JGWVBIHUBXXZBE-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=CC=C1 JGWVBIHUBXXZBE-UHFFFAOYSA-N 0.000 description 2
- BWMDUDCGBRNUQT-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine Chemical compound C12=NC(C)=CN2C=CC=C1OCC1=CC=CC=C1 BWMDUDCGBRNUQT-UHFFFAOYSA-N 0.000 description 2
- NMCBWICNRJLKKM-UHFFFAOYSA-N 3-(benzyloxy)pyridin-2-amine Chemical compound NC1=NC=CC=C1OCC1=CC=CC=C1 NMCBWICNRJLKKM-UHFFFAOYSA-N 0.000 description 2
- BNBOUFHCTIFWHN-UHFFFAOYSA-N 3-bromobutan-2-one Chemical compound CC(Br)C(C)=O BNBOUFHCTIFWHN-UHFFFAOYSA-N 0.000 description 2
- AEVSSZHXGJAPIE-UHFFFAOYSA-N 3-chloropyrazin-2-amine Chemical compound NC1=NC=CN=C1Cl AEVSSZHXGJAPIE-UHFFFAOYSA-N 0.000 description 2
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 2
- GNOVVNZPJJBZQT-UHFFFAOYSA-N 8-bromo-2,3-dimethylimidazo[1,2-a]pyrazine Chemical group BrC1=NC=CN2C(C)=C(C)N=C21 GNOVVNZPJJBZQT-UHFFFAOYSA-N 0.000 description 2
- OKNZMFMNVDJVOR-UHFFFAOYSA-N 8-chloro-2,3-dimethylimidazo[1,2-a]pyrazine Chemical compound ClC1=NC=CN2C(C)=C(C)N=C21 OKNZMFMNVDJVOR-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000003699 antiulcer agent Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910000085 borane Inorganic materials 0.000 description 2
- VQFAIAKCILWQPZ-UHFFFAOYSA-N bromoacetone Chemical compound CC(=O)CBr VQFAIAKCILWQPZ-UHFFFAOYSA-N 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 238000009838 combustion analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- AIPRAPZUGUTQKX-UHFFFAOYSA-N diethoxyphosphorylmethylbenzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC=C1 AIPRAPZUGUTQKX-UHFFFAOYSA-N 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011491 glass wool Substances 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- LFQMZQLUCYBDLH-UHFFFAOYSA-N n-[(2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)methyl]formamide Chemical compound C=1C=CN2C(CNC=O)=C(C)N=C2C=1OCC1=CC=CC=C1 LFQMZQLUCYBDLH-UHFFFAOYSA-N 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229940113116 polyethylene glycol 1000 Drugs 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 229940068968 polysorbate 80 Drugs 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridine hydrochloride Substances [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000001509 sodium citrate Substances 0.000 description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 231100000397 ulcer Toxicity 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- RBDZJRIHPSQCSE-UHFFFAOYSA-N (2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)methanamine Chemical compound C=1C=CN2C(CN)=C(C)N=C2C=1OCC1=CC=CC=C1 RBDZJRIHPSQCSE-UHFFFAOYSA-N 0.000 description 1
- CSVFWMMPUJDVKH-UHFFFAOYSA-N 1,1-dichloropropan-2-one Chemical compound CC(=O)C(Cl)Cl CSVFWMMPUJDVKH-UHFFFAOYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- MUIRYDACQAIGRF-UHFFFAOYSA-N 2,3-dimethyl-5-phenylmethoxyimidazo[1,2-a]pyridine Chemical compound N12C(C)=C(C)N=C2C=CC=C1OCC1=CC=CC=C1 MUIRYDACQAIGRF-UHFFFAOYSA-N 0.000 description 1
- GOCYCWYVTRHCPR-IZZDOVSWSA-N 2,3-dimethyl-8-[(e)-3-phenylprop-1-enyl]imidazo[1,2-a]pyridine Chemical compound C=1C=CN2C(C)=C(C)N=C2C=1\C=C\CC1=CC=CC=C1 GOCYCWYVTRHCPR-IZZDOVSWSA-N 0.000 description 1
- CJCIWYQTNYEJKN-CMDGGOBGSA-N 2,6-dimethyl-8-[(e)-2-phenylethenyl]imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C(C)=CN2C(N)=C(C)N=C2C=1\C=C\C1=CC=CC=C1 CJCIWYQTNYEJKN-CMDGGOBGSA-N 0.000 description 1
- KDPSKNGNUJEAEA-UHFFFAOYSA-N 2,6-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C(C)=CN2C(N)=C(C)N=C2C=1OCC1=CC=CC=C1 KDPSKNGNUJEAEA-UHFFFAOYSA-N 0.000 description 1
- MMPVLGBRCAYMIL-UHFFFAOYSA-N 2,7-dimethyl-8-(2-phenylethyl)imidazo[1,2-a]pyridin-3-amine Chemical compound CC=1C=CN2C(N)=C(C)N=C2C=1CCC1=CC=CC=C1 MMPVLGBRCAYMIL-UHFFFAOYSA-N 0.000 description 1
- PUUSXIHUQWXJEB-UHFFFAOYSA-N 2-(2-methyl-7-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)acetonitrile Chemical compound C1=CN2C(CC#N)=C(C)N=C2C=C1OCC1=CC=CC=C1 PUUSXIHUQWXJEB-UHFFFAOYSA-N 0.000 description 1
- PYKJFEPAUKAXNN-UHFFFAOYSA-N 2-(2-methyl-8-phenylmethoxy-3-imidazo[1,2-a]pyridinyl)acetonitrile Chemical compound C=1C=CN2C(CC#N)=C(C)N=C2C=1OCC1=CC=CC=C1 PYKJFEPAUKAXNN-UHFFFAOYSA-N 0.000 description 1
- OQYGXNFGWLDYKB-UHFFFAOYSA-N 2-(8-hydroxy-2-methylimidazo[1,2-a]pyridin-3-yl)acetonitrile Chemical compound OC1=CC=CN2C(CC#N)=C(C)N=C21 OQYGXNFGWLDYKB-UHFFFAOYSA-N 0.000 description 1
- YAXHMNFYOPQWKP-UHFFFAOYSA-N 2-[2-methyl-6-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]acetonitrile Chemical compound C=1N2C(CC#N)=C(C)N=C2C=CC=1CCC1=CC=CC=C1 YAXHMNFYOPQWKP-UHFFFAOYSA-N 0.000 description 1
- KXQSICYBOVIQTJ-UHFFFAOYSA-N 2-[2-methyl-7-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]acetonitrile Chemical compound C1=CN2C(CC#N)=C(C)N=C2C=C1CCC1=CC=CC=C1 KXQSICYBOVIQTJ-UHFFFAOYSA-N 0.000 description 1
- YSDWXCRPYAVVMD-UHFFFAOYSA-N 2-[7-(benzylamino)-2-methylimidazo[1,2-a]pyridin-3-yl]acetonitrile Chemical compound C1=CN2C(CC#N)=C(C)N=C2C=C1NCC1=CC=CC=C1 YSDWXCRPYAVVMD-UHFFFAOYSA-N 0.000 description 1
- UQXLVSWSVWUNBG-UHFFFAOYSA-N 2-[8-(furan-3-ylmethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]acetonitrile Chemical compound C=1C=CN2C(CC#N)=C(C)N=C2C=1OCC=1C=COC=1 UQXLVSWSVWUNBG-UHFFFAOYSA-N 0.000 description 1
- HXQXMHMWFCWBIV-UHFFFAOYSA-N 2-[8-[(4-tert-butylphenyl)methoxy]-2-methylimidazo[1,2-a]pyridin-3-yl]acetonitrile Chemical compound C=1C=CN2C(CC#N)=C(C)N=C2C=1OCC1=CC=C(C(C)(C)C)C=C1 HXQXMHMWFCWBIV-UHFFFAOYSA-N 0.000 description 1
- QSKPIOLLBIHNAC-UHFFFAOYSA-N 2-chloro-acetaldehyde Chemical compound ClCC=O QSKPIOLLBIHNAC-UHFFFAOYSA-N 0.000 description 1
- VHGICNYGRWKJLM-UHFFFAOYSA-N 2-ethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(CC)N=C2C=1OCC1=CC=CC=C1 VHGICNYGRWKJLM-UHFFFAOYSA-N 0.000 description 1
- ACZARSDEOFBECA-UHFFFAOYSA-N 2-methyl-3-nitroso-8-phenylmethoxyimidazo[1,2-a]pyridine Chemical compound C=1C=CN2C(N=O)=C(C)N=C2C=1OCC1=CC=CC=C1 ACZARSDEOFBECA-UHFFFAOYSA-N 0.000 description 1
- UVWVBMBMMJJQSB-UHFFFAOYSA-N 2-methyl-6-(2-phenylethyl)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1N2C(N)=C(C)N=C2C=CC=1CCC1=CC=CC=C1 UVWVBMBMMJJQSB-UHFFFAOYSA-N 0.000 description 1
- VZELKIFANUNAKC-UHFFFAOYSA-N 2-methyl-7-(2-phenylethyl)imidazo[1,2-a]pyridin-3-amine Chemical compound C1=CN2C(N)=C(C)N=C2C=C1CCC1=CC=CC=C1 VZELKIFANUNAKC-UHFFFAOYSA-N 0.000 description 1
- HOZMNNZTHWFDOS-UHFFFAOYSA-N 2-methyl-7-(2-phenylethyl)imidazo[1,2-a]pyridine Chemical compound C=1C2=NC(C)=CN2C=CC=1CCC1=CC=CC=C1 HOZMNNZTHWFDOS-UHFFFAOYSA-N 0.000 description 1
- VSQNZUKVKUDSBN-UHFFFAOYSA-N 2-methyl-8-(2-phenylethyl)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1CCC1=CC=CC=C1 VSQNZUKVKUDSBN-UHFFFAOYSA-N 0.000 description 1
- HZBJRTMCNSLWLW-UHFFFAOYSA-N 2-methyl-8-(thiophen-2-ylmethoxy)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=CS1 HZBJRTMCNSLWLW-UHFFFAOYSA-N 0.000 description 1
- KGCLASIXNHOQPM-UHFFFAOYSA-N 2-methyl-8-(thiophen-3-ylmethoxy)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1OCC=1C=CSC=1 KGCLASIXNHOQPM-UHFFFAOYSA-N 0.000 description 1
- XHGPTCPMERMUDA-RRABGKBLSA-N 2-methyl-8-[(e)-2-phenylethenyl]imidazo[1,2-a]pyridin-3-amine;hydrochloride Chemical compound Cl.C=1C=CN2C(N)=C(C)N=C2C=1\C=C\C1=CC=CC=C1 XHGPTCPMERMUDA-RRABGKBLSA-N 0.000 description 1
- IRUQZZZROURFAO-KTKRTIGZSA-N 2-methyl-8-[(z)-2-phenylethenyl]imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1\C=C/C1=CC=CC=C1 IRUQZZZROURFAO-KTKRTIGZSA-N 0.000 description 1
- MDKQODHFBAVQBR-UHFFFAOYSA-N 2-methyl-8-n-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine-3,8-diamine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1NCC=1C=CSC=1 MDKQODHFBAVQBR-UHFFFAOYSA-N 0.000 description 1
- PMZOKIXJLLVLEO-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyrazin-3-amine;hydrochloride Chemical compound Cl.N=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=CC=C1 PMZOKIXJLLVLEO-UHFFFAOYSA-N 0.000 description 1
- YSZXBHRFPBTLLK-UHFFFAOYSA-N 2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine;phosphoric acid Chemical compound OP(O)(O)=O.C=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=CC=C1 YSZXBHRFPBTLLK-UHFFFAOYSA-N 0.000 description 1
- KVOFEFKCFXCVFD-UHFFFAOYSA-N 3-(isocyanomethyl)-2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine Chemical compound C=1C=CN2C(C[N+]#[C-])=C(C)N=C2C=1OCC1=CC=CC=C1 KVOFEFKCFXCVFD-UHFFFAOYSA-N 0.000 description 1
- KAWHBJFDNDWFHP-UHFFFAOYSA-N 4-n-benzylpyridine-2,4-diamine Chemical compound C1=NC(N)=CC(NCC=2C=CC=CC=2)=C1 KAWHBJFDNDWFHP-UHFFFAOYSA-N 0.000 description 1
- JFVBCXHSPKJLRP-UHFFFAOYSA-N 4-oxopentanenitrile Chemical compound CC(=O)CCC#N JFVBCXHSPKJLRP-UHFFFAOYSA-N 0.000 description 1
- RAFCWIXBEWVPGL-UHFFFAOYSA-N 4-phenylmethoxypyridin-2-amine Chemical compound C1=NC(N)=CC(OCC=2C=CC=CC=2)=C1 RAFCWIXBEWVPGL-UHFFFAOYSA-N 0.000 description 1
- AQGBGIRQMXALIK-UHFFFAOYSA-N 5-chloro-2,3-dimethylimidazo[1,2-a]pyridine;hydrobromide Chemical compound Br.C1=CC=C(Cl)N2C(C)=C(C)N=C21 AQGBGIRQMXALIK-UHFFFAOYSA-N 0.000 description 1
- MEBQEDFDOKUHEV-UHFFFAOYSA-N 8-[(4-chlorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=C(Cl)C=C1 MEBQEDFDOKUHEV-UHFFFAOYSA-N 0.000 description 1
- WGFIJGOSXKWFGN-UHFFFAOYSA-N 8-[(4-fluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1OCC1=CC=C(F)C=C1 WGFIJGOSXKWFGN-UHFFFAOYSA-N 0.000 description 1
- ARKMQJYERUXMNC-UHFFFAOYSA-N 8-n-benzyl-2-methylimidazo[1,2-a]pyridine-3,8-diamine Chemical compound C=1C=CN2C(N)=C(C)N=C2C=1NCC1=CC=CC=C1 ARKMQJYERUXMNC-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 206010061459 Gastrointestinal ulcer Diseases 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 108010079943 Pentagastrin Proteins 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 210000000683 abdominal cavity Anatomy 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001450 anions Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 229940125717 barbiturate Drugs 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229940028978 brevital Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- UVJHQYIOXKWHFD-UHFFFAOYSA-N cyclohexa-1,4-diene Chemical compound C1C=CCC=C1 UVJHQYIOXKWHFD-UHFFFAOYSA-N 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000002249 digestive system Anatomy 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 229940124274 edetate disodium Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 210000003736 gastrointestinal content Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000005236 imidazo[1,2-a]pyrazines Chemical class 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 150000002485 inorganic esters Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000004694 iodide salts Chemical group 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- FBBDOOHMGLLEGJ-UHFFFAOYSA-N methane;hydrochloride Chemical compound C.Cl FBBDOOHMGLLEGJ-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- RHMQNXNXUZLEIY-UHFFFAOYSA-N methanol;2-propan-2-yloxypropane Chemical compound OC.CC(C)OC(C)C RHMQNXNXUZLEIY-UHFFFAOYSA-N 0.000 description 1
- KDXZREBVGAGZHS-UHFFFAOYSA-M methohexital sodium Chemical compound [Na+].CCC#CC(C)C1(CC=C)C(=O)N=C([O-])N(C)C1=O KDXZREBVGAGZHS-UHFFFAOYSA-M 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- FMTXBQYYEKCPQM-UHFFFAOYSA-N n,2-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(NC)=C(C)N=C2C=1OCC1=CC=CC=C1 FMTXBQYYEKCPQM-UHFFFAOYSA-N 0.000 description 1
- UINXQXVSENFDEE-UHFFFAOYSA-N n,n-dimethyl-1-[2-methyl-7-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]methanamine Chemical compound C1=CN2C(CN(C)C)=C(C)N=C2C=C1CCC1=CC=CC=C1 UINXQXVSENFDEE-UHFFFAOYSA-N 0.000 description 1
- NGRKLTSEKIEZMT-UHFFFAOYSA-N n,n-dimethyl-1-[2-methyl-7-(2-phenylethyl)imidazo[1,2-a]pyridin-3-yl]methanamine;hydrochloride Chemical compound Cl.C1=CN2C(CN(C)C)=C(C)N=C2C=C1CCC1=CC=CC=C1 NGRKLTSEKIEZMT-UHFFFAOYSA-N 0.000 description 1
- OEKOQXWXASNJEF-UHFFFAOYSA-N n-(2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)formamide Chemical compound C=1C=CN2C(NC=O)=C(C)N=C2C=1OCC1=CC=CC=C1 OEKOQXWXASNJEF-UHFFFAOYSA-N 0.000 description 1
- XKIUGRVKLLKSCU-UHFFFAOYSA-N n-benzyl-2,3-dimethylimidazo[1,2-a]pyridin-5-amine Chemical compound N12C(C)=C(C)N=C2C=CC=C1NCC1=CC=CC=C1 XKIUGRVKLLKSCU-UHFFFAOYSA-N 0.000 description 1
- PSONOWADKCTIST-UHFFFAOYSA-N n-ethyl-2-methyl-8-(2-phenylethyl)imidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(NCC)=C(C)N=C2C=1CCC1=CC=CC=C1 PSONOWADKCTIST-UHFFFAOYSA-N 0.000 description 1
- FYNLDPXOAGIJCA-UHFFFAOYSA-N n-ethyl-2-methyl-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine Chemical compound C=1C=CN2C(NCC)=C(C)N=C2C=1OCC1=CC=CC=C1 FYNLDPXOAGIJCA-UHFFFAOYSA-N 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000002895 organic esters Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 1
- 229960000444 pentagastrin Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229940069328 povidone Drugs 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 229960005359 propylparaben sodium Drugs 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- IXMINYBUNCWGER-UHFFFAOYSA-M sodium;4-propoxycarbonylphenolate Chemical compound [Na+].CCCOC(=O)C1=CC=C([O-])C=C1 IXMINYBUNCWGER-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6561—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27757681A | 1981-06-26 | 1981-06-26 | |
| US06/356,052 US4507294A (en) | 1982-03-08 | 1982-03-08 | Imidazo[1,2-a]pyrazines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189595B true HU189595B (en) | 1986-07-28 |
Family
ID=26958574
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU822071A HU189595B (en) | 1981-06-26 | 1982-06-25 | Process for production of new imidazolo /1,2-a/ piridins and pirazins |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4450164A (OSRAM) |
| EP (1) | EP0068378B1 (OSRAM) |
| KR (1) | KR880001718B1 (OSRAM) |
| AU (1) | AU556062B2 (OSRAM) |
| DE (1) | DE3269604D1 (OSRAM) |
| DK (1) | DK284482A (OSRAM) |
| ES (1) | ES513431A0 (OSRAM) |
| FI (1) | FI73433C (OSRAM) |
| GR (1) | GR74924B (OSRAM) |
| HU (1) | HU189595B (OSRAM) |
| IE (1) | IE53324B1 (OSRAM) |
| IL (1) | IL66141A0 (OSRAM) |
| MA (1) | MA19513A1 (OSRAM) |
| MY (1) | MY8700624A (OSRAM) |
| NO (1) | NO159724C (OSRAM) |
| NZ (1) | NZ201066A (OSRAM) |
| OA (1) | OA07130A (OSRAM) |
| PT (1) | PT75115B (OSRAM) |
Families Citing this family (107)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8305245D0 (en) * | 1983-02-25 | 1983-03-30 | Fujisawa Pharmaceutical Co | Imidazo-heterocyclic compounds |
| US4507481A (en) * | 1983-07-29 | 1985-03-26 | Pennwalt Corporation | Pyrrolo[1,2-a]imidazoles and imidazo[1,2-a]pyridines |
| US4578387A (en) * | 1984-03-05 | 1986-03-25 | Eli Lilly And Company | Inotropic agents |
| GB8415540D0 (en) * | 1984-06-18 | 1984-07-25 | Fujisawa Pharmaceutical Co | Imidazoisoquinoline compounds |
| JPS61218589A (ja) * | 1985-03-26 | 1986-09-29 | Eisai Co Ltd | 5―(6―イミダゾ〔1,2―a〕ピリジニル)ピリジン誘導体 |
| DE3516458A1 (de) * | 1985-05-08 | 1986-11-13 | W. Schlafhorst & Co, 4050 Mönchengladbach | Angetriebener fadenspeicher |
| US4725601A (en) * | 1985-06-04 | 1988-02-16 | Fujisawa Pharmaceutical Co., Ltd. | Certain imidazo[1,2-a]pyridines useful in the treatment of ulcers |
| US4596872A (en) * | 1985-06-05 | 1986-06-24 | Schering A.G. | Imidazo[1,2-a]pyridines, and process for their preparation |
| EP0228006A1 (en) * | 1985-12-16 | 1987-07-08 | Fujisawa Pharmaceutical Co., Ltd. | Imidazopyridine compounds and processes for preparation thereof |
| US4727145A (en) * | 1986-09-22 | 1988-02-23 | Ortho Pharmaceutical Corporation | 2- Or 3- aryl substituted imidazo [1,2-a]pyridines |
| US4791117A (en) * | 1986-09-22 | 1988-12-13 | Ortho Pharmaceutical Corporation | 2- or 3-aryl substituted imidazo[1,2-a]pyridines and their use as calcium channel blockers |
| NZ221996A (en) * | 1986-10-07 | 1989-08-29 | Yamanouchi Pharma Co Ltd | Imidazo-pyridine derivatives and pharmaceutical compositions |
| US4831041A (en) * | 1986-11-26 | 1989-05-16 | Fujisawa Pharmaceutical Co., Ltd. | Imidazopyridine compounds and processes for preparation thereof |
| IL86269A0 (en) * | 1987-05-08 | 1988-11-15 | Byk Gulden Lomberg Chem Fab | Imidazole derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same |
| AT390438B (de) * | 1987-10-08 | 1990-05-10 | Yamanouchi Pharma Co Ltd | Neue imidazo(1,2-a)pyridinderivate und deren herstellung und diese enthaltende pharmazeutische zubereitungen |
| SE8704248D0 (sv) * | 1987-10-30 | 1987-10-30 | Haessle Ab | Medical use |
| KR910011852A (ko) * | 1989-12-04 | 1991-08-07 | 폴 디. 매튜카이티스 | 신경독 장해 치료용 이미다조[1,2-a]피리디닐알킬 화합물 |
| US5716964A (en) * | 1989-12-04 | 1998-02-10 | G.D. Searle & Co. | Tetrazolyl substituted imidazo 1,2-a!pyridinylalkyl compounds for treatment of neurotoxic injury |
| IE904346A1 (en) * | 1989-12-04 | 1991-06-05 | Searle & Co | IMIDAZO[1,2-a]PYRIDINYLALKYL COMPOUNDS FOR TREATMENT OF¹NEUROTOXIC INJURY |
| DE4010797A1 (de) * | 1990-04-04 | 1991-10-10 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, diese enthaltende mittel und deren verwendung |
| US5041442A (en) * | 1990-07-31 | 1991-08-20 | Syntex (U.S.A.) Inc. | Pyrrolo(1,2-a)pyrazines as inhibitors of gastric acid secretion |
| US5482947A (en) * | 1990-11-19 | 1996-01-09 | Talley; John J. | Retroviral protease inhibitors |
| US5475013A (en) * | 1990-11-19 | 1995-12-12 | Monsanto Company | Retroviral protease inhibitors |
| US5614522A (en) * | 1990-11-19 | 1997-03-25 | G.D. Searle & Co. | Retroviral protease inhibitors |
| US5475027A (en) * | 1990-11-19 | 1995-12-12 | G.D. Searle & Co. | Retroviral protease inhibitors |
| EP1447398A1 (en) * | 1992-05-21 | 2004-08-18 | Monsanto Company | Retroviral protease inhibitors |
| US5464843A (en) * | 1992-06-23 | 1995-11-07 | G.D. Searle & Co. | Imidazo[1,2-a]pyridinyldiacid compounds for cognitive enhancement and for treatment of cognitive disorders and neutrotoxic injury |
| DE69332002T2 (de) | 1992-08-25 | 2002-12-19 | Monsanto Co | Hydroxyethylaminosulfonamide verwendbar als Inhibitoren retroviraler Proteasen |
| US6046190A (en) * | 1992-08-25 | 2000-04-04 | G.D. Searle & Co. | Hydroxyethylamino sulphonamides useful as retroviral protease inhibitors |
| US6022994A (en) | 1992-08-25 | 2000-02-08 | G. D. Searle &. Co. | Succinoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US7141609B2 (en) * | 1992-08-25 | 2006-11-28 | G.D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5760076A (en) * | 1992-08-25 | 1998-06-02 | G.D Searle & Co. | Succinoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| CA2142998C (en) * | 1992-08-25 | 2008-01-29 | Michael L. Vazquez | N-(alkanoylamino-2-hydroxypropyl)-sulfonamides useful as retroviral protease inhibitors |
| US5968942A (en) | 1992-08-25 | 1999-10-19 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| EP0656888B1 (en) * | 1992-08-25 | 1998-01-07 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5830897A (en) * | 1992-08-27 | 1998-11-03 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonamides useful as retroviral protease inhibitors |
| US5578606A (en) * | 1992-10-30 | 1996-11-26 | G. D. Searle & Co. | α- and β-amino acid hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| US5756498A (en) * | 1992-10-30 | 1998-05-26 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| DK0810208T3 (da) | 1992-10-30 | 2002-03-18 | Monsanto Co | N-substituerede hydroxyethylamino sulfaminsyrederivater til anvendelse som inhibitorer af retrovirale proteaser |
| US6337398B1 (en) * | 1992-10-30 | 2002-01-08 | G.D. Searle & Co. | Succinoylamino hydroxyethylamino sulfonyl urea derivatives useful as retroviral protease inhibitors |
| AU5665194A (en) * | 1992-10-30 | 1994-05-24 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfamic acids useful as retroviral protease inhibitors |
| US5574042A (en) * | 1992-11-02 | 1996-11-12 | Fujisawa Pharmaceutical Co., Ltd | Imidazo [1,2-a] pyridines and their pharmaceutical use |
| US5514801A (en) * | 1992-12-29 | 1996-05-07 | Monsanto Company | Cyclic sulfone containing retroviral protease inhibitors |
| NZ266525A (en) * | 1993-07-06 | 1997-10-24 | Pfizer | 4,5,6,7-tetrahydro-1h-pyrazolo[3,4-c]pyridine derivatives and medicaments |
| US5602119A (en) * | 1993-10-29 | 1997-02-11 | Vazquez; Michael L. | Succinoylamino hydroxyethylamino sulfamic acid derivatives useful as retroviral protease inhibitors |
| US6133444A (en) * | 1993-12-22 | 2000-10-17 | Perseptive Biosystems, Inc. | Synthons for the synthesis and deprotection of peptide nucleic acids under mild conditions |
| FI970330A0 (fi) * | 1994-07-28 | 1997-01-27 | Byk Gulden Lomberg Chem Fab | Imidatsopyridiini-atsolidinonit |
| US5831117A (en) * | 1995-01-20 | 1998-11-03 | G. D. Searle & Co. | Method of preparing retroviral protease inhibitor intermediates |
| US6140505A (en) | 1995-03-10 | 2000-10-31 | G. D. Searle & Co. | Synthesis of benzo fused heterocyclic sulfonyl chlorides |
| US5756533A (en) * | 1995-03-10 | 1998-05-26 | G.D. Searle & Co. | Amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6407134B1 (en) * | 1995-03-10 | 2002-06-18 | G. D. Searle & Co. | Heterocyclecarbonyl amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| PT815124E (pt) * | 1995-03-10 | 2003-04-30 | Searle & Co | Inibidores protease retroviral sulfonamida hidroxietilamino aminoacido heterociclocarbonilo |
| US7339078B2 (en) * | 1995-03-10 | 2008-03-04 | G.D. Searle Llc | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6861539B1 (en) | 1995-03-10 | 2005-03-01 | G. D. Searle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6169085B1 (en) | 1995-03-10 | 2001-01-02 | G. D. Searle & Company | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5985870A (en) * | 1995-03-10 | 1999-11-16 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6150556A (en) | 1995-03-10 | 2000-11-21 | G. D. Dearle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| EP1188766A1 (en) | 1995-03-10 | 2002-03-20 | G.D. Searle & Co. | Bis-amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5705500A (en) * | 1995-03-10 | 1998-01-06 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US5776971A (en) * | 1995-03-10 | 1998-07-07 | G.D. Searle & Co. | Heterocyclecarbonyl amino acid hydroxyethylamino sulfonamide retroviral protease inhibitors |
| US6667307B2 (en) | 1997-12-19 | 2003-12-23 | G.D. Searle & Co. | Sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| CA2218705A1 (en) * | 1995-04-21 | 1996-10-24 | Shinnippon Pharmaceutical Inc. | Fused imidazo¬1,2-a|pyridines |
| AU7722296A (en) * | 1995-11-15 | 1997-06-05 | G.D. Searle & Co. | Substituted sulfonylalkanoylamino hydroxyethylamino sulfonamide retroviral protease inhibitors |
| KR100490790B1 (ko) * | 1997-08-11 | 2005-09-12 | 주식회사 휴비스 | 모세관냉각장치를이용한단성분중공자발권축섬유의제조방법 |
| SE9704404D0 (sv) * | 1997-11-28 | 1997-11-28 | Astra Ab | New compounds |
| SE9801526D0 (sv) | 1998-04-29 | 1998-04-29 | Astra Ab | New compounds |
| AU4862799A (en) | 1998-07-08 | 2000-02-01 | G.D. Searle & Co. | Retroviral protease inhibitors |
| SE9802793D0 (sv) | 1998-08-21 | 1998-08-21 | Astra Ab | New compounds |
| SE9802794D0 (sv) * | 1998-08-21 | 1998-08-21 | Astra Ab | New compounds |
| DE19948437A1 (de) * | 1999-10-08 | 2001-06-07 | Gruenenthal Gmbh | Am Sechsring substituierte, bicyclische Imidazo-3-aminderivate |
| ES2213611T3 (es) | 1999-10-08 | 2004-09-01 | Grunenthal Gmbh | Derivados biciclicos de imidazo-3-il-amina. |
| DK1218380T3 (da) | 1999-10-08 | 2004-03-15 | Gruenenthal Gmbh | Bicykliske imidazo-3-yl-aminoderivater substitueret i seksledsringen |
| DE19948434A1 (de) * | 1999-10-08 | 2001-06-07 | Gruenenthal Gmbh | Substanzbibliothek enthaltend bicyclische Imidazo-5-amine und/oder bicyclische Imidazo-3-amine |
| DE10019714A1 (de) | 2000-04-20 | 2002-01-10 | Gruenenthal Gmbh | Salze von bicyclischen, N-acylierten Imidazo-3-aminen und Imidazo-5-aminen |
| CA2311483A1 (en) * | 2000-06-12 | 2001-12-12 | Gregory N Beatch | IMIDAZO [1,2-A] PYRIDINIC ETHERS AND USES THEREOF |
| SE0003186D0 (sv) * | 2000-09-07 | 2000-09-07 | Astrazeneca Ab | New process |
| US6900324B2 (en) | 2000-09-07 | 2005-05-31 | Astrazeneca Ab | Process for preparing a substituted imidazopyridine compound |
| DE10050663A1 (de) * | 2000-10-13 | 2002-04-18 | Gruenenthal Gmbh | Verwendung von substituierten Imidazo[1,2-a]pyridin-, -pyrimidin- und pyrazin-3-yl-amin-Derivaten zur Herstellung von Medikamenten zur NOS-Inhibierung |
| UA80393C2 (uk) | 2000-12-07 | 2007-09-25 | Алтана Фарма Аг | Фармацевтична композиція, яка містить інгібітор фде 4, диспергований в матриці |
| TWI312347B (en) | 2001-02-08 | 2009-07-21 | Eisai R&D Man Co Ltd | Bicyclic nitrogen-containing condensed ring compounds |
| IL157461A0 (en) * | 2001-03-08 | 2004-03-28 | Astrazeneca Ab Astrazeneca Ab | Use of carboxamido imidazo [1,2] pyridine deivatives in the preparation of medicaments for treating or preventing gastric ulcer |
| DE10117183A1 (de) * | 2001-04-05 | 2002-10-10 | Gruenenthal Gmbh | Verwendung von substituierten Imidazo[1,2-a]-pyridinverbindungen als Arzneimittel |
| DE10117184A1 (de) * | 2001-04-05 | 2002-10-17 | Gruenenthal Gmbh | Substituierte Imidazol[1,2-a]-pyridin-3-yl-amid- und -aminverbindungen |
| SE0102808D0 (sv) * | 2001-08-22 | 2001-08-22 | Astrazeneca Ab | New compounds |
| DE10145457A1 (de) | 2001-09-14 | 2003-04-03 | Basf Ag | Substituierte Imidazo[1,2-a]-5,6,7,8-tetrahydropyridin-8-one, Verfahren zu ihrer Herstellung, sowie deren Verwendung zur Herstellung von Imidazo[1,2,-a]pyridinen |
| MY140561A (en) * | 2002-02-20 | 2009-12-31 | Nycomed Gmbh | Dosage form containing pde 4 inhibitor as active ingredient |
| ME00524B (me) | 2003-03-10 | 2011-10-10 | Astrazeneca Ab | Novi postupak za dobijanje roflumilasta |
| SE0301904D0 (sv) * | 2003-06-26 | 2003-06-26 | Astrazeneca Ab | Novel imidazopyridine compound II with therapeutic effect |
| US20050064076A1 (en) * | 2003-09-22 | 2005-03-24 | Fmc Technologies, Inc. | Method of measuring volatile components of foods |
| DE102004021716A1 (de) * | 2004-04-30 | 2005-12-01 | Grünenthal GmbH | Substituierte Imidazo[1,2-a]pyridin-Verbindungen und Arzneimittel enthaltend substituierte Imidazo[1,2-a]pyridin-Verbindungen |
| US7662832B2 (en) * | 2004-09-03 | 2010-02-16 | Yuhan Corporation | Pyrrolo[2,3-c]pyridine derivatives and processes for the preparation thereof |
| PL1784402T3 (pl) | 2004-09-03 | 2011-12-30 | Yuhan Corp | Pochodne pirolo[3,2-c]pirydyny oraz sposoby ich wytwarzania |
| ES2426920T3 (es) | 2004-09-03 | 2013-10-25 | Yuhan Corporation | Derivados de pirrolo[3,2-B]piridina y procesos para su preparación |
| AU2005280739B2 (en) * | 2004-09-03 | 2010-11-11 | Yuhan Corporation | Pyrrolo[3,2-c]pyridine derivatives and processes for the preparation thereof |
| EP1861074B1 (en) * | 2005-03-16 | 2013-04-24 | Takeda GmbH | Taste masked dosage form containing roflumilast |
| WO2008015196A1 (en) * | 2006-07-31 | 2008-02-07 | Nycomed Gmbh | 5-,7-bis-substituted imidazo[1,2-a]pyridines |
| ES2396126T3 (es) | 2008-04-15 | 2013-02-19 | Eisai R&D Management Co., Ltd. | Compuesto de 3-fenilpirazol[5,1-b]tiazol |
| WO2010017047A1 (en) * | 2008-08-05 | 2010-02-11 | Merck & Co., Inc. | Therapeutic compounds |
| WO2010032195A1 (en) * | 2008-09-16 | 2010-03-25 | Csir | Imidazopyridines and imidazopyrimidines as hiv-i reverse transcriptase inhibitors |
| FI20086158A0 (fi) | 2008-12-03 | 2008-12-03 | Mikael Dahlstroem | Imidatsopyridiinijohdannaiset |
| AU2010284254B2 (en) | 2009-08-17 | 2015-09-17 | Intellikine, Llc | Heterocyclic compounds and uses thereof |
| AR078521A1 (es) | 2009-10-08 | 2011-11-16 | Eisai R&D Man Co Ltd | Compuesto pirazolotiazol |
| US8722026B2 (en) * | 2010-01-06 | 2014-05-13 | Elc Management, Llc | Skin lightening compositions |
| WO2013071272A1 (en) * | 2011-11-11 | 2013-05-16 | Intellikine, Llc | Kinase inhibitor polymorphs |
| CN104619707A (zh) | 2012-07-31 | 2015-05-13 | 协和发酵麒麟株式会社 | 稠环杂环化合物 |
| EP3801069A4 (en) | 2018-06-01 | 2022-03-16 | Cornell University | MULTIPLE THERAPY FOR DISEASE OR DISORDER ASSOCIATED WITH PI3K |
| EP4596548A1 (en) * | 2024-02-05 | 2025-08-06 | Ludwig-Maximilians-Universität | Nurr1 modulators |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3701780A (en) * | 1970-09-18 | 1972-10-31 | Merck & Co Inc | Imidazo(1,2-a)pyridines |
| US4044015A (en) * | 1975-09-03 | 1977-08-23 | Pfizer Inc. | Imidazopyridinium compounds as hypoglycemic agents |
| US4177274A (en) * | 1975-12-09 | 1979-12-04 | Merck & Co., Inc. | Substituted imidazo [1,2-a] pyridines |
| US4092321A (en) * | 1977-06-16 | 1978-05-30 | Merck & Co., Inc. | Process for the preparation of imidazo [1,2-a] pyridines |
| US4221796A (en) * | 1979-09-19 | 1980-09-09 | E. R. Squibb & Sons, Inc. | Substituted imidazolo-pyridines and method |
| ZA81219B (en) * | 1980-01-23 | 1982-01-27 | Schering Corp | Imidazo (1,2-a) pyridines ,process for their preparation and pharmaceutical compositions containing them |
-
1982
- 1982-06-21 DE DE8282105411T patent/DE3269604D1/de not_active Expired
- 1982-06-21 EP EP82105411A patent/EP0068378B1/en not_active Expired
- 1982-06-24 OA OA57720A patent/OA07130A/xx unknown
- 1982-06-24 NZ NZ201066A patent/NZ201066A/en unknown
- 1982-06-24 GR GR68556A patent/GR74924B/el unknown
- 1982-06-24 PT PT75115A patent/PT75115B/pt not_active IP Right Cessation
- 1982-06-24 NO NO822128A patent/NO159724C/no unknown
- 1982-06-24 DK DK284482A patent/DK284482A/da not_active Application Discontinuation
- 1982-06-24 FI FI822266A patent/FI73433C/fi not_active IP Right Cessation
- 1982-06-24 MA MA19720A patent/MA19513A1/fr unknown
- 1982-06-24 AU AU85178/82A patent/AU556062B2/en not_active Ceased
- 1982-06-24 IE IE1515/82A patent/IE53324B1/en not_active IP Right Cessation
- 1982-06-25 KR KR8202835A patent/KR880001718B1/ko not_active Expired
- 1982-06-25 HU HU822071A patent/HU189595B/hu not_active IP Right Cessation
- 1982-06-25 ES ES513431A patent/ES513431A0/es active Granted
- 1982-06-25 IL IL66141A patent/IL66141A0/xx not_active IP Right Cessation
- 1982-12-20 US US06/450,885 patent/US4450164A/en not_active Expired - Lifetime
-
1987
- 1987-12-30 MY MY624/87A patent/MY8700624A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KR840000546A (ko) | 1984-02-25 |
| NO159724C (no) | 1989-02-01 |
| ES8307806A1 (es) | 1983-08-01 |
| DK284482A (da) | 1982-12-27 |
| FI822266L (fi) | 1982-12-27 |
| AU8517882A (en) | 1983-01-06 |
| MY8700624A (en) | 1987-12-31 |
| KR880001718B1 (ko) | 1988-09-08 |
| FI73433B (fi) | 1987-06-30 |
| FI822266A0 (fi) | 1982-06-24 |
| PT75115B (en) | 1985-06-28 |
| US4450164A (en) | 1984-05-22 |
| IE53324B1 (en) | 1988-10-12 |
| OA07130A (fr) | 1984-03-31 |
| MA19513A1 (fr) | 1982-12-31 |
| IE821515L (en) | 1982-12-26 |
| ES513431A0 (es) | 1983-08-01 |
| FI73433C (fi) | 1987-10-09 |
| IL66141A0 (en) | 1982-09-30 |
| EP0068378A1 (en) | 1983-01-05 |
| PT75115A (en) | 1982-07-01 |
| NO822128L (no) | 1982-12-27 |
| GR74924B (OSRAM) | 1984-07-12 |
| EP0068378B1 (en) | 1986-03-05 |
| AU556062B2 (en) | 1986-10-23 |
| NZ201066A (en) | 1985-08-16 |
| NO159724B (no) | 1988-10-24 |
| DE3269604D1 (en) | 1986-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189595B (en) | Process for production of new imidazolo /1,2-a/ piridins and pirazins | |
| KR850000240B1 (ko) | 이미다조[1,2-a]피리딘의 제조방법 | |
| US4725601A (en) | Certain imidazo[1,2-a]pyridines useful in the treatment of ulcers | |
| EP0535529B1 (en) | Indole derivatives and anti-ulcer compositions | |
| RU2136682C1 (ru) | Имидазопиридины, способ их получения, фармацевтическая композиция на их основе и способ получения фармацевтической композиции | |
| SK61594A3 (en) | Proteolitic enzyme inhibitors on saccharine derivatives basis | |
| JPH0366311B2 (OSRAM) | ||
| HU201550B (en) | Process for producing 1,8-naphthyridine derivatives with twin ionic structure and pharmaceutical compositions comprising same | |
| WO1993016076A1 (en) | 3-(1h^_-tetrazol-5-yl)-4h^_-pyrido[1,2-a^_]pyrimidine-4-ones, pharmaceutical compositions containing the same and the preparation thereof | |
| CA1202630A (en) | Imidazo¬1,2-a|pyrazines | |
| EP0243311B1 (en) | Pyrido[2,3-d]pyrimidine derivatives | |
| HU196408B (en) | Process for producing tetrahydro-imidazo-quinazolines and stimulators of cardiac action containing them | |
| HK24194A (en) | Pyrrolo[1,2-a][4,1]benzoxazepines, process for their preparation, pharmaceutical compositions containing these compounds and therapeutical use | |
| JPH044318B2 (OSRAM) | ||
| US4798832A (en) | Pyrido[1,2-a]pyrimidine compounds, corresponding intermediates and use as SRS-A antagonists | |
| EP0522494B1 (en) | Novel isatineoxime derivatives, their preparation and use | |
| US5015636A (en) | Thiazetidine compounds | |
| JPH0248587A (ja) | 複素環置換ビスフォスフォン酸誘導体及びその医薬 | |
| EP0026675B1 (en) | 1-azaxanthone-3-carboxylic acids, their preparation and pharmaceutical compositions containing them | |
| JPH0386884A (ja) | ベンゾピラノピリジン誘導体 | |
| US3917835A (en) | A method of preventing asthmatic symptoms | |
| US4588526A (en) | Bronchodilatory azepino(1,2-A)pyrimidine derivatives and acid addition salts thereof and bronchodilating pharmaceutical compositions containing same | |
| HU200768B (en) | Process for producing aryl-substituted naphthyridine derivatives an dpharmaceutical compositions comprising same | |
| EP0107165A1 (en) | Substituted 9H-8-oxo-pyrimido(2,1-f)purine-2,4-diones, process for their production and pharmaceutical compositions containing them | |
| JPH03264585A (ja) | イミダゾキノロン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |