HU186753B - Process for producing 7-acylamino-3-vinyl-ceph-3-eme-4-carboxylic acid derivatives - Google Patents
Process for producing 7-acylamino-3-vinyl-ceph-3-eme-4-carboxylic acid derivatives Download PDFInfo
- Publication number
- HU186753B HU186753B HU802757A HU275780A HU186753B HU 186753 B HU186753 B HU 186753B HU 802757 A HU802757 A HU 802757A HU 275780 A HU275780 A HU 275780A HU 186753 B HU186753 B HU 186753B
- Authority
- HU
- Hungary
- Prior art keywords
- substituted
- formula
- group
- alkoxycarbonyl
- amino
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 314
- -1 aminothiazolyl Chemical group 0.000 claims abstract description 613
- 150000001875 compounds Chemical class 0.000 claims abstract description 535
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 221
- 238000002360 preparation method Methods 0.000 claims abstract description 107
- 239000002253 acid Substances 0.000 claims abstract description 66
- 125000001424 substituent group Chemical group 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims description 346
- 238000006243 chemical reaction Methods 0.000 claims description 181
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 127
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims description 104
- 125000000217 alkyl group Chemical group 0.000 claims description 102
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 75
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 59
- 125000003277 amino group Chemical group 0.000 claims description 59
- 125000006239 protecting group Chemical group 0.000 claims description 39
- 125000005843 halogen group Chemical group 0.000 claims description 36
- 125000001475 halogen functional group Chemical group 0.000 claims description 33
- 125000004043 oxo group Chemical group O=* 0.000 claims description 28
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 27
- 229910052736 halogen Inorganic materials 0.000 claims description 26
- 125000003342 alkenyl group Chemical group 0.000 claims description 25
- 230000002829 reductive effect Effects 0.000 claims description 21
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 19
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 19
- 125000004423 acyloxy group Chemical group 0.000 claims description 19
- 125000004076 pyridyl group Chemical group 0.000 claims description 17
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 15
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 15
- 239000000463 material Substances 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000001476 phosphono group Chemical class [H]OP(*)(=O)O[H] 0.000 claims description 11
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000004093 cyano group Chemical class *C#N 0.000 claims description 4
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- WHLAXDUXKMECTM-UHFFFAOYSA-N oxadiazol-4-amine Chemical class NC1=CON=N1 WHLAXDUXKMECTM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 10
- 125000000304 alkynyl group Chemical group 0.000 claims 10
- 125000000335 thiazolyl group Chemical group 0.000 claims 5
- 125000000229 (C1-C4)alkoxy group Chemical class 0.000 claims 3
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical class 0.000 claims 3
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims 3
- 125000003282 alkyl amino group Chemical group 0.000 claims 2
- 238000003776 cleavage reaction Methods 0.000 claims 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 2
- 125000001715 oxadiazolyl group Chemical group 0.000 claims 2
- 230000007017 scission Effects 0.000 claims 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims 2
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 claims 1
- PIEXCQIOSMOEOU-UHFFFAOYSA-N 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Br)C(=O)N(Cl)C1=O PIEXCQIOSMOEOU-UHFFFAOYSA-N 0.000 claims 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052796 boron Inorganic materials 0.000 claims 1
- 125000004181 carboxyalkyl group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 145
- 239000003937 drug carrier Substances 0.000 abstract description 2
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 abstract 1
- 239000004615 ingredient Substances 0.000 abstract 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 501
- 239000000243 solution Substances 0.000 description 208
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 190
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 167
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 150
- 238000005481 NMR spectroscopy Methods 0.000 description 138
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 135
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 131
- 239000002904 solvent Substances 0.000 description 129
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 117
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 112
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 98
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 97
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 94
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 78
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 71
- 239000011541 reaction mixture Substances 0.000 description 71
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 60
- 239000011780 sodium chloride Substances 0.000 description 58
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 57
- 238000003756 stirring Methods 0.000 description 56
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 56
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- 238000001816 cooling Methods 0.000 description 54
- 238000001914 filtration Methods 0.000 description 54
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 52
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 48
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 47
- 235000017557 sodium bicarbonate Nutrition 0.000 description 47
- 239000007864 aqueous solution Substances 0.000 description 45
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 39
- 230000007062 hydrolysis Effects 0.000 description 37
- 238000006460 hydrolysis reaction Methods 0.000 description 37
- 239000002585 base Substances 0.000 description 36
- 239000002244 precipitate Substances 0.000 description 36
- 238000006722 reduction reaction Methods 0.000 description 35
- 235000019441 ethanol Nutrition 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 33
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 31
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 29
- 239000000725 suspension Substances 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 26
- 239000000706 filtrate Substances 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 22
- 239000012267 brine Substances 0.000 description 22
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 22
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 22
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 20
- 239000010410 layer Substances 0.000 description 19
- 238000010438 heat treatment Methods 0.000 description 18
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 18
- 235000019341 magnesium sulphate Nutrition 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 17
- 239000012044 organic layer Substances 0.000 description 17
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- 239000007858 starting material Substances 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 16
- 239000003795 chemical substances by application Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 13
- BTGFRKOQMXVJTO-ACGHUIMASA-N benzhydryl (6r)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC(C=C)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 BTGFRKOQMXVJTO-ACGHUIMASA-N 0.000 description 13
- 239000003480 eluent Substances 0.000 description 13
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- 229910052708 sodium Inorganic materials 0.000 description 13
- 230000002411 adverse Effects 0.000 description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- 238000010531 catalytic reduction reaction Methods 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- 235000009518 sodium iodide Nutrition 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 239000003638 chemical reducing agent Substances 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- 229920002554 vinyl polymer Polymers 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 9
- 238000005406 washing Methods 0.000 description 9
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000007796 conventional method Methods 0.000 description 8
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 7
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 150000007942 carboxylates Chemical class 0.000 description 7
- 238000010828 elution Methods 0.000 description 7
- 239000002198 insoluble material Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 6
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 6
- 229940126062 Compound A Drugs 0.000 description 6
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000002178 crystalline material Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000004108 freeze drying Methods 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 244000005700 microbiome Species 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 6
- 238000001179 sorption measurement Methods 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- BYZFLPNJLJGOHB-SSDOTTSWSA-N (6r)-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=C(C=C)CS[C@@H]2CC(=O)N12 BYZFLPNJLJGOHB-SSDOTTSWSA-N 0.000 description 5
- GQLGFBRMCCVQLU-XCGJVMPOSA-N (6r)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C=C)=C(C(O)=O)N2C(=O)C(N)[C@H]21 GQLGFBRMCCVQLU-XCGJVMPOSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- 229920001817 Agar Polymers 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 5
- 239000008272 agar Substances 0.000 description 5
- 230000000845 anti-microbial effect Effects 0.000 description 5
- PGRIZKHTKNBWQC-FBLFFUNLSA-N benzhydryl (6r)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)N)CC(C=C)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 PGRIZKHTKNBWQC-FBLFFUNLSA-N 0.000 description 5
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 5
- PELJISAVHGXLAL-UHFFFAOYSA-N iodomethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCI PELJISAVHGXLAL-UHFFFAOYSA-N 0.000 description 5
- IFZADQLLMDQVOK-UHFFFAOYSA-N iodomethyl hexanoate Chemical compound CCCCCC(=O)OCI IFZADQLLMDQVOK-UHFFFAOYSA-N 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- JPJMIBGVCGNFQD-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CSC(NC=O)=N1 JPJMIBGVCGNFQD-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 244000000010 microbial pathogen Species 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 4
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 4
- 210000002966 serum Anatomy 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- MXJGKTHZWIGRJG-UHFFFAOYSA-N tert-butyl 2-aminooxyacetate Chemical compound CC(C)(C)OC(=O)CON MXJGKTHZWIGRJG-UHFFFAOYSA-N 0.000 description 4
- QQWYQAQQADNEIC-UHFFFAOYSA-N tert-butyl [[cyano(phenyl)methylidene]amino] carbonate Chemical compound CC(C)(C)OC(=O)ON=C(C#N)C1=CC=CC=C1 QQWYQAQQADNEIC-UHFFFAOYSA-N 0.000 description 4
- QTOIPIFTAQLPBI-AZMWARKLSA-N (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)-2-oxoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=O QTOIPIFTAQLPBI-AZMWARKLSA-N 0.000 description 3
- NTKITAKSHBYOSM-HTCLMOQTSA-N (6R)-7-[[(2R)-2-amino-2-[3-(methanesulfonamido)phenyl]acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CS(=O)(=O)NC=1C=C(C=CC=1)[C@@H](N)C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O NTKITAKSHBYOSM-HTCLMOQTSA-N 0.000 description 3
- BFCOEPIZRLNQOP-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCC BFCOEPIZRLNQOP-LNUXAPHWSA-N 0.000 description 3
- USEZCSSBFVPIRD-RKSKCOGQSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=O USEZCSSBFVPIRD-RKSKCOGQSA-N 0.000 description 3
- WDRQUKXWSOKKPI-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-5-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC WDRQUKXWSOKKPI-WCRCJTMVSA-N 0.000 description 3
- MRNNTEICRISHRW-RKSKCOGQSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-5-yl)-2-oxoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=O MRNNTEICRISHRW-RKSKCOGQSA-N 0.000 description 3
- SGWIRMONYCAJIS-FFFFSGIJSA-N (6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 SGWIRMONYCAJIS-FFFFSGIJSA-N 0.000 description 3
- OSXTVLVJPILWKJ-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-5-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CN=C(NC=O)S1 OSXTVLVJPILWKJ-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CLMSHAWYULIVFQ-UHFFFAOYSA-N 3-bromo-3h-2-benzofuran-1-one Chemical compound C1=CC=C2C(Br)OC(=O)C2=C1 CLMSHAWYULIVFQ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 239000004599 antimicrobial Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 3
- 125000004953 trihalomethyl group Chemical group 0.000 description 3
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 2
- NRRJNSWNWIDHOX-YHYXMXQVSA-N (2z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CO\N=C(/C(O)=O)C1=CSC(NC=O)=N1 NRRJNSWNWIDHOX-YHYXMXQVSA-N 0.000 description 2
- LVLKIEASQWTQIP-HNHGDDPOSA-N (6R)-4-acetamido-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)NC1S[C@H]2N(C(=C1C=C)C(=O)O)C(C2)=O LVLKIEASQWTQIP-HNHGDDPOSA-N 0.000 description 2
- FBOOBJJGDFHWBR-WCRCJTMVSA-N (6R)-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound BrCC(C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC)=O FBOOBJJGDFHWBR-WCRCJTMVSA-N 0.000 description 2
- QOYSWOAUSSQDIV-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC QOYSWOAUSSQDIV-WCRCJTMVSA-N 0.000 description 2
- JAYHGNUWZAORPU-JOPIAHFSSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCC#C JAYHGNUWZAORPU-JOPIAHFSSA-N 0.000 description 2
- CINZORVEHKSRPE-JLOHTSLTSA-N (6r)-3-ethenyl-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(NS(=O)(=O)C)=NC=C1CC(=O)NC1C(=O)N2C(C(O)=O)=C(C=C)CS[C@@H]21 CINZORVEHKSRPE-JLOHTSLTSA-N 0.000 description 2
- OKBVVJOGVLARMR-LNUXAPHWSA-N (6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(N)=NC(C(=NOCC(O)=O)C(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 OKBVVJOGVLARMR-LNUXAPHWSA-N 0.000 description 2
- WSZXBFBFPBNIOA-QHDYGNBISA-N (6r)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O1C(N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=N1 WSZXBFBFPBNIOA-QHDYGNBISA-N 0.000 description 2
- ADOSUHWVMDGLTM-FFFFSGIJSA-N (6r)-7-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(N=C(N)N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 ADOSUHWVMDGLTM-FFFFSGIJSA-N 0.000 description 2
- KUBXPWLGSNSBBJ-WZQIAMPNSA-N (6r)-7-[[2-amino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(C=C)=C(C(O)=O)N1C(=O)C2NC(=O)C(N)C1=CSC(N)=N1 KUBXPWLGSNSBBJ-WZQIAMPNSA-N 0.000 description 2
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 2
- MIQVBIPMKVXPQU-UHFFFAOYSA-N 1-bromopropyl acetate Chemical compound CCC(Br)OC(C)=O MIQVBIPMKVXPQU-UHFFFAOYSA-N 0.000 description 2
- GHWSFUSUGMWNJF-LMNIDFBRSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-(2,2-dimethylpropanoyloxymethoxy)-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)(C)C)=O)C1=O)=NOCC(=O)OCOC(C(C)(C)C)=O GHWSFUSUGMWNJF-LMNIDFBRSA-N 0.000 description 2
- BYQJXEMWLLKXJZ-LRHAYUFXSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)(C)C)=O)C1=O)=NOC BYQJXEMWLLKXJZ-LRHAYUFXSA-N 0.000 description 2
- RENVOXJYXKMTBE-XCWJXAQQSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)(C)C)=O)C1=O)=NOCC#C RENVOXJYXKMTBE-XCWJXAQQSA-N 0.000 description 2
- BTCWPJXTCHZMSU-FQNRMIAFSA-N 2,2-dimethylpropanoyloxymethyl (6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@H]2SCC(=C(N2C1=O)C(=O)OCOC(=O)C(C)(C)C)C=C)NC(=O)CC1=CSC(N)=N1 BTCWPJXTCHZMSU-FQNRMIAFSA-N 0.000 description 2
- UMHFTJGIBNPSAS-UHFFFAOYSA-N 2-(2-ethoxy-2-oxoethyl)-1,3-thiazole-4-carboxylic acid Chemical compound CCOC(=O)CC1=NC(C(O)=O)=CS1 UMHFTJGIBNPSAS-UHFFFAOYSA-N 0.000 description 2
- DZHCLSJNGFRJDQ-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(pyridin-2-ylmethoxyimino)acetic acid Chemical compound C=1SC(NC=O)=NC=1C(C(=O)O)=NOCC1=CC=CC=N1 DZHCLSJNGFRJDQ-UHFFFAOYSA-N 0.000 description 2
- ROIHZRQIRKHJJE-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-5-yl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CN=C(NC=O)S1 ROIHZRQIRKHJJE-UHFFFAOYSA-N 0.000 description 2
- VAPBURACQFWGAA-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-5-yl)acetic acid Chemical compound OC(=O)CC1=CN=C(NC=O)S1 VAPBURACQFWGAA-UHFFFAOYSA-N 0.000 description 2
- HICOXOIHOYMLQN-LRHAYUFXSA-N 2-methylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)C)=O)C1=O)=NOC HICOXOIHOYMLQN-LRHAYUFXSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- BOIPVVOTIVFJJP-RZIURPKCSA-N benzhydryl (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC BOIPVVOTIVFJJP-RZIURPKCSA-N 0.000 description 2
- VXUNWFBDAQDQNE-RZIURPKCSA-N benzhydryl (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC VXUNWFBDAQDQNE-RZIURPKCSA-N 0.000 description 2
- XWALFBXCUVUHOC-WLIBENOVSA-N benzhydryl (6R)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C1=CC=CC=C1)(=O)NC(CCCC(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)C(=O)OC(C1=CC=CC=C1)C1=CC=CC=C1 XWALFBXCUVUHOC-WLIBENOVSA-N 0.000 description 2
- AHOSLIYRFWGMSX-IFXFHICWSA-N benzhydryl (6R)-7-[[(2R)-2-amino-2-[3-(methanesulfonamido)phenyl]acetyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C)(C)(C)OC(=O)N(C([C@H](N)C1=CC(=CC=C1)NS(=O)(=O)C)=O)C1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O AHOSLIYRFWGMSX-IFXFHICWSA-N 0.000 description 2
- JRFZIKQVFZKSDR-BRUPJXTFSA-N benzhydryl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C)(C)(C)OC(=O)CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)C=1N=C(SC=1)N JRFZIKQVFZKSDR-BRUPJXTFSA-N 0.000 description 2
- ZQISJLFOAWVPHT-SQVBCBLPSA-N benzhydryl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[4-benzhydryloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOCCC(NC(=O)OC(C)(C)C)C(=O)OC(C1=CC=CC=C1)C1=CC=CC=C1 ZQISJLFOAWVPHT-SQVBCBLPSA-N 0.000 description 2
- IEFSYCPUPNZOPW-ZWAGFTRDSA-N benzhydryl (6r)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C=C)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)CC1=CN=C(NC=O)S1 IEFSYCPUPNZOPW-ZWAGFTRDSA-N 0.000 description 2
- RMZKZBHIOJMREZ-ZWAGFTRDSA-N benzhydryl (6r)-3-ethenyl-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(NS(=O)(=O)C)=NC=C1CC(=O)NC1C(=O)N2C(C(=O)OC(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C=C)CS[C@@H]21 RMZKZBHIOJMREZ-ZWAGFTRDSA-N 0.000 description 2
- YIYGHTHJFHTAEI-ITCMONMYSA-N benzhydryl (6r)-7-(benzylideneamino)-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C=C)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)N=CC1=CC=CC=C1 YIYGHTHJFHTAEI-ITCMONMYSA-N 0.000 description 2
- PBPKDMBQLUWMIO-OTOKDRCRSA-N benzhydryl (6r)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)N)CC(CCl)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 PBPKDMBQLUWMIO-OTOKDRCRSA-N 0.000 description 2
- HDYOATPRFNMLSX-ALAWQYECSA-N benzhydryl (6r)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC(CCl)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 HDYOATPRFNMLSX-ALAWQYECSA-N 0.000 description 2
- XPXILPHOACAUHF-UHFFFAOYSA-N benzhydryl 4-(1,3-dioxoisoindol-2-yl)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound O=C1C2=CC=CC=C2C(=O)N1OCCC(NC(=O)OC(C)(C)C)C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 XPXILPHOACAUHF-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- BELWWIRDPAROQG-UHFFFAOYSA-N ethyl 2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=NOC(N)=N1 BELWWIRDPAROQG-UHFFFAOYSA-N 0.000 description 2
- JMPQJKCDLCFAKT-UHFFFAOYSA-N ethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-2-yl]acetate Chemical compound CCOC(=O)CC1=NC(NC(=O)OC(C)(C)C)=CS1 JMPQJKCDLCFAKT-UHFFFAOYSA-N 0.000 description 2
- PSWRIVVSZXOSJA-UHFFFAOYSA-N ethyl 2-methoxyimino-2-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]acetate Chemical compound CCOC(=O)C(=NOC)C1=NOC(C(Cl)(Cl)Cl)=N1 PSWRIVVSZXOSJA-UHFFFAOYSA-N 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- DBPATCOBIPDQFY-JANGERMGSA-N hexanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(CCCCC)=O)C1=O)=O DBPATCOBIPDQFY-JANGERMGSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910001507 metal halide Inorganic materials 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- JNMIXMFEVJHFNY-UHFFFAOYSA-M methyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 JNMIXMFEVJHFNY-UHFFFAOYSA-M 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 2
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- NWSURGVMAIONHJ-ZHWMGRLRSA-M sodium;(6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].S1C(N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C([O-])=O)=O)=C1 NWSURGVMAIONHJ-ZHWMGRLRSA-M 0.000 description 2
- 241000894007 species Species 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- SDMNLZJVXWONEY-LLVKDONJSA-N (2r)-2-[3-(methanesulfonamido)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)C1=CC=CC(NS(C)(=O)=O)=C1 SDMNLZJVXWONEY-LLVKDONJSA-N 0.000 description 1
- NYCSZUOGZQGPTJ-MRVPVSSYSA-N (2r)-2-amino-2-[3-(methanesulfonamido)phenyl]acetic acid Chemical compound CS(=O)(=O)NC1=CC=CC([C@@H](N)C(O)=O)=C1 NYCSZUOGZQGPTJ-MRVPVSSYSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- PLFFHJWXOGYWPR-HEDMGYOXSA-N (4r)-4-[(3r,3as,5ar,5br,7as,11as,11br,13ar,13bs)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentan-1-ol Chemical compound C([C@]1(C)[C@H]2CC[C@H]34)CCC(C)(C)[C@@H]1CC[C@@]2(C)[C@]4(C)CC[C@@H]1[C@]3(C)CC[C@@H]1[C@@H](CCCO)C PLFFHJWXOGYWPR-HEDMGYOXSA-N 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- DNWGOYWPHIRKHP-LNUXAPHWSA-N (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC DNWGOYWPHIRKHP-LNUXAPHWSA-N 0.000 description 1
- VVSTXDVPBJPVSO-AZMWARKLSA-N (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=O VVSTXDVPBJPVSO-AZMWARKLSA-N 0.000 description 1
- WHTAGNVVUXCDRK-PVQCJRHBSA-N (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCC#C WHTAGNVVUXCDRK-PVQCJRHBSA-N 0.000 description 1
- KBISEHJQQIVOEZ-LNUXAPHWSA-N (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC KBISEHJQQIVOEZ-LNUXAPHWSA-N 0.000 description 1
- CWPYADXRKYDCCU-JOPIAHFSSA-N (6R)-3-ethenyl-7-[[2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCC CWPYADXRKYDCCU-JOPIAHFSSA-N 0.000 description 1
- VYOOGMLBIJSRNY-PVQCJRHBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(3-carboxypropoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCCCC(=O)O VYOOGMLBIJSRNY-PVQCJRHBSA-N 0.000 description 1
- GQBXLHAFXZBREW-XPKAQORNSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hexoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCCCCCC GQBXLHAFXZBREW-XPKAQORNSA-N 0.000 description 1
- LDPGWGOGDHDSHD-YHBRXECLSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)O LDPGWGOGDHDSHD-YHBRXECLSA-N 0.000 description 1
- RXVJLWNXADAWFI-SXMPBOCKSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrochloride Chemical compound Cl.CON=C(C(=O)NC1[C@H]2SCC(C=C)=C(N2C1=O)C(O)=O)c1csc(N)n1 RXVJLWNXADAWFI-SXMPBOCKSA-N 0.000 description 1
- UZJHFZULIIUWJQ-GZYXIPPBSA-N (6R)-7-[[2-(3-amino-3-carboxypropoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOCCC(C(=O)O)N UZJHFZULIIUWJQ-GZYXIPPBSA-N 0.000 description 1
- UYIPUJRAODEJFO-RKSKCOGQSA-N (6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1=NC(=NO1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)O)C1=O)=NOC UYIPUJRAODEJFO-RKSKCOGQSA-N 0.000 description 1
- VKCCUVXGJRQXDB-JLOHTSLTSA-N (6r)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@H]2SCC(=C(N2C1=O)C(=O)O)C=C)NC(=O)CC1=CN=C(NC=O)S1 VKCCUVXGJRQXDB-JLOHTSLTSA-N 0.000 description 1
- WCUHERJUWLNEHO-JLOHTSLTSA-N (6r)-3-ethenyl-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(NS(=O)(=O)C)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 WCUHERJUWLNEHO-JLOHTSLTSA-N 0.000 description 1
- AGAOMWQWVIJILM-FQNRMIAFSA-N (6r)-3-ethenyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@H]2SCC(=C(N2C1=O)C(=O)O)C=C)NC(=O)CC1=CC=CC=C1 AGAOMWQWVIJILM-FQNRMIAFSA-N 0.000 description 1
- MAUHLWUADQYTDD-XCGJVMPOSA-N (6r)-4-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(C=C)S[C@@H]2CC(=O)N12 MAUHLWUADQYTDD-XCGJVMPOSA-N 0.000 description 1
- KCNGQUAMALRMIS-ZHWMGRLRSA-N (6r)-7-[[2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrobromide Chemical compound Br.S1C(N=C(N)N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 KCNGQUAMALRMIS-ZHWMGRLRSA-N 0.000 description 1
- VKKAHWLHVBEMRS-JLHJGDBNSA-N (6r)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride Chemical compound Cl.S1CC(C=C)=C(C(O)=O)N2C(=O)C(N)[C@H]21 VKKAHWLHVBEMRS-JLHJGDBNSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical class 0.000 description 1
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- VYMZHNCKKCOEBG-OOKWDQIISA-N 1-acetyloxypropyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(CC)OC(C)=O)C1=O)=NOC VYMZHNCKKCOEBG-OOKWDQIISA-N 0.000 description 1
- XPDQRULPGCFCLX-UHFFFAOYSA-N 1-bromo-2,3,4,5,6-pentamethylbenzene Chemical compound CC1=C(C)C(C)=C(Br)C(C)=C1C XPDQRULPGCFCLX-UHFFFAOYSA-N 0.000 description 1
- DTBCPZTYJKUOEM-UHFFFAOYSA-N 1-butyl-2h-pyridin-1-ium-1-carboxylate Chemical compound CCCC[N+]1(C([O-])=O)CC=CC=C1 DTBCPZTYJKUOEM-UHFFFAOYSA-N 0.000 description 1
- GWKDRPNLSOEGRT-UHFFFAOYSA-N 1-chloro-2,3,4,5,6-pentamethylbenzene Chemical compound CC1=C(C)C(C)=C(Cl)C(C)=C1C GWKDRPNLSOEGRT-UHFFFAOYSA-N 0.000 description 1
- BXFRMHPLINBPCP-UHFFFAOYSA-N 1-ethyl-2h-pyridin-1-ium-1-carboxylate Chemical compound CC[N+]1(C([O-])=O)CC=CC=C1 BXFRMHPLINBPCP-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- DBGHHEXNWSAWPN-UHFFFAOYSA-M 1-ethylpyridin-1-ium;ethyl sulfate Chemical compound CCOS([O-])(=O)=O.CC[N+]1=CC=CC=C1 DBGHHEXNWSAWPN-UHFFFAOYSA-M 0.000 description 1
- UXHBVYKGPRUHKM-UHFFFAOYSA-N 1-iodo-2,3,4,5,6-pentamethylbenzene Chemical compound CC1=C(C)C(C)=C(I)C(C)=C1C UXHBVYKGPRUHKM-UHFFFAOYSA-N 0.000 description 1
- QGNLULLJNKXKOI-UHFFFAOYSA-N 1-methyl-2h-pyridin-1-ium-1-carboxylate Chemical compound [O-]C(=O)[N+]1(C)CC=CC=C1 QGNLULLJNKXKOI-UHFFFAOYSA-N 0.000 description 1
- QZJOMPYEGLQVQM-UHFFFAOYSA-M 1-methylpyridin-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]1=CC=CC=C1 QZJOMPYEGLQVQM-UHFFFAOYSA-M 0.000 description 1
- BXYPDDIROCFDFT-UHFFFAOYSA-N 1-propan-2-yl-2h-pyridin-1-ium-1-carboxylate Chemical compound CC(C)[N+]1(C([O-])=O)CC=CC=C1 BXYPDDIROCFDFT-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- ZMFDLKSICYGCOD-UHFFFAOYSA-N 1-propyl-2h-pyridin-1-ium-1-carboxylate Chemical compound CCC[N+]1(C([O-])=O)CC=CC=C1 ZMFDLKSICYGCOD-UHFFFAOYSA-N 0.000 description 1
- IKTPUTARUKSCDG-UHFFFAOYSA-N 1h-pyrazole-4,5-dicarboxylic acid Chemical compound OC(=O)C=1C=NNC=1C(O)=O IKTPUTARUKSCDG-UHFFFAOYSA-N 0.000 description 1
- WLPJORSRYZSOSK-UHFFFAOYSA-N 2,2,2-trifluoro-n-(1,3-thiazol-2-yl)acetamide Chemical compound FC(F)(F)C(=O)NC1=NC=CS1 WLPJORSRYZSOSK-UHFFFAOYSA-N 0.000 description 1
- KXHKPPRQNFCWEJ-XPKAQORNSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)(C)C)=O)C1=O)=NOCC KXHKPPRQNFCWEJ-XPKAQORNSA-N 0.000 description 1
- ZICNJYNUDSKAJF-WVQRXBFSSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C(C)(C)C)=O)C1=O)=O ZICNJYNUDSKAJF-WVQRXBFSSA-N 0.000 description 1
- LNRZCHCAPUVAOP-UHFFFAOYSA-N 2,2-diphenylhexanoic acid Chemical compound C=1C=CC=CC=1C(C(O)=O)(CCCC)C1=CC=CC=C1 LNRZCHCAPUVAOP-UHFFFAOYSA-N 0.000 description 1
- ACJRRXYMEQRCFB-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)C1=CSC(N)=N1 ACJRRXYMEQRCFB-UHFFFAOYSA-N 0.000 description 1
- APIMXAGCLCGUGB-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-5-yl)acetate Chemical compound NC1=NC=C(CC(O)=O)S1 APIMXAGCLCGUGB-UHFFFAOYSA-N 0.000 description 1
- ZXYOSQSGKOIEJY-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(pyridin-4-ylmethoxyimino)acetic acid Chemical compound C=1SC(NC=O)=NC=1C(C(=O)O)=NOCC1=CC=NC=C1 ZXYOSQSGKOIEJY-UHFFFAOYSA-N 0.000 description 1
- VGOYZRAMGMTTOP-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=CSC(NC=O)=N1 VGOYZRAMGMTTOP-UHFFFAOYSA-N 0.000 description 1
- RJMHADQKNMCXOZ-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CCCON=C(C(O)=O)C1=CSC(NC=O)=N1 RJMHADQKNMCXOZ-UHFFFAOYSA-N 0.000 description 1
- NAASCDDUCRWJFI-UHFFFAOYSA-N 2-(2-pyridin-2-ylethoxy)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1OCCC1=CC=CC=N1 NAASCDDUCRWJFI-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- OYWFLWPJHLIJJS-UHFFFAOYSA-N 2-(4-aminopyrimidin-2-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=NC=CC(N)=N1 OYWFLWPJHLIJJS-UHFFFAOYSA-N 0.000 description 1
- OOVGTXVSBWLTBN-UHFFFAOYSA-N 2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=NOC(N)=N1 OOVGTXVSBWLTBN-UHFFFAOYSA-N 0.000 description 1
- RYJNDNMLRUGSEB-UHFFFAOYSA-N 2-(5-amino-1,2,4-oxadiazol-3-yl)acetic acid Chemical compound NC1=NC(CC(O)=O)=NO1 RYJNDNMLRUGSEB-UHFFFAOYSA-N 0.000 description 1
- YOSFGDLBDAFZMZ-UHFFFAOYSA-N 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=NSC(N)=N1 YOSFGDLBDAFZMZ-UHFFFAOYSA-N 0.000 description 1
- MJNRKEYQIVUDNZ-UHFFFAOYSA-N 2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C=1N=C(NC=O)SC=1Cl MJNRKEYQIVUDNZ-UHFFFAOYSA-N 0.000 description 1
- PLNOXXFMIVONEL-UHFFFAOYSA-N 2-(pyridin-3-ylmethoxy)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1OCC1=CC=CN=C1 PLNOXXFMIVONEL-UHFFFAOYSA-N 0.000 description 1
- OKRVKSFMNWUJGJ-UHFFFAOYSA-N 2-(pyridin-4-ylmethoxy)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1OCC1=CC=NC=C1 OKRVKSFMNWUJGJ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FOYGOEJLNFZKGH-UHFFFAOYSA-N 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetic acid Chemical compound CS(=O)(=O)NC1=NC(CC(O)=O)=CS1 FOYGOEJLNFZKGH-UHFFFAOYSA-N 0.000 description 1
- CSBGYAURWPFTRE-UHFFFAOYSA-N 2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid Chemical compound CS(=O)(=O)NC1=NC=C(CC(O)=O)S1 CSBGYAURWPFTRE-UHFFFAOYSA-N 0.000 description 1
- JGZKBYLQPPVTLD-UHFFFAOYSA-N 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-2-yl]-2-oxoacetic acid Chemical compound CC(C)(C)OC(=O)NC1=CSC(C(=O)C(O)=O)=N1 JGZKBYLQPPVTLD-UHFFFAOYSA-N 0.000 description 1
- RLSDQZPOHZQAII-UHFFFAOYSA-N 2-[5-(tritylamino)tetrazol-2-yl]acetic acid Chemical compound OC(=O)CN1N=NC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 RLSDQZPOHZQAII-UHFFFAOYSA-N 0.000 description 1
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- OCAIDFZKQFECSE-UHFFFAOYSA-N 2-amino-2-(2-amino-1,3-thiazol-4-yl)acetic acid Chemical compound OC(=O)C(N)C1=CSC(N)=N1 OCAIDFZKQFECSE-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- WZPOBANFTJLEHD-UHFFFAOYSA-N 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CSC(NC=O)=N1 WZPOBANFTJLEHD-UHFFFAOYSA-N 0.000 description 1
- YNWNTRDUDTWVIN-UHFFFAOYSA-N 2-ethyl-3H-1,2-benzoxazole Chemical class C1=CC=C2ON(CC)CC2=C1 YNWNTRDUDTWVIN-UHFFFAOYSA-N 0.000 description 1
- CRPFKUKPDCBUIX-UHFFFAOYSA-N 2-ethyl-5-phenyl-1,2-oxazol-2-ium-3-sulfonate Chemical compound [O-]S(=O)(=O)C1=[N+](CC)OC(C=2C=CC=CC=2)=C1 CRPFKUKPDCBUIX-UHFFFAOYSA-N 0.000 description 1
- HDXLPNJAEMLMKU-UHFFFAOYSA-N 2-methoxyimino-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-2-yl]acetic acid Chemical compound CON=C(C(O)=O)C1=NC(NC(=O)OC(C)(C)C)=CS1 HDXLPNJAEMLMKU-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- DORVUHLSGBKION-UHFFFAOYSA-N 4-bromo-3-oxobutanamide Chemical compound NC(=O)CC(=O)CBr DORVUHLSGBKION-UHFFFAOYSA-N 0.000 description 1
- KXVSPXCGTNISAP-UHFFFAOYSA-N 4-bromo-3-oxobutanoyl bromide Chemical compound BrCC(=O)CC(Br)=O KXVSPXCGTNISAP-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- PZEMWPDUXBZKJN-UHFFFAOYSA-N 4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CCO PZEMWPDUXBZKJN-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- PTWMCAGLORDFOB-UIFSEVMZSA-N C(C1=CC=CC=C1)(C1=CC=CC=C1)OC(=O)[C@H](CC1S[C@H]2N(C=C1C=C)C(C2N)=O)NC(=O)OC(C)(C)C Chemical compound C(C1=CC=CC=C1)(C1=CC=CC=C1)OC(=O)[C@H](CC1S[C@H]2N(C=C1C=C)C(C2N)=O)NC(=O)OC(C)(C)C PTWMCAGLORDFOB-UIFSEVMZSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical class C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical class C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- XSJKKGGNWQVBTQ-UHFFFAOYSA-N P(=O)(Cl)(Cl)Cl.P(Br)(Br)(Br)(Br)Br Chemical compound P(=O)(Cl)(Cl)Cl.P(Br)(Br)(Br)(Br)Br XSJKKGGNWQVBTQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000001888 Peptone Substances 0.000 description 1
- 108010080698 Peptones Proteins 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Natural products P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- BHBYRSNSLVTNQM-SGEGDINISA-N [(6R)-2-benzhydryloxycarbonyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium chloride Chemical compound [Cl-].C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC BHBYRSNSLVTNQM-SGEGDINISA-N 0.000 description 1
- JFPIBXOYXMUAPL-IEJWPOPVSA-N [(6r)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-2-benzhydryloxycarbonyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium;iodide Chemical compound [I-].S([C@@H]12)CC(C[P+](C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC=CC=3)=C(C(=O)OC(C=3C=CC=CC=3)C=3C=CC=CC=3)N1C(=O)C2NC(=O)CCCC(C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)C1=CC=CC=C1 JFPIBXOYXMUAPL-IEJWPOPVSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- QZBADHSJCCGCCE-PVQCJRHBSA-N acetyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(C)=O)C1=O)=NOC QZBADHSJCCGCCE-PVQCJRHBSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005530 alkylenedioxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- PTOOWLSVTAQRSP-KRWDZBQOSA-N benzhydryl (2s)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound C=1C=CC=CC=1C(OC(=O)[C@H](CO)NC(=O)OC(C)(C)C)C1=CC=CC=C1 PTOOWLSVTAQRSP-KRWDZBQOSA-N 0.000 description 1
- MMYCNSPRAVYTCM-BRUPJXTFSA-N benzhydryl (6R)-3-(chloromethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C)(C)(C)OC(=O)CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CCl)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)C=1N=C(SC=1)NC=O MMYCNSPRAVYTCM-BRUPJXTFSA-N 0.000 description 1
- JJBTWNBIQVIIML-ZTDHTWSHSA-N benzhydryl (6R)-3-(chloromethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)CCl)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC JJBTWNBIQVIIML-ZTDHTWSHSA-N 0.000 description 1
- YDEPYGWVCFQWRQ-NBXNUCLWSA-N benzhydryl (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=O YDEPYGWVCFQWRQ-NBXNUCLWSA-N 0.000 description 1
- UGWJOHVDJWWDRU-HOINCLMKSA-N benzhydryl (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOCC#C UGWJOHVDJWWDRU-HOINCLMKSA-N 0.000 description 1
- HBITZMUIMJDJTN-NBXNUCLWSA-N benzhydryl (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-5-yl)-2-oxoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(=O)NC=1SC(=CN=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=O HBITZMUIMJDJTN-NBXNUCLWSA-N 0.000 description 1
- HZAKIBLYNSALSA-GJQLDDCUSA-N benzhydryl (6R)-7-[(4-bromo-3,3-diethoxy-2-methoxyiminobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound BrCC(C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC)(OCC)OCC HZAKIBLYNSALSA-GJQLDDCUSA-N 0.000 description 1
- VBCGPYLDXUKPOD-OPEAARRCSA-N benzhydryl (6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC1=NC(=NO1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O)=NOC VBCGPYLDXUKPOD-OPEAARRCSA-N 0.000 description 1
- WNNOGUYIIRNGQK-GWPCVRSZSA-N benzhydryl (6R)-7-[[2-amino-2-(2-amino-1,3-thiazol-4-yl)acetyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C)(C)(C)OC(=O)N(C(C(N)C=1N=C(SC=1)N)=O)C1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O WNNOGUYIIRNGQK-GWPCVRSZSA-N 0.000 description 1
- UEWUMBFXAKCCIX-JFTKIIHVSA-N benzhydryl (6R)-7-[[2-amino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C)(C)(C)OC(=O)N(C(C(N)C=1N=C(SC=1)NC=O)=O)C1[C@@H]2N(C(=C(CS2)C=C)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O UEWUMBFXAKCCIX-JFTKIIHVSA-N 0.000 description 1
- GZFCWBWTFNDWAO-ZWAGFTRDSA-N benzhydryl (6r)-3-ethenyl-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(NS(=O)(=O)C)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(=O)OC(C=2C=CC=CC=2)C=2C=CC=CC=2)=O)=C1 GZFCWBWTFNDWAO-ZWAGFTRDSA-N 0.000 description 1
- CKCXQIZPZRDHBQ-PIFIWZBESA-N benzhydryl (6r)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound O1C(N)=NC(CC(=O)NC2C(N3C(=C(C=C)CS[C@@H]32)C(=O)OC(C=2C=CC=CC=2)C=2C=CC=CC=2)=O)=N1 CKCXQIZPZRDHBQ-PIFIWZBESA-N 0.000 description 1
- RSIYQJCBMZQFMB-YSTIKXIDSA-N benzhydryl (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 RSIYQJCBMZQFMB-YSTIKXIDSA-N 0.000 description 1
- SNTBCIVLNRVRLF-UHFFFAOYSA-N benzhydryl 4-aminooxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C=1C=CC=CC=1C(OC(=O)C(CCON)NC(=O)OC(C)(C)C)C1=CC=CC=C1 SNTBCIVLNRVRLF-UHFFFAOYSA-N 0.000 description 1
- JNECHASMIHMFLY-UHFFFAOYSA-N benzhydryl 4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C=1C=CC=CC=1C(OC(=O)C(CCO)NC(=O)OC(C)(C)C)C1=CC=CC=C1 JNECHASMIHMFLY-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- KOFZJCYUAVPINT-UHFFFAOYSA-N butyl [[cyano(phenyl)methylidene]amino] carbonate Chemical compound CCCCOC(=O)ON=C(C#N)C1=CC=CC=C1 KOFZJCYUAVPINT-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- QGJOPFRUJISHPQ-UHFFFAOYSA-N carbon disulfide Substances S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- OKGXJRGLYVRVNE-UHFFFAOYSA-N diaminomethylidenethiourea Chemical compound NC(N)=NC(N)=S OKGXJRGLYVRVNE-UHFFFAOYSA-N 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- CRGRWBQSZSQVIE-UHFFFAOYSA-N diazomethylbenzene Chemical compound [N-]=[N+]=CC1=CC=CC=C1 CRGRWBQSZSQVIE-UHFFFAOYSA-N 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical compound C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- CSAITDDAMOOJCF-UHFFFAOYSA-N ethyl 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(NC=O)=N1 CSAITDDAMOOJCF-UHFFFAOYSA-N 0.000 description 1
- ZDFGKRZMTKBAML-UHFFFAOYSA-N ethyl 2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoacetate Chemical compound CCOC(=O)C(=O)C=1N=C(NC=O)SC=1Cl ZDFGKRZMTKBAML-UHFFFAOYSA-N 0.000 description 1
- CWYXUNNEIOKWQV-UHFFFAOYSA-N ethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-2-yl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=NC(NC(=O)OC(C)(C)C)=CS1 CWYXUNNEIOKWQV-UHFFFAOYSA-N 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- MZGFKQBLSUREHL-UHFFFAOYSA-N ethyl 2-cyano-2-methoxyiminoacetate Chemical compound CCOC(=O)C(C#N)=NOC MZGFKQBLSUREHL-UHFFFAOYSA-N 0.000 description 1
- IBHOWDPRDYMIMO-UHFFFAOYSA-N ethyl 3-amino-3-sulfanylidenepropanoate Chemical compound CCOC(=O)CC(N)=S IBHOWDPRDYMIMO-UHFFFAOYSA-N 0.000 description 1
- MHYCRLGKOZWVEF-UHFFFAOYSA-N ethyl acetate;hydrate Chemical compound O.CCOC(C)=O MHYCRLGKOZWVEF-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000004602 germ cell Anatomy 0.000 description 1
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- UKAUYVFTDYCKQA-UHFFFAOYSA-N homoserine Chemical compound OC(=O)C(N)CCO UKAUYVFTDYCKQA-UHFFFAOYSA-N 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- KWIBRJGXWFDQNU-UHFFFAOYSA-N iodomethyl 2-methylpropanoate Chemical compound CC(C)C(=O)OCI KWIBRJGXWFDQNU-UHFFFAOYSA-N 0.000 description 1
- NZDJTVSTIFYISQ-UHFFFAOYSA-N iodomethyl acetate Chemical compound CC(=O)OCI NZDJTVSTIFYISQ-UHFFFAOYSA-N 0.000 description 1
- GLQOBGUEBABWDN-UHFFFAOYSA-N iodomethyl propanoate Chemical compound CCC(=O)OCI GLQOBGUEBABWDN-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- JILPJDVXYVTZDQ-UHFFFAOYSA-N lithium methoxide Chemical compound [Li+].[O-]C JILPJDVXYVTZDQ-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- AGJSNMGHAVDLRQ-HUUJSLGLSA-N methyl (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-HUUJSLGLSA-N 0.000 description 1
- HQOQSFITXGQQDM-SSDOTTSWSA-N methyl (6R)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound COC(=O)C1=CCS[C@@H]2CC(=O)N12 HQOQSFITXGQQDM-SSDOTTSWSA-N 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 description 1
- QRPRIOOKPZSVFN-UHFFFAOYSA-M methyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 QRPRIOOKPZSVFN-UHFFFAOYSA-M 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- POOAXOGRBVEUFA-UHFFFAOYSA-N n-(1,3-thiazol-2-yl)formamide Chemical compound O=CNC1=NC=CS1 POOAXOGRBVEUFA-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- TVPSRTVMZGECAT-UHFFFAOYSA-N o-(pyridin-3-ylmethyl)hydroxylamine Chemical compound NOCC1=CC=CN=C1 TVPSRTVMZGECAT-UHFFFAOYSA-N 0.000 description 1
- GGJNRSIKHOXICL-UHFFFAOYSA-N o-(pyridin-4-ylmethyl)hydroxylamine Chemical compound NOCC1=CC=NC=C1 GGJNRSIKHOXICL-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 235000019319 peptone Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- SIPYUZHVSSUCFW-UHFFFAOYSA-M potassium;2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoacetate Chemical compound [K+].[O-]C(=O)C(=O)C=1N=C(NC=O)SC=1Cl SIPYUZHVSSUCFW-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- ATJFDHNZUXSKQF-LRHAYUFXSA-N propanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)OCOC(CC)=O)C1=O)=NOC ATJFDHNZUXSKQF-LRHAYUFXSA-N 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FOWDZVNRQHPXDO-UHFFFAOYSA-N propyl hydrogen carbonate Chemical compound CCCOC(O)=O FOWDZVNRQHPXDO-UHFFFAOYSA-N 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 229960001153 serine Drugs 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- SLFVVXVIUGDTHZ-RQMRQEGASA-M sodium (6R)-7-[(5-amino-5-carboxypentanoyl)amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC(CCCC(=O)NC1[C@@H]2N(C(=C(CS2)CO)C(=O)[O-])C1=O)C(=O)O.[Na+] SLFVVXVIUGDTHZ-RQMRQEGASA-M 0.000 description 1
- FDDKYDGZVXDLQY-SXMPBOCKSA-M sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)[O-])C1=O)=NOC.[Na+] FDDKYDGZVXDLQY-SXMPBOCKSA-M 0.000 description 1
- JDWHHLGYULDAFO-NEIGUCDHSA-M sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=C)C(=O)[O-])C1=O)=NOCC#C.[Na+] JDWHHLGYULDAFO-NEIGUCDHSA-M 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- ZFDPAZDODACYOG-UHFFFAOYSA-M sodium;[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]methanesulfonate Chemical compound [Na+].CN1C(C)=C(NCS([O-])(=O)=O)C(=O)N1C1=CC=CC=C1 ZFDPAZDODACYOG-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- JZEUUHHCDJBOBQ-SNAWJCMRSA-N tert-butyl (e)-4-aminooxybut-2-enoate Chemical compound CC(C)(C)OC(=O)\C=C\CON JZEUUHHCDJBOBQ-SNAWJCMRSA-N 0.000 description 1
- GJWISYPNGDTPOP-SNAWJCMRSA-N tert-butyl (e)-4-bromobut-2-enoate Chemical compound CC(C)(C)OC(=O)\C=C\CBr GJWISYPNGDTPOP-SNAWJCMRSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004227 thermal cracking Methods 0.000 description 1
- CGACFPIPJPCEQI-UHFFFAOYSA-N thiochloric s-acid Chemical compound SCl(=O)=O CGACFPIPJPCEQI-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- POXSDSRWVJZWCN-UHFFFAOYSA-N triphenylphosphanium;iodide Chemical compound I.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 POXSDSRWVJZWCN-UHFFFAOYSA-N 0.000 description 1
- 108010050327 trypticase-soy broth Proteins 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
- C07D257/06—Five-membered rings with nitrogen atoms directly attached to the ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/587—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with aliphatic hydrocarbon radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms, said aliphatic radicals being substituted in the alpha-position to the ring by a hetero atom, e.g. with m >= 0, Z being a singly or a doubly bound hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7939985 | 1979-11-19 | ||
| GB8004335 | 1980-02-08 | ||
| GB8012991 | 1980-04-21 | ||
| GB8022920 | 1980-07-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU186753B true HU186753B (en) | 1985-09-30 |
Family
ID=27449150
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU802757A HU186753B (en) | 1979-11-19 | 1980-11-18 | Process for producing 7-acylamino-3-vinyl-ceph-3-eme-4-carboxylic acid derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (6) | US4409214A (ref) |
| EP (3) | EP0123024B1 (ref) |
| JP (1) | JPH0710870B2 (ref) |
| AR (1) | AR248139A1 (ref) |
| AT (3) | ATE37028T1 (ref) |
| AU (1) | AU543301B2 (ref) |
| CA (1) | CA1235414A (ref) |
| DE (3) | DE3072207T2 (ref) |
| DK (1) | DK491780A (ref) |
| ES (2) | ES8204739A1 (ref) |
| FI (1) | FI74970C (ref) |
| GR (1) | GR71596B (ref) |
| HK (1) | HK11888A (ref) |
| HU (1) | HU186753B (ref) |
| IE (1) | IE53271B1 (ref) |
| MX (2) | MX158337A (ref) |
| MY (1) | MY101359A (ref) |
| NL (1) | NL930045I2 (ref) |
| NO (1) | NO160921C (ref) |
| PT (1) | PT72079B (ref) |
| SG (1) | SG61787G (ref) |
| SU (1) | SU1186087A3 (ref) |
Families Citing this family (96)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| US4731443A (en) * | 1979-11-19 | 1988-03-15 | Fujisawa Pharmaceutical Co., Ltd. | 7-acylamino-3-vinylcephalosporanic acid derivatives |
| IE53429B1 (en) * | 1981-08-03 | 1988-11-09 | Fujisawa Pharmaceutical Co | New cephem compounds and processes for preparation thereof |
| US4443374A (en) * | 1982-02-01 | 1984-04-17 | E. R. Squibb & Sons, Inc. | Process for preparing (3S)-3-[[(2-amino-4-thiazolyl)[(1-carboxy-1-methylethoxy)imino]-acetyl]amino]-2-oxo-1-azetidinesulfonic acid, and 4-substituted derivatives |
| US4546101A (en) * | 1982-09-10 | 1985-10-08 | Fujisawa Pharmaceutical Co., Ltd. | New cephem compounds useful for treating infectious diseases in human being and animals and processes for preparation thereof |
| DK162718C (da) * | 1982-09-30 | 1992-05-11 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af 7-substitueret-3-vinyl-3-cephemforbindelser |
| US4618606A (en) * | 1982-11-17 | 1986-10-21 | Toyama Chemical Co., Ltd. | Antibiotic 7-(thiazolyl)-3-(pyrazinylmethyl) or (pyridazinylmethyl) cephalosporins |
| US4609730A (en) * | 1982-11-22 | 1986-09-02 | Fujisawa Pharmaceutical Co., Ltd. | 7-[substituted imino-2-(2-aminothiazol-4-yl)-acetamido]-3(2,2-dihalovinyl or ethynyl)-3-cephem-4-carboxylic acid (syn isomers), having antimicrobial activities |
| ZM884A1 (en) * | 1983-01-28 | 1984-10-22 | Bristol Myers Co | Substituted vinyl cephalosporins |
| US4520022A (en) * | 1983-01-28 | 1985-05-28 | Bristol-Myers Company | Substituted vinyl cephalosporins |
| US4486586A (en) * | 1983-02-10 | 1984-12-04 | Bristol-Myers Company | Cephalosporin derivatives |
| CA1276929C (en) * | 1984-04-09 | 1990-11-27 | Masahisa Oka | Cephalosporin antibacterial agents |
| GB8411954D0 (en) * | 1984-05-10 | 1984-06-13 | Glaxo Group Ltd | Cephalosporin antibiotics |
| US4699979A (en) * | 1985-04-22 | 1987-10-13 | Bristol-Meyers Company | 7-amino-3-propenylcephalosporanic acid and esters thereof |
| FR2580652B1 (fr) * | 1985-04-22 | 1989-01-06 | Bristol Myers Co | Acide 7-amino-3-propenylcephalosporanique et ses esters |
| US4874856A (en) * | 1985-06-24 | 1989-10-17 | Bristol-Myers Company | 3-(substituted)propenyl-7-(aminothiazolylacetamido) ceph-3-em-4-carboxylic acids and esters thereof |
| US4708955A (en) * | 1985-06-24 | 1987-11-24 | Bristol-Myers Company | 3-(substituted)propenyl-7-aminothiazol-ylcephalosporanic acids and esters thereof |
| US4659812A (en) * | 1985-08-20 | 1987-04-21 | Bristol-Myers Company | Cephalosporin intermediates |
| US4684722A (en) * | 1986-01-06 | 1987-08-04 | E. R. Squibb & Sons, Inc. | Monosulfactams |
| US5194604A (en) * | 1990-06-29 | 1993-03-16 | E. R. Squibb & Sons, Inc. | Process and intermediates for beta-lactams having aminothiazole(iminooxyacetic acid)acetic acid sidechains |
| US5143911A (en) * | 1990-08-23 | 1992-09-01 | Bristol-Myers Squibb Company | Antibiotic c-3 di-hydroxyphenyl substituted cephalosporin compounds, compositions and method of use thereof |
| AU644518B2 (en) * | 1991-04-29 | 1993-12-09 | Labsphere, Inc. | Integrating sphere for diffuse reflectance and transmittance measurements and the like |
| US5523400A (en) * | 1993-04-16 | 1996-06-04 | Hoffmann-La Roche Inc. | Cephalosporin antibiotics |
| US6468995B1 (en) | 1993-09-09 | 2002-10-22 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| CH688319A5 (fr) * | 1994-06-03 | 1997-07-31 | Marcham Trading & Investment L | Procédé pour la préparation du céfixime trihydraté. |
| AT403049B (de) | 1995-08-14 | 1997-10-27 | Biochemie Gmbh | Abreicherung von 7-adca in 3-vinyl-aca |
| US5883247A (en) * | 1996-06-10 | 1999-03-16 | Hoffmann-La Roche Inc. | Preparation of cephem and isooxacephem derivatives |
| AT404251B (de) * | 1996-08-14 | 1998-10-27 | Biochemie Gmbh | Neues kristallines salz von cefixim |
| AT404727B (de) * | 1997-01-16 | 1999-02-25 | Biochemie Gmbh | Kristallines salz von cefixim und verfahren zu dessen herstellung |
| TW538045B (en) * | 1997-01-16 | 2003-06-21 | Biochemie Gmbh | Process for purifying cefixime |
| JP4157177B2 (ja) | 1997-06-04 | 2008-09-24 | 大塚化学ホールディングス株式会社 | 3−アルケニルセフェム化合物の製造法 |
| US6407124B1 (en) | 1998-06-18 | 2002-06-18 | Bristol-Myers Squibb Company | Carbon substituted aminothiazole inhibitors of cyclin dependent kinases |
| KR100392409B1 (ko) | 2000-03-20 | 2003-07-22 | 한미정밀화학주식회사 | 신규한 티아졸 화합물을 이용한 세팔로스포린계항생물질의 제조 방법 |
| US20060040915A1 (en) * | 2002-04-26 | 2006-02-23 | Yatendra Kumar | Process for the preparation of cefdinir |
| ITMI20020913A0 (it) * | 2002-04-29 | 2002-04-29 | Acs Dobfar Spa | Nuova forma cristallina del cefdinir |
| US6800756B2 (en) * | 2002-05-03 | 2004-10-05 | Orchid Chemicals And Pharmaceuticals, Ltd. | Method for the preparation of ceftiofur sodium and its intermediates |
| US20040002600A1 (en) * | 2002-06-20 | 2004-01-01 | Orchid Chemicals And Pharmaceuticals Limited | Process for the conversion of penam ring system to cepham ring system |
| JP2006500356A (ja) * | 2002-08-13 | 2006-01-05 | サンド・アクチエンゲゼルシヤフト | セフジニル中間体 |
| JPWO2004085443A1 (ja) * | 2003-03-24 | 2006-06-29 | ア・チ・エツセ・ドブフアル・エツセ・ピー・アー | 7−[2−(2−アミノチアゾール−4−イル)−2−ヒドロキシイミノアセトアミド−3−ビニル−3−セフェム−4−カルボン酸(シン異性体)の新規結晶およびその製造方法 |
| US20050137182A1 (en) * | 2003-06-02 | 2005-06-23 | Ramesh Dandala | Novel crystalline form of cefdinir |
| US20040242556A1 (en) * | 2003-06-02 | 2004-12-02 | Ramesh Dandala | Novel crystalline form of cefdinir |
| US7098329B2 (en) * | 2003-06-19 | 2006-08-29 | Orchid Chemicals & Pharmaceuticals Ltd. | Process for the preparation of a cephalosporin antibiotic |
| US20050113355A1 (en) * | 2003-09-12 | 2005-05-26 | Duerst Richard W. | Cefdinir pyridine salt |
| US20050059819A1 (en) * | 2003-09-12 | 2005-03-17 | Duerst Richard W. | Cefdinir pyridine salt |
| US20050059818A1 (en) * | 2003-09-12 | 2005-03-17 | Duerst Richard W. | Polymorph of a pharmaceutical |
| US20050059820A1 (en) * | 2003-09-17 | 2005-03-17 | Debashish Datta | Method for manufacture of ceftriaxone sodium |
| US20050059821A1 (en) * | 2003-09-17 | 2005-03-17 | Debashish Datta | Method for manufacture of ceftriaxone sodium |
| US20050209211A1 (en) * | 2004-03-16 | 2005-09-22 | Devalina Law | Trihemihydrate, anhydrate and novel hydrate forms of Cefdinir |
| US20060069079A1 (en) * | 2004-09-27 | 2006-03-30 | Sever Nancy E | Stable amorphous cefdinir |
| US20050245738A1 (en) * | 2004-05-03 | 2005-11-03 | Lupin Ltd | Stable bioavailable crystalline form or cefdinir and a process for the preparation thereof |
| JP2007536378A (ja) * | 2004-05-10 | 2007-12-13 | ルピン・リミテッド | 生体利用性が強化されている新規セフィキシム医薬製剤 |
| MX2007006018A (es) * | 2004-11-30 | 2007-06-07 | Astellas Pharma Inc | Suspension farmaceutica oral novedosa de cristal de cefdinir. |
| WO2006067806A1 (en) * | 2004-12-21 | 2006-06-29 | Lupin Limited | Process for the preparation of cefixime |
| EP1863822B1 (en) * | 2005-03-29 | 2009-10-14 | Hetero Drugs Limited | An improved process for the preparation of cefixime |
| US20070128268A1 (en) * | 2005-12-07 | 2007-06-07 | Herwig Jennewein | Pharmaceutical compositions comprising an antibiotic |
| WO2007119249A2 (en) | 2006-04-13 | 2007-10-25 | Lupin Limited | Pharmaceutical compositions of cefixime |
| US9233112B2 (en) | 2006-04-13 | 2016-01-12 | Lupin Limited | Pharmaceutical compositions of cefixime |
| TR200909786A1 (tr) | 2009-12-25 | 2011-07-21 | Bi̇lgi̇ç Mahmut | Sefiksim içeren efervesan tablet ve granül formülasyonu. |
| TR201000687A1 (tr) | 2010-01-29 | 2011-08-22 | Bi̇lgi̇ç Mahmut | Aktif madde olarak sefiksim ve klavulanik asit içeren efervesan formülasyonlar |
| EP2568957A1 (en) | 2010-05-14 | 2013-03-20 | Mahmut Bilgic | Pharmaceutical composition comprising cefixime and clavulanic acid derivative compound |
| JP6266978B2 (ja) | 2010-08-10 | 2018-01-24 | レンペックス・ファーマシューティカルズ・インコーポレイテッド | 環状ボロン酸エステル誘導体およびその治療的使用 |
| WO2013033461A1 (en) | 2011-08-31 | 2013-03-07 | Rempex Pharmaceuticals, Inc. | Heterocyclic boronic acid ester derivatives and therapeutic uses thereof |
| PT3616695T (pt) | 2011-09-09 | 2024-11-18 | Merck Sharp & Dohme | Ceftolozano/tazobactam para tratar infeções intrapulmonares |
| WO2013109229A1 (en) | 2012-01-18 | 2013-07-25 | Mahmut Bilgic | Tablet formulations comprising cefixime as active agent |
| US9156858B2 (en) | 2012-05-23 | 2015-10-13 | Rempex Pharmaceuticals, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| US10561675B2 (en) | 2012-06-06 | 2020-02-18 | Rempex Pharmaceuticals, Inc. | Cyclic boronic acid ester derivatives and therapeutic uses thereof |
| US8809314B1 (en) | 2012-09-07 | 2014-08-19 | Cubist Pharmacueticals, Inc. | Cephalosporin compound |
| US8476425B1 (en) | 2012-09-27 | 2013-07-02 | Cubist Pharmaceuticals, Inc. | Tazobactam arginine compositions |
| KR20150103269A (ko) | 2013-01-04 | 2015-09-09 | 렘펙스 파머수티클스 인코퍼레이티드 | 보론산 유도체 및 그의 치료적 용도 |
| US9241947B2 (en) | 2013-01-04 | 2016-01-26 | Rempex Pharmaceuticals, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| EA201591004A1 (ru) | 2013-01-04 | 2016-02-29 | Ремпекс Фармасьютикалз, Инк. | Производные бороновой кислоты и их терапевтическое применение |
| US9101638B2 (en) | 2013-01-04 | 2015-08-11 | Rempex Pharmaceuticals, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| WO2014126541A1 (en) | 2013-02-14 | 2014-08-21 | Bilgiç Mahmut | Pharmaceutical compositions used in treating bacterial infections |
| CN104004003B (zh) * | 2013-02-22 | 2016-05-25 | 广州白云山医药集团股份有限公司白云山制药总厂 | 头孢克肟衍生物及其制备方法和用途 |
| US9872906B2 (en) | 2013-03-15 | 2018-01-23 | Merck Sharp & Dohme Corp. | Ceftolozane antibiotic compositions |
| CN110279698B (zh) | 2013-03-15 | 2022-10-28 | 默沙东有限责任公司 | 头孢特咯瓒抗生素组合物 |
| US20140274990A1 (en) | 2013-03-15 | 2014-09-18 | Cubist Pharmaceuticals, Inc. | Ceftolozane pharmaceutical compositions |
| ES2800603T3 (es) | 2013-09-09 | 2021-01-04 | Merck Sharp & Dohme | Tratamiento de infecciones con ceftolozano/tazobactam en sujetos con insuficiencia renal |
| US8906898B1 (en) | 2013-09-27 | 2014-12-09 | Calixa Therapeutics, Inc. | Solid forms of ceftolozane |
| PL3604316T3 (pl) | 2014-05-05 | 2024-04-29 | Melinta Therapeutics, Inc. | Synteza soli boronianowych |
| US9687497B1 (en) | 2014-05-05 | 2017-06-27 | Rempex Pharmaceuticals, Inc. | Salts and polymorphs of cyclic boronic acid ester derivatives and therapeutic uses thereof |
| EP3145936B1 (en) | 2014-05-19 | 2020-09-30 | Qpex Biopharma, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| CN103980293B (zh) * | 2014-05-21 | 2016-08-17 | 广州白云山医药集团股份有限公司白云山化学制药厂 | 3-乙烯基-7-(噻唑甲氧亚氨基)头孢烷酸的制备方法 |
| CN104045655B (zh) * | 2014-06-23 | 2016-08-17 | 山东普洛得邦医药有限公司 | 一种抗菌素头孢母核的合成方法 |
| JP6700203B2 (ja) | 2014-07-01 | 2020-05-27 | レンペックス・ファーマシューティカルズ・インコーポレイテッド | ボロン酸誘導体およびその治療的使用 |
| CN104193765B (zh) * | 2014-08-12 | 2016-08-17 | 浙江普洛得邦制药有限公司 | 一种头孢克肟的合成方法 |
| WO2016081297A1 (en) | 2014-11-18 | 2016-05-26 | Rempex Pharmaceuticals, Inc. | Cyclic boronic acid ester derivatives and therapeutic uses thereof |
| ES2761778T3 (es) | 2014-12-19 | 2020-05-21 | Rempex Pharmaceuticals Inc | Aparato y proceso de flujo continuo para la producción de derivados de ácido borónico |
| WO2016142902A1 (en) | 2015-03-11 | 2016-09-15 | Lupin Limited | Cefixime with reduced surface area and high stability |
| US20180051041A1 (en) | 2015-03-17 | 2018-02-22 | Rempex Pharmaceuticals, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| WO2017046756A1 (en) * | 2015-09-18 | 2017-03-23 | Lupin Limited | Proxetil and axetil esters of cefixime |
| JP7060245B2 (ja) | 2016-06-30 | 2022-04-26 | キューペックス バイオファーマ, インコーポレイテッド | ボロン酸誘導体およびその治療的使用 |
| BR112020007138B1 (pt) | 2017-10-11 | 2023-03-21 | Qpex Biopharma, Inc | Derivados de ácido borônico, métodos de síntese, composição farmacêutica e uso dos mesmos |
| CA3097127A1 (en) | 2018-04-20 | 2019-10-24 | Qpex Biopharma, Inc. | Boronic acid derivatives and therapeutic uses thereof |
| CN110041346B (zh) * | 2019-04-17 | 2022-06-07 | 广东立国制药有限公司 | 一种低成本的头孢克肟的制备方法 |
| CN111592471B (zh) * | 2020-06-12 | 2023-03-21 | 济南大学 | 一种溴化反应合成头孢活性酯中间体的方法 |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1241657A (en) * | 1967-08-21 | 1971-08-04 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin compounds |
| US3994884A (en) * | 1970-01-23 | 1976-11-30 | Glaxo Laboratories Limited | 3-Vinyl-7β-(2,2-disubstituted acetamido)-cephalosporins |
| GB1342241A (en) * | 1970-01-23 | 1974-01-03 | Glaxo Lab Ltd | Cephalosporin compounds |
| US4107431A (en) * | 1970-01-23 | 1978-08-15 | Glaxo Laboratories Limited | Δ3 -3-Vinyl or substituted vinyl-4-carboxy cephalosporins |
| US4110534A (en) * | 1970-01-23 | 1978-08-29 | Glaxo Laboratories Limited | Process for the preparation of 3-vinyl and substituted vinyl cephalosporins |
| US4024134A (en) * | 1971-01-29 | 1977-05-17 | Glaxo Laboratories Limited | Syn isomers of cephalosporins having α-hydroximino- or α-acyloxyiminoacylamido groups at position-7 |
| GB1389194A (en) | 1971-01-29 | 1975-04-03 | Glaxo Lab Ltd | Antibiotics |
| GB1445979A (en) | 1972-10-25 | 1976-08-11 | Glaxo Lab Ltd | Cephalosporin derivatives |
| GB1399088A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
| GB1575803A (en) * | 1976-03-09 | 1980-10-01 | Fujisawa Pharmaceutical Co | 3,7 disubstituted 3 cephem 4 carboxylic acid compounds andprocesses for the preparation thereof |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| PH17188A (en) | 1977-03-14 | 1984-06-14 | Fujisawa Pharmaceutical Co | New cephem and cepham compounds and their pharmaceutical compositions and method of use |
| SE439312B (sv) * | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| US4255423A (en) * | 1977-07-27 | 1981-03-10 | Merck & Co., Inc. | Cephalosporin compounds |
| IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
| DE2758001A1 (de) * | 1977-12-24 | 1979-07-12 | Hoechst Ag | Cephalosporinderivate und verfahren zu ihrer herstellung |
| FR2387235A1 (fr) * | 1978-01-23 | 1978-11-10 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 3,7-disubstitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, ayant une forte activite antibacterienne |
| SE448379B (sv) * | 1978-03-31 | 1987-02-16 | Roussel Uclaf | O-substituerade oximderivat av 7-amino-tiazolyl-acetamidocefalosporansyra |
| US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
| US4305937A (en) * | 1978-08-17 | 1981-12-15 | Fujisawa Pharmaceutical Co., Ltd. | 2-Lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds and antibacterial pharmaceutical compositions containing them |
| US4703046A (en) * | 1978-09-08 | 1987-10-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and processes for preparation thereof |
| GB2033377B (en) * | 1978-09-11 | 1983-05-05 | Fujisawa Pharmaceuticalco Ltd | Cephem compounds and processes for preparation thereof |
| EP0009671B1 (en) * | 1978-09-12 | 1984-06-13 | Fujisawa Pharmaceutical Co., Ltd. | Starting compounds for preparing cephem compounds and processes for their preparation |
| US4220761A (en) * | 1978-09-12 | 1980-09-02 | Fujisawa Pharmaceutical Co., Ltd. | 7-[Substituted oximinoacetamido]-3-[hydroxy alkyltetrazolo]cephalosporin derivatives |
| US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| US4266049A (en) * | 1980-02-20 | 1981-05-05 | Eli Lilly And Company | Process for 3-iodomethyl cephalosporins |
| DK162718C (da) * | 1982-09-30 | 1992-05-11 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af 7-substitueret-3-vinyl-3-cephemforbindelser |
| GB8323034D0 (en) * | 1983-08-26 | 1983-09-28 | Fujisawo Pharmaceutical Co Ltd | 7-substituted-3-vinyl-3-cephem compounds |
-
1980
- 1980-11-10 US US06/205,334 patent/US4409214A/en not_active Expired - Lifetime
- 1980-11-12 CA CA000364436A patent/CA1235414A/en not_active Expired
- 1980-11-12 IE IE2347/80A patent/IE53271B1/en not_active IP Right Cessation
- 1980-11-13 FI FI803558A patent/FI74970C/fi not_active IP Right Cessation
- 1980-11-14 GR GR63359A patent/GR71596B/el unknown
- 1980-11-15 EP EP84100915A patent/EP0123024B1/en not_active Expired
- 1980-11-15 DE DE8787104893T patent/DE3072207T2/de not_active Expired - Lifetime
- 1980-11-15 AT AT84100915T patent/ATE37028T1/de not_active IP Right Cessation
- 1980-11-15 AT AT87104893T patent/ATE86987T1/de not_active IP Right Cessation
- 1980-11-15 DE DE8080107075T patent/DE3071939D1/de not_active Expired
- 1980-11-15 EP EP80107075A patent/EP0030630B1/en not_active Expired
- 1980-11-15 AT AT80107075T patent/ATE26280T1/de active
- 1980-11-15 DE DE8484100915T patent/DE3072122D1/de not_active Expired
- 1980-11-15 EP EP87104893A patent/EP0244637B1/en not_active Expired - Lifetime
- 1980-11-17 AU AU64442/80A patent/AU543301B2/en not_active Expired
- 1980-11-18 SU SU803009474A patent/SU1186087A3/ru active
- 1980-11-18 NO NO803470A patent/NO160921C/no unknown
- 1980-11-18 MX MX8409A patent/MX158337A/es unknown
- 1980-11-18 MX MX8410A patent/MX158338A/es unknown
- 1980-11-18 ES ES496948A patent/ES8204739A1/es not_active Expired
- 1980-11-18 HU HU802757A patent/HU186753B/hu unknown
- 1980-11-18 DK DK491780A patent/DK491780A/da not_active Application Discontinuation
- 1980-11-19 PT PT72079A patent/PT72079B/pt unknown
-
1981
- 1981-05-07 US US06/261,618 patent/US4423213A/en not_active Expired - Lifetime
- 1981-12-15 ES ES507972A patent/ES8300112A1/es not_active Expired
-
1982
- 1982-01-22 US US06/341,621 patent/US4487927A/en not_active Expired - Lifetime
- 1982-07-30 AR AR82290136A patent/AR248139A1/es active
-
1983
- 1983-05-09 US US06/493,051 patent/US4585860A/en not_active Expired - Lifetime
-
1987
- 1987-07-31 SG SG617/87A patent/SG61787G/en unknown
- 1987-09-05 MY MYPI87001564A patent/MY101359A/en unknown
-
1988
- 1988-02-10 HK HK118/88A patent/HK11888A/en not_active IP Right Cessation
-
1990
- 1990-01-03 US US07/462,347 patent/US4960889A/en not_active Expired - Lifetime
- 1990-09-17 US US07/583,304 patent/US5110921A/en not_active Expired - Lifetime
-
1991
- 1991-05-10 JP JP3201550A patent/JPH0710870B2/ja not_active Expired - Lifetime
-
1993
- 1993-06-01 NL NL930045C patent/NL930045I2/nl unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU186753B (en) | Process for producing 7-acylamino-3-vinyl-ceph-3-eme-4-carboxylic acid derivatives | |
| US4409215A (en) | 7-Acylamino-3-substituted cephalosporanic acid derivatives and processes for the preparation thereof | |
| EP0055465B1 (en) | 7-acylaminocephalosporanic acid derivatives and processes for the preparation thereof | |
| JPH0373553B2 (ref) | ||
| DK163832B (da) | Analogifremgangsmaade til fremstilling af cephemforbindelser og mellemprodukter til anvendelse ved fremgangsmaaden | |
| HU177441B (en) | Process for preparing syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acid derivatives | |
| EP0007633A2 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| JPH0314832B2 (ref) | ||
| EP0133678A2 (en) | New cephem compounds, processes for preparation thereof and pharmaceutical compositions containing them | |
| US4288436A (en) | 3,7-Disubstituted-3-cephem-4-carboxylic acid compounds | |
| EP0184227B1 (en) | 2-oxymino 2-aminothiazolyl acetic acid derivatives and processes for preparation thereof | |
| EP0008442B1 (en) | 2-lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds, processes for their preparation and pharmaceutical compositions containing them | |
| EP0055466A2 (en) | Cephem compounds, processes for their preparation, pharmaceutical compositions containing them and their starting compounds | |
| JPH0262555B2 (ref) | ||
| EP0046964A2 (en) | New cephem compounds and processes for preparation thereof | |
| JPH0144715B2 (ref) | ||
| FR2554110A1 (fr) | Nouveaux composes du cepheme et leurs procedes de preparation | |
| US4731443A (en) | 7-acylamino-3-vinylcephalosporanic acid derivatives | |
| US4324892A (en) | 7-(N-Substituted-2-phenylglycinamido)-3-substituted-3-cephem-4-carboxylic acid compounds | |
| US5252731A (en) | Cephalosporin intermediates | |
| GB2033377A (en) | New Cephem Compounds and Processes for Preparation Thereof | |
| JP2518546B2 (ja) | 新規セフェム化合物 | |
| HU182959B (en) | Process for preparing 1-dethia-1-oxa-3-cefemic derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |