HU184797B - Process for preparing quinazoline derivatives - Google Patents
Process for preparing quinazoline derivatives Download PDFInfo
- Publication number
- HU184797B HU184797B HU801690A HU169080A HU184797B HU 184797 B HU184797 B HU 184797B HU 801690 A HU801690 A HU 801690A HU 169080 A HU169080 A HU 169080A HU 184797 B HU184797 B HU 184797B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- alkyl
- preparation
- compounds
- trans
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 79
- 239000000203 mixture Substances 0.000 claims description 52
- 238000000034 method Methods 0.000 claims description 36
- 238000002360 preparation method Methods 0.000 claims description 26
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 23
- -1 2-hydroxyethoxy group Chemical group 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 239000007787 solid Substances 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000007858 starting material Substances 0.000 claims description 14
- 125000004414 alkyl thio group Chemical group 0.000 claims description 12
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 12
- SHVQUBPOECYGEG-AATRIKPKSA-N (e)-3-(4-oxo-6-propan-2-ylquinazolin-3-yl)prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(C(C)C)=CC=C21 SHVQUBPOECYGEG-AATRIKPKSA-N 0.000 claims description 10
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 10
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 7
- VHFPVEGFRVEDBK-SNAWJCMRSA-N (e)-3-(6-methylsulfanyl-4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(SC)=CC=C21 VHFPVEGFRVEDBK-SNAWJCMRSA-N 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- MHMUCYJKZUZMNJ-OWOJBTEDSA-N trans-3-chloroacrylic acid Chemical class OC(=O)\C=C\Cl MHMUCYJKZUZMNJ-OWOJBTEDSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 4
- 230000003266 anti-allergic effect Effects 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- JVXJNZOYMJJARA-AATRIKPKSA-N (e)-3-(4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical class C1=CC=C2C(=O)N(/C=C/C(=O)O)C=NC2=C1 JVXJNZOYMJJARA-AATRIKPKSA-N 0.000 claims description 2
- LCNXPWGMYLCBGH-SNAWJCMRSA-N (e)-3-(6-methylsulfinyl-4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(S(=O)C)=CC=C21 LCNXPWGMYLCBGH-SNAWJCMRSA-N 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims 1
- UAOUBVAQDAQRPA-ONEGZZNKSA-N (e)-3-(6-hydroxy-4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical compound C1=C(O)C=C2C(=O)N(/C=C/C(=O)O)C=NC2=C1 UAOUBVAQDAQRPA-ONEGZZNKSA-N 0.000 claims 1
- QPQIWUBTEIKPOK-LBEJWNQZSA-N (e)-n-[2-(diethylamino)ethyl]-3-(4-oxo-6-propan-2-ylquinazolin-3-yl)prop-2-enamide;hydrochloride Chemical compound Cl.C1=C(C(C)C)C=C2C(=O)N(/C=C/C(=O)NCCN(CC)CC)C=NC2=C1 QPQIWUBTEIKPOK-LBEJWNQZSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 93
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- 239000011541 reaction mixture Substances 0.000 description 32
- 239000000243 solution Substances 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 26
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 22
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 235000019359 magnesium stearate Nutrition 0.000 description 12
- 239000012312 sodium hydride Substances 0.000 description 12
- 229910000104 sodium hydride Inorganic materials 0.000 description 12
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 11
- 239000008101 lactose Substances 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- ZLDNFLVIPPOXQL-NSCUHMNNSA-N methyl (e)-3-chloroprop-2-enoate Chemical compound COC(=O)\C=C\Cl ZLDNFLVIPPOXQL-NSCUHMNNSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 229920000881 Modified starch Polymers 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000004368 Modified starch Substances 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 235000019426 modified starch Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 4
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 4
- 239000008108 microcrystalline cellulose Substances 0.000 description 4
- 229940016286 microcrystalline cellulose Drugs 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000004533 oil dispersion Substances 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- UJWBZDOSXFXNGK-SNAWJCMRSA-N (e)-3-(6-methoxy-4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(OC)=CC=C21 UJWBZDOSXFXNGK-SNAWJCMRSA-N 0.000 description 2
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 2
- PIINGYXNCHTJTF-UHFFFAOYSA-N 2-(2-azaniumylethylamino)acetate Chemical compound NCCNCC(O)=O PIINGYXNCHTJTF-UHFFFAOYSA-N 0.000 description 2
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 2
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 2
- TVBMKOMPSZAWET-UHFFFAOYSA-N 6-(2-hydroxyethoxy)-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(OCCO)=CC=C21 TVBMKOMPSZAWET-UHFFFAOYSA-N 0.000 description 2
- MTLLYGIGUMMWBT-UHFFFAOYSA-N 6-methylsulfanyl-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(SC)=CC=C21 MTLLYGIGUMMWBT-UHFFFAOYSA-N 0.000 description 2
- UVJOZVNJHJVGRR-UHFFFAOYSA-N 6-propan-2-yl-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(C(C)C)=CC=C21 UVJOZVNJHJVGRR-UHFFFAOYSA-N 0.000 description 2
- OHJKBCZDDATNSO-UHFFFAOYSA-N 6-propan-2-yloxy-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(OC(C)C)=CC=C21 OHJKBCZDDATNSO-UHFFFAOYSA-N 0.000 description 2
- 206010002198 Anaphylactic reaction Diseases 0.000 description 2
- 208000009079 Bronchial Spasm Diseases 0.000 description 2
- 208000014181 Bronchial disease Diseases 0.000 description 2
- 206010006482 Bronchospasm Diseases 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 206010053262 Skin swelling Diseases 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 230000036783 anaphylactic response Effects 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- SZQHBADGTWUZMX-VOTSOKGWSA-N methyl (e)-3-(4-oxo-6-propan-2-yloxyquinazolin-3-yl)prop-2-enoate Chemical compound C1=C(OC(C)C)C=C2C(=O)N(/C=C/C(=O)OC)C=NC2=C1 SZQHBADGTWUZMX-VOTSOKGWSA-N 0.000 description 2
- KSMSKCNSCVVPKC-AATRIKPKSA-N methyl (e)-3-(6-methoxy-4-oxoquinazolin-3-yl)prop-2-enoate Chemical compound C1=C(OC)C=C2C(=O)N(/C=C/C(=O)OC)C=NC2=C1 KSMSKCNSCVVPKC-AATRIKPKSA-N 0.000 description 2
- CMZYFKGGXJHXFT-CMDGGOBGSA-N methyl (e)-3-[6-[2-(diethylamino)ethoxy]-4-oxoquinazolin-3-yl]prop-2-enoate Chemical compound N1=CN(\C=C\C(=O)OC)C(=O)C2=CC(OCCN(CC)CC)=CC=C21 CMZYFKGGXJHXFT-CMDGGOBGSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- CURJNMSGPBXOGK-UHFFFAOYSA-N n',n'-di(propan-2-yl)ethane-1,2-diamine Chemical compound CC(C)N(C(C)C)CCN CURJNMSGPBXOGK-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- PITLDNPGQYPLHR-AATRIKPKSA-N (e)-3-(4-oxo-6-propan-2-yloxyquinazolin-3-yl)prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(OC(C)C)=CC=C21 PITLDNPGQYPLHR-AATRIKPKSA-N 0.000 description 1
- QVWXNFXQSYJUKO-ONEGZZNKSA-N (e)-3-(6-chloro-4-oxoquinazolin-3-yl)prop-2-enoic acid Chemical compound C1=C(Cl)C=C2C(=O)N(/C=C/C(=O)O)C=NC2=C1 QVWXNFXQSYJUKO-ONEGZZNKSA-N 0.000 description 1
- GHAKFMNTTFXGBH-ONEGZZNKSA-N (e)-3-[6-(2-hydroxyethoxy)-4-oxoquinazolin-3-yl]prop-2-enoic acid Chemical compound N1=CN(\C=C\C(O)=O)C(=O)C2=CC(OCCO)=CC=C21 GHAKFMNTTFXGBH-ONEGZZNKSA-N 0.000 description 1
- KSZSSJZKGORORR-USRGLUTNSA-N (e)-3-[6-[2-(diethylamino)ethoxy]-4-oxoquinazolin-3-yl]prop-2-enoic acid;hydrochloride Chemical compound Cl.N1=CN(\C=C\C(O)=O)C(=O)C2=CC(OCCN(CC)CC)=CC=C21 KSZSSJZKGORORR-USRGLUTNSA-N 0.000 description 1
- VPMAWSAODAKKSI-OWOJBTEDSA-N (e)-3-chloroprop-2-enoyl chloride Chemical compound Cl\C=C\C(Cl)=O VPMAWSAODAKKSI-OWOJBTEDSA-N 0.000 description 1
- ZOOZEDAPFYDZIF-LBEJWNQZSA-N (e)-n-[2-[di(propan-2-yl)amino]ethyl]-3-(4-oxo-6-propan-2-ylquinazolin-3-yl)prop-2-enamide;hydrochloride Chemical compound Cl.C1=C(C(C)C)C=C2C(=O)N(/C=C/C(=O)NCCN(C(C)C)C(C)C)C=NC2=C1 ZOOZEDAPFYDZIF-LBEJWNQZSA-N 0.000 description 1
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 1
- PVJZBZSCGJAWNG-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonyl chloride Chemical compound CC1=CC(C)=C(S(Cl)(=O)=O)C(C)=C1 PVJZBZSCGJAWNG-UHFFFAOYSA-N 0.000 description 1
- IKQFHNIBFIMVOG-HRNDJLQDSA-N 2-(diethylamino)ethyl (E)-3-(6-methoxy-4-oxoquinazolin-3-yl)prop-2-enoate hydrochloride Chemical compound Cl.C1=C(OC)C=C2C(=O)N(/C=C/C(=O)OCCN(CC)CC)C=NC2=C1 IKQFHNIBFIMVOG-HRNDJLQDSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- AEUZKXIHXKWHDD-UHFFFAOYSA-N 2-amino-5-(2-hydroxyethoxy)benzoic acid Chemical compound NC1=CC=C(OCCO)C=C1C(O)=O AEUZKXIHXKWHDD-UHFFFAOYSA-N 0.000 description 1
- ZAZGSPQJTLDUDD-UHFFFAOYSA-N 2-amino-5-[2-(diethylamino)ethoxy]benzoic acid;dihydrochloride Chemical compound Cl.Cl.CCN(CC)CCOC1=CC=C(N)C(C(O)=O)=C1 ZAZGSPQJTLDUDD-UHFFFAOYSA-N 0.000 description 1
- UERVAQKRBPRDJP-UHFFFAOYSA-N 2-amino-5-cyclopropylbenzoic acid Chemical compound C1=C(C(O)=O)C(N)=CC=C1C1CC1 UERVAQKRBPRDJP-UHFFFAOYSA-N 0.000 description 1
- QWNMKHLBVHTPFW-UHFFFAOYSA-N 2-amino-5-propan-2-ylbenzoic acid Chemical compound CC(C)C1=CC=C(N)C(C(O)=O)=C1 QWNMKHLBVHTPFW-UHFFFAOYSA-N 0.000 description 1
- LKWPCZDBLQUFJQ-UHFFFAOYSA-N 2-amino-5-propan-2-yloxybenzoic acid Chemical compound CC(C)OC1=CC=C(N)C(C(O)=O)=C1 LKWPCZDBLQUFJQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- DDOUPXWRCKUTLI-UHFFFAOYSA-N 6-[2-(diethylamino)ethoxy]-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(OCCN(CC)CC)=CC=C21 DDOUPXWRCKUTLI-UHFFFAOYSA-N 0.000 description 1
- LHBXAYHOPMCNDF-UHFFFAOYSA-N 6-cyclopropyl-1h-quinazolin-4-one Chemical compound C1=C2C(=O)NC=NC2=CC=C1C1CC1 LHBXAYHOPMCNDF-UHFFFAOYSA-N 0.000 description 1
- NOFVNLZQAOGUIT-UHFFFAOYSA-N 6-methoxy-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=CC(OC)=CC=C21 NOFVNLZQAOGUIT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GZLYSDJGEXGQDO-UHFFFAOYSA-N C1=CC=CC2=NCNC=C21 Chemical compound C1=CC=CC2=NCNC=C21 GZLYSDJGEXGQDO-UHFFFAOYSA-N 0.000 description 1
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 1
- UCKTTZDYQRSDRI-TXOOBNKBSA-N CCN(CC)CCN.CC(C)C(C=C12)=CC=C1N=CN(/C=C/C(O)=O)C2=O.Cl Chemical compound CCN(CC)CCN.CC(C)C(C=C12)=CC=C1N=CN(/C=C/C(O)=O)C2=O.Cl UCKTTZDYQRSDRI-TXOOBNKBSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010042674 Swelling Diseases 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000002804 anti-anaphylactic effect Effects 0.000 description 1
- 230000007503 antigenic stimulation Effects 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 229960003699 evans blue Drugs 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- AAOIHFOCAQJJRT-VOTSOKGWSA-N methyl (e)-3-(4-oxo-6-propan-2-ylquinazolin-3-yl)prop-2-enoate Chemical compound C1=C(C(C)C)C=C2C(=O)N(/C=C/C(=O)OC)C=NC2=C1 AAOIHFOCAQJJRT-VOTSOKGWSA-N 0.000 description 1
- NGHCFPARWXWEAA-SNAWJCMRSA-N methyl (e)-3-(6-chloro-4-oxoquinazolin-3-yl)prop-2-enoate Chemical compound C1=C(Cl)C=C2C(=O)N(/C=C/C(=O)OC)C=NC2=C1 NGHCFPARWXWEAA-SNAWJCMRSA-N 0.000 description 1
- OKYCYJVRMSDLPV-VOTSOKGWSA-N methyl (e)-3-(6-cyclopropyl-4-oxoquinazolin-3-yl)prop-2-enoate Chemical compound C1=C2C(=O)N(/C=C/C(=O)OC)C=NC2=CC=C1C1CC1 OKYCYJVRMSDLPV-VOTSOKGWSA-N 0.000 description 1
- ANJXTHPVOKAXEZ-AATRIKPKSA-N methyl (e)-3-(6-methylsulfanyl-4-oxoquinazolin-3-yl)prop-2-enoate Chemical compound C1=C(SC)C=C2C(=O)N(/C=C/C(=O)OC)C=NC2=C1 ANJXTHPVOKAXEZ-AATRIKPKSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- QMYZFEFSEQOZPW-UHFFFAOYSA-N o-methyl 2-amino-5-methylbenzenecarbothioate Chemical compound COC(=S)C1=CC(C)=CC=C1N QMYZFEFSEQOZPW-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5572879A | 1979-07-09 | 1979-07-09 | |
| US06/142,903 US4281127A (en) | 1979-07-09 | 1980-04-23 | Trans-3-(4-oxo-4H-quinazolin-3-yl)-2-propenoic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU184797B true HU184797B (en) | 1984-10-29 |
Family
ID=26734565
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU801690A HU184797B (en) | 1979-07-09 | 1980-07-07 | Process for preparing quinazoline derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4281127A (OSRAM) |
| EP (1) | EP0023594B1 (OSRAM) |
| AR (1) | AR226854A1 (OSRAM) |
| AU (1) | AU521014B2 (OSRAM) |
| CA (1) | CA1134825A (OSRAM) |
| DE (1) | DE3067830D1 (OSRAM) |
| DK (1) | DK150483C (OSRAM) |
| ES (2) | ES8106302A1 (OSRAM) |
| FI (1) | FI74279C (OSRAM) |
| GR (1) | GR65952B (OSRAM) |
| HK (1) | HK52187A (OSRAM) |
| HU (1) | HU184797B (OSRAM) |
| IE (1) | IE49938B1 (OSRAM) |
| IL (1) | IL60514A (OSRAM) |
| MC (1) | MC1333A1 (OSRAM) |
| NO (1) | NO154426C (OSRAM) |
| NZ (1) | NZ194259A (OSRAM) |
| PH (1) | PH16413A (OSRAM) |
| PT (1) | PT71512B (OSRAM) |
| SG (1) | SG20887G (OSRAM) |
| YU (1) | YU42348B (OSRAM) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7009049B2 (en) | 2002-02-15 | 2006-03-07 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| US7038048B2 (en) | 2002-05-23 | 2006-05-02 | Cytokinetics, Inc. | 3H-pyridopyrimidin-4-one compounds, compositions, and methods of their use |
| US7041676B2 (en) | 2002-06-14 | 2006-05-09 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7105668B1 (en) | 1999-10-27 | 2006-09-12 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7166595B2 (en) | 2002-05-09 | 2007-01-23 | Cytokinetics, Inc. | Compounds, methods and compositions |
| US7211580B2 (en) | 2002-07-23 | 2007-05-01 | Cytokinetics, Incorporated | Compounds, compositions, and methods |
| US7214800B2 (en) | 2002-05-09 | 2007-05-08 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7230000B1 (en) | 1999-10-27 | 2007-06-12 | Cytokinetics, Incorporated | Methods and compositions utilizing quinazolinones |
| US7439254B2 (en) | 2003-12-08 | 2008-10-21 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7557115B2 (en) | 2002-09-30 | 2009-07-07 | Cytokinetics, Inc. | Compounds, compositions, and methods |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4599336A (en) * | 1983-08-08 | 1986-07-08 | Hoffmann-La Roche Inc. | Derivatives of (E)-3-(4-oxo-4H-quinazolin-3-yl)-2-propenamide |
| GB9404485D0 (en) * | 1994-03-09 | 1994-04-20 | Cancer Res Campaign Tech | Benzamide analogues |
| US6706721B1 (en) * | 1998-04-29 | 2004-03-16 | Osi Pharmaceuticals, Inc. | N-(3-ethynylphenylamino)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine mesylate anhydrate and monohydrate |
| US7087613B2 (en) * | 1999-11-11 | 2006-08-08 | Osi Pharmaceuticals, Inc. | Treating abnormal cell growth with a stable polymorph of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine hydrochloride |
| UA74803C2 (uk) | 1999-11-11 | 2006-02-15 | Осі Фармасьютікалз, Інк. | Стійкий поліморф гідрохлориду n-(3-етинілфеніл)-6,7-біс(2-метоксіетокси)-4-хіназолінаміну, спосіб його одержання (варіанти) та фармацевтичне застосування |
| EP1539180A4 (en) * | 2002-08-21 | 2006-08-30 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| EP1682534A2 (en) * | 2003-11-03 | 2006-07-26 | Cytokinetics, Inc. | Pyrimidin-4-one compounds, compositions, and methods |
| EP1680420A4 (en) * | 2003-11-07 | 2008-09-24 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| UY29198A1 (es) * | 2004-11-09 | 2006-05-31 | Cancer Rec Tech Ltd | Derivados sustituidos de quinazolinona y derivados sustituidos de quinazolina-2, 4-diona, composiciones conteniéndolos, procedimientos de preparación y aplicaciones |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2786055A (en) * | 1955-02-10 | 1957-03-19 | Mallinckrodt Chemical Works | Carboxyalkyl-iodoquinazolones |
| US3517005A (en) * | 1967-10-26 | 1970-06-23 | Pfizer & Co C | Certain 2- and 4-substituted quinazolines |
| US3696102A (en) * | 1970-03-09 | 1972-10-03 | Pfizer & Co C | Process for the synthesis of substituted quinazolin-4-ones |
-
1980
- 1980-04-23 US US06/142,903 patent/US4281127A/en not_active Expired - Lifetime
- 1980-07-07 MC MC801458A patent/MC1333A1/fr unknown
- 1980-07-07 NZ NZ194259A patent/NZ194259A/en unknown
- 1980-07-07 CA CA000355555A patent/CA1134825A/en not_active Expired
- 1980-07-07 IL IL60514A patent/IL60514A/xx unknown
- 1980-07-07 HU HU801690A patent/HU184797B/hu not_active IP Right Cessation
- 1980-07-07 GR GR62402A patent/GR65952B/el unknown
- 1980-07-08 PT PT71512A patent/PT71512B/pt unknown
- 1980-07-08 DK DK294780A patent/DK150483C/da active
- 1980-07-08 DE DE8080103896T patent/DE3067830D1/de not_active Expired
- 1980-07-08 ES ES493203A patent/ES8106302A1/es not_active Expired
- 1980-07-08 NO NO802056A patent/NO154426C/no unknown
- 1980-07-08 AR AR281693A patent/AR226854A1/es active
- 1980-07-08 EP EP80103896A patent/EP0023594B1/de not_active Expired
- 1980-07-08 IE IE1412/80A patent/IE49938B1/en not_active IP Right Cessation
- 1980-07-09 FI FI802195A patent/FI74279C/fi not_active IP Right Cessation
- 1980-07-09 PH PH24261A patent/PH16413A/en unknown
- 1980-07-09 AU AU60244/80A patent/AU521014B2/en not_active Ceased
- 1980-07-09 YU YU1766/80A patent/YU42348B/xx unknown
-
1981
- 1981-02-02 ES ES499035A patent/ES8207155A1/es not_active Expired
-
1987
- 1987-02-26 SG SG208/87A patent/SG20887G/en unknown
- 1987-07-09 HK HK521/87A patent/HK52187A/xx unknown
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7294634B2 (en) | 1999-10-27 | 2007-11-13 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7589098B2 (en) | 1999-10-27 | 2009-09-15 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7105668B1 (en) | 1999-10-27 | 2006-09-12 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7230000B1 (en) | 1999-10-27 | 2007-06-12 | Cytokinetics, Incorporated | Methods and compositions utilizing quinazolinones |
| US7009049B2 (en) | 2002-02-15 | 2006-03-07 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| US7161002B2 (en) | 2002-02-15 | 2007-01-09 | Cytokinetics, Inc. | Syntheses of quinazolinones |
| US7214800B2 (en) | 2002-05-09 | 2007-05-08 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7166595B2 (en) | 2002-05-09 | 2007-01-23 | Cytokinetics, Inc. | Compounds, methods and compositions |
| US7528137B2 (en) | 2002-05-09 | 2009-05-05 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7332498B2 (en) | 2002-05-23 | 2008-02-19 | Cytokinetics, Inc. | Modulation of KSP kinesin activity with heterocyclic-fused pyrimidinone derivatives |
| US7038048B2 (en) | 2002-05-23 | 2006-05-02 | Cytokinetics, Inc. | 3H-pyridopyrimidin-4-one compounds, compositions, and methods of their use |
| US7041676B2 (en) | 2002-06-14 | 2006-05-09 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7211580B2 (en) | 2002-07-23 | 2007-05-01 | Cytokinetics, Incorporated | Compounds, compositions, and methods |
| US7557115B2 (en) | 2002-09-30 | 2009-07-07 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| US7439254B2 (en) | 2003-12-08 | 2008-10-21 | Cytokinetics, Inc. | Compounds, compositions, and methods |
Also Published As
| Publication number | Publication date |
|---|---|
| DK294780A (da) | 1981-01-10 |
| IE49938B1 (en) | 1986-01-08 |
| ES499035A0 (es) | 1982-09-16 |
| MC1333A1 (fr) | 1981-04-21 |
| YU42348B (en) | 1988-08-31 |
| IL60514A0 (en) | 1980-09-16 |
| US4281127A (en) | 1981-07-28 |
| FI74279B (fi) | 1987-09-30 |
| SG20887G (en) | 1988-09-16 |
| ES493203A0 (es) | 1981-05-16 |
| NZ194259A (en) | 1984-09-28 |
| EP0023594A1 (de) | 1981-02-11 |
| AU6024480A (en) | 1981-03-12 |
| AU521014B2 (en) | 1982-03-11 |
| DE3067830D1 (en) | 1984-06-20 |
| IL60514A (en) | 1985-03-31 |
| ES8106302A1 (es) | 1981-05-16 |
| GR65952B (OSRAM) | 1981-01-09 |
| PT71512B (en) | 1981-12-11 |
| YU176680A (en) | 1984-12-31 |
| PH16413A (en) | 1983-09-29 |
| CA1134825A (en) | 1982-11-02 |
| EP0023594B1 (de) | 1984-05-16 |
| DK150483B (da) | 1987-03-09 |
| FI74279C (fi) | 1988-01-11 |
| NO154426C (no) | 1986-09-17 |
| PT71512A (en) | 1980-08-01 |
| AR226854A1 (es) | 1982-08-31 |
| NO802056L (no) | 1981-01-12 |
| IE801412L (en) | 1981-01-09 |
| FI802195A7 (fi) | 1981-01-10 |
| HK52187A (en) | 1987-07-17 |
| DK150483C (da) | 1987-11-09 |
| NO154426B (no) | 1986-06-09 |
| ES8207155A1 (es) | 1982-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU184797B (en) | Process for preparing quinazoline derivatives | |
| KR910004430B1 (ko) | 5-피리딜-1,3-티아졸 유도체의 제조방법 | |
| CA2206754C (en) | Benzimidazole derivatives with antihistaminic activity | |
| DE69530081T2 (de) | Gastrin- und cck-antagonisten | |
| DE69205327T2 (de) | Harnstoffderivate, Verfahren zu ihrer Herstellung und diese enthaltende Medikamente. | |
| EP0580541B1 (en) | Piperidine derivatives of benzimidazole as antihistaminic and antiallergic agents | |
| US5252584A (en) | Hydroxyquinolone derivatives | |
| IE904146A1 (en) | Indole Derivatives | |
| JP2005527463A (ja) | Cns疾患を治療するための5−ht6受容体アフィニティーを有する3−アリールスルホニル−7−ピペラジニル−インドール、−ベンゾフランおよび−ベンゾチオフェン | |
| EP0116769B1 (en) | Dihydropyridines | |
| DE69828284T2 (de) | Naphthyridinderivate oder salze davon | |
| EP0150505B1 (en) | 3-indolecarboxamide compounds | |
| JP3086692B2 (ja) | 抗炎症剤としてのフエナメート1,3,4‐チアジアゾール類および1,3,4‐オキサジアゾール類 | |
| EP0912556B1 (en) | Indoline derivatives useful as 5-ht-2c receptor antagonists | |
| DD207377A5 (de) | Verfahren zur herstellung von neuen theophyllin-derivaten | |
| DD228547A5 (de) | Verfahren zur herstellung von neuen amid-verbindungen | |
| CZ296134B6 (cs) | Kyselá adicní sul 10-aminoalifatyl-dibenzo[b,f]oxepinu, 10-aminoalifatyl-dibenzo[b,f]oxepin, tyto slouceniny pro lécbu cloveka nebo zvírat, farmaceutická kompozice obsahující tyto slouceniny a pouzití techto sloucenin pro výrobu léciva | |
| JPS6351154B2 (OSRAM) | ||
| JPH02218682A (ja) | エルゴリン誘導体 | |
| JPH0327363A (ja) | チオウラシル誘導体 | |
| HU179391B (en) | Process for producing thiasolo-square bracket-2,3-b-square bracket closed-quinasoline derivatives | |
| US4596799A (en) | 9H-pyrrolo[2,1-c]-1,2,4-triazolo[4,3-a][1,4]benzodiazepines | |
| JP3499569B2 (ja) | 新規複素環式化合物 | |
| SU1245259A3 (ru) | Способ получени 2-ациламинометил-1 @ -2,3-дигидро-1,4-бензодиазепиновых соединений,а также их оптических изомеров и их солей кислотного присоединени | |
| US4069331A (en) | N-(p-fluorobenzoyl-n-propyl)-4-piperidylamides and salts thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |