HU180951B - Process for preparing acyl derivatives of steroid-21-thiols - Google Patents
Process for preparing acyl derivatives of steroid-21-thiols Download PDFInfo
- Publication number
- HU180951B HU180951B HU79SI1732A HUSI001732A HU180951B HU 180951 B HU180951 B HU 180951B HU 79SI1732 A HU79SI1732 A HU 79SI1732A HU SI001732 A HUSI001732 A HU SI001732A HU 180951 B HU180951 B HU 180951B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- process according
- dione
- acid
- pregnadiene
- Prior art date
Links
- 125000002252 acyl group Chemical group 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000000034 method Methods 0.000 claims abstract description 18
- 239000000725 suspension Substances 0.000 claims abstract description 13
- 150000003431 steroids Chemical class 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 60
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 52
- 239000002253 acid Substances 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 238000006277 sulfonation reaction Methods 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 238000003756 stirring Methods 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 239000002516 radical scavenger Substances 0.000 claims description 4
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000006545 (C1-C9) alkyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 239000002002 slurry Substances 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 7
- 238000003786 synthesis reaction Methods 0.000 abstract description 7
- 239000000543 intermediate Substances 0.000 abstract description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 16
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 9
- -1 heterocyclic amines Chemical class 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 7
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 7
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 229950010765 pivalate Drugs 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 239000008367 deionised water Substances 0.000 description 5
- 229910021641 deionized water Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- BISFDZNIUZIKJD-XDANTLIUSA-N tixocortol pivalate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)CSC(=O)C(C)(C)C)(O)[C@@]1(C)C[C@@H]2O BISFDZNIUZIKJD-XDANTLIUSA-N 0.000 description 5
- 125000005208 trialkylammonium group Chemical group 0.000 description 5
- JHSXHKMJBWOMRU-UHFFFAOYSA-N 2,2-dimethylpropanethioic s-acid Chemical compound CC(C)(C)C(S)=O JHSXHKMJBWOMRU-UHFFFAOYSA-N 0.000 description 4
- BBYDXOIZLAWGSL-UHFFFAOYSA-M 4-fluorobenzoate Chemical compound [O-]C(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical group CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000007970 thio esters Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- MFCFYXJVHMXPDQ-JSQCKWNTSA-N (8s,9s,10r,13s,14s,17r)-17-acetyl-17-hydroxy-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2=O MFCFYXJVHMXPDQ-JSQCKWNTSA-N 0.000 description 2
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 2
- FFAADXOKPZHULO-UHFFFAOYSA-N 2-methylpropanethioic s-acid Chemical compound CC(C)C(S)=O FFAADXOKPZHULO-UHFFFAOYSA-N 0.000 description 2
- PUKLDDOGISCFCP-JSQCKWNTSA-N 21-Deoxycortisone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2=O PUKLDDOGISCFCP-JSQCKWNTSA-N 0.000 description 2
- LCZBQMKVFQNSJR-UJPCIWJBSA-N 21-deoxycortisol Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)C[C@@H]2O LCZBQMKVFQNSJR-UJPCIWJBSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- FGKJLKRYENPLQH-UHFFFAOYSA-N isocaproic acid Chemical compound CC(C)CCC(O)=O FGKJLKRYENPLQH-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 2
- 238000006257 total synthesis reaction Methods 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- JDPURKGEQMLZNC-HPMPOATDSA-N (8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-propyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene Chemical compound C1CC2=CCC=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CCC)[C@@]1(C)CC2 JDPURKGEQMLZNC-HPMPOATDSA-N 0.000 description 1
- KQZSMOGWYFPKCH-UJPCIWJBSA-N (8s,9s,10r,11s,13s,14s,17r)-17-acetyl-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthren-3-one Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)C[C@@H]2O KQZSMOGWYFPKCH-UJPCIWJBSA-N 0.000 description 1
- SYVFBJQHOGXAMY-XUCMERPOSA-N (8s,9s,10r,13s,14s,17s)-10,13-dimethyl-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)CC)[C@@]1(C)CC2 SYVFBJQHOGXAMY-XUCMERPOSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-BYPYZUCNSA-N 2-Methylbutanoic acid Natural products CC[C@H](C)C(O)=O WLAMNBDJUVNPJU-BYPYZUCNSA-N 0.000 description 1
- BUOQFXCDULYEDJ-UHFFFAOYSA-N 2-ethylhexanethioic s-acid Chemical compound CCCCC(CC)C(S)=O BUOQFXCDULYEDJ-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-M 3,3-dimethylbutanoate Chemical compound CC(C)(C)CC([O-])=O MLMQPDHYNJCQAO-UHFFFAOYSA-M 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-N 3,3-dimethylbutyric acid Chemical compound CC(C)(C)CC(O)=O MLMQPDHYNJCQAO-UHFFFAOYSA-N 0.000 description 1
- YJESALUAHUVISI-UHFFFAOYSA-N 3,5-dimethylhexan-2-one Chemical compound CC(C)CC(C)C(C)=O YJESALUAHUVISI-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N 3-methyl-2-pentanone Chemical compound CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- LBVWMBBKFFQMRX-UHFFFAOYSA-N 4-chlorobenzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=C(Cl)C=C1 LBVWMBBKFFQMRX-UHFFFAOYSA-N 0.000 description 1
- PEQZEAWOMNXGCD-UHFFFAOYSA-N 4-fluorobenzenecarbothioic s-acid Chemical compound FC1=CC=C(C(S)=O)C=C1 PEQZEAWOMNXGCD-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAYZSLLQFKPMNQ-UHFFFAOYSA-M [Na+].CC(C)(C)C([O-])=S Chemical compound [Na+].CC(C)(C)C([O-])=S QAYZSLLQFKPMNQ-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229960000250 adipic acid Drugs 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- DGAODIKUWGRDBO-UHFFFAOYSA-N butanethioic s-acid Chemical compound CCCC(O)=S DGAODIKUWGRDBO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- RJKFOVLPORLFTN-UHFFFAOYSA-N progesterone acetate Natural products C1CC2=CC(=O)CCC2(C)C2C1C1CCC(C(=O)C)C1(C)CC2 RJKFOVLPORLFTN-UHFFFAOYSA-N 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 229940034238 utira Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J31/00—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring
- C07J31/006—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring not covered by C07J31/003
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7833959A FR2442856A1 (fr) | 1978-12-01 | 1978-12-01 | Procede de preparation de steroides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU180951B true HU180951B (en) | 1983-05-30 |
Family
ID=9215594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79SI1732A HU180951B (en) | 1978-12-01 | 1979-11-30 | Process for preparing acyl derivatives of steroid-21-thiols |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4269778A (OSRAM) |
| JP (1) | JPS5858359B2 (OSRAM) |
| AT (1) | AT370740B (OSRAM) |
| AU (1) | AU526109B2 (OSRAM) |
| BE (1) | BE880343A (OSRAM) |
| CA (1) | CA1124711A (OSRAM) |
| CH (1) | CH648329A5 (OSRAM) |
| DE (1) | DE2948142C2 (OSRAM) |
| DK (1) | DK160281C (OSRAM) |
| ES (1) | ES486325A1 (OSRAM) |
| FI (1) | FI67859C (OSRAM) |
| FR (1) | FR2442856A1 (OSRAM) |
| GB (1) | GB2037290B (OSRAM) |
| GR (1) | GR63585B (OSRAM) |
| HU (1) | HU180951B (OSRAM) |
| IL (1) | IL58778A (OSRAM) |
| IT (1) | IT1124356B (OSRAM) |
| NL (1) | NL7908634A (OSRAM) |
| PT (1) | PT70458A (OSRAM) |
| SE (1) | SE441833B (OSRAM) |
| YU (1) | YU40766B (OSRAM) |
| ZA (1) | ZA796226B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2529894B2 (fr) * | 1981-07-30 | 1986-07-25 | Jouveinal | Steroides esterifies en la position 17 et thio-esterifies en la position 21 et leur application comme medicament |
| FR2510582B1 (fr) * | 1981-07-30 | 1986-05-30 | Sipsy | Steroides esterifies en la position 17 et thio-esterifies en la position 21, leur procede de preparation et leur application comme medicament |
| FI80790C (fi) * | 1988-02-22 | 1990-07-10 | Matti Henttinen | Foerfarande och anordning foer bestaemning av ett spaors laege. |
| US5344651A (en) * | 1993-07-23 | 1994-09-06 | The Procter & Gamble Company | Cyproterone acetate thioacetate |
| US5439901A (en) * | 1993-07-23 | 1995-08-08 | The Procter & Gamble Company | Cyproterone thiopivalate |
| IES68868B2 (en) * | 1996-03-20 | 1996-07-24 | Losbanos Ltd | Manufacture of steroids |
| ES2716401T3 (es) * | 2013-09-25 | 2019-06-12 | H4 Pharma | Procedimiento de síntesis de una sal mineral del ácido piválico como producto intermedio |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1187M (fr) * | 1961-03-17 | 1962-03-19 | Roussel Uclaf | Nouveau médicament notamment pour le traitement des manifestations inflammatoires d'origine rhumatismale arthritique ou infectieuse. |
| CH566349A5 (OSRAM) * | 1969-12-24 | 1975-09-15 | Ciba Geigy Ag | |
| US3803133A (en) * | 1972-12-15 | 1974-04-09 | Squibb & Sons Inc | 21-sulfinyl steroids |
| FR2231374B1 (OSRAM) * | 1973-05-30 | 1976-10-22 | Jouveinal Sa |
-
1978
- 1978-12-01 FR FR7833959A patent/FR2442856A1/fr active Granted
-
1979
- 1979-11-15 PT PT70458A patent/PT70458A/pt unknown
- 1979-11-19 ZA ZA00796226A patent/ZA796226B/xx unknown
- 1979-11-20 US US06/096,153 patent/US4269778A/en not_active Expired - Lifetime
- 1979-11-22 IL IL58778A patent/IL58778A/xx unknown
- 1979-11-22 GR GR60575A patent/GR63585B/el unknown
- 1979-11-22 AU AU53116/79A patent/AU526109B2/en not_active Expired
- 1979-11-23 IT IT12840/79A patent/IT1124356B/it active
- 1979-11-23 FI FI793683A patent/FI67859C/fi not_active IP Right Cessation
- 1979-11-26 ES ES486325A patent/ES486325A1/es not_active Expired
- 1979-11-27 YU YU2901/79A patent/YU40766B/xx unknown
- 1979-11-28 NL NL7908634A patent/NL7908634A/nl active Search and Examination
- 1979-11-29 SE SE7909852A patent/SE441833B/sv not_active IP Right Cessation
- 1979-11-29 DE DE2948142A patent/DE2948142C2/de not_active Expired
- 1979-11-29 CH CH10632/79A patent/CH648329A5/fr not_active IP Right Cessation
- 1979-11-29 BE BE6/47023A patent/BE880343A/fr not_active IP Right Cessation
- 1979-11-30 AT AT0760479A patent/AT370740B/de not_active IP Right Cessation
- 1979-11-30 HU HU79SI1732A patent/HU180951B/hu unknown
- 1979-11-30 DK DK511279A patent/DK160281C/da active
- 1979-11-30 GB GB7941360A patent/GB2037290B/en not_active Expired
- 1979-11-30 CA CA340,967A patent/CA1124711A/en not_active Expired
- 1979-12-01 JP JP54154995A patent/JPS5858359B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE880343A (fr) | 1980-05-29 |
| DK511279A (da) | 1980-06-02 |
| IT1124356B (it) | 1986-05-07 |
| ES486325A1 (es) | 1980-06-16 |
| DK160281B (da) | 1991-02-18 |
| PT70458A (fr) | 1979-12-01 |
| DE2948142C2 (de) | 1982-06-24 |
| JPS5858359B2 (ja) | 1983-12-24 |
| US4269778A (en) | 1981-05-26 |
| GR63585B (en) | 1979-11-23 |
| FR2442856B1 (OSRAM) | 1981-05-22 |
| ATA760479A (de) | 1982-09-15 |
| AT370740B (de) | 1983-04-25 |
| AU526109B2 (en) | 1982-12-16 |
| SE441833B (sv) | 1985-11-11 |
| AU5311679A (en) | 1980-06-05 |
| CA1124711A (en) | 1982-06-01 |
| CH648329A5 (fr) | 1985-03-15 |
| NL7908634A (nl) | 1980-06-03 |
| FI67859C (fi) | 1985-06-10 |
| JPS5579399A (en) | 1980-06-14 |
| FR2442856A1 (fr) | 1980-06-27 |
| DK160281C (da) | 1991-07-29 |
| SE7909852L (sv) | 1980-06-02 |
| GB2037290B (en) | 1983-02-09 |
| GB2037290A (en) | 1980-07-09 |
| FI793683A7 (fi) | 1980-06-02 |
| FI67859B (fi) | 1985-02-28 |
| IT7912840A0 (it) | 1979-11-23 |
| ZA796226B (en) | 1981-06-24 |
| YU40766B (en) | 1986-06-30 |
| YU290179A (en) | 1983-01-21 |
| DE2948142A1 (de) | 1980-06-04 |
| IL58778A0 (en) | 1980-02-29 |
| IL58778A (en) | 1982-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL119050B1 (en) | Process for preparing corticosteroid derivatives | |
| US4198403A (en) | 17 Beta-thiocarboxylic acid esters of 4-halo-3-oxoandrost-4-enes | |
| AU2007298770B2 (en) | Processes for the preparation of ciclesonide and its crystal form | |
| CA1310009C (en) | Ester prodrugs of steroids | |
| HU227380B1 (en) | Process for preparing delta 9,11 and 21-chloro corticosteroids | |
| HU180951B (en) | Process for preparing acyl derivatives of steroid-21-thiols | |
| US4650610A (en) | Androstane carbothioic acids | |
| CA1202300A (en) | Corticosteroid derivatives | |
| NO153431B (no) | Fremgangsmaate ved fremstilling av 6alfa-halogen-3-keto-delta1,4-pregnadiener. | |
| US3988365A (en) | Resolution of 2-(6-methoxy-2-napthyl)propionic acid | |
| US5159091A (en) | Process for preparing 21-desoxyprednisolone 17-esters | |
| IE58798B1 (en) | Process for the production of 17 alpha-ethynyl-17-hydr oxy-18-methyl-4, 15-estradien-3-one, and the novel starting compounds for this process | |
| HU184189B (en) | Process for preparing pregnane derivatives substituted in position 17 | |
| JPS5940840B2 (ja) | アンドロスタン系の新規なジエン誘導体の製造法 | |
| KR830002060B1 (ko) | 스테로이드의 제조방법 | |
| CS252474B2 (en) | Method of 17-halogenethinylsteroides production | |
| NL8102602A (nl) | Werkwijze voor selectieve solvolyse. | |
| US4011315A (en) | 21-acetals and mixed acetals of steroidal 21-aldehydes, intermediates and methods of preparation | |
| AU2004324237B2 (en) | Process for the esterification of a carbothioic acid | |
| MXPA04007529A (es) | Proceso para la produccion de 6. alfa. 9, 9. alfa- difluoro-17. alfa. -(1- oxo-propoxi- 11. beta. -hidroxi -16. alfa. metil-3 -oxo- androst-1, 4-dieno-17. beta.-carbotioico. | |
| CN100351266C (zh) | (11β,16β)-21-(3-羰基-3-氧代丙氧基) -11-羟基-2′-甲基-5′H-孕甾-1,4-二烯并[17,16-D]唑-3,20-二酮的制备方法 | |
| SE437020B (sv) | Forfarande for framstellning av substituerade fenylestrar av vissa prostaglandinanaloger av typ e?712 | |
| PL151850B1 (en) | Method for manufacturing 6-amine-1,2-dihydro-1-hydroxy-2-amine-4-piperidinepyrimidine | |
| US3932486A (en) | Substituted tolyl esters of PGA2 | |
| US5332847A (en) | Process for the preparation of 21-bromo-4-pregnene-3,20-dione derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |