HU180951B - Process for preparing acyl derivatives of steroid-21-thiols - Google Patents
Process for preparing acyl derivatives of steroid-21-thiols Download PDFInfo
- Publication number
- HU180951B HU180951B HU79SI1732A HUSI001732A HU180951B HU 180951 B HU180951 B HU 180951B HU 79SI1732 A HU79SI1732 A HU 79SI1732A HU SI001732 A HUSI001732 A HU SI001732A HU 180951 B HU180951 B HU 180951B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- process according
- dione
- acid
- pregnadiene
- Prior art date
Links
- 125000002252 acyl group Chemical group 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000000034 method Methods 0.000 claims abstract description 18
- 239000000725 suspension Substances 0.000 claims abstract description 13
- 150000003431 steroids Chemical class 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 60
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 52
- 239000002253 acid Substances 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 238000006277 sulfonation reaction Methods 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 238000003756 stirring Methods 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 239000002516 radical scavenger Substances 0.000 claims description 4
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000006545 (C1-C9) alkyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 239000002002 slurry Substances 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 7
- 238000003786 synthesis reaction Methods 0.000 abstract description 7
- 239000000543 intermediate Substances 0.000 abstract description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 16
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 9
- -1 heterocyclic amines Chemical class 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 7
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 7
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 229950010765 pivalate Drugs 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 239000008367 deionised water Substances 0.000 description 5
- 229910021641 deionized water Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- BISFDZNIUZIKJD-XDANTLIUSA-N tixocortol pivalate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)CSC(=O)C(C)(C)C)(O)[C@@]1(C)C[C@@H]2O BISFDZNIUZIKJD-XDANTLIUSA-N 0.000 description 5
- 125000005208 trialkylammonium group Chemical group 0.000 description 5
- JHSXHKMJBWOMRU-UHFFFAOYSA-N 2,2-dimethylpropanethioic s-acid Chemical compound CC(C)(C)C(S)=O JHSXHKMJBWOMRU-UHFFFAOYSA-N 0.000 description 4
- BBYDXOIZLAWGSL-UHFFFAOYSA-M 4-fluorobenzoate Chemical compound [O-]C(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical group CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000007970 thio esters Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- MFCFYXJVHMXPDQ-JSQCKWNTSA-N (8s,9s,10r,13s,14s,17r)-17-acetyl-17-hydroxy-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2=O MFCFYXJVHMXPDQ-JSQCKWNTSA-N 0.000 description 2
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 2
- FFAADXOKPZHULO-UHFFFAOYSA-N 2-methylpropanethioic s-acid Chemical compound CC(C)C(S)=O FFAADXOKPZHULO-UHFFFAOYSA-N 0.000 description 2
- PUKLDDOGISCFCP-JSQCKWNTSA-N 21-Deoxycortisone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2=O PUKLDDOGISCFCP-JSQCKWNTSA-N 0.000 description 2
- LCZBQMKVFQNSJR-UJPCIWJBSA-N 21-deoxycortisol Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)C[C@@H]2O LCZBQMKVFQNSJR-UJPCIWJBSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- FGKJLKRYENPLQH-UHFFFAOYSA-N isocaproic acid Chemical compound CC(C)CCC(O)=O FGKJLKRYENPLQH-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 2
- 238000006257 total synthesis reaction Methods 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- JDPURKGEQMLZNC-HPMPOATDSA-N (8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-propyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene Chemical compound C1CC2=CCC=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CCC)[C@@]1(C)CC2 JDPURKGEQMLZNC-HPMPOATDSA-N 0.000 description 1
- KQZSMOGWYFPKCH-UJPCIWJBSA-N (8s,9s,10r,11s,13s,14s,17r)-17-acetyl-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthren-3-one Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)C[C@@H]2O KQZSMOGWYFPKCH-UJPCIWJBSA-N 0.000 description 1
- SYVFBJQHOGXAMY-XUCMERPOSA-N (8s,9s,10r,13s,14s,17s)-10,13-dimethyl-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)CC)[C@@]1(C)CC2 SYVFBJQHOGXAMY-XUCMERPOSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-BYPYZUCNSA-N 2-Methylbutanoic acid Natural products CC[C@H](C)C(O)=O WLAMNBDJUVNPJU-BYPYZUCNSA-N 0.000 description 1
- BUOQFXCDULYEDJ-UHFFFAOYSA-N 2-ethylhexanethioic s-acid Chemical compound CCCCC(CC)C(S)=O BUOQFXCDULYEDJ-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-M 3,3-dimethylbutanoate Chemical compound CC(C)(C)CC([O-])=O MLMQPDHYNJCQAO-UHFFFAOYSA-M 0.000 description 1
- MLMQPDHYNJCQAO-UHFFFAOYSA-N 3,3-dimethylbutyric acid Chemical compound CC(C)(C)CC(O)=O MLMQPDHYNJCQAO-UHFFFAOYSA-N 0.000 description 1
- YJESALUAHUVISI-UHFFFAOYSA-N 3,5-dimethylhexan-2-one Chemical compound CC(C)CC(C)C(C)=O YJESALUAHUVISI-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N 3-methyl-2-pentanone Chemical compound CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- LBVWMBBKFFQMRX-UHFFFAOYSA-N 4-chlorobenzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=C(Cl)C=C1 LBVWMBBKFFQMRX-UHFFFAOYSA-N 0.000 description 1
- PEQZEAWOMNXGCD-UHFFFAOYSA-N 4-fluorobenzenecarbothioic s-acid Chemical compound FC1=CC=C(C(S)=O)C=C1 PEQZEAWOMNXGCD-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAYZSLLQFKPMNQ-UHFFFAOYSA-M [Na+].CC(C)(C)C([O-])=S Chemical compound [Na+].CC(C)(C)C([O-])=S QAYZSLLQFKPMNQ-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229960000250 adipic acid Drugs 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- DGAODIKUWGRDBO-UHFFFAOYSA-N butanethioic s-acid Chemical compound CCCC(O)=S DGAODIKUWGRDBO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- RJKFOVLPORLFTN-UHFFFAOYSA-N progesterone acetate Natural products C1CC2=CC(=O)CCC2(C)C2C1C1CCC(C(=O)C)C1(C)CC2 RJKFOVLPORLFTN-UHFFFAOYSA-N 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 229940034238 utira Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J31/00—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring
- C07J31/006—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring not covered by C07J31/003
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7833959A FR2442856A1 (fr) | 1978-12-01 | 1978-12-01 | Procede de preparation de steroides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU180951B true HU180951B (en) | 1983-05-30 |
Family
ID=9215594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79SI1732A HU180951B (en) | 1978-12-01 | 1979-11-30 | Process for preparing acyl derivatives of steroid-21-thiols |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4269778A (OSRAM) |
| JP (1) | JPS5858359B2 (OSRAM) |
| AT (1) | AT370740B (OSRAM) |
| AU (1) | AU526109B2 (OSRAM) |
| BE (1) | BE880343A (OSRAM) |
| CA (1) | CA1124711A (OSRAM) |
| CH (1) | CH648329A5 (OSRAM) |
| DE (1) | DE2948142C2 (OSRAM) |
| DK (1) | DK160281C (OSRAM) |
| ES (1) | ES486325A1 (OSRAM) |
| FI (1) | FI67859C (OSRAM) |
| FR (1) | FR2442856A1 (OSRAM) |
| GB (1) | GB2037290B (OSRAM) |
| GR (1) | GR63585B (OSRAM) |
| HU (1) | HU180951B (OSRAM) |
| IL (1) | IL58778A (OSRAM) |
| IT (1) | IT1124356B (OSRAM) |
| NL (1) | NL7908634A (OSRAM) |
| PT (1) | PT70458A (OSRAM) |
| SE (1) | SE441833B (OSRAM) |
| YU (1) | YU40766B (OSRAM) |
| ZA (1) | ZA796226B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2510582B1 (fr) * | 1981-07-30 | 1986-05-30 | Sipsy | Steroides esterifies en la position 17 et thio-esterifies en la position 21, leur procede de preparation et leur application comme medicament |
| FR2529894B2 (fr) * | 1981-07-30 | 1986-07-25 | Jouveinal | Steroides esterifies en la position 17 et thio-esterifies en la position 21 et leur application comme medicament |
| FI80790C (fi) * | 1988-02-22 | 1990-07-10 | Matti Henttinen | Foerfarande och anordning foer bestaemning av ett spaors laege. |
| US5344651A (en) * | 1993-07-23 | 1994-09-06 | The Procter & Gamble Company | Cyproterone acetate thioacetate |
| US5439901A (en) * | 1993-07-23 | 1995-08-08 | The Procter & Gamble Company | Cyproterone thiopivalate |
| IES68868B2 (en) * | 1996-03-20 | 1996-07-24 | Losbanos Ltd | Manufacture of steroids |
| EP3153502B1 (fr) * | 2013-09-25 | 2018-12-19 | H4 Pharma | Procédé de synthèse d'un sel minéral de l'acide pivalique en tant que produit intermédiaire |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1187M (fr) * | 1961-03-17 | 1962-03-19 | Roussel Uclaf | Nouveau médicament notamment pour le traitement des manifestations inflammatoires d'origine rhumatismale arthritique ou infectieuse. |
| CH566349A5 (OSRAM) * | 1969-12-24 | 1975-09-15 | Ciba Geigy Ag | |
| US3803133A (en) * | 1972-12-15 | 1974-04-09 | Squibb & Sons Inc | 21-sulfinyl steroids |
| FR2231374B1 (OSRAM) * | 1973-05-30 | 1976-10-22 | Jouveinal Sa |
-
1978
- 1978-12-01 FR FR7833959A patent/FR2442856A1/fr active Granted
-
1979
- 1979-11-15 PT PT70458A patent/PT70458A/pt unknown
- 1979-11-19 ZA ZA00796226A patent/ZA796226B/xx unknown
- 1979-11-20 US US06/096,153 patent/US4269778A/en not_active Expired - Lifetime
- 1979-11-22 AU AU53116/79A patent/AU526109B2/en not_active Expired
- 1979-11-22 IL IL58778A patent/IL58778A/xx unknown
- 1979-11-22 GR GR60575A patent/GR63585B/el unknown
- 1979-11-23 IT IT12840/79A patent/IT1124356B/it active
- 1979-11-23 FI FI793683A patent/FI67859C/fi not_active IP Right Cessation
- 1979-11-26 ES ES486325A patent/ES486325A1/es not_active Expired
- 1979-11-27 YU YU2901/79A patent/YU40766B/xx unknown
- 1979-11-28 NL NL7908634A patent/NL7908634A/nl active Search and Examination
- 1979-11-29 BE BE6/47023A patent/BE880343A/fr not_active IP Right Cessation
- 1979-11-29 DE DE2948142A patent/DE2948142C2/de not_active Expired
- 1979-11-29 CH CH10632/79A patent/CH648329A5/fr not_active IP Right Cessation
- 1979-11-29 SE SE7909852A patent/SE441833B/sv not_active IP Right Cessation
- 1979-11-30 CA CA340,967A patent/CA1124711A/en not_active Expired
- 1979-11-30 GB GB7941360A patent/GB2037290B/en not_active Expired
- 1979-11-30 AT AT0760479A patent/AT370740B/de not_active IP Right Cessation
- 1979-11-30 HU HU79SI1732A patent/HU180951B/hu unknown
- 1979-11-30 DK DK511279A patent/DK160281C/da active
- 1979-12-01 JP JP54154995A patent/JPS5858359B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2442856B1 (OSRAM) | 1981-05-22 |
| YU290179A (en) | 1983-01-21 |
| DK160281C (da) | 1991-07-29 |
| JPS5579399A (en) | 1980-06-14 |
| JPS5858359B2 (ja) | 1983-12-24 |
| AU5311679A (en) | 1980-06-05 |
| IT7912840A0 (it) | 1979-11-23 |
| BE880343A (fr) | 1980-05-29 |
| GB2037290A (en) | 1980-07-09 |
| FI793683A7 (fi) | 1980-06-02 |
| IL58778A0 (en) | 1980-02-29 |
| GR63585B (en) | 1979-11-23 |
| AT370740B (de) | 1983-04-25 |
| DK511279A (da) | 1980-06-02 |
| IT1124356B (it) | 1986-05-07 |
| DE2948142C2 (de) | 1982-06-24 |
| FR2442856A1 (fr) | 1980-06-27 |
| US4269778A (en) | 1981-05-26 |
| ZA796226B (en) | 1981-06-24 |
| DK160281B (da) | 1991-02-18 |
| SE7909852L (sv) | 1980-06-02 |
| CA1124711A (en) | 1982-06-01 |
| ATA760479A (de) | 1982-09-15 |
| FI67859C (fi) | 1985-06-10 |
| IL58778A (en) | 1982-11-30 |
| PT70458A (fr) | 1979-12-01 |
| SE441833B (sv) | 1985-11-11 |
| YU40766B (en) | 1986-06-30 |
| CH648329A5 (fr) | 1985-03-15 |
| NL7908634A (nl) | 1980-06-03 |
| DE2948142A1 (de) | 1980-06-04 |
| FI67859B (fi) | 1985-02-28 |
| AU526109B2 (en) | 1982-12-16 |
| GB2037290B (en) | 1983-02-09 |
| ES486325A1 (es) | 1980-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL119050B1 (en) | Process for preparing corticosteroid derivatives | |
| AU2007298770B2 (en) | Processes for the preparation of ciclesonide and its crystal form | |
| CA1310009C (en) | Ester prodrugs of steroids | |
| US4650610A (en) | Androstane carbothioic acids | |
| CA1202300A (en) | Corticosteroid derivatives | |
| JP3734090B2 (ja) | 新規シリル化合物およびその使用 | |
| US3988365A (en) | Resolution of 2-(6-methoxy-2-napthyl)propionic acid | |
| JPH05170788A (ja) | プレグナ−1,4−ジエン−3,20−ジオンの新規なステロイド誘導体、それらの製造、置換16,17−メチレンジオキシ誘導体の製造へのそれらの使用及び新規な中間体 | |
| US4269778A (en) | Process for the preparation of steroids | |
| CH639981A5 (it) | Procedimento per la preparazione di 6-alfa-alo-3-cheto-delta-1,4-pregnadieni. | |
| US5159091A (en) | Process for preparing 21-desoxyprednisolone 17-esters | |
| HU184189B (en) | Process for preparing pregnane derivatives substituted in position 17 | |
| JPS5940840B2 (ja) | アンドロスタン系の新規なジエン誘導体の製造法 | |
| RU2333217C2 (ru) | СПОСОБ ПОЛУЧЕНИЯ 6α, 9α-ДИФТОР-17α-(1-ОКСО-ПРОПОКСИ)-11β-ГИДРОКСИ-16α-МЕТИЛ-3-ОКСО-АНДРОСТ-1,4-ДИЕН-17β-КАРБОТИОНОВОЙ КИСЛОТЫ | |
| KR830002060B1 (ko) | 스테로이드의 제조방법 | |
| CS252474B2 (en) | Method of 17-halogenethinylsteroides production | |
| NL8102602A (nl) | Werkwijze voor selectieve solvolyse. | |
| US4011315A (en) | 21-acetals and mixed acetals of steroidal 21-aldehydes, intermediates and methods of preparation | |
| AU2004324237B2 (en) | Process for the esterification of a carbothioic acid | |
| CN100351266C (zh) | (11β,16β)-21-(3-羰基-3-氧代丙氧基) -11-羟基-2′-甲基-5′H-孕甾-1,4-二烯并[17,16-D]唑-3,20-二酮的制备方法 | |
| SE437020B (sv) | Forfarande for framstellning av substituerade fenylestrar av vissa prostaglandinanaloger av typ e?712 | |
| PL151850B1 (en) | Method for manufacturing 6-amine-1,2-dihydro-1-hydroxy-2-amine-4-piperidinepyrimidine | |
| US3932486A (en) | Substituted tolyl esters of PGA2 | |
| US5332847A (en) | Process for the preparation of 21-bromo-4-pregnene-3,20-dione derivatives | |
| US5602248A (en) | Process for preparation of 9α-chloro-11β-formyloxypregna-3,20-diones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |