GB915559A - Improvements in vacuum type circuit interrupters - Google Patents
Improvements in vacuum type circuit interruptersInfo
- Publication number
- GB915559A GB915559A GB24617/59A GB2461759A GB915559A GB 915559 A GB915559 A GB 915559A GB 24617/59 A GB24617/59 A GB 24617/59A GB 2461759 A GB2461759 A GB 2461759A GB 915559 A GB915559 A GB 915559A
- Authority
- GB
- United Kingdom
- Prior art keywords
- metals
- bismuth
- antimony
- mercury
- molybdenum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 abstract 6
- 229910052751 metal Inorganic materials 0.000 abstract 4
- 239000002184 metal Substances 0.000 abstract 4
- 229910045601 alloy Inorganic materials 0.000 abstract 3
- 239000000956 alloy Substances 0.000 abstract 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 abstract 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 abstract 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 abstract 2
- 229910052787 antimony Inorganic materials 0.000 abstract 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 abstract 2
- 229910052797 bismuth Inorganic materials 0.000 abstract 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 abstract 2
- 239000000470 constituent Substances 0.000 abstract 2
- 229910052802 copper Inorganic materials 0.000 abstract 2
- 239000010949 copper Substances 0.000 abstract 2
- 239000011133 lead Substances 0.000 abstract 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 abstract 2
- 229910052753 mercury Inorganic materials 0.000 abstract 2
- 150000002739 metals Chemical class 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- 229910052750 molybdenum Inorganic materials 0.000 abstract 2
- 239000011733 molybdenum Substances 0.000 abstract 2
- 229910052709 silver Inorganic materials 0.000 abstract 2
- 239000004332 silver Substances 0.000 abstract 2
- 229910052718 tin Inorganic materials 0.000 abstract 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 abstract 2
- 229910052721 tungsten Inorganic materials 0.000 abstract 2
- 239000010937 tungsten Substances 0.000 abstract 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 abstract 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 abstract 1
- 238000005275 alloying Methods 0.000 abstract 1
- 239000004411 aluminium Substances 0.000 abstract 1
- 229910052782 aluminium Inorganic materials 0.000 abstract 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 229910052793 cadmium Inorganic materials 0.000 abstract 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 abstract 1
- 229910052738 indium Inorganic materials 0.000 abstract 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 abstract 1
- 239000011777 magnesium Substances 0.000 abstract 1
- 229910052749 magnesium Inorganic materials 0.000 abstract 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 abstract 1
- 150000001247 metal acetylides Chemical class 0.000 abstract 1
- 229910052759 nickel Inorganic materials 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 239000003870 refractory metal Substances 0.000 abstract 1
- 229910052725 zinc Inorganic materials 0.000 abstract 1
- 239000011701 zinc Substances 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/60—Switches wherein the means for extinguishing or preventing the arc do not include separate means for obtaining or increasing flow of arc-extinguishing fluid
- H01H33/66—Vacuum switches
- H01H33/664—Contacts; Arc-extinguishing means, e.g. arcing rings
- H01H33/6643—Contacts; Arc-extinguishing means, e.g. arcing rings having disc-shaped contacts subdivided in petal-like segments, e.g. by helical grooves
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B1/00—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H1/00—Contacts
- H01H1/02—Contacts characterised by the material thereof
- H01H1/0203—Contacts characterised by the material thereof specially adapted for vacuum switches
Landscapes
- High-Tension Arc-Extinguishing Switches Without Spraying Means (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
- Thermistors And Varistors (AREA)
- Measuring Fluid Pressure (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US750615A US3016436A (en) | 1958-07-24 | 1958-07-24 | Vacuum circuit interrupters |
| US750784A US2975256A (en) | 1958-07-24 | 1958-07-24 | Vacuum type circuit interrupter |
| US750614A US2975255A (en) | 1958-07-24 | 1958-07-24 | Vacuum circuit interrupters |
| US76921558A | 1958-10-23 | 1958-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB915559A true GB915559A (en) | 1963-01-16 |
Family
ID=27505654
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB24637/59A Expired GB915560A (en) | 1958-07-24 | 1959-07-17 | Improvements in vacuum circuit interrupters |
| GB24617/59A Expired GB915559A (en) | 1958-07-24 | 1959-07-17 | Improvements in vacuum type circuit interrupters |
| GB35675/59A Expired GB922012A (en) | 1958-07-24 | 1959-10-21 | Improvements in vacuum-type circuit interrupter |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB24637/59A Expired GB915560A (en) | 1958-07-24 | 1959-07-17 | Improvements in vacuum circuit interrupters |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB35675/59A Expired GB922012A (en) | 1958-07-24 | 1959-10-21 | Improvements in vacuum-type circuit interrupter |
Country Status (8)
| Country | Link |
|---|---|
| US (3) | US3016436A (enExample) |
| BE (2) | BE580492A (enExample) |
| CH (3) | CH384053A (enExample) |
| DE (3) | DE1074120B (enExample) |
| ES (2) | ES250963A1 (enExample) |
| FR (3) | FR76858E (enExample) |
| GB (3) | GB915560A (enExample) |
| NL (3) | NL241568A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2323213A (en) * | 1997-03-10 | 1998-09-16 | Gec Alsthom Ltd | Vacuum switching device |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3182156A (en) * | 1961-09-19 | 1965-05-04 | Gen Electric | Vacuum-type circuit interrupter |
| US3234351A (en) * | 1961-10-19 | 1966-02-08 | Gen Electric | Vacuum devices having arc electrodes free of adsorbed gas and gas-forming constituents |
| GB1020914A (en) * | 1961-11-10 | 1966-02-23 | Gen Electric | Improvements in vacuum circuit interrupter |
| US3163734A (en) * | 1962-01-26 | 1964-12-29 | Gen Electric | Vacuum-type circuit interrupter with improved vapor-condensing shielding |
| US3210505A (en) * | 1962-04-03 | 1965-10-05 | Gen Electric | Electrode structure for an electric circuit interrupter |
| NL299341A (enExample) * | 1964-03-11 | |||
| FR1385794A (fr) * | 1963-01-30 | 1965-01-15 | Thomson Houston Comp Francaise | Perfectionnements apportés à un interrupteur de circuit électrique du type interrupteur à vide |
| US3313620A (en) * | 1963-02-18 | 1967-04-11 | E I Te R S P A Elettochimica I | Steel with lead and rare earth metals |
| GB1047706A (en) * | 1963-06-14 | 1966-11-09 | Gen Electric Co Ltd | Improvements in or relating to electrical devices wherein an electric arc may be produced in operation |
| GB1087074A (en) * | 1963-07-18 | 1967-10-11 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| GB1065886A (en) * | 1963-10-11 | 1967-04-19 | Ass Elect Ind | Improvements relating to vacuum-switch contacts |
| US3283103A (en) * | 1963-12-06 | 1966-11-01 | Gen Electric | Means for controlling phase relationship between flux and current in a vacuum interrupter |
| US3225167A (en) * | 1964-03-16 | 1965-12-21 | Gen Electric | Vacuum circuit breaker with arc rotation contact means |
| GB1079013A (en) * | 1964-04-21 | 1967-08-09 | English Electric Co Ltd | Improvements in or relating to contacts and electrodes |
| DE1228697B (de) * | 1964-07-13 | 1966-11-17 | English Electric Co Ltd | Druckgasschalter |
| GB1100259A (en) * | 1965-02-16 | 1968-01-24 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| GB1078657A (en) * | 1965-06-30 | 1967-08-09 | Ass Elect Ind | Grain refinement process for copper-bismuth alloys |
| NL6511914A (enExample) * | 1965-09-13 | 1967-03-14 | ||
| JPS451489B1 (enExample) * | 1966-03-28 | 1970-01-19 | ||
| GB1194674A (en) * | 1966-05-27 | 1970-06-10 | English Electric Co Ltd | Vacuum Type Electric Circuit Interrupting Devices |
| US3497755A (en) * | 1966-07-01 | 1970-02-24 | Gen Electric | Vacuum devices with electrode members containing oxygen - reactive minor constitutent |
| US3369094A (en) * | 1966-07-15 | 1968-02-13 | Metcom Inc | Gallium metal contact switch |
| US3514559A (en) * | 1967-03-27 | 1970-05-26 | Mc Graw Edison Co | Vacuum type circuit interrupter |
| US3389359A (en) * | 1967-04-19 | 1968-06-18 | Gen Electric | Change of state current limiter devices with stacked segment construction |
| US3389360A (en) * | 1967-04-19 | 1968-06-18 | Gen Electric | Change of state current limiter having flat plate construction |
| US3502465A (en) * | 1967-05-24 | 1970-03-24 | Mitsubishi Electric Corp | Contact alloys for vacuum circuit interrupters |
| DE1558647B2 (de) * | 1967-08-05 | 1972-03-09 | Siemens Ag | Heterogenes durchdringungsverbundmetall als kontaktwerkstoff fuer vakuumschalter |
| GB1257417A (enExample) * | 1970-03-20 | 1971-12-15 | ||
| US3663775A (en) * | 1970-03-24 | 1972-05-16 | Gen Electric | Vacuum interrupter with contacts containing a minor percentage of aluminum |
| US3686456A (en) * | 1970-04-09 | 1972-08-22 | Gen Electric | Contact structure for an electric circuit breaker |
| JPS555652B2 (enExample) * | 1974-06-26 | 1980-02-08 | ||
| JPS596449B2 (ja) * | 1976-05-27 | 1984-02-10 | 株式会社東芝 | 真空しや断器 |
| JPS52155373A (en) * | 1976-05-28 | 1977-12-23 | Tokyo Shibaura Electric Co | Vacuum breaker |
| SU705909A1 (ru) * | 1976-08-02 | 1992-10-07 | Предприятие П/Я Р-6517 | Система электродов дл вакуумного коммутационного прибора |
| JPS5519710A (en) * | 1978-07-28 | 1980-02-12 | Hitachi Ltd | Vacuum breaker electrode |
| US4426560A (en) | 1980-11-13 | 1984-01-17 | Westinghouse Electric Corp. | Reduced pressure electrical switch |
| JPS5848323A (ja) | 1981-09-16 | 1983-03-22 | 三菱電機株式会社 | 真空開閉器用接点 |
| JPS58108622A (ja) * | 1981-12-21 | 1983-06-28 | 三菱電機株式会社 | 真空開閉器用電極材料 |
| DE3428276A1 (de) * | 1984-08-01 | 1986-02-06 | Doduco KG Dr. Eugen Dürrwächter, 7530 Pforzheim | Werkstoff fuer elektrische kontakte auf der basis von silber mit wolframkarbid und verfahren zu seiner herstellung |
| US4551395A (en) * | 1984-09-07 | 1985-11-05 | D.A.B. Industries, Inc. | Bearing materials |
| DE3435637A1 (de) * | 1984-09-28 | 1986-04-10 | Calor-Emag Elektrizitäts-Aktiengesellschaft, 4030 Ratingen | Kontaktanordnung fuer vakuumschalter |
| DE3576833D1 (de) * | 1985-11-04 | 1990-05-03 | Jpi Transport Prod | Werkstoffe fuer lager. |
| EP0234246A1 (de) * | 1986-01-30 | 1987-09-02 | Siemens Aktiengesellschaft | Schaltkontaktstücke für Vakuumschaltgeräte und Verfahren zu deren Herstellung |
| US4940862A (en) * | 1989-10-26 | 1990-07-10 | Westinghouse Electric Corp. | Vacuum interrupter with improved vapor shield for gas adsorption |
| JP2778826B2 (ja) * | 1990-11-28 | 1998-07-23 | 株式会社東芝 | 真空バルブ用接点材料 |
| US5288458A (en) * | 1991-03-01 | 1994-02-22 | Olin Corporation | Machinable copper alloys having reduced lead content |
| EP0538896A3 (en) * | 1991-10-25 | 1993-11-18 | Meidensha Electric Mfg Co Ltd | Process for forming contact material |
| DE4447391C1 (de) * | 1994-12-23 | 1996-06-05 | Siemens Ag | Vakuumschalter |
| US5653827A (en) * | 1995-06-06 | 1997-08-05 | Starline Mfg. Co., Inc. | Brass alloys |
| TW200710905A (en) * | 2005-07-07 | 2007-03-16 | Hitachi Ltd | Electrical contacts for vacuum circuit breakers and methods of manufacturing the same |
| US10872739B2 (en) * | 2019-05-24 | 2020-12-22 | Frank P Stacom | Methods and systems for DC current interrupter based on thermionic arc extinction via anode ion depletion |
| CN110957154B (zh) * | 2019-05-29 | 2025-04-08 | 湖南长高电气有限公司 | 一种具有自动调整功能的导电结构 |
| DE102020208426B4 (de) | 2020-07-06 | 2023-10-12 | Siemens Aktiengesellschaft | Kurzschlussstrombegrenzer |
| FR3116938A1 (fr) * | 2020-11-30 | 2022-06-03 | Schneider Electric Industries Sas | Contact d’ampoule à vide à moyenne tension à coupure d’arc améliorée et ampoule à vide associée |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1334150A (en) * | 1916-07-11 | 1920-03-16 | Gen Electric | Electrical discharge-tube |
| US1481005A (en) * | 1918-06-18 | 1924-01-15 | Gen Electric | Protective device |
| GB153306A (en) * | 1919-10-31 | 1921-09-29 | Firm Of Kunheim And Co | Igniter or sparker of cerium metal alloys for pyrophoric ignition devices and the like |
| US1901639A (en) * | 1923-04-06 | 1933-03-14 | Westinghouse Electric & Mfg Co | Vacuum circuit breaker |
| US1934458A (en) * | 1928-03-23 | 1933-11-07 | Gen Electric | High vacuum fuse |
| US1784303A (en) * | 1928-09-05 | 1930-12-09 | California Inst Of Techn | Alternating-power-current interrupter |
| US2027835A (en) * | 1932-10-12 | 1936-01-14 | Gen Electric | Vacuum switch and method of fabricating the same |
| US2049500A (en) * | 1935-02-23 | 1936-08-04 | Mallory & Co Inc P R | Alloy |
| US2156974A (en) * | 1935-06-12 | 1939-05-02 | Gilbert E Doan | Method of and apparatus for nonarcing circuit interruption |
| US2121180A (en) * | 1935-11-21 | 1938-06-21 | Siemens Ag | Method for gettering vacuum tubes |
| US2200855A (en) * | 1939-05-02 | 1940-05-14 | Ruben Samuel | Electrical contact |
| US2419469A (en) * | 1943-04-24 | 1947-04-22 | Gen Electric | Manufacturing method for electrical contacts |
| US2888741A (en) * | 1955-03-22 | 1959-06-02 | American Metallurg Products Co | Alloys |
| DE1048625B (enExample) * | 1956-04-17 |
-
0
- NL NL244627D patent/NL244627A/xx unknown
- NL NL241567D patent/NL241567A/xx unknown
-
1958
- 1958-07-24 US US750615A patent/US3016436A/en not_active Expired - Lifetime
- 1958-07-24 US US750614A patent/US2975255A/en not_active Expired - Lifetime
- 1958-07-24 US US750784A patent/US2975256A/en not_active Expired - Lifetime
-
1959
- 1959-07-02 DE DE1959G0027419 patent/DE1074120B/de active Pending
- 1959-07-03 DE DEG27420A patent/DE1081950B/de active Pending
- 1959-07-08 BE BE580492A patent/BE580492A/fr unknown
- 1959-07-09 BE BE580532A patent/BE580532R/fr active
- 1959-07-17 GB GB24637/59A patent/GB915560A/en not_active Expired
- 1959-07-17 GB GB24617/59A patent/GB915559A/en not_active Expired
- 1959-07-22 ES ES0250963A patent/ES250963A1/es not_active Expired
- 1959-07-23 CH CH7613259A patent/CH384053A/de unknown
- 1959-07-23 CH CH7613359A patent/CH424918A/de unknown
- 1959-07-23 NL NL241568D patent/NL241568A/xx unknown
- 1959-07-23 ES ES0251010A patent/ES251010A2/es not_active Expired
- 1959-07-24 FR FR801035A patent/FR76858E/fr not_active Expired
- 1959-07-24 FR FR801033A patent/FR1234382A/fr not_active Expired
- 1959-10-15 FR FR807568A patent/FR76868E/fr not_active Expired
- 1959-10-21 GB GB35675/59A patent/GB922012A/en not_active Expired
- 1959-10-22 DE DEG28207A patent/DE1088132B/de active Pending
- 1959-10-22 CH CH7972259A patent/CH423925A/de unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2323213A (en) * | 1997-03-10 | 1998-09-16 | Gec Alsthom Ltd | Vacuum switching device |
| GB2323213B (en) * | 1997-03-10 | 2001-10-17 | Gec Alsthom Ltd | Vacuum switching device |
| US6326573B1 (en) | 1997-03-10 | 2001-12-04 | Gec Alsthom Limited | Vacuum switching device |
Also Published As
| Publication number | Publication date |
|---|---|
| ES251010A2 (es) | 1960-01-16 |
| US2975256A (en) | 1961-03-14 |
| GB922012A (en) | 1963-03-27 |
| US3016436A (en) | 1962-01-09 |
| NL241568A (enExample) | 1965-05-25 |
| FR76858E (fr) | 1961-12-15 |
| US2975255A (en) | 1961-03-14 |
| CH423925A (de) | 1966-11-15 |
| DE1088132B (de) | 1960-09-01 |
| DE1081950B (de) | 1960-05-19 |
| FR76868E (fr) | 1961-12-15 |
| CH384053A (de) | 1964-11-15 |
| BE580532R (fr) | 1959-11-03 |
| FR1234382A (fr) | 1960-10-17 |
| NL241567A (enExample) | |
| NL244627A (enExample) | |
| GB915560A (en) | 1963-01-16 |
| DE1074120B (de) | 1960-01-28 |
| BE580492A (fr) | 1959-11-03 |
| CH424918A (de) | 1966-11-30 |
| ES250963A1 (es) | 1959-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB915559A (en) | Improvements in vacuum type circuit interrupters | |
| GB1194674A (en) | Vacuum Type Electric Circuit Interrupting Devices | |
| US3379846A (en) | Electrodes for electric devices operable in a vacuum | |
| US2470034A (en) | Electric contact formed of a ruthenium composition | |
| US3551622A (en) | Alloy materials for electrodes of vacuum circuit breakers | |
| US2241262A (en) | Electrical contact | |
| US2057604A (en) | Electrical switch contact | |
| US4299889A (en) | Contact for vacuum interrupter | |
| US2796495A (en) | Electrical contact elements | |
| GB1438698A (en) | Metallic composite materials | |
| US3411902A (en) | Method of producing infiltrated contact material | |
| US2664618A (en) | Electrical contact | |
| GB1388700A (en) | Vacuum switches | |
| GB1032519A (en) | An electric two-layer sintered contact body having high resistance to welding | |
| US3281563A (en) | Vacuum switch having an improved electrode tip | |
| US2818633A (en) | Electrical contact | |
| GB1270719A (en) | Improvements in vacuum type circuit interrupter | |
| GB1219204A (en) | Sealed mercury-wetted contact device | |
| GB1213759A (en) | Improvements in vacuum-type circuit interrupter with contacts containing a refractory metal | |
| GB1309197A (en) | Vacuum interrupter contacts | |
| US3225169A (en) | Silver-refractory metal electrical contact having refractory metal carbide in the marginal layer of its active contact face | |
| GB1224848A (en) | Improvements in or relating to electrodes for vacuum switches | |
| US3811939A (en) | Method for the manufacture of heterogeneous penetration compound metal | |
| GB1346758A (en) | Vacuum interrupter contacts | |
| GB1388283A (en) | Vacuum type electric circuit interrupting devices |