GB835253A - Improvements relating to vacuum electric switches - Google Patents
Improvements relating to vacuum electric switchesInfo
- Publication number
- GB835253A GB835253A GB11677/56A GB1167756A GB835253A GB 835253 A GB835253 A GB 835253A GB 11677/56 A GB11677/56 A GB 11677/56A GB 1167756 A GB1167756 A GB 1167756A GB 835253 A GB835253 A GB 835253A
- Authority
- GB
- United Kingdom
- Prior art keywords
- tungsten
- copper
- volts
- voltages
- bodies
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 abstract 8
- 229910052721 tungsten Inorganic materials 0.000 abstract 8
- 239000010937 tungsten Substances 0.000 abstract 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract 7
- 229910052802 copper Inorganic materials 0.000 abstract 7
- 239000010949 copper Substances 0.000 abstract 7
- 239000000463 material Substances 0.000 abstract 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 abstract 5
- 229910000831 Steel Inorganic materials 0.000 abstract 5
- 229910052750 molybdenum Inorganic materials 0.000 abstract 5
- 239000011733 molybdenum Substances 0.000 abstract 5
- 239000010959 steel Substances 0.000 abstract 5
- 239000000203 mixture Substances 0.000 abstract 3
- 239000004411 aluminium Substances 0.000 abstract 2
- 229910052782 aluminium Inorganic materials 0.000 abstract 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 2
- 229910000497 Amalgam Inorganic materials 0.000 abstract 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 abstract 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 abstract 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 abstract 1
- 230000001464 adherent effect Effects 0.000 abstract 1
- 229910052785 arsenic Inorganic materials 0.000 abstract 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 abstract 1
- 229910052797 bismuth Inorganic materials 0.000 abstract 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 abstract 1
- 229910052793 cadmium Inorganic materials 0.000 abstract 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000012530 fluid Substances 0.000 abstract 1
- 239000011777 magnesium Substances 0.000 abstract 1
- 229910052749 magnesium Inorganic materials 0.000 abstract 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 abstract 1
- 229910052753 mercury Inorganic materials 0.000 abstract 1
- 229910052709 silver Inorganic materials 0.000 abstract 1
- 239000004332 silver Substances 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- 229910052725 zinc Inorganic materials 0.000 abstract 1
- 239000011701 zinc Substances 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H1/00—Contacts
- H01H1/02—Contacts characterised by the material thereof
- H01H1/0203—Contacts characterised by the material thereof specially adapted for vacuum switches
Landscapes
- High-Tension Arc-Extinguishing Switches Without Spraying Means (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB345930X | 1956-04-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB835253A true GB835253A (en) | 1960-05-18 |
Family
ID=10367562
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB11677/56A Expired GB835253A (en) | 1956-04-17 | 1956-04-17 | Improvements relating to vacuum electric switches |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2900476A (enrdf_load_stackoverflow) |
| BE (1) | BE556719A (enrdf_load_stackoverflow) |
| CH (1) | CH345930A (enrdf_load_stackoverflow) |
| DE (1) | DE1048625B (enrdf_load_stackoverflow) |
| FR (1) | FR1175455A (enrdf_load_stackoverflow) |
| GB (1) | GB835253A (enrdf_load_stackoverflow) |
| IT (1) | IT570073A (enrdf_load_stackoverflow) |
| NL (1) | NL216321A (enrdf_load_stackoverflow) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1210933B (de) * | 1963-01-30 | 1966-06-17 | Gen Electric | Vakuumschalter |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2975254A (en) * | 1958-06-25 | 1961-03-14 | Allis Chalmers Mfg Co | Spring bearing for vacuumized electric devices |
| NL241567A (enrdf_load_stackoverflow) * | 1958-07-24 | |||
| US3021407A (en) * | 1958-09-16 | 1962-02-13 | Jennings Radio Mfg Corp | Vacuumized electric switch |
| US2979587A (en) * | 1958-10-28 | 1961-04-11 | Jennings Radio Mfg Corp | Vacuum electric switch |
| US2979588A (en) * | 1958-12-09 | 1961-04-11 | Jennings Radio Mfg Corp | Vacuum switch |
| US3014107A (en) * | 1959-01-02 | 1961-12-19 | Gen Electric | Vacuum switch |
| US3151225A (en) * | 1960-03-07 | 1964-09-29 | Gerhard W Senlen | Shielding means for an electromagnetic electrical contactor |
| US3026394A (en) * | 1959-11-10 | 1962-03-20 | Jennings Radio Mfg Corp | Vacuumized electric switch |
| US3038980A (en) * | 1959-12-17 | 1962-06-12 | Gen Electric | Vacuum-type circuit interrupter |
| US3089936A (en) * | 1960-02-23 | 1963-05-14 | Gen Electric | Contact structure for an electric circuit interrupter |
| US3163736A (en) * | 1961-05-23 | 1964-12-29 | S & C Electric Co | High voltage gas type circuit interrupter |
| GB978973A (en) * | 1961-06-30 | 1965-01-01 | English Electric Co Ltd | Improvements in and relating to vacuum electric switches |
| US3182156A (en) * | 1961-09-19 | 1965-05-04 | Gen Electric | Vacuum-type circuit interrupter |
| US3234351A (en) * | 1961-10-19 | 1966-02-08 | Gen Electric | Vacuum devices having arc electrodes free of adsorbed gas and gas-forming constituents |
| US3163734A (en) * | 1962-01-26 | 1964-12-29 | Gen Electric | Vacuum-type circuit interrupter with improved vapor-condensing shielding |
| US3210505A (en) * | 1962-04-03 | 1965-10-05 | Gen Electric | Electrode structure for an electric circuit interrupter |
| US3185797A (en) * | 1962-07-17 | 1965-05-25 | Gen Electric | Vacuum-type circuit interrupter with improved arc splitting means |
| US3140374A (en) * | 1962-09-20 | 1964-07-07 | Fred H Cole | Circuit breaker interrupter |
| GB993737A (en) * | 1963-04-23 | 1965-06-02 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| US3194932A (en) * | 1963-05-07 | 1965-07-13 | Bell Telephone Labor Inc | Contacts for mercury switches including mercury recovery cowls |
| GB1087074A (en) * | 1963-07-18 | 1967-10-11 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| GB1065886A (en) * | 1963-10-11 | 1967-04-19 | Ass Elect Ind | Improvements relating to vacuum-switch contacts |
| US3225167A (en) * | 1964-03-16 | 1965-12-21 | Gen Electric | Vacuum circuit breaker with arc rotation contact means |
| GB1100259A (en) * | 1965-02-16 | 1968-01-24 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| DE1244914B (de) * | 1965-09-29 | 1967-07-20 | Licentia Gmbh | Vakuumschalter |
| GB1142200A (en) * | 1965-11-17 | 1969-02-05 | Ass Elect Ind | Improvements relating to vacuum switch contacts |
| GB1194674A (en) * | 1966-05-27 | 1970-06-10 | English Electric Co Ltd | Vacuum Type Electric Circuit Interrupting Devices |
| US3454811A (en) * | 1967-04-18 | 1969-07-08 | Bell Telephone Labor Inc | Gas tube surge (overload) protection device |
| US3612795A (en) * | 1969-01-09 | 1971-10-12 | Westinghouse Electric Corp | Shielding arrangements for vacuum-type circuit interrupters of the two-contact type |
| US3670129A (en) * | 1970-08-17 | 1972-06-13 | Westinghouse Electric Corp | Electrical contact members |
| US3674969A (en) * | 1971-08-04 | 1972-07-04 | Honeywell Inc | Stainless steel snap acting mechanism with low resistance electrical path |
| US3783213A (en) * | 1972-04-27 | 1974-01-01 | Gen Electric | Vacuum type electric circuit interrupter |
| US3980850A (en) * | 1974-12-19 | 1976-09-14 | Westinghouse Electric Corporation | Vacuum interrupter with cup-shaped contact having an inner arc controlling electrode |
| US4061894A (en) * | 1976-04-28 | 1977-12-06 | General Electric Company | Vacuum-type circuit interrupter with improved protection for bellows |
| DE2619459C3 (de) * | 1976-05-03 | 1978-11-09 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Sinterverbundwerkstoff als Kontaktwerkstoff für Vakuum-Mittelspannungs-Leistungsschalter |
| US4384179A (en) * | 1981-02-12 | 1983-05-17 | Westinghouse Electric Corp. | Stiff flexible connector for a circuit breaker or other electrical apparatus |
| US4376235A (en) * | 1981-02-12 | 1983-03-08 | Westinghouse Electric Corp. | Electrical junction of high conductivity for a circuit breaker or other electrical apparatus |
| DE3215020A1 (de) * | 1982-04-22 | 1983-10-27 | Calor-Emag Elektrizitäts-Aktiengesellschaft, 4030 Ratingen | Vakuumschalter |
| DE3528890A1 (de) * | 1985-08-12 | 1987-02-19 | Siemens Ag | Kontaktstueck |
| US4665287A (en) * | 1985-11-08 | 1987-05-12 | General Electric Company | Shield assembly of a vacuum interrupter |
| US4695688A (en) * | 1986-03-24 | 1987-09-22 | General Electric Company | Electrical contact construction |
| US5903203A (en) * | 1997-08-06 | 1999-05-11 | Elenbaas; George H. | Electromechanical switch |
| WO2000058981A1 (de) * | 1999-03-29 | 2000-10-05 | Siemens Aktiengesellschaft | Schaltkontakt für elektrische schaltgeräte |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US550360A (en) * | 1895-11-26 | Alexander jay wurts | ||
| US1556573A (en) * | 1921-09-01 | 1925-10-13 | Westinghouse Electric & Mfg Co | Thermal relay and cut-out |
| US1648100A (en) * | 1925-04-17 | 1927-11-08 | Aichele Ernest | Composition of matter |
| BE350293A (enrdf_load_stackoverflow) * | 1927-04-20 | |||
| GB293018A (en) * | 1927-07-01 | 1929-08-29 | Arthur Scherbius | Improvements in and relating to electric switches |
| US1906602A (en) * | 1930-08-06 | 1933-05-02 | Gen Electric | Lightning arrester |
| US2064998A (en) * | 1935-08-27 | 1936-12-22 | Otis Elevator Co | Switch contact |
| US2253401A (en) * | 1937-10-09 | 1941-08-19 | Westinghouse Electric & Mfg Co | Circuit interrupter contact |
| US2234834A (en) * | 1937-10-09 | 1941-03-11 | Westinghouse Electric & Mfg Co | Electrical contact |
| US2294783A (en) * | 1940-04-13 | 1942-09-01 | Westinghouse Electric & Mfg Co | Contact member |
| US2370400A (en) * | 1941-09-25 | 1945-02-27 | Ite Circuit Breaker Ltd | Contact materials |
| GB591183A (en) * | 1944-01-08 | 1947-08-11 | Rene Pointout | Improvements in electric contacts |
| US2641670A (en) * | 1950-08-22 | 1953-06-09 | Gibson Electric Company | Serrated contact |
| US2794885A (en) * | 1954-12-13 | 1957-06-04 | Jennings Radio Mfg Corp | Vacuum switch |
-
0
- NL NL216321D patent/NL216321A/xx unknown
- IT IT570073D patent/IT570073A/it unknown
- BE BE556719D patent/BE556719A/xx unknown
- DE DENDAT1048625D patent/DE1048625B/de active Pending
-
1956
- 1956-04-17 GB GB11677/56A patent/GB835253A/en not_active Expired
-
1957
- 1957-04-08 US US651280A patent/US2900476A/en not_active Expired - Lifetime
- 1957-04-12 CH CH345930D patent/CH345930A/fr unknown
- 1957-04-15 FR FR1175455D patent/FR1175455A/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1210933B (de) * | 1963-01-30 | 1966-06-17 | Gen Electric | Vakuumschalter |
Also Published As
| Publication number | Publication date |
|---|---|
| US2900476A (en) | 1959-08-18 |
| CH345930A (fr) | 1960-04-30 |
| NL216321A (enrdf_load_stackoverflow) | |
| IT570073A (enrdf_load_stackoverflow) | |
| DE1048625B (enrdf_load_stackoverflow) | |
| BE556719A (enrdf_load_stackoverflow) | |
| FR1175455A (fr) | 1959-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB835253A (en) | Improvements relating to vacuum electric switches | |
| GB922012A (en) | Improvements in vacuum-type circuit interrupter | |
| GB1329725A (en) | Electrical switch for high voltages | |
| GB1519046A (en) | Shorting switch for low voltage application | |
| GB1103619A (en) | Improvements in or relating to vacuum-type circuit interrupters | |
| GB1142200A (en) | Improvements relating to vacuum switch contacts | |
| GB1304443A (enrdf_load_stackoverflow) | ||
| GB978973A (en) | Improvements in and relating to vacuum electric switches | |
| GB993737A (en) | Improvements relating to vacuum switch contacts | |
| GB1136510A (en) | Improvements in or relating to vacuum switches | |
| GB758953A (en) | Improvements in or relating to direct current electric switching contacts | |
| GB1219805A (en) | Improvements in vacuum type circuit interrupter | |
| GB1084543A (en) | Improvements in and relating to electric switchgear | |
| GB758266A (en) | A high-voltage gas-blast electric circuit breaker | |
| GB1210542A (en) | Improvements relating to vacuum electric switches | |
| GB1161443A (en) | Improvements in Vacuum Type Circuit Interrupters | |
| ES320310A1 (es) | Un metodo para fabricar un tiristor semiconductor | |
| GB1185872A (en) | Improvements in or relating to Vacuum Electric Devices | |
| GB816309A (en) | Air blast electric circuit breaker for high voltages | |
| GB927395A (en) | Improvements relating to the transmission of electric current between conductor members of solid and liquid forms respectively | |
| GB967737A (en) | Improvements in and relating to electrical vacuum switches | |
| GB1040571A (en) | Improvements relating to relays and electrical contact assemblies therefor | |
| GB1163272A (en) | Improvements in or relating to Electric Switches | |
| GB1359072A (en) | Electrical switch having pivoted arm contact | |
| CA627780A (en) | Current conductive spring bearing for vacuum switch contacts |