GB1491274A - Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides - Google Patents
Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicidesInfo
- Publication number
- GB1491274A GB1491274A GB41560/75A GB4156075A GB1491274A GB 1491274 A GB1491274 A GB 1491274A GB 41560/75 A GB41560/75 A GB 41560/75A GB 4156075 A GB4156075 A GB 4156075A GB 1491274 A GB1491274 A GB 1491274A
- Authority
- GB
- United Kingdom
- Prior art keywords
- group
- substituted
- halogen atom
- formula
- moiety
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 phenoxy alkane carboxylic acid derivatives Chemical class 0.000 title abstract 4
- 239000004009 herbicide Substances 0.000 title 1
- 125000005843 halogen group Chemical group 0.000 abstract 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 7
- 125000000217 alkyl group Chemical group 0.000 abstract 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 5
- 125000003118 aryl group Chemical group 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000003277 amino group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 150000001768 cations Chemical class 0.000 abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 2
- 239000000463 material Substances 0.000 abstract 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 abstract 1
- 125000003302 alkenyloxy group Chemical group 0.000 abstract 1
- 125000003282 alkyl amino group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 abstract 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 abstract 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 abstract 1
- 150000002989 phenols Chemical class 0.000 abstract 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 abstract 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- 150000003222 pyridines Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11867674A JPS5327768B2 (en:Method) | 1974-10-17 | 1974-10-17 | |
| JP2955675A JPS51106735A (ja) | 1975-03-13 | 1975-03-13 | Josozai |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1491274A true GB1491274A (en) | 1977-11-09 |
Family
ID=26367766
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB41560/75A Expired GB1491274A (en) | 1974-10-17 | 1975-10-10 | Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US4046553A (en:Method) |
| AR (1) | AR209784A1 (en:Method) |
| AT (1) | AT350317B (en:Method) |
| AU (1) | AU496882B2 (en:Method) |
| BG (1) | BG28025A3 (en:Method) |
| BR (1) | BR7506722A (en:Method) |
| CA (1) | CA1061786A (en:Method) |
| CH (1) | CH616662A5 (en:Method) |
| CS (1) | CS189723B2 (en:Method) |
| DD (1) | DD123425A5 (en:Method) |
| DE (1) | DE2546251A1 (en:Method) |
| DK (1) | DK154074C (en:Method) |
| EG (1) | EG12043A (en:Method) |
| ES (1) | ES456653A1 (en:Method) |
| FR (1) | FR2288089A1 (en:Method) |
| GB (1) | GB1491274A (en:Method) |
| IN (1) | IN143116B (en:Method) |
| IT (1) | IT1047828B (en:Method) |
| MX (1) | MX3476E (en:Method) |
| MY (1) | MY7800323A (en:Method) |
| NL (1) | NL166468C (en:Method) |
| NZ (1) | NZ178959A (en:Method) |
| OA (1) | OA05134A (en:Method) |
| PH (1) | PH12116A (en:Method) |
| PL (1) | PL99026B1 (en:Method) |
| RO (1) | RO68925A (en:Method) |
| SE (1) | SE426241C (en:Method) |
| SU (1) | SU634640A3 (en:Method) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3004770A1 (de) | 1979-02-22 | 1980-08-28 | Nissan Chemical Ind Ltd | Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselben |
| US4246419A (en) | 1978-02-15 | 1981-01-20 | Imperial Chemical Industries Limited | Herbicidal compounds |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083714A (en) * | 1974-10-17 | 1978-04-11 | Ishihara Sangyo Kaisha, Ltd. | Alkoxyalkyl esters of substituted pyridyloxyphenoxy-2-propanoic acids, herbicidal composition containing the same and method of use thereof |
| GB1512189A (en) * | 1975-10-29 | 1978-05-24 | Ishihara Mining & Chemical Co | Herbicidal composition and method of use thereof |
| JPS52131544A (en) | 1976-04-08 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxymalonic acid derivatives and herbicides containing them |
| JPS52131540A (en) * | 1976-04-14 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxyvaleric acid derivatives and herbicides therefrom |
| US4133675A (en) * | 1976-07-23 | 1979-01-09 | Ciba-Geigy Corporation | Pyridyloxy-phenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth |
| DE2640730C2 (de) | 1976-09-10 | 1983-08-25 | Hoechst Ag, 6230 Frankfurt | Benzoxazolyloxy- und Benzothiazolyloxy-phenoxy-Verbindungen und diese enthaltende herbizide Mittel |
| US4198416A (en) * | 1976-09-30 | 1980-04-15 | Meiji Seika Kaisha, Ltd. | 5-Alkoxy-picolinic esters and anti-hypertensive composition containing 5-alkoxy-picolinic esters |
| US4248618A (en) * | 1977-05-06 | 1981-02-03 | Ici Australia Limited | Derivatives of (pyrimidyloxy)phenoxy-alkanecarboxylic acid and herbicidal compositions thereof |
| DE2861073D1 (en) | 1977-06-29 | 1981-12-03 | Ciba Geigy Ag | Pyridyloxy-phenoxy-alkanoic acid derivatives , processes for their preparation and their use as herbicides or plant growth regulators |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| UA6300A1 (uk) * | 1977-07-21 | 1994-12-29 | Ісіхара Сангіо Кайся Лтд | Гербіцидний склад |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| US4149872A (en) * | 1977-07-21 | 1979-04-17 | Shell Oil Company | N-pyridinyl urea and cyclopropanecarboxamide herbicides |
| US4628099A (en) * | 1977-07-22 | 1986-12-09 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy propanoic acid chlorides |
| US4523017A (en) * | 1977-07-22 | 1985-06-11 | The Dow Chemical Company | Preparation of trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4479001A (en) * | 1977-07-22 | 1984-10-23 | The Dow Chemical Company | Trifluoromethyl pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof |
| US4491468A (en) * | 1977-07-22 | 1985-01-01 | The Dow Chemical Company | Herbicidal trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanenitriles and derivatives thereof |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0107866B1 (en) * | 1977-08-12 | 1988-03-30 | Imperial Chemical Industries Plc | Trihalomethylpyridine compounds |
| US4275212A (en) * | 1977-08-15 | 1981-06-23 | The Dow Chemical Company | Method of preparing pyridinyloxyphenols and derivatives |
| EP0002204B1 (de) * | 1977-11-24 | 1981-09-02 | Ciba-Geigy Ag | Alpha-phenoxy-propionthiolsäuren und Salze, ihre Herstellung und Verwendung als Herbizide oder Zwischenprodukte |
| DE2755536A1 (de) * | 1977-12-13 | 1979-06-21 | Ciba Geigy Ag | Neue herbizid und pflanzenregulatorisch wirksame pyridyloxy-phenoxy-propionsaeurederivate |
| US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
| JPS55500010A (en:Method) * | 1977-12-23 | 1980-01-17 | ||
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| DE2861615D1 (en) * | 1978-01-02 | 1982-03-11 | Ciba Geigy Ag | Phenoxy-alkyl oxazolines, their preparation, compositions containing them and their application as herbicides |
| DE2961917D1 (en) * | 1978-01-18 | 1982-03-11 | Ciba Geigy Ag | Herbicidal active unsaturated esters of 4- (3',5'-dihalogenpyridyl-(2')-oxy)-alpha-phenoxy propionic acids, process for their preparation, herbicidal compositions containing them and their use |
| AT379802B (de) * | 1978-01-27 | 1986-03-10 | Ciba Geigy Ag | Verfahren zur herstellung von neuen alpha-(pyridyloxy-phenoxy-propionsaeure-aminoalk l-estern |
| JPH0224818B2 (en:Method) * | 1978-02-15 | 1990-05-30 | Imuperiaru Chem Ind Plc | |
| DE2964580D1 (en) * | 1978-03-01 | 1983-03-03 | Ici Plc | Herbicidal pyridine compounds and herbicidal compositions containing them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| DE2961736D1 (en) * | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| JPS54144375A (en) * | 1978-04-27 | 1979-11-10 | Ishihara Sangyo Kaisha Ltd | 4-(5-trifluoromethyl-2-pyridyloxy)phenoxyalkane derivative and herbicide containing the same |
| JPS54163582A (en) * | 1978-06-09 | 1979-12-26 | Ishihara Mining & Chemical Co | 22phenoxyy55 trifluoromethypiridine compound |
| DE2963229D1 (en) * | 1978-06-29 | 1982-08-19 | Ciba Geigy Ag | Herbicidal, optically active r(+)-dichloropyridyloxy-alpha-phenoxy-propionic acid-propargylesters, process for their preparation and their use in herbicidal compositions |
| CA1114382A (en) * | 1978-07-03 | 1981-12-15 | Hermann Rempfler | Esters of 0-(pyridyloxy-phenyl)-lactic acids |
| US4272281A (en) * | 1978-07-20 | 1981-06-09 | Ciba-Geigy Corporation | Composition for and method of selectively controlling weeds in cereals |
| US4325728A (en) * | 1978-07-20 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal compositions containing N-(3-trifluoromethyl-1,2,4-thiadiazolyl-5)-N'-methyl-N'-methoxy urea and α-[4-(3'-5'-dichloropyridyl-2'-oxy)-phenoxy]-propionic acid propargyl ester for control of weeds in wheat cultures |
| US4284566A (en) * | 1979-01-04 | 1981-08-18 | Ciba-Geigy Corporation | Herbicidal α-[4-trifluoromethylphenoxy)-propionic acid γ-butyrolactone ester and thioester |
| US4236912A (en) * | 1979-03-05 | 1980-12-02 | The Dow Chemical Company | Quinolinyloxyphenoxy and quinolyinylthiophenoxy alkanoic acids and derivatives thereof and methods of herbicidal use |
| JPS55139361A (en) * | 1979-04-19 | 1980-10-31 | Ishihara Sangyo Kaisha Ltd | Preparation of 4-(pyridyl-2-oxy)phenoxyalkane-carboxylic acid or its derivative |
| WO1981000563A1 (en) * | 1979-08-23 | 1981-03-05 | Du Pont | Pyridinyloxyphenoxy lower alkenoic acids,esters or amides thereof as selective weed control agents |
| US4311513A (en) * | 1979-08-24 | 1982-01-19 | Ciba-Geigy Corporation | Herbicidal α-phenoxypropionylazoles, compositions containing them, and method of use thereof |
| US4266063A (en) * | 1979-12-17 | 1981-05-05 | E. I. Du Pont De Nemours And Company | Process for preparing substituted pyridinyloxy ether intermediate |
| WO1982000400A1 (en) * | 1980-07-30 | 1982-02-18 | Smith L | Method for selectively controlling grassy weeds in rice |
| US5364831A (en) * | 1980-08-06 | 1994-11-15 | Nissan Chemical Industries Ltd. | Quinoxaline derivatives and herbicidal composition |
| IL65708A (en) * | 1981-06-01 | 1986-01-31 | Dow Chemical Co | Process for making pyridyloxyphenol compounds |
| US4410701A (en) * | 1981-06-01 | 1983-10-18 | The Dow Chemical Company | Process for making pyridyloxyphenol compounds |
| DE3151589A1 (de) * | 1981-12-28 | 1983-07-07 | Basf Ag, 6700 Ludwigshafen | Diether von m- oder p-hydroxyphenolen und verfahren zur herstellung der diether oder monoether von m- oder p-hydroxyphenolen |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| JPS58183688A (ja) * | 1982-04-20 | 1983-10-26 | Nippon Tokushu Noyaku Seizo Kk | オキサジアゾ−ル誘導体、その製法及び除草剤 |
| IL68822A (en) * | 1982-06-18 | 1990-07-12 | Dow Chemical Co | Pyridyl(oxy/thio)phenoxy compounds,herbicidal compositions and methods of using them |
| IL71668A (en) * | 1983-05-13 | 1988-07-31 | Dow Chemical Co | Method of preparing esters of aryloxyphenoxy propanoic acid |
| US4681941A (en) * | 1983-05-13 | 1987-07-21 | The Dow Chemical Company | Method of preparing esters of aryloxyphenoxy propanoic acid |
| US4517368A (en) * | 1983-09-06 | 1985-05-14 | The Dow Chemical Company | 2,3-Dichloro-5-iodopyridine and methods of making and using the same |
| JPS60136561A (ja) * | 1983-11-28 | 1985-07-20 | ザ・ダウ・ケミカル・カンパニ− | 2−(4−〔(3−クロロ−5−ヨ−ド−2−ピリジニル)オキシ〕フエノキシ)プロピオン酸及びその誘導体並びにそれらの製造方法 |
| US4537620A (en) * | 1984-07-02 | 1985-08-27 | Stauffer Chemical Company | Aryloxyphenoxy proponyl isothioureas and use as herbicides |
| US4613356A (en) * | 1984-08-06 | 1986-09-23 | Stauffer Chemical Company | Aryloxyphenoxy propionylthioureas which are useful as herbicides |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| US5049675A (en) * | 1990-01-29 | 1991-09-17 | Dowelanco | Solvent-free process for the preparation of ((pyridinyloxy)phenoxy) propionate derivatives |
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| KR100884933B1 (ko) * | 2007-07-03 | 2009-02-23 | 주식회사경농 | 광활성 (r)-알릴옥시프로피온산 아마이드 화합물 및 이를포함하는 제초제 조성물 |
| US10543481B2 (en) | 2011-08-19 | 2020-01-28 | Trustees Of Princeton Univesity | Targeted, metal-catalyzed fluorination of complex compounds with fluoride ion via decarboxylation |
| CN108290840A (zh) * | 2015-12-01 | 2018-07-17 | 巴斯夫欧洲公司 | 作为杀真菌剂的吡啶化合物 |
| CN106632258B (zh) * | 2016-12-15 | 2019-04-02 | 三峡大学 | 四氢异喹啉-2-基芳氧基苯氧基烷基酮化合物及其应用 |
| CN110627782B (zh) * | 2019-10-14 | 2023-03-31 | 山东胜邦绿野化学有限公司 | 一种含二硫键的吡啶氧基苯氧基丙酰胺化合物的制备方法与应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH434868A (de) * | 1964-02-10 | 1967-04-30 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| GB1210151A (en) * | 1967-06-15 | 1970-10-28 | Ishihara Sangyo Co Ltd | Novel compounds of chloro- or methyl substituted pyridyl phenyl ethers |
| US3651072A (en) * | 1967-08-21 | 1972-03-21 | Monsanto Co | 3-(halophenoxy) pyridines |
| US3563998A (en) * | 1968-07-08 | 1971-02-16 | Sandoz Ag | 2 - (4 - (2',6' - diphenyl - 4 - pyridyl)phenoxy)-and 2 - (4 - (4',6' - diphenyl - 2 -pyridyl)phenoxy) lower aliphatic monocarbocylic acids and esters |
| US3609158A (en) * | 1969-03-17 | 1971-09-28 | Dow Chemical Co | Certain substituted (pyridyl)-oxy acetic acid derivatives |
| US3576616A (en) * | 1969-05-15 | 1971-04-27 | Monsanto Co | Herbicidal compositions and methods |
| JPS5517027B2 (en:Method) * | 1972-05-15 | 1980-05-08 | ||
| DE2223894C3 (de) * | 1972-05-17 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Herbizide Mittel auf Basis von Phenoxycarbonsäurederivaten |
| US3962265A (en) * | 1974-01-22 | 1976-06-08 | The Dow Chemical Company | H'-(4-((6-chloro-2-pyridinyl)oxy)phenyl)-n-methyl-n-(1-methyl-2-propynyl)urea |
| US3931201A (en) * | 1974-01-22 | 1976-01-06 | The Dow Chemical Company | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives |
-
1975
- 1975-10-09 DK DK454775A patent/DK154074C/da active
- 1975-10-10 AU AU85623/75A patent/AU496882B2/en not_active Expired
- 1975-10-10 GB GB41560/75A patent/GB1491274A/en not_active Expired
- 1975-10-15 NL NL7512095.A patent/NL166468C/xx not_active IP Right Cessation
- 1975-10-15 DE DE19752546251 patent/DE2546251A1/de active Granted
- 1975-10-15 CS CS756969A patent/CS189723B2/cs unknown
- 1975-10-15 BR BR7506722*A patent/BR7506722A/pt unknown
- 1975-10-15 IT IT7551774A patent/IT1047828B/it active
- 1975-10-15 NZ NZ178959A patent/NZ178959A/xx unknown
- 1975-10-16 CH CH1342875A patent/CH616662A5/de not_active IP Right Cessation
- 1975-10-16 MX MX006399U patent/MX3476E/es unknown
- 1975-10-16 CA CA237,770A patent/CA1061786A/en not_active Expired
- 1975-10-16 SE SE7511634A patent/SE426241C/xx not_active IP Right Cessation
- 1975-10-16 SU SU752180109A patent/SU634640A3/ru active
- 1975-10-16 AR AR260838A patent/AR209784A1/es active
- 1975-10-17 US US05/623,517 patent/US4046553A/en not_active Expired - Lifetime
- 1975-10-17 RO RO7583636A patent/RO68925A/ro unknown
- 1975-10-17 FR FR7531887A patent/FR2288089A1/fr active Granted
- 1975-10-17 BG BG031254A patent/BG28025A3/xx unknown
- 1975-10-17 AT AT790775A patent/AT350317B/de not_active IP Right Cessation
- 1975-10-17 DD DD188924A patent/DD123425A5/xx unknown
- 1975-10-17 PH PH17670A patent/PH12116A/en unknown
- 1975-10-17 OA OA55637A patent/OA05134A/xx unknown
- 1975-10-17 IN IN2013/CAL/1975A patent/IN143116B/en unknown
- 1975-10-17 PL PL1975184059A patent/PL99026B1/pl unknown
- 1975-10-18 EG EG613/75A patent/EG12043A/xx active
-
1977
- 1977-03-01 ES ES456653A patent/ES456653A1/es not_active Expired
-
1978
- 1978-12-30 MY MY323/78A patent/MY7800323A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4246419A (en) | 1978-02-15 | 1981-01-20 | Imperial Chemical Industries Limited | Herbicidal compounds |
| DE3004770A1 (de) | 1979-02-22 | 1980-08-28 | Nissan Chemical Ind Ltd | Phenoxyfettsaeurederivate vom typ heterocyclischer aether und herbizide mittel mit einem gehalt derselben |
| DE3051172C2 (en:Method) * | 1979-02-22 | 1993-01-28 | Nissan Chemical Industries, Ltd., Tokio/Tokyo, Jp |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1491274A (en) | Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides | |
| GB1507159A (en) | Substituted diphenyl ethers and herbicidal composition containing them | |
| ES8400100A1 (es) | Procedimiento para la obtencion de derivados de 1-hidroxialquilazolilo sustituidos. | |
| EP0062328A3 (en) | Novel penicillin and cephalosporin compounds, a process for preparing the same and antibacterial composition containing the novel compounds | |
| GB1513347A (en) | Thiolcarbonyl derivatives of n-phosphonomethylglycine | |
| FI914187A0 (fi) | Menetelmä valmistaa kaavan /I/ mukaista 1-metyylikarbapeneemijohdosta | |
| GB1343368A (en) | Substituted 1-phenyl-2,5-dioxo-imidazolidines and their use as herbicidal agents | |
| FI851932A0 (fi) | --karbolin-3- karboxylsyraderivat, deras framstaellningsfoerfarande och deras anvaendning. | |
| GR3020583T3 (en) | Substituted pyridinesulfonamide compounds, herbicidal compositions containing them, and process for their production | |
| GB1244975A (en) | Benzodioxane derivatives | |
| IE791490L (en) | Phenyl-alkanoic acids | |
| AU565518B2 (en) | S-aryl (heteroaryl) thiomethyl pyridines | |
| KR830007554A (ko) | 인돌리논의 제조방법 | |
| ATE15192T1 (de) | 2-(2-halo-4-(6-haloquinoxalin-2yloxy)phenoxy)propions|ure-derivate, verfahren zu ihrer herstellung, diese enthaltende herbizide zusammensetzungen und ihre verwendung als herbizide. | |
| EP0003648A3 (en) | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them | |
| US4496737A (en) | Process for preparing sulfamylamidine antisecretory agents | |
| EP0239064A3 (en) | Herbicidal compounds, their production and use | |
| ES481199A1 (es) | Procedimiento para preparar benzoilimidatos sustituidos. | |
| AU609377B2 (en) | New derivaties of 4-OH quinoline carboxylic acid substituted in position 2 by a possibly etherified or esterified dihydroxyl group, the process and intermediates for preparation, their application as medicaments and the compositions containing them | |
| KR880009906A (ko) | 신규한 제초 화합물과 그 제조방법 및 이를 포함하는 제초조성물 | |
| ES544542A0 (es) | Procedimiento para la preparacion de derivados de pirimidn- tioalquilpiridina | |
| ES8105981A1 (es) | Procedimiento para la preparacion de derivados de 4-(nafta- leniloxi)piperidina | |
| GB8905741D0 (en) | Process for preparing carbamates,and intermediates therin | |
| KR910004611A (ko) | 아졸리딘 유도체, 그의 제조방법 및 농원예용 살균제 | |
| EP0027482A3 (en) | Herbicidal pyridinesulfonylisothioureas, preparation and use thereof, compositions containing them, intermediates for preparing them and preparation of such intermediates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 704A | Declaration that licence is not available as of right for an excepted use (par. 4a/1977) | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19951009 |