GB1375162A - - Google Patents
Info
- Publication number
- GB1375162A GB1375162A GB963871*[A GB5035070A GB1375162A GB 1375162 A GB1375162 A GB 1375162A GB 5035070 A GB5035070 A GB 5035070A GB 1375162 A GB1375162 A GB 1375162A
- Authority
- GB
- United Kingdom
- Prior art keywords
- group
- formula
- alkylthio
- compounds
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 abstract 7
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 abstract 6
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000004414 alkyl thio group Chemical group 0.000 abstract 3
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- 238000006243 chemical reaction Methods 0.000 abstract 3
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 abstract 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000003277 amino group Chemical group 0.000 abstract 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 125000001302 tertiary amino group Chemical group 0.000 abstract 2
- XHPZVBGIPQQTQW-UHFFFAOYSA-N 5-benzylpyrimidine-2,4-diamine Chemical class NC1=NC(N)=NC=C1CC1=CC=CC=C1 XHPZVBGIPQQTQW-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 229940100198 alkylating agent Drugs 0.000 abstract 1
- 239000002168 alkylating agent Substances 0.000 abstract 1
- 125000005530 alkylenedioxy group Chemical group 0.000 abstract 1
- 229960004050 aminobenzoic acid Drugs 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 230000000078 anti-malarial effect Effects 0.000 abstract 1
- 239000003430 antimalarial agent Substances 0.000 abstract 1
- 239000000010 aprotic solvent Substances 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 230000026030 halogenation Effects 0.000 abstract 1
- 238000005658 halogenation reaction Methods 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 238000007327 hydrogenolysis reaction Methods 0.000 abstract 1
- 229940054534 ophthalmic solution Drugs 0.000 abstract 1
- 239000002997 ophthalmic solution Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- YAAWASYJIRZXSZ-UHFFFAOYSA-N pyrimidine-2,4-diamine Chemical compound NC1=CC=NC(N)=N1 YAAWASYJIRZXSZ-UHFFFAOYSA-N 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 abstract 1
- 229940124530 sulfonamide Drugs 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
- C07D239/49—Two nitrogen atoms with an aralkyl radical, or substituted aralkyl radical, attached in position 5, e.g. trimethoprim
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (45)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB963871*[A GB1375162A (bg) | 1970-10-22 | 1970-10-22 | |
| US00134876A US3772289A (en) | 1970-10-22 | 1971-04-16 | Alkyl substituted benzyl pyrimidines |
| RO7168472A RO67383A (ro) | 1970-10-22 | 1971-10-15 | Procedeu pentru prepararea unor 2,4-diamino-5-benzilpirimidine |
| BG021451A BG20364A3 (bg) | 1970-10-22 | 1971-10-21 | Метод за получаване на производни на бензилпиримидина |
| BG018828A BG20797A3 (bg) | 1970-10-22 | 1971-10-21 | Метод за получаване на производни на бензил-пиримидина |
| NLAANVRAGE7114494,A NL175178C (nl) | 1970-10-22 | 1971-10-21 | Werkwijze om 2,4-diamino-5-benzylpyrimidinederivaten en farmaceutische preparaten die deze stoffen bevatten te bereiden. |
| LU64129A LU64129A1 (bg) | 1970-10-22 | 1971-10-21 | |
| PH12953*UA PH9226A (en) | 1970-10-22 | 1971-10-21 | Alkyl substituted benzyl pyrimidines and pharmaceutical preparations thereof |
| SE7113328A SE384505B (sv) | 1970-10-22 | 1971-10-21 | Forfarande for framstellning av 2,4-diamino-5-bensylpyrimidinderivat |
| IL37984A IL37984A (en) | 1970-10-22 | 1971-10-21 | 2,4-diamino-5-benzylpyrimidine derivatives,their preparation and pharmaceutical compositions containing them |
| CA125,807A CA967158A (en) | 1970-10-22 | 1971-10-21 | Benzylpyrimidines |
| YU267871A YU35002B (en) | 1970-10-22 | 1971-10-21 | Process for preparing 2,4-diamino-5-benzyl-pyrimidine |
| SU1707802A SU429581A3 (ru) | 1970-10-22 | 1971-10-21 | Способ получения производных 2,4-диамино-5-бензил пиримидина12 |
| ZA717047A ZA717047B (en) | 1970-10-22 | 1971-10-21 | Organic compounds |
| ES396219A ES396219A1 (es) | 1970-10-22 | 1971-10-21 | Un metodo para preparar 2,4-diamino-5-bencilpirimidinas. |
| DD167435A DD100877A5 (bg) | 1970-10-22 | 1971-10-21 | |
| FI2975/71A FI56175C (fi) | 1970-10-22 | 1971-10-21 | Foerfarande foer framstaellning av malaria foerhindrande och/eller baktericida 2,4-diamino-5-bensylpyrimidiner |
| DD15846971A DD94818A5 (bg) | 1970-10-22 | 1971-10-21 | |
| AR238596A AR192588A1 (es) | 1970-10-22 | 1971-10-21 | Un metodo para preparar derivados de pirimidina |
| CH1027675A CH568302A5 (bg) | 1970-10-22 | 1971-10-21 | |
| BE774281A BE774281A (fr) | 1970-10-22 | 1971-10-21 | Nouveaux composes organiques |
| IL45422A IL45422A (en) | 1970-10-22 | 1971-10-21 | Alpha-(3,4,5-trisubstituted benzyl)-acrylonitriles and propionitriles and their preparation |
| JP8365271A JPS5536662B1 (bg) | 1970-10-22 | 1971-10-21 | |
| NO391071A NO134837C (bg) | 1970-10-22 | 1971-10-21 | |
| CH1532171A CH568301A5 (bg) | 1970-10-22 | 1971-10-21 | |
| HUWE450A HU166528B (bg) | 1970-10-22 | 1971-10-21 | |
| ZM149/71A ZM14971A1 (en) | 1970-10-22 | 1971-10-21 | Organic compounds |
| BG021452A BG20365A3 (bg) | 1970-10-22 | 1971-10-21 | Метод за получаване на производни на бензилпиримидина |
| CH1027775A CH582681A5 (bg) | 1970-10-22 | 1971-10-21 | |
| AU34863/71A AU465145B2 (en) | 1970-10-22 | 1971-10-21 | 2, 4-diamino-5-benzylpyrimidines |
| DK513771A DK132174C (da) | 1970-10-22 | 1971-10-21 | Analogifremgangsmade til fremstilling af 2,4-diamino-5-benzylpyrimidiner |
| IE1329/71A IE37452B1 (en) | 1970-10-22 | 1971-10-21 | 2,4-diamino-5-benzylpyrimidines and processes for their production |
| FR7137870A FR2111769B1 (bg) | 1970-10-22 | 1971-10-21 | |
| MC951A MC894A1 (fr) | 1970-10-22 | 1971-10-21 | Benzil-pyrimidines et leur préparations |
| AT909371A AT319948B (de) | 1970-10-22 | 1971-10-21 | Verfahren zur Herstellung von neuen 2,4-Diamino-5-benzylpyrimidinen |
| DE19712152814 DE2152814A1 (de) | 1970-10-22 | 1971-10-22 | Pharmazeutisch wirksame Benzylpynmi dme, Verfahren xu ihrer Herstellung und ihre Verwendung |
| AR242772A AR192802A1 (es) | 1970-10-22 | 1972-06-27 | Metodo para preparar 2,4-diamino-5-bencil-pirimidinas |
| AR242773A AR192803A1 (es) | 1970-10-22 | 1972-06-27 | Metodo para preparar 2,4-diamino-5-bencilpirimidinas |
| BG021466A BG21406A3 (bg) | 1970-10-22 | 1972-10-21 | Метод за получаване на производни на бензилпиримидина |
| KR7201836A KR780000097B1 (en) | 1970-10-22 | 1972-12-05 | A method of preparing 2.4-diamino-5-benzylpyrimidines |
| SE7406661A SE409705B (sv) | 1970-10-22 | 1974-05-20 | Vissa angivna nitrilforeningar till anvendning som mellanprodukter for framstellning av 2,4-diamino-5-bensylpyrimidiner med aktivitet mot malaria och bakterier |
| GB2955374A GB1375163A (bg) | 1970-10-22 | 1974-07-03 | |
| CA205,203A CA999583A (en) | 1970-10-22 | 1974-07-19 | Intermediates for benzylpyrimides |
| JP15499477A JPS53135991A (en) | 1970-10-22 | 1977-12-22 | Method of producing 2*44diaminoo55 benzylpyrimidine |
| YU186678A YU186678A (en) | 1970-10-22 | 1978-08-01 | Process for producing 2,4-diamino-5-benzylpyrimidine |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB963871*[A GB1375162A (bg) | 1970-10-22 | 1970-10-22 | |
| GB963871 | 1971-04-16 | ||
| GB4749171 | 1971-10-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1375162A true GB1375162A (bg) | 1974-11-27 |
Family
ID=27255400
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB963871*[A Expired GB1375162A (bg) | 1970-10-22 | 1970-10-22 |
Country Status (20)
| Country | Link |
|---|---|
| JP (2) | JPS5536662B1 (bg) |
| AR (3) | AR192588A1 (bg) |
| AT (1) | AT319948B (bg) |
| BE (1) | BE774281A (bg) |
| BG (4) | BG20797A3 (bg) |
| CA (1) | CA967158A (bg) |
| CH (3) | CH568301A5 (bg) |
| DD (1) | DD100877A5 (bg) |
| DK (1) | DK132174C (bg) |
| ES (1) | ES396219A1 (bg) |
| FI (1) | FI56175C (bg) |
| FR (1) | FR2111769B1 (bg) |
| GB (1) | GB1375162A (bg) |
| IE (1) | IE37452B1 (bg) |
| IL (2) | IL45422A (bg) |
| LU (1) | LU64129A1 (bg) |
| MC (1) | MC894A1 (bg) |
| NL (1) | NL175178C (bg) |
| SE (2) | SE384505B (bg) |
| ZM (1) | ZM14971A1 (bg) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006987A1 (en) * | 1978-05-24 | 1980-01-23 | The Wellcome Foundation Limited | 2,4-Diamino-5-benzylpyrimidines, especially for the treatment of microbial infections, pharmaceutical compositions containing these compounds and processes for preparing these compounds |
| WO2009067081A1 (en) * | 2007-11-22 | 2009-05-28 | Astrazeneca Ab | Pyrimidine derivatives for the treatment of asthma, copd, allergic rhinitis, allergic conjunctivitis, atopic dermatitis, cancer, hepatitis b, hepatitis c, hiv, hpv, bacterial infections and dermatosis |
| US8044056B2 (en) | 2007-03-20 | 2011-10-25 | Dainippon Sumitomo Pharma Co., Ltd. | Adenine compound |
| US8063051B2 (en) | 2007-03-19 | 2011-11-22 | Astrazeneca Ab | 9-substituted-8-oxo-adenine compounds as toll-like receptor (TLR7) modulators |
| US8067413B2 (en) | 2007-03-19 | 2011-11-29 | Astrazeneca Ab | 9-substituted-8-oxo-adenine compounds as toll-like receptor (TLR7 ) modulators |
| US8067411B2 (en) | 2006-12-14 | 2011-11-29 | Astrazeneca Ab | Compounds |
| US8138172B2 (en) | 2006-07-05 | 2012-03-20 | Astrazeneca Ab | 8-oxoadenine derivatives acting as modulators of TLR7 |
| US8476288B2 (en) | 2009-05-21 | 2013-07-02 | Astrazeneca Ab | Salts 756 |
| US8575180B2 (en) | 2004-03-26 | 2013-11-05 | Astrazeneca Aktiebolag | 9-substituted 8-oxoadenine compound |
| US8673907B2 (en) | 2007-12-17 | 2014-03-18 | Astrazeneca Ab | Pharmaceutically acceptable salts of methyl (3-{ [[3-(6-amino- 2-butoxy-8-oxo-7,8-dihydro-9H-purin-9-yl) propyl] (3-morpholin-4-ylpropyl) amino] methyl }phenyl) acetate and their use in therapy |
| US8895570B2 (en) | 2010-12-17 | 2014-11-25 | Astrazeneca Ab | Purine derivatives |
| US9045472B2 (en) | 2010-12-16 | 2015-06-02 | Astrazeneca Ab | Imidazoquinoline compounds |
| US9376398B2 (en) | 2012-05-18 | 2016-06-28 | Sumitomo Dainippon Pharma Co., Ltd | Carboxylic acid compounds |
| US9533978B2 (en) | 2009-05-21 | 2017-01-03 | Sumitomo Dainippon Pharma Co., Ltd | Pyrimidine derivatives and their use in the treatment of cancer and further diseases |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792096A (fr) * | 1971-12-01 | 1973-05-30 | Hoffmann La Roche | Nouvelles benzylpyrimidines |
| FR2397407A2 (fr) * | 1977-07-11 | 1979-02-09 | Dick Pierre | Derives de 2,4-diamino pyrimidines et leur mise en solution en association avec des sulfamides |
| JPS61156909A (ja) * | 1984-12-27 | 1986-07-16 | Matsushita Electric Ind Co Ltd | カレント・ミラ−回路 |
| JPS62145907A (ja) * | 1985-12-20 | 1987-06-30 | Hitachi Ltd | トランジスタ回路 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE710100A (bg) * | 1967-02-02 | 1968-07-30 | ||
| JPS511716A (ja) * | 1974-06-25 | 1976-01-08 | Toray Industries | Horiesuterumaruchifuiramentono seiho |
-
1970
- 1970-10-22 GB GB963871*[A patent/GB1375162A/en not_active Expired
-
1971
- 1971-10-21 BG BG018828A patent/BG20797A3/bg unknown
- 1971-10-21 AR AR238596A patent/AR192588A1/es active
- 1971-10-21 LU LU64129A patent/LU64129A1/xx unknown
- 1971-10-21 ZM ZM149/71A patent/ZM14971A1/xx unknown
- 1971-10-21 AT AT909371A patent/AT319948B/de not_active IP Right Cessation
- 1971-10-21 MC MC951A patent/MC894A1/xx unknown
- 1971-10-21 CH CH1532171A patent/CH568301A5/xx not_active IP Right Cessation
- 1971-10-21 ES ES396219A patent/ES396219A1/es not_active Expired
- 1971-10-21 DK DK513771A patent/DK132174C/da not_active IP Right Cessation
- 1971-10-21 IL IL45422A patent/IL45422A/en unknown
- 1971-10-21 BG BG021451A patent/BG20364A3/bg unknown
- 1971-10-21 BE BE774281A patent/BE774281A/xx not_active IP Right Cessation
- 1971-10-21 IE IE1329/71A patent/IE37452B1/xx unknown
- 1971-10-21 DD DD167435A patent/DD100877A5/xx unknown
- 1971-10-21 SE SE7113328A patent/SE384505B/xx unknown
- 1971-10-21 CA CA125,807A patent/CA967158A/en not_active Expired
- 1971-10-21 BG BG021452A patent/BG20365A3/bg not_active Expired
- 1971-10-21 FI FI2975/71A patent/FI56175C/fi active
- 1971-10-21 CH CH1027775A patent/CH582681A5/xx not_active IP Right Cessation
- 1971-10-21 FR FR7137870A patent/FR2111769B1/fr not_active Expired
- 1971-10-21 NL NLAANVRAGE7114494,A patent/NL175178C/xx not_active IP Right Cessation
- 1971-10-21 CH CH1027675A patent/CH568302A5/xx not_active IP Right Cessation
- 1971-10-21 IL IL37984A patent/IL37984A/en unknown
- 1971-10-21 JP JP8365271A patent/JPS5536662B1/ja active Pending
-
1972
- 1972-06-27 AR AR242772A patent/AR192802A1/es active
- 1972-06-27 AR AR242773A patent/AR192803A1/es active
- 1972-10-21 BG BG021466A patent/BG21406A3/bg unknown
-
1974
- 1974-05-20 SE SE7406661A patent/SE409705B/sv not_active IP Right Cessation
-
1977
- 1977-12-22 JP JP15499477A patent/JPS53135991A/ja active Pending
Cited By (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006987A1 (en) * | 1978-05-24 | 1980-01-23 | The Wellcome Foundation Limited | 2,4-Diamino-5-benzylpyrimidines, especially for the treatment of microbial infections, pharmaceutical compositions containing these compounds and processes for preparing these compounds |
| US8969362B2 (en) | 2004-03-26 | 2015-03-03 | Astrazeneca Aktiebolag | 9-substituted 8-oxoadenine compound |
| US8575180B2 (en) | 2004-03-26 | 2013-11-05 | Astrazeneca Aktiebolag | 9-substituted 8-oxoadenine compound |
| US8138172B2 (en) | 2006-07-05 | 2012-03-20 | Astrazeneca Ab | 8-oxoadenine derivatives acting as modulators of TLR7 |
| US8067411B2 (en) | 2006-12-14 | 2011-11-29 | Astrazeneca Ab | Compounds |
| US8063051B2 (en) | 2007-03-19 | 2011-11-22 | Astrazeneca Ab | 9-substituted-8-oxo-adenine compounds as toll-like receptor (TLR7) modulators |
| US8067413B2 (en) | 2007-03-19 | 2011-11-29 | Astrazeneca Ab | 9-substituted-8-oxo-adenine compounds as toll-like receptor (TLR7 ) modulators |
| US8044056B2 (en) | 2007-03-20 | 2011-10-25 | Dainippon Sumitomo Pharma Co., Ltd. | Adenine compound |
| US8765939B2 (en) | 2007-11-22 | 2014-07-01 | Astrazeneca Ab | Pyrimidline derivatives having immune modulating properties that act via TLR7 for the treatment of viral or allergic diseases and cancers |
| CN103342682A (zh) * | 2007-11-22 | 2013-10-09 | 阿斯利康(瑞典)有限公司 | 用于制备嘧啶衍生物的中间体 |
| CN101925584B (zh) * | 2007-11-22 | 2013-04-17 | 阿斯利康(瑞典)有限公司 | 用于治疗哮喘、copd、过敏性鼻炎、过敏性结膜炎、特应性皮炎、癌症、乙型肝炎、丙型肝炎、hiv、hpv、细菌感染和皮肤病的嘧啶衍生物 |
| US8268990B2 (en) | 2007-11-22 | 2012-09-18 | Astrazeneca Ab | Compounds |
| EA018121B1 (ru) * | 2007-11-22 | 2013-05-30 | Астразенека Аб | Производные пиримидина для лечения астмы, хобл, аллергического ринита, аллергического конъюнктивита, атопического дерматита, рака, гепатита в, гепатита с, вич, впч, бактериальных инфекций и дерматоза |
| WO2009067081A1 (en) * | 2007-11-22 | 2009-05-28 | Astrazeneca Ab | Pyrimidine derivatives for the treatment of asthma, copd, allergic rhinitis, allergic conjunctivitis, atopic dermatitis, cancer, hepatitis b, hepatitis c, hiv, hpv, bacterial infections and dermatosis |
| US8673907B2 (en) | 2007-12-17 | 2014-03-18 | Astrazeneca Ab | Pharmaceutically acceptable salts of methyl (3-{ [[3-(6-amino- 2-butoxy-8-oxo-7,8-dihydro-9H-purin-9-yl) propyl] (3-morpholin-4-ylpropyl) amino] methyl }phenyl) acetate and their use in therapy |
| US9533978B2 (en) | 2009-05-21 | 2017-01-03 | Sumitomo Dainippon Pharma Co., Ltd | Pyrimidine derivatives and their use in the treatment of cancer and further diseases |
| US8476288B2 (en) | 2009-05-21 | 2013-07-02 | Astrazeneca Ab | Salts 756 |
| US9045472B2 (en) | 2010-12-16 | 2015-06-02 | Astrazeneca Ab | Imidazoquinoline compounds |
| US8895570B2 (en) | 2010-12-17 | 2014-11-25 | Astrazeneca Ab | Purine derivatives |
| US9376398B2 (en) | 2012-05-18 | 2016-06-28 | Sumitomo Dainippon Pharma Co., Ltd | Carboxylic acid compounds |
| US10150743B2 (en) | 2012-05-18 | 2018-12-11 | Sumitomo Dainippon Pharma Co., Ltd. | Carboxylic acid compounds |
| US10562861B2 (en) | 2012-05-18 | 2020-02-18 | Sumitomo Dainippon Pharma Co., Ltd. | Carboxylic acid compounds |
| US11299465B2 (en) | 2012-05-18 | 2022-04-12 | Sumitomo Dainippon Pharma Co., Ltd. | Carboxylic acid compounds |
| US12077510B2 (en) | 2012-05-18 | 2024-09-03 | Sumitomo Pharma Co., Ltd. | Carboxylic acid compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| BE774281A (fr) | 1972-04-21 |
| AT319948B (de) | 1975-01-10 |
| CA967158A (en) | 1975-05-06 |
| JPS5536662B1 (bg) | 1980-09-22 |
| SE384505B (sv) | 1976-05-10 |
| NL175178B (nl) | 1984-05-01 |
| MC894A1 (fr) | 1972-06-22 |
| DK132174B (da) | 1975-11-03 |
| BG21406A3 (bg) | 1976-05-20 |
| BG20797A3 (bg) | 1975-12-20 |
| CH568302A5 (bg) | 1975-10-31 |
| AR192588A1 (es) | 1973-02-28 |
| AR192802A1 (es) | 1973-03-14 |
| IL37984A0 (en) | 1971-12-29 |
| FR2111769B1 (bg) | 1974-10-18 |
| ES396219A1 (es) | 1975-09-16 |
| ZM14971A1 (en) | 1972-07-21 |
| BG20364A3 (bg) | 1975-11-05 |
| FI56175C (fi) | 1979-12-10 |
| NL7114494A (bg) | 1972-04-25 |
| LU64129A1 (bg) | 1972-06-28 |
| CH568301A5 (bg) | 1975-10-31 |
| CH582681A5 (bg) | 1976-12-15 |
| JPS53135991A (en) | 1978-11-28 |
| NL175178C (nl) | 1984-10-01 |
| SE409705B (sv) | 1979-09-03 |
| IL37984A (en) | 1976-03-31 |
| FR2111769A1 (bg) | 1972-06-09 |
| IL45422A (en) | 1976-03-31 |
| DD100877A5 (bg) | 1973-10-12 |
| DK132174C (da) | 1976-03-29 |
| IE37452B1 (en) | 1977-08-03 |
| FI56175B (fi) | 1979-08-31 |
| BG20365A3 (bg) | 1975-11-05 |
| AR192803A1 (es) | 1973-03-14 |
| IE37452L (en) | 1972-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1375162A (bg) | ||
| ES431775A1 (es) | Procedimiento para la preparacion de derivados de 1-fenil-2-aminoguanidina. | |
| IE34044L (en) | Alpha benzylacrylonitriles and 5-benzylpyrimidines | |
| ES8307760A1 (es) | Un procedimiento para la preparacion de derivados de 4-anilino-pirimidina. | |
| GB1332477A (en) | Basic azo dyes free from sulphonic acid groups their production and use | |
| GB1131191A (en) | New imidazole derivatives, their preparation and use | |
| IL43722A (en) | 2-aminomethyleneindanones and pharmaceutical compositions containing them | |
| GB1409648A (en) | Substituted pyrrolidinemethanol compounds and pharmaceutical compositions thereof | |
| GB1424492A (en) | Pyrazol-5-ones their preparation and their pharmaceutical use | |
| GB1392551A (en) | Ergolene derivatives their preparation and use | |
| GB1255633A (en) | Halophenylalkylene amines and their use as algicides and slime bactericides | |
| SE7413856L (bg) | ||
| US4335119A (en) | Quick-acting diuretic compositions | |
| GB1325769A (en) | Pyrimidopyridazine derivatives | |
| GB1315849A (en) | 1,2,3-trithiane derivatives | |
| GB1152883A (en) | 4,5-Polymethylene-Pyrimidine Derivatives | |
| ES381036A1 (es) | Medicamentos analgesicos a base de n-(aroilalkil) n'-(alfa-nols) piperacinas y sus derivados, y procedimiento para su obtencion. | |
| GB1511736A (en) | Amidino-hydrazone derivatives of benzocycloalkanones | |
| GB1305725A (bg) | ||
| GB1082964A (en) | New substituted imidazolines and their preparation and use | |
| GB1377224A (en) | Bis-triazole compounds | |
| GB1423465A (en) | 1-phenyl-2-aminoalkyl imidazole derivatives and pharmaceutical compositions thereof | |
| GB1473014A (en) | 5-amino-4,5-dideoxy-ambutyrosin a | |
| GB1240648A (en) | N-substituted isatins | |
| IL39218A (en) | 2,4-diamino-5-(3,4,5-triethoxybenzyl) pyrimidine its preparation and pharmaceutical compositions containing it |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 416 | Proceeding under section 16 patents act 1949 | ||
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |