GB1239818A - Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids - Google Patents
Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acidsInfo
- Publication number
- GB1239818A GB1239818A GB37026/68A GB3702668A GB1239818A GB 1239818 A GB1239818 A GB 1239818A GB 37026/68 A GB37026/68 A GB 37026/68A GB 3702668 A GB3702668 A GB 3702668A GB 1239818 A GB1239818 A GB 1239818A
- Authority
- GB
- United Kingdom
- Prior art keywords
- brightening
- paper
- brightened
- triazinyl
- aqueous
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VGRFLABBLVKUGG-UHFFFAOYSA-N 2-[2-(2-sulfophenyl)-1,2-bis(1,3,5-triazin-2-ylamino)ethenyl]benzenesulfonic acid Polymers OS(=O)(=O)C1=CC=CC=C1C(NC=1N=CN=CN=1)=C(C=1C(=CC=CC=1)S(O)(=O)=O)NC1=NC=NC=N1 VGRFLABBLVKUGG-UHFFFAOYSA-N 0.000 title 1
- 238000005282 brightening Methods 0.000 abstract 5
- 229920000742 Cotton Polymers 0.000 abstract 3
- 239000000203 mixture Substances 0.000 abstract 3
- 239000000758 substrate Substances 0.000 abstract 3
- 125000004306 triazinyl group Chemical group 0.000 abstract 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 238000002360 preparation method Methods 0.000 abstract 2
- 238000004513 sizing Methods 0.000 abstract 2
- 239000004753 textile Substances 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- 229920000297 Rayon Polymers 0.000 abstract 1
- 229920002472 Starch Polymers 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 239000004411 aluminium Chemical class 0.000 abstract 1
- 229910052782 aluminium Chemical class 0.000 abstract 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical class [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 239000007864 aqueous solution Substances 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000011230 binding agent Substances 0.000 abstract 1
- 150000001768 cations Chemical class 0.000 abstract 1
- 239000008199 coating composition Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000004744 fabric Substances 0.000 abstract 1
- 239000000835 fiber Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 230000003287 optical effect Effects 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 229920000058 polyacrylate Polymers 0.000 abstract 1
- 239000002964 rayon Substances 0.000 abstract 1
- 239000011347 resin Substances 0.000 abstract 1
- 229920005989 resin Polymers 0.000 abstract 1
- 235000019698 starch Nutrition 0.000 abstract 1
- 239000008107 starch Substances 0.000 abstract 1
- 238000004381 surface treatment Methods 0.000 abstract 1
- -1 triazinyl compound Chemical class 0.000 abstract 1
- 238000005406 washing Methods 0.000 abstract 1
- 239000012463 white pigment Substances 0.000 abstract 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H21/00—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties
- D21H21/14—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties characterised by function or properties in or on the paper
- D21H21/30—Luminescent or fluorescent substances, e.g. for optical bleaching
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65801967A | 1967-08-03 | 1967-08-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1239818A true GB1239818A (en) | 1971-07-21 |
Family
ID=24639579
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB37026/68A Expired GB1239818A (en) | 1967-08-03 | 1968-08-02 | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| GB44884/70A Expired GB1241400A (en) | 1967-08-03 | 1968-08-02 | Optical brightening of cellulose textiles |
| GB44885/70A Expired GB1243479A (en) | 1967-08-03 | 1968-08-02 | Optical brightening of paper |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB44884/70A Expired GB1241400A (en) | 1967-08-03 | 1968-08-02 | Optical brightening of cellulose textiles |
| GB44885/70A Expired GB1243479A (en) | 1967-08-03 | 1968-08-02 | Optical brightening of paper |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3479349A (enExample) |
| JP (2) | JPS5113797B1 (enExample) |
| AT (1) | AT286225B (enExample) |
| AU (1) | AU426935B2 (enExample) |
| BE (1) | BE719065A (enExample) |
| CH (2) | CH547891A (enExample) |
| DE (2) | DE1794330B2 (enExample) |
| ES (1) | ES356804A1 (enExample) |
| FR (1) | FR1576100A (enExample) |
| GB (3) | GB1239818A (enExample) |
| NL (3) | NL6811041A (enExample) |
| SE (3) | SE363633B (enExample) |
| SU (1) | SU520057A3 (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL1012168C2 (nl) * | 1999-05-27 | 2000-11-28 | Security Transfer B V | Basispapier, alsmede veiligheidspapier. |
| WO2007061326A1 (en) * | 2005-11-24 | 2007-05-31 | Termo Organika Sp. Z O.O. | Method of preparation the materials protecting them against the effects of ultraviolet radiation and ozone |
| WO2007143184A3 (en) * | 2006-06-02 | 2008-03-06 | Int Paper Co | Pulp and paper having increased brightness |
| WO2009118247A1 (en) * | 2008-03-26 | 2009-10-01 | Clariant International Ltd | Improved optical brightening compositions |
| RU2495972C2 (ru) * | 2008-03-26 | 2013-10-20 | Клариант Финанс (Бви) Лимитед | Усовершенствованные композиции для оптического отбеливания |
| RU2515297C2 (ru) * | 2008-11-27 | 2014-05-10 | Клариант Финанс (Бви) Лимитед | Улучшенные оптические отбеливающие композиции для высококачественной струйной печати |
| AU2014259497B2 (en) * | 2008-03-26 | 2016-05-12 | Archroma Ip Gmbh | Improved optical brightening compositions |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3542642A (en) * | 1968-03-01 | 1970-11-24 | Geigy Chem Corp | Quenching the fluorescence of optical brightener compounds in paper by means of hydroxymethylamino acetonitrile |
| US3682907A (en) * | 1968-09-12 | 1972-08-08 | Sumitomo Chemical Co | 4,4{40 -bis(2-{62 -sulfoethylamino-4-amino-1,3,5-triazine-6-ylamino)stilbene-2,2{40 -disulfonic |
| US3883515A (en) * | 1969-12-29 | 1975-05-13 | Ciba Geigy Corp | Adiabatic process for the production of 2,4-dichloro-6-amino-S-triazines |
| IT942451B (it) * | 1970-09-16 | 1973-03-20 | Sandoz Ag | Acidi bis traizinilamino stilbensolfonici |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| CH583211A5 (enExample) * | 1973-05-22 | 1976-12-31 | Sandoz Ag | |
| CH583212A5 (enExample) * | 1973-07-02 | 1976-12-31 | Sandoz Ag | |
| USRE30227E (en) * | 1973-11-29 | 1980-03-11 | Ciba-Geigy Corporation | Agent for brightening and removing greyness from textiles |
| US4233167A (en) * | 1979-06-14 | 1980-11-11 | S. C. Johnson & Son, Inc. | Liquid detergent softening and brightening composition |
| DE3112435A1 (de) * | 1981-03-28 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Waessrige aminoplastdispersionen |
| US4597930A (en) * | 1983-07-11 | 1986-07-01 | Szal John R | Method of manufacture of a felted fibrous product from a nonaqueous medium |
| GB8704328D0 (en) * | 1987-02-24 | 1987-04-01 | Sandoz Products Ltd | Organic compounds |
| US5018742A (en) * | 1987-09-24 | 1991-05-28 | Acushnet Company | Golf ball clear coating with optical brighteners |
| US4865326A (en) * | 1987-09-24 | 1989-09-12 | Acushnet Company | Optical brightners in golf ball clear coatings |
| US5160536A (en) * | 1991-04-18 | 1992-11-03 | Acushnet Company | Printing ink for golf balls |
| DE4230655A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weißgrad, Helligkeit und Farbort von Faserstoffen |
| DE4230656A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weissgrad, Helligkeit und Farbort von Füllstoffen und Pigmenten |
| GB9412590D0 (en) * | 1994-06-23 | 1994-08-10 | Sandoz Ltd | Organic compounds |
| DE19500791C1 (de) * | 1995-01-13 | 1996-08-01 | Bayer Ag | Verfahren zur Herstellung von substituierten 4,4'-Diaminostilben-2,2'-disulfonsäuresalzen |
| US5891609A (en) * | 1997-12-15 | 1999-04-06 | Trebla Chemical Company | Photographic color developer replenishing concentrates |
| ES2189619B1 (es) * | 2001-01-30 | 2004-10-01 | Elaboracion De Colorantes, S.A. | 2,2-(vinilenbis(3-sulfonato-4,1-fenilen) imino (6-(bid(2-hidroxipropil) amino) 1,3,5,-triazina-4,2-diil) imino))bis(benceno-1,4-disulfonato) de hexasodio y procedimiento para su obtencion. |
| JP4179584B2 (ja) * | 2001-03-22 | 2008-11-12 | 日本化薬株式会社 | 染色特性に優れる蛍光増白剤の水性液状組成物 |
| WO2008017585A1 (en) * | 2006-08-08 | 2008-02-14 | Clariant International Ltd | Aqueous solutions of optical brighteners |
| EP1694732A1 (en) * | 2003-11-18 | 2006-08-30 | Ciba SC Holding AG | Fluorescent whiteninig pigments |
| EP1712677A1 (en) * | 2005-04-08 | 2006-10-18 | Clariant International Ltd. | Aqueous solutions of optical brighteners |
| US8613834B2 (en) | 2008-04-03 | 2013-12-24 | Basf Se | Paper coating or binding formulations and methods of making and using same |
| EP2192230B2 (en) † | 2008-11-27 | 2020-01-01 | Clariant Finance (BVI) Limited | Optical brightening compositions for high quality inkjet printing |
| AU2010327087A1 (en) | 2009-12-02 | 2012-05-17 | Clariant Finance (Bvi) Limited | Concentrated storage-stable aqueous optical brightening solutions |
| RU2564310C2 (ru) * | 2010-07-01 | 2015-09-27 | Клариант Финанс (Бви) Лимитед | Водные композиции для отбеливания и тонировки при нанесении покрытий |
| PL2596170T3 (pl) * | 2010-07-23 | 2018-11-30 | Archroma Ip Gmbh | Sposób otrzymywania białego papieru |
| JP6068996B2 (ja) * | 2012-02-06 | 2017-01-25 | 日本製紙株式会社 | 顕色剤層にデキストリンを含有する感圧複写紙、および感圧複写紙の製造方法 |
| DE202014000968U1 (de) * | 2014-02-18 | 2014-06-18 | Hans Kölbl | Fügepresse für elektronische Geräte |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE551712A (enExample) * | 1955-10-12 | |||
| GB930393A (enExample) * | 1959-11-20 | 1900-01-01 | ||
| FR1388476A (fr) * | 1963-04-12 | 1965-02-05 | Gen Aniline & Film Corp | Agents avivants à base d'acide 4, 4'-bis [(4-carboxyméthylamino) et (4-nu-2-sulfoéthylamino)-6-sulfophénoxy-s-triazine-2-ylamino]-2, 2'-stilbène-disulfonique |
-
1967
- 1967-08-03 US US658019A patent/US3479349A/en not_active Expired - Lifetime
-
1968
- 1968-07-10 CH CH1021768A patent/CH547891A/xx unknown
- 1968-07-10 CH CH1021768D patent/CH1021768A4/xx unknown
- 1968-07-30 SE SE13889/70A patent/SE363633B/xx unknown
- 1968-07-30 SE SE13890/70A patent/SE363634B/xx unknown
- 1968-07-30 SE SE10325/68A patent/SE345272B/xx unknown
- 1968-08-02 GB GB37026/68A patent/GB1239818A/en not_active Expired
- 1968-08-02 ES ES356804A patent/ES356804A1/es not_active Expired
- 1968-08-02 GB GB44884/70A patent/GB1241400A/en not_active Expired
- 1968-08-02 AT AT755668A patent/AT286225B/de not_active IP Right Cessation
- 1968-08-02 DE DE19681794330 patent/DE1794330B2/de active Granted
- 1968-08-02 NL NL6811041A patent/NL6811041A/xx unknown
- 1968-08-02 FR FR1576100D patent/FR1576100A/fr not_active Expired
- 1968-08-02 DE DE1795047A patent/DE1795047C3/de not_active Expired
- 1968-08-02 GB GB44885/70A patent/GB1243479A/en not_active Expired
- 1968-08-05 BE BE719065D patent/BE719065A/xx not_active IP Right Cessation
-
1970
- 1970-08-24 SU SU1473678A patent/SU520057A3/ru active
- 1970-10-30 JP JP45095507A patent/JPS5113797B1/ja active Pending
- 1970-10-30 JP JP45095506A patent/JPS5241366B1/ja active Pending
- 1970-11-16 AU AU22277/70A patent/AU426935B2/en not_active Expired
-
1978
- 1978-09-28 NL NL7809830A patent/NL7809830A/xx not_active Application Discontinuation
- 1978-09-28 NL NL7809831A patent/NL7809831A/xx not_active Application Discontinuation
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000073582A1 (en) * | 1999-05-27 | 2000-12-07 | Security Transfer B.V. | Base paper as well as security paper |
| NL1012168C2 (nl) * | 1999-05-27 | 2000-11-28 | Security Transfer B V | Basispapier, alsmede veiligheidspapier. |
| US8845861B2 (en) | 2000-03-26 | 2014-09-30 | Clariant Finance (Bvi) Limited | Optical brightening compositions |
| US7638016B2 (en) | 2005-02-19 | 2009-12-29 | International Paper Company | Method for treating kraft pulp with optical brighteners after chlorine bleaching to increase brightness |
| WO2007061326A1 (en) * | 2005-11-24 | 2007-05-31 | Termo Organika Sp. Z O.O. | Method of preparation the materials protecting them against the effects of ultraviolet radiation and ozone |
| WO2007143184A3 (en) * | 2006-06-02 | 2008-03-06 | Int Paper Co | Pulp and paper having increased brightness |
| CN102007247B (zh) * | 2008-03-26 | 2012-10-03 | 科莱恩金融(Bvi)有限公司 | 改良的荧光增白组合物 |
| KR20100135845A (ko) * | 2008-03-26 | 2010-12-27 | 클라리언트 파이넌스 (비브이아이)리미티드 | 개선된 형광 증백 조성물 |
| WO2009118248A3 (en) * | 2008-03-26 | 2009-11-19 | Clariant International Ltd | Improved optical brightening compositions |
| RU2495972C2 (ru) * | 2008-03-26 | 2013-10-20 | Клариант Финанс (Бви) Лимитед | Усовершенствованные композиции для оптического отбеливания |
| RU2495973C2 (ru) * | 2008-03-26 | 2013-10-20 | Клариант Финанс (Бви) Лимитед | Усовершенствованные композиции для оптического отбеливания |
| AU2009228720B2 (en) * | 2008-03-26 | 2014-02-27 | Archroma Ip Gmbh | Improved optical brightening compositions |
| US8821688B2 (en) | 2008-03-26 | 2014-09-02 | Clariant Finance (Bvi) Limited | Optical brightening compositions |
| WO2009118247A1 (en) * | 2008-03-26 | 2009-10-01 | Clariant International Ltd | Improved optical brightening compositions |
| AU2014259497B2 (en) * | 2008-03-26 | 2016-05-12 | Archroma Ip Gmbh | Improved optical brightening compositions |
| KR101631871B1 (ko) | 2008-03-26 | 2016-06-20 | 아르크로마 아이피 게엠베하 | 개선된 형광 증백 조성물 |
| USRE46913E1 (en) | 2008-03-26 | 2018-06-26 | Archroma Ip Gmbh | Optical brightening compositions |
| RU2515297C2 (ru) * | 2008-11-27 | 2014-05-10 | Клариант Финанс (Бви) Лимитед | Улучшенные оптические отбеливающие композиции для высококачественной струйной печати |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1796306B1 (de) | 1972-06-29 |
| SU520057A3 (ru) | 1976-06-30 |
| SE345272B (enExample) | 1972-05-23 |
| DE1794330A1 (de) | 1972-03-16 |
| AU426935B2 (en) | 1972-08-08 |
| CH1021768A4 (enExample) | 1973-08-31 |
| BE719065A (enExample) | 1969-02-05 |
| US3479349A (en) | 1969-11-18 |
| SE363634B (enExample) | 1974-01-28 |
| JPS5113797B1 (enExample) | 1976-05-04 |
| DE1795047C3 (de) | 1976-01-08 |
| AT286225B (de) | 1970-11-25 |
| DE1795047B2 (de) | 1975-04-24 |
| NL7809830A (nl) | 1979-02-28 |
| DE1794330B2 (de) | 1973-04-12 |
| CH547891A (enExample) | 1974-04-11 |
| NL7809831A (nl) | 1979-02-28 |
| GB1243479A (en) | 1971-08-18 |
| DE1795047A1 (de) | 1972-05-10 |
| DE1794330C3 (enExample) | 1973-11-08 |
| JPS5241366B1 (enExample) | 1977-10-18 |
| FR1576100A (enExample) | 1969-07-25 |
| ES356804A1 (es) | 1970-02-16 |
| GB1241400A (en) | 1971-08-04 |
| AU2227770A (en) | 1971-01-07 |
| SE363633B (enExample) | 1974-01-28 |
| NL6811041A (enExample) | 1969-02-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1239818A (en) | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids | |
| GB1274545A (en) | DERIVATIVES OF 4,4'-BIS(s-TRIAZINYLAMINO)-STILBENE-2,2'-DISULPHONIC ACID, AND PROCESSES FOR THEIR MANUFACTURE AND USE AS OPTICAL BRIGHTENERS | |
| US3442905A (en) | N-methylol-n'-substituted-4,5-dihydroxy-2-imidazolidinones | |
| US3475190A (en) | Optical brightening of paper | |
| ES234195A1 (es) | PROCEDIMIENTO PARA TENIR DE MODO UNIFORME ARTiCULOS TEXTILES DE POLICARBONAMIDA | |
| US3309363A (en) | Das triazine brightener | |
| EP0359039A3 (de) | Verfahren zur Pflegeleichtausrüstung von textilen Materialien | |
| DE746569C (de) | Aufhellungsmittel fuer organische Stoffe | |
| GB896533A (en) | New stilbene derivatives and process for their manufacture | |
| US3356524A (en) | Process for treating and brightening cellulose fibers | |
| GB1502106A (en) | Composition and process for brightening and removing greyness from textiles | |
| GB1285142A (en) | Triazinylaminostilbene disulphonic acid optical brightening compositions | |
| GB1266738A (enExample) | ||
| GB1266841A (enExample) | ||
| GB1268108A (en) | Derivatives of 4,4'-diaminostilbene-2,2'-disulphonic acid and the use thereof as optical whitening agents | |
| GB976822A (en) | New bistriazinylaminostilbene derivatives | |
| GB1010759A (en) | Bis-triazinylamino-stilbene brightening agents | |
| GB906960A (en) | Process for brightening fibrous materials | |
| GB1077777A (en) | Process for the production of water-insoluble azo dyestuffs on textile material of cellulose or protein fibres | |
| KR100732351B1 (ko) | 설포네이트화된 디스티릴-비페닐 화합물의 제조방법 | |
| US3745036A (en) | Optical brightening composition and method of brightening fibres made of cellulose and polyamide | |
| AT215944B (de) | Optisch aufhellende Stoffe | |
| AT206857B (de) | Verfahren zur Verbesserung des Weißgehaltes von organischen Stoffen, insbesondere von Faserstoffen, wic Textilien und Papier, sowie Folien | |
| GB1218160A (en) | Triazinylamino stilbene derivatives and their use as optical brighteners | |
| DE2051718A1 (de) | Konzentrierte wasserige, asymmetrisch substituierte Bis triazinyl amino stilbene enthaltende Zurbereitungen und deren Ver wendung zum optischen Aufhellen |