FI80043B - Kefalosporin derivat. - Google Patents
Kefalosporin derivat. Download PDFInfo
- Publication number
- FI80043B FI80043B FI842211A FI842211A FI80043B FI 80043 B FI80043 B FI 80043B FI 842211 A FI842211 A FI 842211A FI 842211 A FI842211 A FI 842211A FI 80043 B FI80043 B FI 80043B
- Authority
- FI
- Finland
- Prior art keywords
- alkyl
- formula
- solvent
- nmr
- hydrogen
- Prior art date
Links
- -1 2-aminothiazol-4-yl Chemical group 0.000 claims description 115
- 150000001875 compounds Chemical class 0.000 claims description 104
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 88
- 238000000034 method Methods 0.000 claims description 70
- 125000000217 alkyl group Chemical group 0.000 claims description 69
- 239000000460 chlorine Substances 0.000 claims description 46
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 38
- 150000001780 cephalosporins Chemical class 0.000 claims description 34
- 229930186147 Cephalosporin Natural products 0.000 claims description 33
- 229940124587 cephalosporin Drugs 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 27
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 8
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 7
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 238000010511 deprotection reaction Methods 0.000 claims description 6
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 6
- 239000012458 free base Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 6
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 5
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- LWTIGYSPAXKMDG-UHFFFAOYSA-N 2,3-dihydro-1h-imidazole Chemical compound C1NC=CN1 LWTIGYSPAXKMDG-UHFFFAOYSA-N 0.000 claims description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 2
- 125000005999 2-bromoethyl group Chemical group 0.000 claims description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 230000008030 elimination Effects 0.000 claims description 2
- 238000003379 elimination reaction Methods 0.000 claims description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 310
- 239000002904 solvent Substances 0.000 description 241
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 120
- 239000007858 starting material Substances 0.000 description 115
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 90
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 86
- 239000000203 mixture Substances 0.000 description 85
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 76
- 239000000047 product Substances 0.000 description 70
- 239000000243 solution Substances 0.000 description 69
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 63
- 239000003480 eluent Substances 0.000 description 60
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 57
- 238000004128 high performance liquid chromatography Methods 0.000 description 55
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 49
- 229910004373 HOAc Inorganic materials 0.000 description 49
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 37
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 35
- 238000004587 chromatography analysis Methods 0.000 description 32
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 29
- 239000011347 resin Substances 0.000 description 24
- 229920005989 resin Polymers 0.000 description 24
- 238000003756 stirring Methods 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 20
- 239000000706 filtrate Substances 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 235000019439 ethyl acetate Nutrition 0.000 description 17
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- 235000017557 sodium bicarbonate Nutrition 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 12
- 101100313763 Arabidopsis thaliana TIM22-2 gene Proteins 0.000 description 12
- 241000588724 Escherichia coli Species 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- YTJSFYQNRXLOIC-UHFFFAOYSA-N octadecylsilane Chemical compound CCCCCCCCCCCCCCCCCC[SiH3] YTJSFYQNRXLOIC-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000007868 Raney catalyst Substances 0.000 description 10
- 229910000564 Raney nickel Inorganic materials 0.000 description 10
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 10
- 239000005909 Kieselgur Substances 0.000 description 9
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 8
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 8
- 239000001099 ammonium carbonate Substances 0.000 description 8
- 235000012501 ammonium carbonate Nutrition 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000010561 standard procedure Methods 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000012299 nitrogen atmosphere Substances 0.000 description 7
- 238000001556 precipitation Methods 0.000 description 7
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 6
- XCHSSZMKKXPBAI-UHFFFAOYSA-N 4-methylsulfanylpyridine Chemical compound CSC1=CC=NC=C1 XCHSSZMKKXPBAI-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 241000219470 Mirabilis Species 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- ILTKGLWEAOKGAK-UHFFFAOYSA-M 4-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C=C1 ILTKGLWEAOKGAK-UHFFFAOYSA-M 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 229960004424 carbon dioxide Drugs 0.000 description 4
- 235000011089 carbon dioxide Nutrition 0.000 description 4
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- YWWZASFPWWPUBN-UHFFFAOYSA-N 1-bromoisoquinoline Chemical compound C1=CC=C2C(Br)=NC=CC2=C1 YWWZASFPWWPUBN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- LMYLEZYGXCVCEY-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=CC(Cl)=CC=N1 LMYLEZYGXCVCEY-UHFFFAOYSA-N 0.000 description 3
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical class ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 3
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- JPUTTYRVDANTBN-UHFFFAOYSA-N ethyl methanimidate;hydrochloride Chemical compound Cl.CCOC=N JPUTTYRVDANTBN-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- WXAZKFDZPUFDML-WMMMYUQOSA-N (2z)-2-(cyanomethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound N#CCO\N=C(C(=O)O)\C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 WXAZKFDZPUFDML-WMMMYUQOSA-N 0.000 description 2
- IUGLELXUMXFCQD-JYUHDHNASA-N (2z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)OC(=O)NCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 IUGLELXUMXFCQD-JYUHDHNASA-N 0.000 description 2
- BJJVYGINKGULCF-OMNKOJBGSA-N (6r)-3-(aminomethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(CN)=C(C(O)=O)N2C(=O)C(NC(=O)OC(C)(C)C)[C@H]21 BJJVYGINKGULCF-OMNKOJBGSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 2
- OWVBVNSYKXWWAE-UHFFFAOYSA-N 2-(azidomethyl)-4-chloropyridine Chemical compound ClC1=CC=NC(CN=[N+]=[N-])=C1 OWVBVNSYKXWWAE-UHFFFAOYSA-N 0.000 description 2
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 2
- MVAXKFAQKTWRAH-UHFFFAOYSA-N 4-chloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC=N1 MVAXKFAQKTWRAH-UHFFFAOYSA-N 0.000 description 2
- VZDOLJHAWASTCZ-UHFFFAOYSA-N 4-methylsulfanyl-2-propylquinazoline Chemical compound C1=CC=CC2=NC(CCC)=NC(SC)=C21 VZDOLJHAWASTCZ-UHFFFAOYSA-N 0.000 description 2
- COABNVNLVJLMAS-UHFFFAOYSA-N 4-methylsulfanylquinazoline Chemical compound C1=CC=C2C(SC)=NC=NC2=C1 COABNVNLVJLMAS-UHFFFAOYSA-N 0.000 description 2
- OTCYFCHOGMFRDM-UHFFFAOYSA-N 7-chloro-4-methylsulfanylquinazoline Chemical compound ClC1=CC=C2C(SC)=NC=NC2=C1 OTCYFCHOGMFRDM-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 241000588697 Enterobacter cloacae Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002829 nitrogen Chemical class 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000008055 phosphate buffer solution Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- XTVAOGFZTSUERE-UHFFFAOYSA-N tert-butyl n-[2-(4-chloropyridin-1-ium-1-yl)ethyl]carbamate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CC(C)(C)OC(=O)NCC[N+]1=CC=C(Cl)C=C1 XTVAOGFZTSUERE-UHFFFAOYSA-N 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- DWAWYEUJUWLESO-UHFFFAOYSA-N trichloromethylsilane Chemical compound [SiH3]C(Cl)(Cl)Cl DWAWYEUJUWLESO-UHFFFAOYSA-N 0.000 description 2
- SIOVKLKJSOKLIF-HJWRWDBZSA-N trimethylsilyl (1z)-n-trimethylsilylethanimidate Chemical compound C[Si](C)(C)OC(/C)=N\[Si](C)(C)C SIOVKLKJSOKLIF-HJWRWDBZSA-N 0.000 description 2
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NSWHTWVHOBWFDQ-MRRCHDRASA-N (2e)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetic acid Chemical compound C=1SC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=NC=1/C(C(=O)O)=N\OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NSWHTWVHOBWFDQ-MRRCHDRASA-N 0.000 description 1
- IPARGUVYMOMVNU-LLVKDONJSA-N (2r)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@@H](C(O)=O)C1=CC=C(O)C=C1 IPARGUVYMOMVNU-LLVKDONJSA-N 0.000 description 1
- QMMPFPLSEIBZCF-WMMMYUQOSA-N (2z)-2-(2-amino-2-oxoethoxy)imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound NC(=O)CO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 QMMPFPLSEIBZCF-WMMMYUQOSA-N 0.000 description 1
- DHHGKPVJEBCXLJ-WMMMYUQOSA-N (2z)-2-(2-bromoethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound BrCCO\N=C(C(=O)O)\C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 DHHGKPVJEBCXLJ-WMMMYUQOSA-N 0.000 description 1
- XRSOYEWUZGNEFB-GDWJVWIDSA-N (2z)-2-(2-ethoxyethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CCOCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 XRSOYEWUZGNEFB-GDWJVWIDSA-N 0.000 description 1
- FILXMIKOWJWDKV-WCIBSUBMSA-N (2z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CO\N=C(/C(O)=O)C=1N=C(NC=O)SC=1Br FILXMIKOWJWDKV-WCIBSUBMSA-N 0.000 description 1
- RLIIROLYNCDXLI-RLANJUCJSA-N (2z)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutyl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound C=1SC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=NC=1C(/C(O)=O)=N/OC1(C(=O)OC(C)(C)C)CCC1 RLIIROLYNCDXLI-RLANJUCJSA-N 0.000 description 1
- PHBAFSJFAJNNSF-KCFYYHDHSA-N (2z)-2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfanylethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1SCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 PHBAFSJFAJNNSF-KCFYYHDHSA-N 0.000 description 1
- LWRXBZDYMOWJEV-FAJYDZGRSA-N (2z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 LWRXBZDYMOWJEV-FAJYDZGRSA-N 0.000 description 1
- GYPXHTYLLUUDHE-AUWJEWJLSA-N (2z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-4-yl]acetic acid Chemical compound CO\N=C(/C(O)=O)C1=COC(NC(=O)OC(C)(C)C)=N1 GYPXHTYLLUUDHE-AUWJEWJLSA-N 0.000 description 1
- MATCFRWXASIMLN-UHFFFAOYSA-M (4-chloro-1-methylpyridin-1-ium-2-yl)methyl acetate;methyl sulfate Chemical compound COS([O-])(=O)=O.CC(=O)OCC1=CC(Cl)=CC=[N+]1C MATCFRWXASIMLN-UHFFFAOYSA-M 0.000 description 1
- WOEWMGJSTHBCRB-HWZXHQHMSA-N (6R)-7-amino-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CN=[N+]=[N-])C(=O)O)C1=O WOEWMGJSTHBCRB-HWZXHQHMSA-N 0.000 description 1
- XSBHBYCNRIIYDF-BAFYGKSASA-N (6r)-4-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(N)S[C@@H]2CC(=O)N21 XSBHBYCNRIIYDF-BAFYGKSASA-N 0.000 description 1
- FZDRVLJSDYQRPO-HWZXHQHMSA-N (6r)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(C)S[C@@H]2CC(=O)N21 FZDRVLJSDYQRPO-HWZXHQHMSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000005868 (methoxymethoxy)methanyl group Chemical group [H]C([H])([H])OC([H])([H])OC([H])([H])* 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- KXAHDPKQOFASEB-UHFFFAOYSA-N 1,4-dibromoisoquinoline Chemical compound C1=CC=C2C(Br)=CN=C(Br)C2=C1 KXAHDPKQOFASEB-UHFFFAOYSA-N 0.000 description 1
- OYQZQNMFTCJSLQ-UHFFFAOYSA-M 1-(4-methylsulfinylpyridin-1-ium-1-yl)propan-2-one;chloride Chemical compound [Cl-].CC(=O)C[N+]1=CC=C(S(C)=O)C=C1 OYQZQNMFTCJSLQ-UHFFFAOYSA-M 0.000 description 1
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 1
- OAPXNORCQAMGAJ-UHFFFAOYSA-M 1-benzyl-4-chloropyridin-1-ium;bromide Chemical compound [Br-].C1=CC(Cl)=CC=[N+]1CC1=CC=CC=C1 OAPXNORCQAMGAJ-UHFFFAOYSA-M 0.000 description 1
- OTRYVKDIWLGHNU-UHFFFAOYSA-M 1-benzyl-4-methylsulfanylquinazolin-1-ium;chloride Chemical compound [Cl-].C12=CC=CC=C2C(SC)=NC=[N+]1CC1=CC=CC=C1 OTRYVKDIWLGHNU-UHFFFAOYSA-M 0.000 description 1
- MMYKTRPLXXWLBC-UHFFFAOYSA-N 1-bromo-2-ethoxyethane Chemical compound CCOCCBr MMYKTRPLXXWLBC-UHFFFAOYSA-N 0.000 description 1
- ZLTKWHIWKLGHOF-UHFFFAOYSA-N 1-cyclopropylpyridin-4-one Chemical compound C1=CC(=O)C=CN1C1CC1 ZLTKWHIWKLGHOF-UHFFFAOYSA-N 0.000 description 1
- HIJUNUKEBATFPF-UHFFFAOYSA-M 1-ethylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 HIJUNUKEBATFPF-UHFFFAOYSA-M 0.000 description 1
- KDRNILXJMALQBN-UHFFFAOYSA-N 1-ethylpyridin-4-one Chemical compound CCN1C=CC(=O)C=C1 KDRNILXJMALQBN-UHFFFAOYSA-N 0.000 description 1
- KCDJQVCUGATWAS-UHFFFAOYSA-M 1-methoxy-3-methylbenzimidazol-3-ium;iodide Chemical compound [I-].C1=CC=C2[N+](OC)=CN(C)C2=C1 KCDJQVCUGATWAS-UHFFFAOYSA-M 0.000 description 1
- WTDKNKIQGBNMKG-UHFFFAOYSA-M 1-methylpyridin-1-ium;bromide Chemical compound [Br-].C[N+]1=CC=CC=C1 WTDKNKIQGBNMKG-UHFFFAOYSA-M 0.000 description 1
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 1
- MIUVWJJNPDWVMH-UHFFFAOYSA-N 1-propylpyridin-4-one Chemical compound CCCN1C=CC(=O)C=C1 MIUVWJJNPDWVMH-UHFFFAOYSA-N 0.000 description 1
- XZSDAVQPXFMHBG-UHFFFAOYSA-N 1-tert-butyl-4-chloropyridin-1-ium Chemical compound CC(C)(C)[N+]1=CC=C(Cl)C=C1 XZSDAVQPXFMHBG-UHFFFAOYSA-N 0.000 description 1
- DMSSTTLDFWKBSX-UHFFFAOYSA-N 1h-1,2,3-benzotriazin-4-one Chemical compound C1=CC=C2C(=O)N=NNC2=C1 DMSSTTLDFWKBSX-UHFFFAOYSA-N 0.000 description 1
- KMOYVWBLNBADMY-UHFFFAOYSA-N 1h-azepine;methanesulfonic acid Chemical compound CS(O)(=O)=O.N1C=CC=CC=C1 KMOYVWBLNBADMY-UHFFFAOYSA-N 0.000 description 1
- PMRFHZGOPOAXMA-UHFFFAOYSA-N 2,3,4,5-tetramethylquinoline;azide Chemical compound [N-]=[N+]=[N-].C1=CC(C)=C2C(C)=C(C)C(C)=NC2=C1 PMRFHZGOPOAXMA-UHFFFAOYSA-N 0.000 description 1
- HBGBCWDOYVUUAA-UHFFFAOYSA-M 2-(4-methylsulfanylpyridin-1-ium-1-yl)ethanimidamide;chloride Chemical compound [Cl-].CSC1=CC=[N+](CC(N)=N)C=C1 HBGBCWDOYVUUAA-UHFFFAOYSA-M 0.000 description 1
- NFYNNDGVKASWCX-UHFFFAOYSA-M 2-(4-methylsulfanylpyridin-1-ium-1-yl)ethanol;bromide Chemical compound [Br-].CSC1=CC=[N+](CCO)C=C1 NFYNNDGVKASWCX-UHFFFAOYSA-M 0.000 description 1
- XZQMXNVNYKWYPC-UHFFFAOYSA-N 2-(4-methylsulfinylpyridin-1-ium-1-yl)acetamide;bromide Chemical compound [Br-].CS(=O)C1=CC=[N+](CC(N)=O)C=C1 XZQMXNVNYKWYPC-UHFFFAOYSA-N 0.000 description 1
- NQWQXURKJJAXQR-UHFFFAOYSA-M 2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanimidamide;chloride Chemical compound [Cl-].CS(=O)C1=CC=[N+](CC(N)=N)C=C1 NQWQXURKJJAXQR-UHFFFAOYSA-M 0.000 description 1
- JULREWKAXYSVBX-UHFFFAOYSA-M 2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanol;bromide Chemical compound [Br-].CS(=O)C1=CC=[N+](CCO)C=C1 JULREWKAXYSVBX-UHFFFAOYSA-M 0.000 description 1
- NLOVPGZATCSLMB-UHFFFAOYSA-M 2-[(4-chloropyridin-1-ium-1-yl)methyl]benzonitrile;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(Cl)=CC=[N+]1CC1=CC=CC=C1C#N NLOVPGZATCSLMB-UHFFFAOYSA-M 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- LDNJYYHKSRADIU-UHFFFAOYSA-M 2-bromoquinolizin-5-ium;bromide Chemical compound [Br-].C1=CC=CC2=CC(Br)=CC=[N+]21 LDNJYYHKSRADIU-UHFFFAOYSA-M 0.000 description 1
- JVMJNDLIVMDWJS-UHFFFAOYSA-M 2-chloro-1,3-dimethylimidazol-1-ium;iodide Chemical compound [I-].CN1C=C[N+](C)=C1Cl JVMJNDLIVMDWJS-UHFFFAOYSA-M 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- BFYRXCWLDJORHM-UHFFFAOYSA-N 2-chloro-4,5-dihydro-1h-imidazole Chemical compound ClC1=NCCN1 BFYRXCWLDJORHM-UHFFFAOYSA-N 0.000 description 1
- GUPOZVHRTJYZCX-UHFFFAOYSA-N 2-chloroethanimidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])CCl GUPOZVHRTJYZCX-UHFFFAOYSA-N 0.000 description 1
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 1
- OCVXSFKKWXMYPF-UHFFFAOYSA-N 2-chloroimidazole Chemical compound ClC1=NC=CN1 OCVXSFKKWXMYPF-UHFFFAOYSA-N 0.000 description 1
- FNRMMDCDHWCQTH-UHFFFAOYSA-N 2-chloropyridine;3-chloropyridine;4-chloropyridine Chemical compound ClC1=CC=NC=C1.ClC1=CC=CN=C1.ClC1=CC=CC=N1 FNRMMDCDHWCQTH-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- LNFZAUNJFRYZLE-UHFFFAOYSA-N 2-fluoro-1h-imidazole Chemical compound FC1=NC=CN1 LNFZAUNJFRYZLE-UHFFFAOYSA-N 0.000 description 1
- NYWWLAGHUMTSBB-UHFFFAOYSA-N 2-methoxy-1-oxidopyridin-1-ium Chemical compound COC1=CC=CC=[N+]1[O-] NYWWLAGHUMTSBB-UHFFFAOYSA-N 0.000 description 1
- YLZYSVYZMDJYOT-UHFFFAOYSA-N 2-methoxypyrimidine Chemical compound COC1=NC=CC=N1 YLZYSVYZMDJYOT-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- COCFIBRMFPWUDW-UHFFFAOYSA-N 2-methylquinolin-4-amine Chemical compound C1=CC=CC2=NC(C)=CC(N)=C21 COCFIBRMFPWUDW-UHFFFAOYSA-N 0.000 description 1
- MFAZKHYKVSPPIB-UHFFFAOYSA-N 2-propyl-1h-quinazolin-4-one Chemical compound C1=CC=C2NC(CCC)=NC(=O)C2=C1 MFAZKHYKVSPPIB-UHFFFAOYSA-N 0.000 description 1
- NLDQGEZFOMVCOH-UHFFFAOYSA-N 2-propyl-1h-quinazoline-4-thione Chemical compound C1=CC=C2NC(CCC)=NC(=S)C2=C1 NLDQGEZFOMVCOH-UHFFFAOYSA-N 0.000 description 1
- FPEANFVVZUKNFU-UHFFFAOYSA-N 2-sulfanylbenzotriazole Chemical compound C1=CC=CC2=NN(S)N=C21 FPEANFVVZUKNFU-UHFFFAOYSA-N 0.000 description 1
- RGSWYEYNDJNXRK-UHFFFAOYSA-N 2-tert-butyl-3h-pyridin-4-one Chemical compound CC(C)(C)C1=NC=CC(=O)C1 RGSWYEYNDJNXRK-UHFFFAOYSA-N 0.000 description 1
- PLKNGGRZZIWWLD-UHFFFAOYSA-N 3,5-dioxo-2h-1,2,4-triazine-6-carboxylic acid Chemical compound OC(=O)C1=NN=C(O)N=C1O PLKNGGRZZIWWLD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ULJCUMSGAKFVQL-UHFFFAOYSA-M 3-benzyl-2-bromo-1,3-thiazol-3-ium;bromide Chemical compound [Br-].S1C=C[N+](CC=2C=CC=CC=2)=C1Br ULJCUMSGAKFVQL-UHFFFAOYSA-M 0.000 description 1
- RPYICTHKCBXLBR-UHFFFAOYSA-M 3-bromo-4-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(Br)=C1 RPYICTHKCBXLBR-UHFFFAOYSA-M 0.000 description 1
- QADXKWUCCGPQNR-UHFFFAOYSA-N 3-bromo-4-chloropyridine Chemical compound ClC1=CC=NC=C1Br QADXKWUCCGPQNR-UHFFFAOYSA-N 0.000 description 1
- SIMYCJOGGRXQIY-UHFFFAOYSA-N 3-chloropyrrolidine Chemical compound ClC1CCNC1 SIMYCJOGGRXQIY-UHFFFAOYSA-N 0.000 description 1
- XUDQJRFWODLIPM-UHFFFAOYSA-M 3-fluoro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC(F)=C1 XUDQJRFWODLIPM-UHFFFAOYSA-M 0.000 description 1
- CELKOWQJPVJKIL-UHFFFAOYSA-N 3-fluoropyridine Chemical compound FC1=CC=CN=C1 CELKOWQJPVJKIL-UHFFFAOYSA-N 0.000 description 1
- CCCGZCQYXYLDIH-UHFFFAOYSA-N 3-methoxy-5-methyl-1,2-oxazole Chemical compound COC=1C=C(C)ON=1 CCCGZCQYXYLDIH-UHFFFAOYSA-N 0.000 description 1
- KYBCQZHRJZJYCE-UHFFFAOYSA-N 4,6-dichloro-2-methylquinoline Chemical compound C1=C(Cl)C=CC2=NC(C)=CC(Cl)=C21 KYBCQZHRJZJYCE-UHFFFAOYSA-N 0.000 description 1
- JAOINXWEFKZYIL-UHFFFAOYSA-N 4-(1-methyl-2-oxoquinolin-4-yl)oxy-n-(4-methylpyridin-2-yl)butanamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC1=CC=NC(NC(=O)CCCOC=2C3=CC=CC=C3N(C)C(=O)C=2)=C1 JAOINXWEFKZYIL-UHFFFAOYSA-N 0.000 description 1
- CQQSQBRPAJSTFB-UHFFFAOYSA-N 4-(bromomethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(CBr)C=C1 CQQSQBRPAJSTFB-UHFFFAOYSA-N 0.000 description 1
- XEATWTQXOLTEBX-UHFFFAOYSA-N 4-[(4-chloropyridin-1-ium-1-yl)methyl]benzoic acid;bromide Chemical compound [Br-].C1=CC(C(=O)O)=CC=C1C[N+]1=CC=C(Cl)C=C1 XEATWTQXOLTEBX-UHFFFAOYSA-N 0.000 description 1
- AYSCIYSRYOMFTP-UHFFFAOYSA-M 4-chloro-1,2-dimethylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=CC2=[N+](C)C(C)=CC(Cl)=C21 AYSCIYSRYOMFTP-UHFFFAOYSA-M 0.000 description 1
- SRVQKTSYAQICEA-UHFFFAOYSA-M 4-chloro-1-(methoxymethyl)pyrimidin-1-ium;bromide Chemical compound [Br-].COC[N+]1=CC=C(Cl)N=C1 SRVQKTSYAQICEA-UHFFFAOYSA-M 0.000 description 1
- WLNYRZOIIKZHBJ-UHFFFAOYSA-M 4-chloro-1-(methylsulfanylmethyl)pyridin-1-ium;chloride Chemical compound [Cl-].CSC[N+]1=CC=C(Cl)C=C1 WLNYRZOIIKZHBJ-UHFFFAOYSA-M 0.000 description 1
- DKFIENATHYUDBX-UHFFFAOYSA-M 4-chloro-1-[(3-methoxyphenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.COC1=CC=CC(C[N+]=2C=CC(Cl)=CC=2)=C1 DKFIENATHYUDBX-UHFFFAOYSA-M 0.000 description 1
- NNBBNSGBUPAWNH-UHFFFAOYSA-M 4-chloro-1-[(4-fluorophenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(F)=CC=C1C[N+]1=CC=C(Cl)C=C1 NNBBNSGBUPAWNH-UHFFFAOYSA-M 0.000 description 1
- ZRNQGCAIWFVUMO-UHFFFAOYSA-M 4-chloro-1-[(4-methylphenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(C)=CC=C1C[N+]1=CC=C(Cl)C=C1 ZRNQGCAIWFVUMO-UHFFFAOYSA-M 0.000 description 1
- LYBRKZJPXRUPPM-UHFFFAOYSA-M 4-chloro-1-[(4-nitrophenyl)methyl]pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC([N+](=O)[O-])=CC=C1C[N+]1=CC=C(Cl)C=C1 LYBRKZJPXRUPPM-UHFFFAOYSA-M 0.000 description 1
- VKXHJZFWVAJKAG-UHFFFAOYSA-M 4-chloro-1-cyclopropylpyridin-1-ium 4-methylbenzenesulfonate Chemical compound C1=CC(Cl)=CC=[N+]1C1CC1.CC1=CC=C(S([O-])(=O)=O)C=C1 VKXHJZFWVAJKAG-UHFFFAOYSA-M 0.000 description 1
- WYINNSOHYWDWJG-UHFFFAOYSA-N 4-chloro-1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=C(Cl)C=C1 WYINNSOHYWDWJG-UHFFFAOYSA-N 0.000 description 1
- YNCYXHUQSIVEBZ-UHFFFAOYSA-M 4-chloro-1-methyl-3-[(4-nitrophenyl)methoxy]pyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(OCC=2C=CC(=CC=2)[N+]([O-])=O)=C1 YNCYXHUQSIVEBZ-UHFFFAOYSA-M 0.000 description 1
- SGRIQHLJRIMNLG-UHFFFAOYSA-N 4-chloro-1-methylpyridin-1-ium-2-amine;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C=C1N SGRIQHLJRIMNLG-UHFFFAOYSA-N 0.000 description 1
- XEMPAPZJPSDSQJ-UHFFFAOYSA-M 4-chloro-1-methylpyridin-1-ium-3-amine;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(N)=C1 XEMPAPZJPSDSQJ-UHFFFAOYSA-M 0.000 description 1
- YNVSUEIOWWNWIE-UHFFFAOYSA-M 4-chloro-1-methylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=CC=C(Cl)C2=C1 YNVSUEIOWWNWIE-UHFFFAOYSA-M 0.000 description 1
- KWGPUDZXBORMGB-UHFFFAOYSA-N 4-chloro-1-oxidopyridin-1-ium-3-ol Chemical compound OC1=C[N+]([O-])=CC=C1Cl KWGPUDZXBORMGB-UHFFFAOYSA-N 0.000 description 1
- KTLQWVRFSFTPKW-UHFFFAOYSA-M 4-chloro-1-propylpyridin-1-ium 4-methylbenzenesulfonate Chemical compound CCC[N+]1=CC=C(Cl)C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 KTLQWVRFSFTPKW-UHFFFAOYSA-M 0.000 description 1
- HQAIROMRVBVWSK-UHFFFAOYSA-N 4-chloro-2-methylquinoline Chemical compound C1=CC=CC2=NC(C)=CC(Cl)=C21 HQAIROMRVBVWSK-UHFFFAOYSA-N 0.000 description 1
- GCCOVPIYBFPYOR-UHFFFAOYSA-N 4-chloro-3-[(4-nitrophenyl)methoxy]pyridine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1COC1=CN=CC=C1Cl GCCOVPIYBFPYOR-UHFFFAOYSA-N 0.000 description 1
- HEAUUSUVCNXXDR-UHFFFAOYSA-M 4-chloro-3-fluoro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(F)=C1 HEAUUSUVCNXXDR-UHFFFAOYSA-M 0.000 description 1
- MSYPXENUSGPSGK-UHFFFAOYSA-M 4-chloro-3-methoxy-1-methylpyridin-1-ium;iodide Chemical compound [I-].COC1=C[N+](C)=CC=C1Cl MSYPXENUSGPSGK-UHFFFAOYSA-M 0.000 description 1
- DICAQTPGOQCCOH-UHFFFAOYSA-N 4-chloro-3-methoxypyridine Chemical compound COC1=CN=CC=C1Cl DICAQTPGOQCCOH-UHFFFAOYSA-N 0.000 description 1
- ACGWDTACRIOFGU-UHFFFAOYSA-M 4-chloro-6-fluoro-1,2-dimethylquinolin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=C(F)C=CC2=[N+](C)C(C)=CC(Cl)=C21 ACGWDTACRIOFGU-UHFFFAOYSA-M 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical compound NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- GTLFLMZOABSJSV-UHFFFAOYSA-N 4-chloropyridin-3-amine Chemical compound NC1=CN=CC=C1Cl GTLFLMZOABSJSV-UHFFFAOYSA-N 0.000 description 1
- GQORRJKLCCMNPX-UHFFFAOYSA-N 4-chloropyridin-3-ol Chemical compound OC1=CN=CC=C1Cl GQORRJKLCCMNPX-UHFFFAOYSA-N 0.000 description 1
- 150000005751 4-halopyridines Chemical class 0.000 description 1
- AEKCNKQSIRUADN-UHFFFAOYSA-N 4-methoxy-1-methylpyridin-1-ium-2-carboxamide;sulfate Chemical compound [O-]S([O-])(=O)=O.COC1=CC=[N+](C)C(C(N)=O)=C1.COC1=CC=[N+](C)C(C(N)=O)=C1 AEKCNKQSIRUADN-UHFFFAOYSA-N 0.000 description 1
- IKNDUXJUWCMTPG-UHFFFAOYSA-N 4-methoxy-1-methylpyridin-1-ium-3-carboxamide;sulfate Chemical compound [O-]S([O-])(=O)=O.COC1=CC=[N+](C)C=C1C(N)=O.COC1=CC=[N+](C)C=C1C(N)=O IKNDUXJUWCMTPG-UHFFFAOYSA-N 0.000 description 1
- HSASPJKRUHQXJB-UHFFFAOYSA-N 4-methoxy-1-oxidopyridin-1-ium-2-carboxamide Chemical compound COC1=CC=[N+]([O-])C(C(N)=O)=C1 HSASPJKRUHQXJB-UHFFFAOYSA-N 0.000 description 1
- JOUKZHHGEKOOPZ-UHFFFAOYSA-N 4-methoxy-6-methyl-1,2-dihydropyrimidin-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate Chemical compound COC1=CC(C)=[NH+]CN1N.CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 JOUKZHHGEKOOPZ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- DYHMIVKBJSIOCH-UHFFFAOYSA-N 4-methoxypyridine-2-carboxamide Chemical compound COC1=CC=NC(C(N)=O)=C1 DYHMIVKBJSIOCH-UHFFFAOYSA-N 0.000 description 1
- NXQLBCIJYNCZKC-UHFFFAOYSA-N 4-methoxypyridine-3-carboxamide Chemical compound COC1=CC=NC=C1C(N)=O NXQLBCIJYNCZKC-UHFFFAOYSA-N 0.000 description 1
- NDYDYCFFKFQTPA-UHFFFAOYSA-N 4-nitro-1-oxidopyridin-1-ium-3-ol Chemical compound OC1=C[N+]([O-])=CC=C1[N+]([O-])=O NDYDYCFFKFQTPA-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- YBGBTGGBNZEUJS-UHFFFAOYSA-N 5-chloro-1,3-thiazole Chemical compound ClC1=CN=CS1 YBGBTGGBNZEUJS-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- JTTKXEIHKDSIRC-UHFFFAOYSA-N 5-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=CC=C(Cl)C=N1 JTTKXEIHKDSIRC-UHFFFAOYSA-N 0.000 description 1
- FMXSYRBHGUMFBA-UHFFFAOYSA-N 6-amino-3-azaniumylidene-9-[2-carboxy-4-[6-[4-[4-[4-[4-[3-carboxy-6-[4-(trifluoromethyl)phenyl]naphthalen-1-yl]phenyl]piperidin-1-yl]butyl]triazol-1-yl]hexylcarbamoyl]phenyl]-5-sulfoxanthene-4-sulfonate Chemical compound Nc1ccc2c(-c3ccc(cc3C(O)=O)C(=O)NCCCCCCn3cc(CCCCN4CCC(CC4)c4ccc(cc4)-c4cc(cc5cc(ccc45)-c4ccc(cc4)C(F)(F)F)C(O)=O)nn3)c3ccc(=[NH2+])c(c3oc2c1S(O)(=O)=O)S([O-])(=O)=O FMXSYRBHGUMFBA-UHFFFAOYSA-N 0.000 description 1
- NZVXNANNSHSECK-UHFFFAOYSA-N 6-fluoro-1,2-dimethylquinolin-4-one Chemical compound FC1=CC=C2N(C)C(C)=CC(=O)C2=C1 NZVXNANNSHSECK-UHFFFAOYSA-N 0.000 description 1
- QAEPQDLTYLAQEJ-UHFFFAOYSA-M 7-chloro-1-methyl-4-methylsulfanylquinazolin-1-ium;iodide Chemical compound [I-].ClC1=CC=C2C(SC)=NC=[N+](C)C2=C1 QAEPQDLTYLAQEJ-UHFFFAOYSA-M 0.000 description 1
- PMLONMIODRHERC-UHFFFAOYSA-N 7-chloro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C=2C1=CC(Cl)=CC=2 PMLONMIODRHERC-UHFFFAOYSA-N 0.000 description 1
- YOVNGYWYUZMMPG-UHFFFAOYSA-N 7-chloro-1h-quinazoline-4-thione Chemical compound N1C=NC(=S)C=2C1=CC(Cl)=CC=2 YOVNGYWYUZMMPG-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102220582664 Astrocytic phosphoprotein PEA-15_N14R_mutation Human genes 0.000 description 1
- IEUZDWMFWJKEQR-UHFFFAOYSA-N C1C=CC2=C(N1Br)C=CC=C2[N+](=O)[O-] Chemical compound C1C=CC2=C(N1Br)C=CC=C2[N+](=O)[O-] IEUZDWMFWJKEQR-UHFFFAOYSA-N 0.000 description 1
- PXJMSKKODDFGLN-JYUHDHNASA-N CC(C)(C)OC(C(C)(C)O/N=C(\C(Cl)=O)/C1=NN(NC(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=C1)=O Chemical compound CC(C)(C)OC(C(C)(C)O/N=C(\C(Cl)=O)/C1=NN(NC(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=C1)=O PXJMSKKODDFGLN-JYUHDHNASA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N Chelidonic acid Chemical compound OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- LNNWYWYHUAXBMI-UHFFFAOYSA-N ClC1=CC=[N+](C(=C1)C)C Chemical compound ClC1=CC=[N+](C(=C1)C)C LNNWYWYHUAXBMI-UHFFFAOYSA-N 0.000 description 1
- JLJQMRXWUOSCRT-UHFFFAOYSA-N ClC=1N(CN=C(C=1)C)N Chemical compound ClC=1N(CN=C(C=1)C)N JLJQMRXWUOSCRT-UHFFFAOYSA-N 0.000 description 1
- LDUXMMSHEQAYMN-UHFFFAOYSA-N Cl[N+]1=CC=CC=C1 Chemical class Cl[N+]1=CC=CC=C1 LDUXMMSHEQAYMN-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101000760663 Hololena curta Mu-agatoxin-Hc1a Proteins 0.000 description 1
- 101000610640 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp3 Proteins 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CVQUWLDCFXOXEN-UHFFFAOYSA-N Pyran-4-one Chemical compound O=C1C=COC=C1 CVQUWLDCFXOXEN-UHFFFAOYSA-N 0.000 description 1
- 101001110823 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-A Proteins 0.000 description 1
- 101000712176 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-B Proteins 0.000 description 1
- 241000392514 Salmonella enterica subsp. enterica serovar Dublin Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 102100040374 U4/U6 small nuclear ribonucleoprotein Prp3 Human genes 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- GPRBEKHLDVQUJE-VINNURBNSA-N cefotaxime Chemical compound N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C(O)=O)=O)C(=O)/C(=N/OC)C1=CSC(N)=N1 GPRBEKHLDVQUJE-VINNURBNSA-N 0.000 description 1
- 229960004261 cefotaxime Drugs 0.000 description 1
- WZOZEZRFJCJXNZ-ZBFHGGJFSA-N cefoxitin Chemical compound N([C@]1(OC)C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)CC1=CC=CS1 WZOZEZRFJCJXNZ-ZBFHGGJFSA-N 0.000 description 1
- 229960002682 cefoxitin Drugs 0.000 description 1
- 229960002588 cefradine Drugs 0.000 description 1
- RDLPVSKMFDYCOR-UEKVPHQBSA-N cephradine Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CCC=CC1 RDLPVSKMFDYCOR-UEKVPHQBSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 1
- 229960003324 clavulanic acid Drugs 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- OQBCSSWQGYWEHX-UHFFFAOYSA-M ethyl 3-[(4-chloropyridin-1-ium-1-yl)methyl]benzoate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCOC(=O)C1=CC=CC(C[N+]=2C=CC(Cl)=CC=2)=C1 OQBCSSWQGYWEHX-UHFFFAOYSA-M 0.000 description 1
- CQBWPUJYGMSGDU-UHFFFAOYSA-N ethyl benzenecarboximidate Chemical compound CCOC(=N)C1=CC=CC=C1 CQBWPUJYGMSGDU-UHFFFAOYSA-N 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 210000003918 fraction a Anatomy 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- LULXBAGMGMJJRW-UHFFFAOYSA-N n,2-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)CC(=O)N[Si](C)(C)C LULXBAGMGMJJRW-UHFFFAOYSA-N 0.000 description 1
- MDQYMNXMQMRKGB-UHFFFAOYSA-M n,n-dimethyl-2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanamine;chloride Chemical compound [Cl-].CN(C)CC[N+]1=CC=C(S(C)=O)C=C1 MDQYMNXMQMRKGB-UHFFFAOYSA-M 0.000 description 1
- HSKNJSHFPPHTAQ-UHFFFAOYSA-N n-(2-chloroethyl)acetamide Chemical compound CC(=O)NCCCl HSKNJSHFPPHTAQ-UHFFFAOYSA-N 0.000 description 1
- OESDOFIWOSBLER-UHFFFAOYSA-O n-[(4-chloro-1-methylpyridin-1-ium-2-yl)methyl]acetamide Chemical compound CC(=O)NCC1=CC(Cl)=CC=[N+]1C OESDOFIWOSBLER-UHFFFAOYSA-O 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DBABZHXKTCFAPX-UHFFFAOYSA-N probenecid Chemical compound CCCN(CCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 DBABZHXKTCFAPX-UHFFFAOYSA-N 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical class N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- PAGRPIWEWZODKJ-UHFFFAOYSA-N tert-butyl 2-(2-chloroimidazol-1-yl)acetate Chemical compound CC(C)(C)OC(=O)CN1C=CN=C1Cl PAGRPIWEWZODKJ-UHFFFAOYSA-N 0.000 description 1
- OTWCWIJBVPDNRS-UHFFFAOYSA-M tert-butyl 2-amino-3-(4-chloropyridin-1-ium-1-yl)propanoate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CC(C)(C)OC(=O)C(N)C[N+]1=CC=C(Cl)C=C1 OTWCWIJBVPDNRS-UHFFFAOYSA-M 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- BFNYNEMRWHFIMR-UHFFFAOYSA-N tert-butyl 2-cyanoacetate Chemical compound CC(C)(C)OC(=O)CC#N BFNYNEMRWHFIMR-UHFFFAOYSA-N 0.000 description 1
- JCJCAEFVDYJKKI-UHFFFAOYSA-N tert-butyl 2-sulfanylbenzoate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1S JCJCAEFVDYJKKI-UHFFFAOYSA-N 0.000 description 1
- GSJJCZSHYJNRPN-UHFFFAOYSA-N tert-butyl n-(2-sulfanylethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCS GSJJCZSHYJNRPN-UHFFFAOYSA-N 0.000 description 1
- KZBFNVDGLMJXJV-UHFFFAOYSA-N tert-butyl n-[(4-chloro-1-methylpyridin-1-ium-2-yl)methyl]carbamate;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]1=CC=C(Cl)C=C1CNC(=O)OC(C)(C)C KZBFNVDGLMJXJV-UHFFFAOYSA-N 0.000 description 1
- CLIIHUOFOCDSDJ-UHFFFAOYSA-N tert-butyl n-[(4-chloropyridin-2-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC(Cl)=CC=N1 CLIIHUOFOCDSDJ-UHFFFAOYSA-N 0.000 description 1
- CRRNBVYNBMRUMD-UHFFFAOYSA-N tert-butyl n-[2-(4-oxopyridin-1-yl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCN1C=CC(=O)C=C1 CRRNBVYNBMRUMD-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical group C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- LEMXOCROJQSQFD-UHFFFAOYSA-N trimethyl(pyridin-4-yloxy)silane Chemical compound C[Si](C)(C)OC1=CC=NC=C1 LEMXOCROJQSQFD-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/57—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with a further substituent in position 7, e.g. cephamycines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D505/00—Heterocyclic compounds containing 5-oxa-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxacephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Claims (15)
1. Förfarande för framställning av terapeutiskt användbara substituerade 3-aminometylcefalosporiner med 5 formeln I 120 80043 R1-NH--p > 0^- Y 2 4
1. Ro 10 3 väri R^ är en i cefalosporinkemin sedvanlig C-4-substi-tuent;
15 R^ är en grupp som har formeln II, V eller VI O 20 HO r CH-CO- ' NH V Rll-fi-C0 VI N ^°-R12 30 väri R^ ooh R^ oberoende av varandra betecknar väte eller metyl; R10 är en grupp som har formeln VII eller VIII 0 0 0H M >>. -N H-C2H5 ' ' H VII VIII 121 80043 är 2-aminotiazol-4-yl eller 2-amino-oxazol-4-yl, vilka vardera eventuellt substituerats i 5-ställningen med fluor, klor eller brom, R^2 är väte, C^_g-alkyl, C3_g-cykloalkyl, C3_g-sykloalkyl-5 C1_3~alkyl, C3_6~alkenyl, C3_g-alkynyl, halogen-C1_3~alkyl, hydroxi-C2_g-alkyl7 C3_4~alkoxi-C2_4-alkyl, amino-C2_6-alkyl, cyano-C3_5-alkyl, azido-C3_4-alkyl, karbamoyl-C3_4-alkyl, fenyl-C3_4-alkyl, 5-metylisozazol-3-ylmetyl, 2-(2-karboxifenyltio)etyl eller en grupp som har formeln XI 10 -CR29R30-(CH2»nTCOR31 XI väri m är 0 - 3, R2g är väte eller C-^-alkyl, är väte eller C3_3~alkyl eller R2g och R3Q bildar tillsammans 15 med den kolatomen, vid vilken de är bundna en karbocyklisk C3_7~ring och R^^ är väte eller Cj_4~alkoxi; R4 är en grupp som har formeln XII eller XIV / R34 N\
20 -N=C^ R33 XII *32 _NH_1 Y J— R4q XIV
25. N-^ R39 väri R32 är väte, C^_g-alkyl, fenyl eller karboxi-C3_g- alkyl; R33 är väte; C3_6-alkyl, fenyl, karboxi-C^g-alkyl 30 eller cyano och R34 är väte eller C1_6~alkyl eller R33 och R_ . bildar tillsammans med den kväveatomen vid vilken de 34 är bundna, en hexahydroazepinring; ringen Y är pyridin, pyrmidin, imidazol, dihydroimidazol, tiazol eller isoxaz-ol, vid vilka eventuellt fusionerats, dä det är möjligt, 35 en bensen-, cyklopentan-eller cyklohexanring; R3g är väte, C1_6~alkyl, C1_4~alkoxi-C1_4-alkyl, fenyl-C^g-alkyl, C1-6-alkoxikarbonyl-C1_6-alkyl, karboxi-C1_6~alkyl, C1_g- 122 80043 alkyltio-C^_g-alkyl, C1_g-alkoxi-C^_g-alkoxi-C1_g-alkyl, C^_g-alkylsulfinyl-C^_g-alkyl, C^_g-alkoxi, fenyl-C^_g-alkoxi, C^_g-alkoxikarbonylamino-C^_g-alkyl, amino-C^g-alkyl, karbamoyl-C^_g-alkyl, hydroxi-C^g-alkyl < c\-s~ 5 alkanoyl-C^_g-alkyl, di-C^_g-alkylamino-C^_g-alkyl, C^_g-alkanoylamino-C^_g-alkyl, C-^g-cykloalkyl, Cg_g-alkanyl, amino, fenyl-C^_g-alkyl, vars fenylring eventuellt är substituerad med cyano, C^_g-alkoxi, C^_g-alkoxikarbonyl, halogen, C^g-alkyl, nitro eller karboxi, eller en grupp 10 som har formeln -(CH_) -N=CR,,NR ,,.R.c 2 n 43 44 45 väri n är 1 - 4 och ^43/ R44 och R^ oberoende av varand- 15 ra betecknar väte eller C^^-alkyl; och R-» är väte eller en eller tvA substituenter, vilka valts 40 bland C1_g-alkyl, halogen-C1_g-alkyl, karbamoyl, halogen, C^_g-alkoxi, C^_g-alkoxikarbonyl-C^_g-alkyl, amino, 2-aminoetyltiometyl, C1_g-alkanoylamino-C^_g-metyl, amino-20 C^_g-alkyl, nitro, fenyl-C^_g-alkyl och nitrobensyloxi; och di föreningen med formeln I ej bär en posi-tiv laddning, farmaceutiskt godtagbara syradditionssalter därav, och dä föreningen med formeln I bär en karboxi-radikal, farmaceutiskt godtagbara basadditionssalter där-25 av, kännetecknat därav, att man a) omsätter en förening med formeln XVIII R1-NH--r N XVIII 30 o^-Nv^ch^Bj R3 genom fogande av aminogruppen tili en aktiverad C=C- eller C=N-bindning, vilken pä kolatomen bär radikalen R^q 35 och sedan eliminerar HR,-0 frän produkten, varvid R,-0 är en undanträngbar radikal; 123 80043 b) för sädana föreningar, vilka innehäller en karboxi- och/eller aminoradikal, avlägsnar skyddsgruppen frän motsvarande förening, vilken bär en skyddsgrupp pä platsen för den relevanta väteatomen; 5 c) för sädana föreningar, väri R^ har formeln V eller VI, acylerar en förening med formeln XIX H2N ^ XIX 0^~ V“ CH2-R4
10 I R3 med en syra med formeln R^-OH, väri R,-^ har formeln V eller VI, eller med ett aktiverat derivat därav; 15 d) för sädana föreningar, väri R^ har formeln VI, väri R-^2 är annat än väte, omsätter en förening med formeln I, väri R^ har formeln I, väri R^ är väte, med en förening med formeln R5oR52' vari R5q är en undanträngbar radikal och R^ har nägon av betydelserna för R^/ mec* un_ 20 dantag av väte; e) för sädana föreningar, väri R^ har formeln VI, omsätter en förening med formeln XXI Rn-C0-C°-NH--f 25 ^CH2-R4 XXI R3 med en förening med formeln HjN-O-R^» 30 och sedan, dä föreningen med formeln I erhälls i form av den fria basen eller med hybridjon, och ett sait erfodras, omsätter föreningen med formeln I, som är i form av den fria basen eller med hybridjon, med en syra, vilken avger en farmaceutiskt godtagbar anjon, eller dä 35 föreningen med formeln I bär en karboxiradikal, omsätter föreningen med formeln I med en bas, vilken avger en farmaceutiskt godtagbar katjon. 124 80043
2. Förfarande enligt patentkravet 1, känne-t e c k n a t därav, att man framställer ett cefalosporinderivat, väri R1 har formeln VI, R^ är karboxi och R4 har formeln XIV. 5 3. Förfarande enligt patentkravet 1, känne- t e c k n a t därav, att man framställer ett cefalospo-rinderivat väri R^ är 2-aminotiazol-4-yl.
4. Förfarande enligt patentkravet 2 eller 3, kännetecknat därav, att man framställer ett 10 cefalosporinderivat, väri R12 är metyl, etyl, i-propyl, allyl, propargyl, cyklopentyl, cyklopropylmetyl, 2-klor-etyl, 2-brometyl, cyanometyl, 2-cyanoetyl, 2-hydroxietyl, 2-etoxietyl, bensyl eller har formeln XI, väri m är 0, R2g och R30 vardera är väte eller metyl eller R2g och R^q 15 bildar tillsammans med kolet, vid vilket de är bundna, en cyklobutyl- eller cyklopentylring, och R^ är väte eller metoxi.
5. Förfarande enligt patentkravet 4, kännetecknat därav, att man framställer ett cefalospo- 20 rinderivat, väri har formeln XIV, väri ringen Y är py-ridin, vid vilken eventuellt är bunden en bensen- eller cyklopentenring, pyrimidin, vid vilken eventuellt är bunden en bensenring, tiazol eller isoxazol.
6. Förfarande enligt patentkravet 5, känne- 25 tecknat därav, att man framställer ett cefalosporinderivat, väri R^g är metyl, etyl, n-propyl, i-propyl, allyl, karbamoylmetyl, (2-acetylamino)-etyl, metyltio-metyl, 2-hydroxietyl, 2-aminoetyl, 4-nitrobensyl, CH2CH2N=C(CH3)NH2 eller CH2C(CH)CH2 och R4Q är väte, 30 fluor, amino, metyl, metoxi eller karbamoyl.
7. Förfarande enligt patentkravet 1, kännetecknat därav, att man framställer ett cefalosporinderivat som valts bland föreningarna som upptagits i nedanstäende tabell, och ett farmaceutiskt godtagbart bas- 35 additionssalt därav: 125 80043 H2N-{ I H - S n -k/c°— nh ^ x~ "ί I ,^ch2-r4
0 R12 ^ £ cocl·- R12 R4 -c(ch3)2cooh -nh^j-ch3 /-Λ Φ -C(CH3)2COOH -NH~T_ N"CH3 ch3^ -C(CH3)2COOH -NH-g^CH3 /r^\G> -C(CH3)2COOH -NH-/' N-CH2CH2NH2 /-\ © -C(CH3)2COOH -ΝΗ-γ VN-CH(CH3)2 /—^ Φ -c(ch3)2cooh -nh-/^ n-ch3 F ~c ( ch3 ) 2cooh -NH-f^ 126 80043 R12 R4 -c(ch3)2cooh -nh-<^n9ch2ch=ch2 — NH -t N-CH3 -C(CH3)2C00H y-(
10 -CH2COOH -NH-A 'n-CH-
8. Cefalosporinderivat, kännetecknat därav, att det har formeln XIX H H h2n-j 3 'Ί
20 N\|/^-CH2-R4 XIX R3 vari och R^ betecknar samma som i patentkravet 1 och 25 syraadditionssalter därav. II
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP83401135 | 1983-06-03 | ||
| EP83401135 | 1983-06-03 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI842211A0 FI842211A0 (fi) | 1984-06-01 |
| FI842211A FI842211A (fi) | 1984-12-04 |
| FI80043B true FI80043B (fi) | 1989-12-29 |
| FI80043C FI80043C (sv) | 1990-04-10 |
Family
ID=8191406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI842211A FI80043C (sv) | 1983-06-03 | 1984-06-01 | Förfarande för framställning av terapeutiskt användbara substituerade 3-aminometylcefalossporiner och nya mellanprodukter |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4678781A (sv) |
| EP (1) | EP0127992B1 (sv) |
| JP (1) | JPH0633283B2 (sv) |
| KR (1) | KR910008352B1 (sv) |
| AU (1) | AU585831B2 (sv) |
| CA (1) | CA1272188A (sv) |
| DE (1) | DE3486033T2 (sv) |
| DK (1) | DK271584A (sv) |
| ES (1) | ES533084A0 (sv) |
| FI (1) | FI80043C (sv) |
| GB (1) | GB8413152D0 (sv) |
| GR (1) | GR81617B (sv) |
| HU (1) | HU196811B (sv) |
| IL (1) | IL71969A (sv) |
| NO (1) | NO164301C (sv) |
| NZ (1) | NZ208360A (sv) |
| PH (1) | PH22334A (sv) |
| PT (1) | PT78685B (sv) |
| ZA (1) | ZA844052B (sv) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4855420A (en) * | 1983-06-03 | 1989-08-08 | Ici Pharma | Cephalosporin derivatives |
| FI851934L (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporinderivat. |
| US4868173A (en) * | 1984-11-20 | 1989-09-19 | Ici Pharma | Cephalosporin derivatives |
| EP0187456A1 (en) * | 1984-11-29 | 1986-07-16 | Ici Pharma | Cephalosporin derivatives |
| US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| GB8626245D0 (en) * | 1985-11-27 | 1986-12-03 | Ici Pharma | Cephalosporin compounds |
| US4684722A (en) * | 1986-01-06 | 1987-08-04 | E. R. Squibb & Sons, Inc. | Monosulfactams |
| GB8611823D0 (en) * | 1986-05-15 | 1986-06-25 | Ici Plc | Process |
| ZA877987B (en) * | 1986-11-12 | 1988-08-31 | Ici Pharma | Antibiotic compounds |
| DE3750673T2 (de) * | 1986-11-21 | 1995-03-16 | Ici Pharma | Cephalosporine, Verfahren zu ihrer Herstellung und pharmazeutische Präparate. |
| US5262410A (en) * | 1986-12-23 | 1993-11-16 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
| EP0272827A3 (en) * | 1986-12-23 | 1990-02-07 | ZENECA Pharma S.A. | 3-heterocyclicthiomethyl cephalosphorins |
| GB8816519D0 (en) * | 1987-07-23 | 1988-08-17 | Ici Plc | Antibiotic compounds |
| DE3854804T2 (de) * | 1987-07-23 | 1996-06-13 | Zeneca Pharma Sa | Cephalosporinverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
| US5232918A (en) * | 1987-07-23 | 1993-08-03 | Imperial Chemical Industries Plc | Cephalosporin derivatives |
| ATE130299T1 (de) * | 1987-07-23 | 1995-12-15 | Zeneca Pharma Sa | Cephalosporinverbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische präparate. |
| AT395854B (de) * | 1991-05-24 | 1993-03-25 | Biochemie Gmbh | Neues verfahren zur herstellung von 7-amino-3azidomethyl-3-cephem-4-carbonsaeure und deren derivate |
| US5817520A (en) * | 1991-12-20 | 1998-10-06 | Oxis International S.A. | Spectrophotometric methods for assaying total mercaptans, reduced glutathione (GSH) and mercaptans other than GSH in an aqueous medium reagents and kits for implementing same |
| DE19647413A1 (de) * | 1996-11-15 | 1998-05-20 | Hoechst Schering Agrevo Gmbh | Substituierte Stickstoff-Heterocyclen, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| DE10225537A1 (de) * | 2002-06-10 | 2003-12-18 | Bayer Ag | N-alkylierte Thiazoliumsalze und Verfahren zu deren Herstellung |
| CN103502218B (zh) | 2011-03-04 | 2016-08-17 | 生命科技公司 | 用于缀合生物分子的化合物和方法 |
| JP7158717B2 (ja) * | 2017-11-22 | 2022-10-24 | 国立大学法人九州工業大学 | 求電子的アジド化剤又はジアゾ化剤 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1584713A (sv) * | 1967-01-18 | 1970-01-02 | ||
| GB1478055A (en) * | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| GR63088B (en) * | 1976-04-14 | 1979-08-09 | Takeda Chemical Industries Ltd | Preparation process of novel cephalosporins |
| FR2432521A1 (fr) | 1978-03-31 | 1980-02-29 | Roussel Uclaf | Nouvelles oximes o-substituees derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| DE2818263A1 (de) * | 1978-04-26 | 1979-11-08 | Bayer Ag | Beta-lactamantibiotika |
| GB1604724A (en) * | 1978-05-26 | 1981-12-16 | Glaxo Operations Ltd | 7-(2-aminothiazol-4-yl)-2-oxymino-acedamido)-cephem derivatives |
| JPS54154786A (en) * | 1978-05-26 | 1979-12-06 | Glaxo Group Ltd | Cephalosporin compound |
| GB2036738B (en) * | 1978-11-17 | 1983-01-19 | Glaxo Group Ltd | Cephalosporin antibiotics |
| GB2046261B (en) * | 1979-03-22 | 1983-07-20 | Glaxo Group Ltd | Cephalosporin antibiotics |
| EP0018595B1 (en) * | 1979-04-27 | 1986-08-20 | Merck & Co. Inc. | 7-n-heterocyclyl cephalosporins, a process for preparing and a pharmaceutical composition comprising the same |
| JPS57167993A (en) * | 1981-04-09 | 1982-10-16 | Yamanouchi Pharmaceut Co Ltd | Novel 3-((4-carboxy-3-hydroxyisothiazole-5-yl) thiomethyl)-delta3-cephem derivative |
| GB2103205A (en) * | 1981-06-15 | 1983-02-16 | Fujisawa Pharmaceutical Co | New cephem compounds |
| AU8474382A (en) * | 1981-06-19 | 1982-12-23 | Imperial Chemical Industries Plc | Process of preparing cephalosporin antibiotics |
| JPS5876088A (ja) * | 1981-10-27 | 1983-05-09 | Nippon Paint Co Ltd | 固定化植物組織 |
| US4401668A (en) * | 1981-10-02 | 1983-08-30 | Eli Lilly And Company | Pyrazinium substituted cephalosporins |
| FR2516515A1 (fr) * | 1981-11-16 | 1983-05-20 | Sanofi Sa | Nouveaux derives de pyridinium thiomethyl cephalosporines, procede pour leur preparation et compositions pharmaceutiques les contenant |
| FR2530248A1 (fr) * | 1982-07-13 | 1984-01-20 | Sanofi Sa | Nouveaux derives des cephalosporines, leur procede de preparation et medicaments antibiotiques contenant lesdits derives |
| HU188874B (en) * | 1983-04-19 | 1986-05-28 | Biogal Gyogyszergyar,Hu | Process for producing new 7-acylamido-3-acylaminomethyl-ceph-3-eme-4-carboxylic acid derivatives and pharmaceutically acceptable salts thereof |
| US4560749A (en) * | 1983-11-18 | 1985-12-24 | Eli Lilly And Company | Cephem-3-imidates and 3-amidines |
| FI851934L (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporinderivat. |
-
1984
- 1984-05-23 GB GB848413152A patent/GB8413152D0/en active Pending
- 1984-05-25 EP EP84303585A patent/EP0127992B1/en not_active Expired - Lifetime
- 1984-05-25 DE DE8484303585T patent/DE3486033T2/de not_active Expired - Fee Related
- 1984-05-28 ZA ZA844052A patent/ZA844052B/xx unknown
- 1984-05-30 GR GR74879A patent/GR81617B/el unknown
- 1984-05-30 IL IL71969A patent/IL71969A/xx unknown
- 1984-06-01 NZ NZ208360A patent/NZ208360A/en unknown
- 1984-06-01 DK DK271584A patent/DK271584A/da not_active Application Discontinuation
- 1984-06-01 ES ES533084A patent/ES533084A0/es active Granted
- 1984-06-01 AU AU28943/84A patent/AU585831B2/en not_active Ceased
- 1984-06-01 NO NO842214A patent/NO164301C/no unknown
- 1984-06-01 PH PH30751A patent/PH22334A/en unknown
- 1984-06-01 HU HU842142A patent/HU196811B/hu not_active IP Right Cessation
- 1984-06-01 PT PT78685A patent/PT78685B/pt not_active IP Right Cessation
- 1984-06-01 FI FI842211A patent/FI80043C/sv not_active IP Right Cessation
- 1984-06-01 CA CA000455723A patent/CA1272188A/en not_active Expired - Lifetime
- 1984-06-04 KR KR1019840003102A patent/KR910008352B1/ko not_active IP Right Cessation
- 1984-06-04 JP JP59113221A patent/JPH0633283B2/ja not_active Expired - Lifetime
- 1984-06-04 US US06/616,891 patent/US4678781A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FI842211A (fi) | 1984-12-04 |
| IL71969A (en) | 1988-03-31 |
| AU2894384A (en) | 1984-12-06 |
| JPS6045584A (ja) | 1985-03-12 |
| NO164301C (no) | 1990-09-19 |
| EP0127992B1 (en) | 1993-01-13 |
| NZ208360A (en) | 1988-01-08 |
| FI80043C (sv) | 1990-04-10 |
| HU196811B (en) | 1989-01-30 |
| ZA844052B (en) | 1985-01-30 |
| PT78685A (sv) | 1984-06-01 |
| AU585831B2 (en) | 1989-06-29 |
| DE3486033T2 (de) | 1993-05-06 |
| KR850000458A (ko) | 1985-02-27 |
| HUT34499A (en) | 1985-03-28 |
| NO842214L (no) | 1984-12-04 |
| ES8601213A1 (es) | 1985-10-16 |
| DE3486033D1 (de) | 1993-02-25 |
| GB8413152D0 (en) | 1984-06-27 |
| CA1272188A (en) | 1990-07-31 |
| GR81617B (sv) | 1984-12-11 |
| DK271584D0 (da) | 1984-06-01 |
| ES533084A0 (es) | 1985-10-16 |
| DK271584A (da) | 1984-12-04 |
| EP0127992A2 (en) | 1984-12-12 |
| NO164301B (no) | 1990-06-11 |
| US4678781A (en) | 1987-07-07 |
| PT78685B (en) | 1986-10-21 |
| JPH0633283B2 (ja) | 1994-05-02 |
| PH22334A (en) | 1988-08-12 |
| EP0127992A3 (en) | 1985-11-21 |
| FI842211A0 (fi) | 1984-06-01 |
| KR910008352B1 (ko) | 1991-10-12 |
| IL71969A0 (en) | 1984-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI80043B (fi) | Kefalosporin derivat. | |
| JP4433383B2 (ja) | 広域セフェム化合物 | |
| FI115525B (sv) | Förfarande för framställning av kefalosporinderivat och mellanprodukter för användning vid förfarandet | |
| HU186019B (en) | Process for preparing new cefem-carboxylic acid derivatives | |
| EP0256542A2 (en) | Cephem compounds | |
| KR100455544B1 (ko) | 세팔로스포린항생제 | |
| FI66007B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara cefalosporinderivat | |
| CA1225390A (en) | 3-bicyclicpyridinium-methyl cephalosporins | |
| EP0153709B1 (en) | Novel cephalosporin derivatives | |
| SK284962B6 (sk) | 7-Acylamino-3-(hydrazono)metylcefalosporíny, spôsob ich prípravy, medziprodukty na ich prípravu a farmaceutický prostriedok, ktorý ich obsahuje | |
| US4786633A (en) | Cephalosporin compounds | |
| PL140023B1 (en) | Process for preparing novel derivatives of 7-/(z)-2-/2-aminothiazolyl-4/-2-oxyiminoacetamide/-3-cephemo-4-carboxylic acid | |
| EP0376724A2 (en) | Cephalosporin compounds | |
| FI74020C (sv) | Förfarande för framställning av nya terapeutiskt användbara 7-beta-/al fa-syn-metoxiimino-alfa-(2-aminotiazol-4-yl) acetamido/-3-/(1,2,3-tiad iazol-5-yltio)metyl/-3-cefem-4-karboxylsyraderivat | |
| FI85858B (fi) | Foerfarande foer framstaellning av farmaceutiska 3-kondenserade imidazoliumcefemfoereningar. | |
| CA2058822C (en) | Antibacterial agents | |
| US4855420A (en) | Cephalosporin derivatives | |
| HU184805B (en) | Process for preparing new substituted alkyl-oximes derived from 7-/2-amino-4-thazolyl/-acetamido-cephalosporanic acid | |
| HU195663B (en) | Process for producing beta-lactame compounds and pharmaceutical compositions containing them | |
| US3814755A (en) | 7-(omikron-aminomethylphenylacetamido)-3-(tetrazolo(4,5-b)pyridazin-6-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| US4921953A (en) | Cephalosporin derivatives | |
| KAWABATA et al. | STUDIES ON β-LACTAM ANTIBIOTICS XIII. SYNTHESIS AND STRUCTURE-ACTIVITY RELATIONSHIPS OF 7β-[(Z)-2-ARYL-2-CARBOXYMETHOXYIMINOACETAMIDO]-3-VINYLCEPHALOSPORINS | |
| EP0249170A2 (en) | Cephem compounds, their production and use | |
| JPS6067483A (ja) | チアゾリオメチル置換基を有するセフアロスポリン誘導体 | |
| US4784995A (en) | Cephalosporin compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: ICI PHARMA |