FI74277C - Foerfarande foer framstaellning av bensimidazolderivat. - Google Patents
Foerfarande foer framstaellning av bensimidazolderivat. Download PDFInfo
- Publication number
- FI74277C FI74277C FI803278A FI803278A FI74277C FI 74277 C FI74277 C FI 74277C FI 803278 A FI803278 A FI 803278A FI 803278 A FI803278 A FI 803278A FI 74277 C FI74277 C FI 74277C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- och
- alkali metal
- alkyl
- benzimidazole
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 10
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 title claims description 4
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 150000001340 alkali metals Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000002168 alkylating agent Substances 0.000 claims description 6
- 229940100198 alkylating agent Drugs 0.000 claims description 6
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- 230000029936 alkylation Effects 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 229910052977 alkali metal sulfide Inorganic materials 0.000 claims description 3
- 150000001556 benzimidazoles Chemical class 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- -1 alkyl mercaptans Chemical class 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 125000004414 alkyl thio group Chemical group 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- QUWHIBBGKKRYFW-UHFFFAOYSA-N (4-amino-3-nitrophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1[N+]([O-])=O QUWHIBBGKKRYFW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 230000000507 anthelmentic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229940048181 sodium sulfide nonahydrate Drugs 0.000 description 2
- WMDLZMCDBSJMTM-UHFFFAOYSA-M sodium;sulfanide;nonahydrate Chemical compound O.O.O.O.O.O.O.O.O.[Na+].[SH-] WMDLZMCDBSJMTM-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JVSORZTZKODIJB-UHFFFAOYSA-N (3,4-diaminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1N JVSORZTZKODIJB-UHFFFAOYSA-N 0.000 description 1
- RLPLNYIDEVVEBK-UHFFFAOYSA-N (4-acetamido-3-nitrophenyl) thiocyanate Chemical compound CC(=O)NC1=CC=C(SC#N)C=C1[N+]([O-])=O RLPLNYIDEVVEBK-UHFFFAOYSA-N 0.000 description 1
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- RYFTUCOEDBJVGR-UHFFFAOYSA-N NC(OC1=NC(C=CC=C2SC#N)=C2N1)=O Chemical class NC(OC1=NC(C=CC=C2SC#N)=C2N1)=O RYFTUCOEDBJVGR-UHFFFAOYSA-N 0.000 description 1
- 238000001069 Raman spectroscopy Methods 0.000 description 1
- VPCGHWDXDKWQNV-UHFFFAOYSA-N S-(2-aminosulfanylphenyl)thiohydroxylamine Chemical class NSC1=C(C=CC=C1)SN VPCGHWDXDKWQNV-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- GGISZLOBBISXOZ-UHFFFAOYSA-N acetic acid;chloroform Chemical compound CC(O)=O.ClC(Cl)Cl GGISZLOBBISXOZ-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000002925 chemical effect Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YWANGSCDWBUSBK-UHFFFAOYSA-N n-(5-chloro-2-nitrophenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=CC=C1[N+]([O-])=O YWANGSCDWBUSBK-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- INAAIJLSXJJHOZ-UHFFFAOYSA-N pibenzimol Chemical compound C1CN(C)CCN1C1=CC=C(N=C(N2)C=3C=C4NC(=NC4=CC=3)C=3C=CC(O)=CC=3)C2=C1 INAAIJLSXJJHOZ-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ZGHLCBJZQLNUAZ-UHFFFAOYSA-N sodium sulfide nonahydrate Chemical compound O.O.O.O.O.O.O.O.O.[Na+].[Na+].[S-2] ZGHLCBJZQLNUAZ-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 125000000858 thiocyanato group Chemical group *SC#N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI852139A FI77236C (fi) | 1979-10-19 | 1985-05-29 | Foerfarande foer framstaellning av bensimidazolderivat. |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001975 HU182763B (hu) | 1979-10-19 | 1979-10-19 | Eljárás 5(6)-alkiltio-benzimidazolil-alkil-karbamátok előállítására |
| HU80635A HU182794B (en) | 1980-03-19 | 1980-03-19 | Process for producing 5-bracket-6-bracket closed-thiocyanato-benzimidazolyl-alkyl-carbamates and salts |
| HU63580 | 1980-03-19 | ||
| HU197580 | 1980-04-22 | ||
| HU197580 | 1980-04-22 | ||
| HUCI001975 | 1980-07-11 | ||
| HU801387A HU184780B (en) | 1980-09-17 | 1980-09-17 | Process for producing thiocyanato-benzimidazoles |
| HU138780 | 1980-09-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI803278L FI803278L (fi) | 1981-04-20 |
| FI74277B FI74277B (fi) | 1987-09-30 |
| FI74277C true FI74277C (fi) | 1988-01-11 |
Family
ID=27451960
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI803278A FI74277C (fi) | 1979-10-19 | 1980-10-17 | Foerfarande foer framstaellning av bensimidazolderivat. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4473697A (oth) |
| EP (1) | EP0027646B1 (oth) |
| DE (1) | DE3066857D1 (oth) |
| DK (1) | DK160552C (oth) |
| FI (1) | FI74277C (oth) |
| GR (1) | GR70766B (oth) |
| IL (1) | IL61232A (oth) |
| NO (3) | NO154634C (oth) |
| YU (1) | YU42360B (oth) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4315609A1 (de) * | 1993-05-11 | 1994-11-17 | Basf Ag | Verfahren und Vorrichtung zur Herstellung von Fasern nach einem Zentrifugalspinnverfahren |
| CN104961655B (zh) * | 2015-06-11 | 2017-01-18 | 安徽东至广信农化有限公司 | 一种石灰氮一次性水解的工艺 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2041324A1 (de) * | 1970-08-20 | 1972-02-24 | Agfa Gevaert Ag | Neue Benzimidazolderivate,sowie ein Verfahren zu ihrer Herstellung |
| IL43396A (en) * | 1972-10-14 | 1976-07-30 | Hoechst Ag | Process for the preparation of 2-benzimidazole-carbamic acid alkyl and benzyl esters |
| US3965113A (en) * | 1972-12-29 | 1976-06-22 | Syntex (U.S.A.) Inc. | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US3929821A (en) * | 1972-12-29 | 1975-12-30 | Syntex Inc | 5 (6)-Benzene ring substituted benzimidazole-2-carbamate derivatives |
| US3929823A (en) * | 1973-11-21 | 1975-12-30 | Syntex Inc | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US4152522A (en) * | 1978-01-03 | 1979-05-01 | Ethyl Corporation | Process for the preparation of 2-benzimidazole carbamates |
-
1980
- 1980-10-08 IL IL8061232A patent/IL61232A/xx not_active IP Right Cessation
- 1980-10-11 GR GR63144A patent/GR70766B/el unknown
- 1980-10-17 DE DE8080106321T patent/DE3066857D1/de not_active Expired
- 1980-10-17 EP EP80106321A patent/EP0027646B1/de not_active Expired
- 1980-10-17 FI FI803278A patent/FI74277C/fi not_active IP Right Cessation
- 1980-10-17 DK DK440880A patent/DK160552C/da not_active IP Right Cessation
- 1980-10-17 NO NO80803111A patent/NO154634C/no unknown
- 1980-10-17 YU YU2663/80A patent/YU42360B/xx unknown
-
1983
- 1983-01-17 US US06/458,266 patent/US4473697A/en not_active Expired - Fee Related
-
1984
- 1984-11-12 NO NO84844514A patent/NO154053C/no unknown
- 1984-11-12 NO NO84844515A patent/NO154881C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL61232A (en) | 1985-09-29 |
| NO803111L (no) | 1981-04-21 |
| DK160552C (da) | 1991-09-09 |
| YU42360B (en) | 1988-08-31 |
| DK440880A (da) | 1981-04-20 |
| US4473697A (en) | 1984-09-25 |
| EP0027646A1 (de) | 1981-04-29 |
| FI74277B (fi) | 1987-09-30 |
| YU266380A (en) | 1983-09-30 |
| NO154053C (no) | 1986-07-09 |
| DK160552B (da) | 1991-03-25 |
| GR70766B (oth) | 1983-03-16 |
| NO154634B (no) | 1986-08-11 |
| DE3066857D1 (en) | 1984-04-12 |
| IL61232A0 (en) | 1980-12-31 |
| FI803278L (fi) | 1981-04-20 |
| NO844514L (no) | 1981-04-21 |
| NO154053B (no) | 1986-04-01 |
| NO154881B (no) | 1986-09-29 |
| NO844515L (no) | 1981-04-21 |
| NO154881C (no) | 1987-01-07 |
| NO154634C (no) | 1986-11-19 |
| EP0027646B1 (de) | 1984-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0302720B1 (en) | Production of 2-(2-pyridylmethylsulfinyl)-benzimidazole compounds | |
| FI71557B (fi) | Foerfarande foer framstaellning av 5(6)-tiobensimidazolderivat | |
| FI74277C (fi) | Foerfarande foer framstaellning av bensimidazolderivat. | |
| Fardpour et al. | Utilizing amines and carbon disulfide to obtain nitrogen-and sulfur-containing compounds under green conditions: A review | |
| EP0091794A1 (en) | Process for preparing 1.6-disubstituted 2-aminobenzimidazoles | |
| US7560547B2 (en) | Hydroxyalkyl cyclic diamine compounds | |
| Daniher | Sulfation of hydroxamic acids | |
| FI86057C (fi) | 2-bensyltio- eller 2-bensylsulfoxid-1- cyklopenten-1-karboxamider, foerfaranden foer deras framstaellning och deras anvaendning vid syntes av 4,5-trimetylen-4-isotiazolin-3-oner. | |
| US6040455A (en) | One-pot process for the preparation of 5-sulfonyl-substituted benzotriazoles UV absorbers | |
| Gonda et al. | Some nucleophilic reactions of 2-isothiocyanatobenzyl bromide. A new simple synthesis of 2-substituted 4H-benzo [d][1, 3] thiazines | |
| US4599428A (en) | Process for the preparation of 5(6)-thio substituted benzimidazoles | |
| JP3963523B2 (ja) | ジアゾ化合物の製造方法 | |
| EP0224592B1 (en) | P-hydroxybenzoic acid derivatives | |
| PL129787B1 (en) | Process for preparing derivatives of benzimidazole | |
| HU182763B (hu) | Eljárás 5(6)-alkiltio-benzimidazolil-alkil-karbamátok előállítására | |
| KR950002841B1 (ko) | 페닐-구아니딘 유도체의 신규 제조방법 | |
| FI66855B (fi) | Foerfarande foer framstaellning av 5-merkaptotetrazolyl-1-aettiksyra och alkalisalter daerav | |
| FI77236C (fi) | Foerfarande foer framstaellning av bensimidazolderivat. | |
| JPS6327346B2 (oth) | ||
| SU677357A1 (ru) | Производные 5,6-дигидродипиримидо(4,5-в)(5,4-F)-(1,4)тиазепина и способ их получени | |
| HU182794B (en) | Process for producing 5-bracket-6-bracket closed-thiocyanato-benzimidazolyl-alkyl-carbamates and salts | |
| DK151812B (da) | Fremgangsmaade til fremstilling af auranofin | |
| McCombie et al. | CCXII.—The condensation of α-keto-β-anilino-αβ-diphenylethane and its homologues with ethyl chlorocarbonate and thionyl chloride | |
| NL8200339A (nl) | Werkwijze ter bereiding of vervaardiging van anthelmintisch werkzame farmaceutische preparaten en fungicide preparaten en werkwijze ter bereiding van anthelmintisch en als fungicide werkzame 2-alkoxycarbonylamino-benzimidazoolderivaten. | |
| PL119175B1 (en) | Process for preparing n-chloroimides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: CHINOIN GYOGUSZER ES VEGYESZETI TERMEKEK |