FI71306C - Foerfarande foer framstaellning av terapeutiskt anvaendbara inanderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara inanderivat Download PDFInfo
- Publication number
- FI71306C FI71306C FI792347A FI792347A FI71306C FI 71306 C FI71306 C FI 71306C FI 792347 A FI792347 A FI 792347A FI 792347 A FI792347 A FI 792347A FI 71306 C FI71306 C FI 71306C
- Authority
- FI
- Finland
- Prior art keywords
- group
- general formula
- nitroindan
- preparation
- atom
- Prior art date
Links
- 230000001225 therapeutic effect Effects 0.000 title description 3
- -1 phenyl ester Chemical class 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical class C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 150000003458 sulfonic acid derivatives Chemical class 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 238000009472 formulation Methods 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- 229940124597 therapeutic agent Drugs 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 26
- OJNRHKOJADOVAE-UHFFFAOYSA-N 5-bromo-6-nitro-2,3-dihydro-1h-indene Chemical compound C1=C(Br)C([N+](=O)[O-])=CC2=C1CCC2 OJNRHKOJADOVAE-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- 229910052799 carbon Inorganic materials 0.000 description 14
- 239000012141 concentrate Substances 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 238000009835 boiling Methods 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000002468 indanes Chemical class 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- PYPIEUKDKXCSSI-UHFFFAOYSA-N 6-phenoxy-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1 PYPIEUKDKXCSSI-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OQRGTWJAXDMYQY-UHFFFAOYSA-N 5-nitro-6-phenoxy-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CC=C1 OQRGTWJAXDMYQY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 208000025865 Ulcer Diseases 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229950005499 carbon tetrachloride Drugs 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- BVWQEBWCUCGHHZ-UHFFFAOYSA-N n-(1-oxo-6-phenoxy-2,3-dihydroinden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1 BVWQEBWCUCGHHZ-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- KCPQQVCJZPFLDU-UHFFFAOYSA-N 5-(2-fluorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CC=C1F KCPQQVCJZPFLDU-UHFFFAOYSA-N 0.000 description 2
- IRYAOHYKEVMSBJ-UHFFFAOYSA-N 5-(3-chlorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CC(Cl)=C1 IRYAOHYKEVMSBJ-UHFFFAOYSA-N 0.000 description 2
- GOYSYSPDXHHGKV-UHFFFAOYSA-N 5-(4-chlorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C=C1 GOYSYSPDXHHGKV-UHFFFAOYSA-N 0.000 description 2
- BKDBQNGKAXPOQZ-UHFFFAOYSA-N 5-(4-fluorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(F)C=C1 BKDBQNGKAXPOQZ-UHFFFAOYSA-N 0.000 description 2
- YYGNFQHQWUTJNJ-UHFFFAOYSA-N 5-fluoro-6-nitro-2,3-dihydroinden-1-one Chemical compound C1=C(F)C([N+](=O)[O-])=CC2=C1CCC2=O YYGNFQHQWUTJNJ-UHFFFAOYSA-N 0.000 description 2
- BBXDIZJIVWZLNU-UHFFFAOYSA-N 6-(4-fluorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(F)C=C1 BBXDIZJIVWZLNU-UHFFFAOYSA-N 0.000 description 2
- BDQHCRZTZUVRMT-UHFFFAOYSA-N 6-phenylsulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1SC1=CC=CC=C1 BDQHCRZTZUVRMT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 241000186359 Mycobacterium Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 229910052794 bromium Chemical group 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- QFYRJDXCFZQEDI-UHFFFAOYSA-N n-(1-hydroxy-6-phenoxy-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCC(O)C=2C=C1OC1=CC=CC=C1 QFYRJDXCFZQEDI-UHFFFAOYSA-N 0.000 description 2
- SEOYFJMPFVYJAQ-UHFFFAOYSA-N n-(3-oxo-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2C(=O)CCC=2C=C1OC1=CC=CC=C1 SEOYFJMPFVYJAQ-UHFFFAOYSA-N 0.000 description 2
- HCBMEMPZHUPGHY-UHFFFAOYSA-N n-(6-phenoxy-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1 HCBMEMPZHUPGHY-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- PWNBOTMWJZFKHV-UHFFFAOYSA-N 1,1,1-trifluoro-n-(6-phenoxy-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1 PWNBOTMWJZFKHV-UHFFFAOYSA-N 0.000 description 1
- FQQLETXDJGPJPY-UHFFFAOYSA-N 1,1,1-trifluoro-n-(6-phenylsulfanyl-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)NC1=CC=2CCCC=2C=C1SC1=CC=CC=C1 FQQLETXDJGPJPY-UHFFFAOYSA-N 0.000 description 1
- RGYUHLKLOMGFMI-UHFFFAOYSA-N 1-[6-(2-fluorophenoxy)-5-nitro-2,3-dihydroinden-1-ylidene]-n,n-dimethylmethanamine Chemical compound C1=C2C(=CN(C)C)CCC2=CC([N+]([O-])=O)=C1OC1=CC=CC=C1F RGYUHLKLOMGFMI-UHFFFAOYSA-N 0.000 description 1
- IPZJWHYGTIFTMJ-UHFFFAOYSA-N 1-[6-(3-chlorophenoxy)-5-nitro-2,3-dihydroinden-1-ylidene]-n,n-dimethylmethanamine Chemical compound C1=C2C(=CN(C)C)CCC2=CC([N+]([O-])=O)=C1OC1=CC=CC(Cl)=C1 IPZJWHYGTIFTMJ-UHFFFAOYSA-N 0.000 description 1
- NUBGBWDMGVJMGR-UHFFFAOYSA-N 1-[6-(4-chlorophenoxy)-5-nitro-2,3-dihydroinden-1-ylidene]-n,n-dimethylmethanamine Chemical compound C1=C2C(=CN(C)C)CCC2=CC([N+]([O-])=O)=C1OC1=CC=C(Cl)C=C1 NUBGBWDMGVJMGR-UHFFFAOYSA-N 0.000 description 1
- PUTGFEDVECEHKO-UHFFFAOYSA-N 1-[6-(4-fluorophenoxy)-5-nitro-2,3-dihydroinden-1-ylidene]-n,n-dimethylmethanamine Chemical compound C1=C2C(=CN(C)C)CCC2=CC([N+]([O-])=O)=C1OC1=CC=C(F)C=C1 PUTGFEDVECEHKO-UHFFFAOYSA-N 0.000 description 1
- JYPCAWKGKGAHDQ-UHFFFAOYSA-N 1-chloro-n-(6-phenoxy-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound ClCS(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1 JYPCAWKGKGAHDQ-UHFFFAOYSA-N 0.000 description 1
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 description 1
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- VBKJQYQIMAIQEH-UHFFFAOYSA-N 2-[(6-nitro-2,3-dihydro-1h-inden-5-yl)sulfanyl]pyridine Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1SC1=CC=CC=N1 VBKJQYQIMAIQEH-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- IGYXYGDEYHNFFT-UHFFFAOYSA-N 2-chloro-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Cl IGYXYGDEYHNFFT-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- AIEAPUYXEQNISH-UHFFFAOYSA-N 3-[(6-nitro-2,3-dihydro-1h-inden-5-yl)oxy]pyridine Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CN=C1 AIEAPUYXEQNISH-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- PWRBCZZQRRPXAB-UHFFFAOYSA-N 3-chloropyridine Chemical compound ClC1=CC=CN=C1 PWRBCZZQRRPXAB-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- OKIHXNKYYGUVTE-UHFFFAOYSA-N 4-Fluorothiophenol Chemical compound FC1=CC=C(S)C=C1 OKIHXNKYYGUVTE-UHFFFAOYSA-N 0.000 description 1
- AXASPCIBDBIQAT-UHFFFAOYSA-N 4-[(6-nitro-2,3-dihydro-1h-inden-5-yl)sulfanyl]pyridine Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1SC1=CC=NC=C1 AXASPCIBDBIQAT-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- RHPUJHQBPORFGV-UHFFFAOYSA-N 4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=CC=C1O RHPUJHQBPORFGV-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- GNXBFFHXJDZGEK-UHFFFAOYSA-N 4-tert-butylbenzenethiol Chemical compound CC(C)(C)C1=CC=C(S)C=C1 GNXBFFHXJDZGEK-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- MBIAXYRGQVGWAD-UHFFFAOYSA-N 5-(2,4-dichlorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C=C1Cl MBIAXYRGQVGWAD-UHFFFAOYSA-N 0.000 description 1
- YJWHXXHNSWWBQZ-UHFFFAOYSA-N 5-(2-chloro-4-fluorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(F)C=C1Cl YJWHXXHNSWWBQZ-UHFFFAOYSA-N 0.000 description 1
- YTPGTTFQYDIXQF-UHFFFAOYSA-N 5-(2-chlorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CC=C1Cl YTPGTTFQYDIXQF-UHFFFAOYSA-N 0.000 description 1
- FFJQLJLMERMQCX-UHFFFAOYSA-N 5-(2-methylphenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound CC1=CC=CC=C1OC(C(=C1)[N+]([O-])=O)=CC2=C1CCC2 FFJQLJLMERMQCX-UHFFFAOYSA-N 0.000 description 1
- RYUOQJUBCVVIAC-UHFFFAOYSA-N 5-(3,4-dichlorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C(Cl)=C1 RYUOQJUBCVVIAC-UHFFFAOYSA-N 0.000 description 1
- BABAIYSGPOLZGG-UHFFFAOYSA-N 5-(3-fluorophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=CC(F)=C1 BABAIYSGPOLZGG-UHFFFAOYSA-N 0.000 description 1
- REBMGSHQLQBKCC-UHFFFAOYSA-N 5-(4-bromophenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1OC1=CC=C(Br)C=C1 REBMGSHQLQBKCC-UHFFFAOYSA-N 0.000 description 1
- CWXSGGRHTQKKGL-UHFFFAOYSA-N 5-(4-chloro-2-methylphenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound CC1=CC(Cl)=CC=C1OC(C(=C1)[N+]([O-])=O)=CC2=C1CCC2 CWXSGGRHTQKKGL-UHFFFAOYSA-N 0.000 description 1
- MFZWZRALRGKNGK-UHFFFAOYSA-N 5-(4-chlorophenyl)sulfanyl-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1SC1=CC=C(Cl)C=C1 MFZWZRALRGKNGK-UHFFFAOYSA-N 0.000 description 1
- BSYFIHCQPWHNJQ-UHFFFAOYSA-N 5-(4-fluorophenyl)sulfanyl-6-nitro-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1SC1=CC=C(F)C=C1 BSYFIHCQPWHNJQ-UHFFFAOYSA-N 0.000 description 1
- BFTROKIGVIXAKD-UHFFFAOYSA-N 5-(4-methylphenoxy)-6-nitro-2,3-dihydro-1h-indene Chemical compound C1=CC(C)=CC=C1OC(C(=C1)[N+]([O-])=O)=CC2=C1CCC2 BFTROKIGVIXAKD-UHFFFAOYSA-N 0.000 description 1
- VXPUTENETGMKKM-UHFFFAOYSA-N 5-(4-tert-butylphenyl)sulfanyl-6-nitro-2,3-dihydro-1h-indene Chemical compound C1=CC(C(C)(C)C)=CC=C1SC(C(=C1)[N+]([O-])=O)=CC2=C1CCC2 VXPUTENETGMKKM-UHFFFAOYSA-N 0.000 description 1
- RKXYIUBGXCPBFS-UHFFFAOYSA-N 5-amino-6-(2-fluorophenoxy)-2,3-dihydroinden-1-one Chemical compound NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1F RKXYIUBGXCPBFS-UHFFFAOYSA-N 0.000 description 1
- MDINQKAHZLWFQQ-UHFFFAOYSA-N 5-amino-6-(3-chlorophenoxy)-2,3-dihydroinden-1-one Chemical compound NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC(Cl)=C1 MDINQKAHZLWFQQ-UHFFFAOYSA-N 0.000 description 1
- RLSPDSVLSNTWIR-UHFFFAOYSA-N 5-amino-6-(4-chlorophenoxy)-2,3-dihydroinden-1-one Chemical compound NC1=CC=2CCC(=O)C=2C=C1OC1=CC=C(Cl)C=C1 RLSPDSVLSNTWIR-UHFFFAOYSA-N 0.000 description 1
- UPYPTDDLVMLJSH-UHFFFAOYSA-N 5-amino-6-(4-fluorophenoxy)-2,3-dihydroinden-1-one Chemical compound NC1=CC=2CCC(=O)C=2C=C1OC1=CC=C(F)C=C1 UPYPTDDLVMLJSH-UHFFFAOYSA-N 0.000 description 1
- VJDKXBSDZLSGIW-UHFFFAOYSA-N 5-amino-6-phenoxy-2,3-dihydroinden-1-one Chemical compound NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1 VJDKXBSDZLSGIW-UHFFFAOYSA-N 0.000 description 1
- WVPPBVAMKNQXJA-UHFFFAOYSA-N 5-fluoro-2,3-dihydroinden-1-one Chemical compound FC1=CC=C2C(=O)CCC2=C1 WVPPBVAMKNQXJA-UHFFFAOYSA-N 0.000 description 1
- SOVVXYZVIMCNNZ-UHFFFAOYSA-N 5-nitro-5-[3-(trifluoromethyl)phenoxy]-1,2,3,4-tetrahydroindene Chemical compound [N+](=O)([O-])C1(CC=2CCCC=2C=C1)OC1=CC(=CC=C1)C(F)(F)F SOVVXYZVIMCNNZ-UHFFFAOYSA-N 0.000 description 1
- VUKVRULQEFBCAS-UHFFFAOYSA-N 5-nitro-6-phenoxy-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1 VUKVRULQEFBCAS-UHFFFAOYSA-N 0.000 description 1
- ZIVJSZCSWIXYPE-UHFFFAOYSA-N 5-nitro-6-phenylsulfanyl-2,3-dihydro-1h-indene Chemical compound [O-][N+](=O)C1=CC=2CCCC=2C=C1SC1=CC=CC=C1 ZIVJSZCSWIXYPE-UHFFFAOYSA-N 0.000 description 1
- FPRHZTXVICZAOZ-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C=C1Cl FPRHZTXVICZAOZ-UHFFFAOYSA-N 0.000 description 1
- SXEYDYIZOVYUBO-UHFFFAOYSA-N 6-(2-chloro-4-fluorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(F)C=C1Cl SXEYDYIZOVYUBO-UHFFFAOYSA-N 0.000 description 1
- MDRFPJNYTOPMII-UHFFFAOYSA-N 6-(2-chlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1Cl MDRFPJNYTOPMII-UHFFFAOYSA-N 0.000 description 1
- MFEUTJRHVJQACF-UHFFFAOYSA-N 6-(2-fluorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1F MFEUTJRHVJQACF-UHFFFAOYSA-N 0.000 description 1
- WJPCYMXYTOZGNP-UHFFFAOYSA-N 6-(2-fluorophenoxy)-5-nitro-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1F WJPCYMXYTOZGNP-UHFFFAOYSA-N 0.000 description 1
- YTMYLEMCMZYEFY-UHFFFAOYSA-N 6-(2-methylphenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound CC1=CC=CC=C1OC(C(=C1)N)=CC2=C1CCC2 YTMYLEMCMZYEFY-UHFFFAOYSA-N 0.000 description 1
- FVJXSRUKLSPIJY-UHFFFAOYSA-N 6-(3,4-dichlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C(Cl)=C1 FVJXSRUKLSPIJY-UHFFFAOYSA-N 0.000 description 1
- NZCAZIPNYGLFKE-UHFFFAOYSA-N 6-(3-chlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC(Cl)=C1 NZCAZIPNYGLFKE-UHFFFAOYSA-N 0.000 description 1
- DFOAANPPMMDVJG-UHFFFAOYSA-N 6-(3-chlorophenoxy)-5-nitro-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2CCC(=O)C=2C=C1OC1=CC=CC(Cl)=C1 DFOAANPPMMDVJG-UHFFFAOYSA-N 0.000 description 1
- MDKJCGGIDIBDDM-UHFFFAOYSA-N 6-(3-fluorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC(F)=C1 MDKJCGGIDIBDDM-UHFFFAOYSA-N 0.000 description 1
- AHYIKQOYHORPFI-UHFFFAOYSA-N 6-(4-bromophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(Br)C=C1 AHYIKQOYHORPFI-UHFFFAOYSA-N 0.000 description 1
- XJGANOVPNSQALR-UHFFFAOYSA-N 6-(4-chloro-2-methylphenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound CC1=CC(Cl)=CC=C1OC(C(=C1)N)=CC2=C1CCC2 XJGANOVPNSQALR-UHFFFAOYSA-N 0.000 description 1
- KHTMVGSUIYYFFL-UHFFFAOYSA-N 6-(4-chlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=C(Cl)C=C1 KHTMVGSUIYYFFL-UHFFFAOYSA-N 0.000 description 1
- RWTWOIULHCTKIL-UHFFFAOYSA-N 6-(4-chlorophenoxy)-5-nitro-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2CCC(=O)C=2C=C1OC1=CC=C(Cl)C=C1 RWTWOIULHCTKIL-UHFFFAOYSA-N 0.000 description 1
- UFQORERRCPFPEW-UHFFFAOYSA-N 6-(4-chlorophenyl)sulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1SC1=CC=C(Cl)C=C1 UFQORERRCPFPEW-UHFFFAOYSA-N 0.000 description 1
- NVEYSVMRFJENIZ-UHFFFAOYSA-N 6-(4-fluorophenoxy)-5-nitro-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2CCC(=O)C=2C=C1OC1=CC=C(F)C=C1 NVEYSVMRFJENIZ-UHFFFAOYSA-N 0.000 description 1
- YJWZPNIYXXYKMX-UHFFFAOYSA-N 6-(4-fluorophenyl)sulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1SC1=CC=C(F)C=C1 YJWZPNIYXXYKMX-UHFFFAOYSA-N 0.000 description 1
- MPWAPKWLJHXGCV-UHFFFAOYSA-N 6-(4-methylphenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound C1=CC(C)=CC=C1OC(C(=C1)N)=CC2=C1CCC2 MPWAPKWLJHXGCV-UHFFFAOYSA-N 0.000 description 1
- YHHJFNOWTYCPOD-UHFFFAOYSA-N 6-(4-tert-butylphenyl)sulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound C1=CC(C(C)(C)C)=CC=C1SC(C(=C1)N)=CC2=C1CCC2 YHHJFNOWTYCPOD-UHFFFAOYSA-N 0.000 description 1
- LJMHNYHKDQZZQA-UHFFFAOYSA-N 6-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CC(C(F)(F)F)=C1 LJMHNYHKDQZZQA-UHFFFAOYSA-N 0.000 description 1
- WKGWQQHJJODARU-UHFFFAOYSA-N 6-amino-5-phenoxy-2,3-dihydroinden-1-one Chemical compound NC1=CC=2C(=O)CCC=2C=C1OC1=CC=CC=C1 WKGWQQHJJODARU-UHFFFAOYSA-N 0.000 description 1
- WTPWZZFPDWSMCS-UHFFFAOYSA-N 6-amino-5-phenylsulfanyl-2,3-dihydroinden-1-one Chemical compound NC1=CC=2C(=O)CCC=2C=C1SC1=CC=CC=C1 WTPWZZFPDWSMCS-UHFFFAOYSA-N 0.000 description 1
- BIGZKMDAXCOQCN-UHFFFAOYSA-N 6-methylsulfonyl-5-phenoxy-2,3-dihydro-1H-inden-1-ol Chemical compound CS(=O)(=O)C1=C(C=C2CCC(C2=C1)O)OC1=CC=CC=C1 BIGZKMDAXCOQCN-UHFFFAOYSA-N 0.000 description 1
- AZAWEMHHJLYLBA-UHFFFAOYSA-N 6-nitro-5-phenoxy-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2C(=O)CCC=2C=C1OC1=CC=CC=C1 AZAWEMHHJLYLBA-UHFFFAOYSA-N 0.000 description 1
- MAHJPOIMKGNNGM-UHFFFAOYSA-N 6-nitro-5-phenylsulfanyl-2,3-dihydroinden-1-one Chemical compound [O-][N+](=O)C1=CC=2C(=O)CCC=2C=C1SC1=CC=CC=C1 MAHJPOIMKGNNGM-UHFFFAOYSA-N 0.000 description 1
- CCJVWJUKHZWNPI-UHFFFAOYSA-N 6-pyridin-2-ylsulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1SC1=CC=CC=N1 CCJVWJUKHZWNPI-UHFFFAOYSA-N 0.000 description 1
- KOFVJMMWHSWUFZ-UHFFFAOYSA-N 6-pyridin-3-yloxy-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1OC1=CC=CN=C1 KOFVJMMWHSWUFZ-UHFFFAOYSA-N 0.000 description 1
- RCIAMVMHIIUDRU-UHFFFAOYSA-N 6-pyridin-4-ylsulfanyl-2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=2CCCC=2C=C1SC1=CC=NC=C1 RCIAMVMHIIUDRU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 101100124609 Caenorhabditis elegans zyg-12 gene Proteins 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XYKWKGATPAETAD-UHFFFAOYSA-N ClC1=CC(=C(OC2(CC=3CCCC3C=C2)NS(=O)(=O)C)C=C1)C Chemical compound ClC1=CC(=C(OC2(CC=3CCCC3C=C2)NS(=O)(=O)C)C=C1)C XYKWKGATPAETAD-UHFFFAOYSA-N 0.000 description 1
- CIZBOIUTTFWBMP-UHFFFAOYSA-N FC1=CC=C(C=C1)C1=C(C=C2CCC(C2=C1)=O)NS(=O)(=O)C Chemical compound FC1=CC=C(C=C1)C1=C(C=C2CCC(C2=C1)=O)NS(=O)(=O)C CIZBOIUTTFWBMP-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- OEZYQMGCNNLUDM-UHFFFAOYSA-N N-[3-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-1H-inden-5-yl]methanesulfonamide Chemical compound FC(C=1C=C(OC2CCC3=CC=C(C=C23)NS(=O)(=O)C)C=CC1)(F)F OEZYQMGCNNLUDM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 206010036030 Polyarthritis Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 208000026816 acute arthritis Diseases 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000006053 animal diet Substances 0.000 description 1
- 230000000702 anti-platelet effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000000026 anti-ulcerogenic effect Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- AJYXQZZAMKCOJH-UHFFFAOYSA-N chloromethylsulfonyl chloromethanesulfonate Chemical compound ClCS(=O)(=O)OS(=O)(=O)CCl AJYXQZZAMKCOJH-UHFFFAOYSA-N 0.000 description 1
- IAQWMWUKBQPOIY-UHFFFAOYSA-N chromium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Cr+4] IAQWMWUKBQPOIY-UHFFFAOYSA-N 0.000 description 1
- AYTAKQFHWFYBMA-UHFFFAOYSA-N chromium(IV) oxide Inorganic materials O=[Cr]=O AYTAKQFHWFYBMA-UHFFFAOYSA-N 0.000 description 1
- LXMQZGGLHVSEBA-UHFFFAOYSA-N chromium;trihydrate Chemical compound O.O.O.[Cr] LXMQZGGLHVSEBA-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- QDYBCIWLGJMJGO-UHFFFAOYSA-N dinitromethanone Chemical class [O-][N+](=O)C(=O)[N+]([O-])=O QDYBCIWLGJMJGO-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 230000009841 epithelial lesion Effects 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- CCJXQRNXZKSOGJ-UHFFFAOYSA-N ethylsulfonyl ethanesulfonate Chemical compound CCS(=O)(=O)OS(=O)(=O)CC CCJXQRNXZKSOGJ-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 210000002683 foot Anatomy 0.000 description 1
- 201000005917 gastric ulcer Diseases 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 1
- HMCHPJARCSHOPH-UHFFFAOYSA-N n,n-dimethyl-1-(5-nitro-6-phenoxy-2,3-dihydroinden-1-ylidene)methanamine Chemical compound C1=C2C(=CN(C)C)CCC2=CC([N+]([O-])=O)=C1OC1=CC=CC=C1 HMCHPJARCSHOPH-UHFFFAOYSA-N 0.000 description 1
- WDYGVVWWRZFQEO-UHFFFAOYSA-N n-(1-oxo-6-phenoxy-2-phenylsulfanyl-2,3-dihydroinden-5-yl)methanesulfonamide Chemical compound O=C1C=2C=C(OC=3C=CC=CC=3)C(NS(=O)(=O)C)=CC=2CC1SC1=CC=CC=C1 WDYGVVWWRZFQEO-UHFFFAOYSA-N 0.000 description 1
- PVASFPOPJZUISB-UHFFFAOYSA-N n-(3-hydroxy-6-phenoxy-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2C(O)CCC=2C=C1OC1=CC=CC=C1 PVASFPOPJZUISB-UHFFFAOYSA-N 0.000 description 1
- ZPTHYFLPJBOJCH-UHFFFAOYSA-N n-(3-oxo-6-phenylsulfanyl-1,2-dihydroinden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2C(=O)CCC=2C=C1SC1=CC=CC=C1 ZPTHYFLPJBOJCH-UHFFFAOYSA-N 0.000 description 1
- YTNLNHLOXYAXOG-UHFFFAOYSA-N n-(4-chlorophenoxy)-2,3-dihydro-1h-inden-5-amine Chemical compound C1=CC(Cl)=CC=C1ONC1=CC=C(CCC2)C2=C1 YTNLNHLOXYAXOG-UHFFFAOYSA-N 0.000 description 1
- QYIQXNQEKPXETC-UHFFFAOYSA-N n-(6-phenoxy-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2C=CCC=2C=C1OC1=CC=CC=C1 QYIQXNQEKPXETC-UHFFFAOYSA-N 0.000 description 1
- AVEVSZXVFYABDM-UHFFFAOYSA-N n-(6-phenoxy-2,3-dihydro-1h-inden-5-yl)ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1 AVEVSZXVFYABDM-UHFFFAOYSA-N 0.000 description 1
- OKPFFJPEKYCXRA-UHFFFAOYSA-N n-(6-phenoxy-3h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CC=CC=2C=C1OC1=CC=CC=C1 OKPFFJPEKYCXRA-UHFFFAOYSA-N 0.000 description 1
- LMQOHUWEDJFZLA-UHFFFAOYSA-N n-(6-phenylsulfanyl-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1SC1=CC=CC=C1 LMQOHUWEDJFZLA-UHFFFAOYSA-N 0.000 description 1
- NTPSXRBNACRUGB-UHFFFAOYSA-N n-(6-pyridin-2-ylsulfanyl-2,3-dihydro-1h-inden-5-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1SC1=CC=CC=N1 NTPSXRBNACRUGB-UHFFFAOYSA-N 0.000 description 1
- JSPRTRYLEVSYQQ-UHFFFAOYSA-N n-[5-(methanesulfonamido)-6-phenoxy-1h-inden-1-yl]methanesulfonamide Chemical compound C1=C2C(NS(=O)(=O)C)C=CC2=CC(NS(C)(=O)=O)=C1OC1=CC=CC=C1 JSPRTRYLEVSYQQ-UHFFFAOYSA-N 0.000 description 1
- BHFTXGZFNZXHBJ-UHFFFAOYSA-N n-[6-(2-chloro-4-fluorophenoxy)-2,3-dihydro-1h-inden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=C(F)C=C1Cl BHFTXGZFNZXHBJ-UHFFFAOYSA-N 0.000 description 1
- DQIZANOEMRQGLW-UHFFFAOYSA-N n-[6-(2-fluorophenoxy)-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC=C1F DQIZANOEMRQGLW-UHFFFAOYSA-N 0.000 description 1
- BLPWRUYBASPQAC-UHFFFAOYSA-N n-[6-(2-fluorophenoxy)-2,3-dihydro-1h-inden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1OC1=CC=CC=C1F BLPWRUYBASPQAC-UHFFFAOYSA-N 0.000 description 1
- PWLYYCXYMUAPOV-UHFFFAOYSA-N n-[6-(3-chlorophenoxy)-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCC(=O)C=2C=C1OC1=CC=CC(Cl)=C1 PWLYYCXYMUAPOV-UHFFFAOYSA-N 0.000 description 1
- LIOFQCWKFQYUNI-UHFFFAOYSA-N n-[6-(4-chlorophenoxy)-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCC(=O)C=2C=C1OC1=CC=C(Cl)C=C1 LIOFQCWKFQYUNI-UHFFFAOYSA-N 0.000 description 1
- CMWLOZHEYMWKAB-UHFFFAOYSA-N n-[6-(4-chlorophenyl)sulfanyl-2,3-dihydro-1h-inden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1SC1=CC=C(Cl)C=C1 CMWLOZHEYMWKAB-UHFFFAOYSA-N 0.000 description 1
- PCUOXCKGUNVECA-UHFFFAOYSA-N n-[6-(4-fluorophenyl)sulfanyl-2,3-dihydro-1h-inden-5-yl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=2CCCC=2C=C1SC1=CC=C(F)C=C1 PCUOXCKGUNVECA-UHFFFAOYSA-N 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/38—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. nitrodiphenyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782833202 DE2833202A1 (de) | 1978-07-27 | 1978-07-27 | Neue indanyl- und tetralinylamide, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
| DE2833202 | 1978-07-27 | ||
| DE2923937 | 1979-06-11 | ||
| DE19792923937 DE2923937A1 (de) | 1979-06-11 | 1979-06-11 | Neue indanyl-derivate, ihre herstellung und verwendung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI792347A7 FI792347A7 (fi) | 1980-01-28 |
| FI71306B FI71306B (fi) | 1986-09-09 |
| FI71306C true FI71306C (fi) | 1986-12-19 |
Family
ID=25775214
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI792347A FI71306C (fi) | 1978-07-27 | 1979-07-26 | Foerfarande foer framstaellning av terapeutiskt anvaendbara inanderivat |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4244960A (ro) |
| EP (1) | EP0009554B1 (ro) |
| AU (1) | AU532405B2 (ro) |
| BG (1) | BG36197A3 (ro) |
| CA (1) | CA1124724A (ro) |
| DD (1) | DD145101A5 (ro) |
| DE (1) | DE2965279D1 (ro) |
| DK (1) | DK159269C (ro) |
| DZ (1) | DZ206A1 (ro) |
| EG (1) | EG14394A (ro) |
| ES (1) | ES482918A1 (ro) |
| FI (1) | FI71306C (ro) |
| FR (1) | FR2433512A1 (ro) |
| GB (1) | GB2025973A (ro) |
| GR (1) | GR73006B (ro) |
| IE (1) | IE48783B1 (ro) |
| IL (1) | IL57901A (ro) |
| NO (1) | NO147560C (ro) |
| NZ (1) | NZ191100A (ro) |
| PH (1) | PH20604A (ro) |
| PL (1) | PL126816B1 (ro) |
| PT (1) | PT69986A (ro) |
| RO (1) | RO78632A (ro) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3103372A1 (de) * | 1981-01-27 | 1982-09-02 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue indanyl-derivate, ihre herstellung und verwendung |
| DE3208079A1 (de) * | 1982-03-04 | 1983-09-08 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue indanyl-derivate, ihre herstellung und verwendung |
| US4555406A (en) * | 1983-09-06 | 1985-11-26 | Schering Aktiengesellschaft | Indanyl derivatives, their preparation and use |
| DE3343331A1 (de) * | 1983-11-28 | 1985-06-05 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von indanyl-derivaten und deren verwendung |
| US4919705A (en) * | 1987-02-10 | 1990-04-24 | Idemitsu Kosan Company Limited | Trifluoromethanesulfonamide derivative, a method for the preparation thereof and a herbicide containing the same |
| US5035739A (en) * | 1987-02-10 | 1991-07-30 | Idemitsu Kosan Company Limited | Trifluoromethanesulfonamide derivative and a herbicide containing the same |
| JPH0753725B2 (ja) * | 1987-10-08 | 1995-06-07 | 富山化学工業株式会社 | 4h―1―ベンゾピラン―4―オン誘導体およびその塩、それらの製造法並びにそれらを含有する抗炎症剤 |
| GB9003551D0 (en) * | 1990-02-16 | 1990-04-11 | Ici Plc | Heterocyclic compounds |
| US5604260A (en) * | 1992-12-11 | 1997-02-18 | Merck Frosst Canada Inc. | 5-methanesulfonamido-1-indanones as an inhibitor of cyclooxygenase-2 |
| US5409944A (en) * | 1993-03-12 | 1995-04-25 | Merck Frosst Canada, Inc. | Alkanesulfonamido-1-indanone derivatives as inhibitors of cyclooxygenase |
| CA2211320C (en) * | 1995-01-31 | 2007-03-20 | Merck Frosst Canada Inc. | 5-methanesulfonamido-3h-isobenzofuran-1-ones as inhibitors of cyclooxygenase-2 |
| ES2138902B1 (es) * | 1997-05-19 | 2000-09-16 | Salvat Lab Sa | "5-ariltio-6-sulfonamido-3(2h)-benzofuranonas como inhibidores de la cox-2". |
| DE10142660A1 (de) | 2001-08-31 | 2003-03-20 | Aventis Pharma Gmbh | Verwendung von Derivaten von C2-substituierten Indan-1-ol-Systemen zur Herstellung von Medikamenten zur Prophylaxe oder Behandlung von Obesitas |
| DE10142722A1 (de) | 2001-08-31 | 2003-03-27 | Aventis Pharma Deutschland GmbH, 65929 Frankfurt | C2-substituierte Indan-1-one und ihre Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE10142668A1 (de) | 2001-08-31 | 2003-03-20 | Aventis Pharma Gmbh | Verwendung von C2-substituierten Indan-1-on-Systemen zur Herstellung von Medikamenten zur Prophylaxe oder Behandlung von Obesitas |
| DE10142659A1 (de) | 2001-08-31 | 2003-03-20 | Aventis Pharma Gmbh | Verwendung von mehrfach substituierten Indan-1-ol. Systemen zur Herstellung von Medikamenten zur Prophylaxe oder Behandlung von Obesitas |
| DE10142667B4 (de) | 2001-08-31 | 2004-06-09 | Aventis Pharma Deutschland Gmbh | C2-substituierte Indan-1-ole und ihre Derivate und ihre Verwendung als Arzneimittel |
| DE10142666A1 (de) * | 2001-08-31 | 2003-03-20 | Aventis Pharma Gmbh | Verwendung von C2-substituierten Indan-1-ol-Systemen zur Herstellung von Medikamenten zur Prophylaxe oder Behandlung von Obesitas |
| DE10142661B4 (de) * | 2001-08-31 | 2004-06-09 | Aventis Pharma Deutschland Gmbh | Mehrfach substituierte Indan-1-ol-Systeme und ihre Verwendung als Arzneimittel |
| DE10142662B4 (de) | 2001-08-31 | 2004-07-08 | Aventis Pharma Deutschland Gmbh | Derivate von C2-substituierten Indan-1-ol-Systemen und ihre Verwendung als Arzneimittel |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2921958A (en) * | 1954-09-03 | 1960-01-19 | Ruhrchemie Ag | 4.5.6.7.10.10-hexachloro-4.7-methylene-4.7.8.9-tetrahydroindane-sulfonic acid, saltsand acid amides thereof |
| US3288852A (en) * | 1964-05-08 | 1966-11-29 | Dow Chemical Co | Anthracene dialkanesulfonamides |
| AR206496A1 (es) * | 1972-07-03 | 1976-07-30 | Riker Laboratories Inc | Procedimiento para la preparacion de 2-fenoxi-4-nitro-alquil o haloalquilsulfonanilidas |
| US4087549A (en) * | 1972-12-06 | 1978-05-02 | Merck & Co., Inc. | Sulphonic acid containing indenyl derivatives |
| US4086255A (en) * | 1974-04-15 | 1978-04-25 | Minnesota Mining And Manufacturing Company | Perfluoroalkylsulfonamidoaryl compounds |
| GB1472843A (en) * | 1976-02-12 | 1977-05-11 | Pfizer Ltd | Benzene sulphonamides |
| GB2009146B (en) * | 1977-11-29 | 1982-03-24 | Ishihara Sangyo Kaisha | Sulphonanilide copmouds and herbicidal compositions therof |
-
1979
- 1979-07-20 EP EP79102566A patent/EP0009554B1/de not_active Expired
- 1979-07-20 DE DE7979102566T patent/DE2965279D1/de not_active Expired
- 1979-07-24 BG BG044445A patent/BG36197A3/xx unknown
- 1979-07-24 DD DD79214579A patent/DD145101A5/de unknown
- 1979-07-24 NZ NZ191100A patent/NZ191100A/xx unknown
- 1979-07-25 GR GR59694A patent/GR73006B/el unknown
- 1979-07-25 EG EG448/79A patent/EG14394A/xx active
- 1979-07-25 DZ DZ795518A patent/DZ206A1/fr active
- 1979-07-25 PL PL1979217384A patent/PL126816B1/pl unknown
- 1979-07-26 FI FI792347A patent/FI71306C/fi not_active IP Right Cessation
- 1979-07-26 GB GB7926016A patent/GB2025973A/en not_active Withdrawn
- 1979-07-26 IL IL57901A patent/IL57901A/xx unknown
- 1979-07-26 NO NO792474A patent/NO147560C/no unknown
- 1979-07-26 PH PH22819A patent/PH20604A/en unknown
- 1979-07-26 PT PT69986A patent/PT69986A/pt unknown
- 1979-07-26 FR FR7919301A patent/FR2433512A1/fr active Pending
- 1979-07-26 DK DK315979A patent/DK159269C/da not_active IP Right Cessation
- 1979-07-27 US US06/061,779 patent/US4244960A/en not_active Expired - Lifetime
- 1979-07-27 AU AU49325/79A patent/AU532405B2/en not_active Ceased
- 1979-07-27 ES ES482918A patent/ES482918A1/es not_active Expired
- 1979-07-27 RO RO7998285A patent/RO78632A/ro unknown
- 1979-07-27 CA CA332,665A patent/CA1124724A/en not_active Expired
- 1979-08-08 IE IE1422/79A patent/IE48783B1/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PL126816B1 (en) | 1983-09-30 |
| DK315979A (da) | 1980-01-28 |
| US4244960A (en) | 1981-01-13 |
| DE2965279D1 (en) | 1983-06-01 |
| RO78632A (ro) | 1982-04-12 |
| PT69986A (de) | 1979-08-01 |
| AU532405B2 (en) | 1983-09-29 |
| IL57901A (en) | 1983-11-30 |
| IE791422L (en) | 1980-01-27 |
| NO792474L (no) | 1980-01-29 |
| NO147560C (no) | 1983-05-04 |
| DK159269C (da) | 1991-02-18 |
| FI792347A7 (fi) | 1980-01-28 |
| IE48783B1 (en) | 1985-05-15 |
| EP0009554B1 (de) | 1983-04-27 |
| GR73006B (ro) | 1984-01-24 |
| NO147560B (no) | 1983-01-24 |
| DZ206A1 (fr) | 2004-09-13 |
| FR2433512A1 (fr) | 1980-03-14 |
| CA1124724A (en) | 1982-06-01 |
| PL217384A1 (ro) | 1981-11-13 |
| EG14394A (en) | 1983-12-31 |
| AU4932579A (en) | 1980-02-07 |
| IL57901A0 (en) | 1979-11-30 |
| DK159269B (da) | 1990-09-24 |
| EP0009554A1 (de) | 1980-04-16 |
| NZ191100A (en) | 1982-03-30 |
| PH20604A (en) | 1987-02-24 |
| ES482918A1 (es) | 1980-05-16 |
| DD145101A5 (de) | 1980-11-19 |
| GB2025973A (en) | 1980-01-30 |
| BG36197A3 (bg) | 1984-09-14 |
| FI71306B (fi) | 1986-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI71306B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara inanderivat | |
| FI102895B (fi) | Menetelmä terapeuttisesti aktiivisten 5-(fenyylisulfonyyliamino)- ja 5 -(fenyylisulfonyyliaminokarbonyyli)pyridiini-2-karboksyylihappoamidien valmistamiseksi | |
| SK3699A3 (en) | Substituted pyridines as selective cyclooxygenase-2 inhibitors | |
| RU2127268C1 (ru) | Производные бензоциклогептена или бензоксепина, способ их получения, промежуточные соединения и фармацевтическая композиция | |
| JPS6323847A (ja) | 置換アミノ−5,6,7,8−テトラヒドロナフチル−オキシ酢酸 | |
| KR20070063005A (ko) | 괴사 또는 세포 사멸에 의한 조직 손상 또는 질병 치료에서폴리(adp-리보오스)폴리머라아제(parp)억제제로서의 3,6-치환된 5-아릴아미노-1h-피리딘-2-온 유도체및 관련 화합물 | |
| US4371537A (en) | Sulfur-substituted phenoxypyridines having antiviral activity | |
| IL42640A (en) | Substituted 2'-phenoxyalkane-sulfonanilides | |
| PL190265B1 (pl) | Sposób wytwarzania związków 2-arylo-3-arylopirydynowych | |
| JPH06135934A (ja) | ピリジン誘導体又はその塩を含有するホスホリパーゼ▲a2▼阻害剤、抗炎症剤又は抗膵炎剤 | |
| EP0081756B1 (en) | New compounds with antiinflammatory and antitussive activity, process for their preparation and relative pharmaceutical compositions | |
| SU1199197A3 (ru) | Способ получени производных фенилалкановой кислоты | |
| DE69406350T2 (de) | Pyridinederivate, die die Kaliumkanäle öffnen | |
| CA2085347C (en) | Novel cyclic aminophenylacetic acid derivative, production therof, and immune response modulator containing the same as active ingredient | |
| US4168313A (en) | Phthalidyl 2-(3'-trifluoromethyl-anilino)-pyridine-3-carboxylate and its salts | |
| RU2309148C2 (ru) | Производные пиридинсульфонамида, фармацевтическая композиция на их основе и применение | |
| CS216206B2 (en) | Method of making the derivatives of the diphenylpyrazole | |
| Shutske et al. | Synthesis of some piperazinylpyrazolo [3, 4‐b] pyridines as selective serotonin re‐uptake inhibitors | |
| Sliwa et al. | Isolation and alkaline decomposition of the intermediated pyridinium salts occurring in the pyridine N-oxide oxidation of. alpha.-halo esters or acids | |
| US4558134A (en) | Certain phenoxy-pyridine-carbonitriles having antiviral activity | |
| JPS5840544B2 (ja) | 1−(2−(b− ナフチルオキシ )−エチル)−3− メチル − ピラゾロン −(5) ノセイゾウホウホウ | |
| Hoffman et al. | A deuterium isotope effect on the inhibition of gastric secretion by N, N-dimethyl-N'-[2-(diisopropylamino) ethyl]-N'-(4, 6-dimethyl-2-pyridyl) urea. Synthesis of metabolites | |
| AU2002337116A1 (en) | Pyridinic sulfonamide derivatives, method of production and use thereof | |
| DE2756771A1 (de) | Verfahren zur herstellung von neuen substituierten 5-amino-2-pyridincarbonsaeure-verbindungen | |
| JPS6159625B2 (ro) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: SCHERING AKTIENGESELLSCHAFT |