FI65993C - Foerfarande foer framstaellning av nya antimykotiska hydroxietyl-azolderivat - Google Patents
Foerfarande foer framstaellning av nya antimykotiska hydroxietyl-azolderivat Download PDFInfo
- Publication number
- FI65993C FI65993C FI793689A FI793689A FI65993C FI 65993 C FI65993 C FI 65993C FI 793689 A FI793689 A FI 793689A FI 793689 A FI793689 A FI 793689A FI 65993 C FI65993 C FI 65993C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- chlorine
- phenyl
- mono
- fluorine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 238000000034 method Methods 0.000 claims abstract description 22
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- XBVPIPOORLGFGK-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)ethanol Chemical class OCCC1=CC=CN1 XBVPIPOORLGFGK-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims abstract description 7
- 239000000460 chlorine Chemical group 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 17
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 12
- 229910052801 chlorine Chemical group 0.000 claims description 12
- -1 1,2,4-triazole 1-yl Chemical group 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 230000000843 anti-fungal effect Effects 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 229940121375 antifungal agent Drugs 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 239000002516 radical scavenger Substances 0.000 claims description 5
- SWSIKJHQXQBBGI-UHFFFAOYSA-N 1-phenyl-2-(1h-pyrrol-2-yl)ethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CN1 SWSIKJHQXQBBGI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 230000001857 anti-mycotic effect Effects 0.000 claims description 2
- 239000002543 antimycotic Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- MPWUTCPIYWRGDI-UHFFFAOYSA-N 2-hydroxyethyl 1h-pyrrole-2-carboxylate Chemical compound OCCOC(=O)C1=CC=CN1 MPWUTCPIYWRGDI-UHFFFAOYSA-N 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 125000002883 imidazolyl group Chemical group 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 229940124597 therapeutic agent Drugs 0.000 claims 1
- 239000003429 antifungal agent Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 208000015181 infectious disease Diseases 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 7
- 208000031888 Mycoses Diseases 0.000 description 7
- 125000001309 chloro group Chemical group Cl* 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 241000233866 Fungi Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 4
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 2
- ZPNUWMKZXYQJJM-UHFFFAOYSA-N 2-chloro-1-(4-fluorophenyl)-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(CCl)(O)C1=CC=C(F)C=C1 ZPNUWMKZXYQJJM-UHFFFAOYSA-N 0.000 description 2
- 201000004384 Alopecia Diseases 0.000 description 2
- 241001480043 Arthrodermataceae Species 0.000 description 2
- 241000228212 Aspergillus Species 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 206010012504 Dermatophytosis Diseases 0.000 description 2
- 241001480036 Epidermophyton floccosum Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001460074 Microsporum distortum Species 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000002474 Tinea Diseases 0.000 description 2
- QCQYNYWXPHCAAZ-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=C(Cl)C=C1 Chemical compound [Cl-].[Mg+]C1=CC=C(Cl)C=C1 QCQYNYWXPHCAAZ-UHFFFAOYSA-M 0.000 description 2
- LMWRUVZWLBOLRD-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=CC=C1Cl Chemical compound [Cl-].[Mg+]C1=CC=CC=C1Cl LMWRUVZWLBOLRD-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 230000037304 dermatophytes Effects 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 208000024963 hair loss Diseases 0.000 description 2
- 230000003676 hair loss Effects 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- WAGBGLRIFIHHLK-UHFFFAOYSA-N 1,3-bis[4-(2-phenylphenyl)imidazol-1-yl]propan-2-one Chemical compound C1(=C(C=CC=C1)C=1N=CN(C=1)CC(=O)CN1C=NC(=C1)C1=C(C=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 WAGBGLRIFIHHLK-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- ZKLFDYQDFFSXAW-UHFFFAOYSA-N 1-(3-chlorophenyl)-2-imidazol-1-yl-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(C=1C=C(Cl)C=CC=1)(O)CN1C=CN=C1 ZKLFDYQDFFSXAW-UHFFFAOYSA-N 0.000 description 1
- BTOQYKKYPOUZGJ-UHFFFAOYSA-N 1-(4-fluorophenyl)-2-imidazol-1-yl-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(F)C=CC=1C(C=1C=CC(=CC=1)C=1C=CC=CC=1)(O)CN1C=CN=C1 BTOQYKKYPOUZGJ-UHFFFAOYSA-N 0.000 description 1
- JRGGUPZKKTVKOV-UHFFFAOYSA-N 1-bromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1 JRGGUPZKKTVKOV-UHFFFAOYSA-N 0.000 description 1
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 1
- YNCPXBIZAPNQIJ-UHFFFAOYSA-N 1h-imidazole;sodium Chemical compound [Na].C1=CNC=N1 YNCPXBIZAPNQIJ-UHFFFAOYSA-N 0.000 description 1
- UFNIBRDIUNVOMX-UHFFFAOYSA-N 2,4'-dichlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC=CC=C1Cl UFNIBRDIUNVOMX-UHFFFAOYSA-N 0.000 description 1
- AKGHKFRQFARKRF-UHFFFAOYSA-N 2-chloro-1-(2,4-dichlorophenyl)-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(CCl)(O)C(C=C1)=CC=C1C1=CC=CC=C1 AKGHKFRQFARKRF-UHFFFAOYSA-N 0.000 description 1
- LAXBNTIAOJWAOP-UHFFFAOYSA-N 2-chlorobiphenyl Chemical group ClC1=CC=CC=C1C1=CC=CC=C1 LAXBNTIAOJWAOP-UHFFFAOYSA-N 0.000 description 1
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical class CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 description 1
- CTBDNAHBIPBRTI-UHFFFAOYSA-N 2-imidazol-1-yl-1-(4-phenylphenyl)ethanone Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(=O)CN1C=CN=C1 CTBDNAHBIPBRTI-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZHTHFRIQYSIAOF-UHFFFAOYSA-N 4,5-dihydro-1h-imidazole;nitric acid Chemical compound O[N+]([O-])=O.C1CN=CN1 ZHTHFRIQYSIAOF-UHFFFAOYSA-N 0.000 description 1
- FPWNLURCHDRMHC-UHFFFAOYSA-N 4-chlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC=CC=C1 FPWNLURCHDRMHC-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 208000007163 Dermatomycoses Diseases 0.000 description 1
- 241001480035 Epidermophyton Species 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000250507 Gigaspora candida Species 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- BYBLEWFAAKGYCD-UHFFFAOYSA-N Miconazole Chemical compound ClC1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 BYBLEWFAAKGYCD-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 241001507677 Penicillium commune Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 241000223238 Trichophyton Species 0.000 description 1
- DSTYFUTWKVNGQK-UHFFFAOYSA-M [Cl-].FC1=CC=CC(Cl)=C1[Mg+] Chemical compound [Cl-].FC1=CC=CC(Cl)=C1[Mg+] DSTYFUTWKVNGQK-UHFFFAOYSA-M 0.000 description 1
- DPAXVFFYPUINRW-UHFFFAOYSA-M [Cl-].[Mg+]C1=C(Cl)C=CC=C1Cl Chemical compound [Cl-].[Mg+]C1=C(Cl)C=CC=C1Cl DPAXVFFYPUINRW-UHFFFAOYSA-M 0.000 description 1
- IWJNLFUHPFRHGU-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=C(Cl)C=C1Cl Chemical compound [Cl-].[Mg+]C1=CC=C(Cl)C=C1Cl IWJNLFUHPFRHGU-UHFFFAOYSA-M 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- QVQGTNFYPJQJNM-UHFFFAOYSA-N dicyclohexylmethanamine Chemical compound C1CCCCC1C(N)C1CCCCC1 QVQGTNFYPJQJNM-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 231100000321 erythema Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- IWCVDCOJSPWGRW-UHFFFAOYSA-M magnesium;benzene;chloride Chemical compound [Mg+2].[Cl-].C1=CC=[C-]C=C1 IWCVDCOJSPWGRW-UHFFFAOYSA-M 0.000 description 1
- ZMPYQGQHGLLBQI-UHFFFAOYSA-M magnesium;chlorobenzene;bromide Chemical compound [Mg+2].[Br-].ClC1=CC=C[C-]=C1 ZMPYQGQHGLLBQI-UHFFFAOYSA-M 0.000 description 1
- BRKADVNLTRCLOW-UHFFFAOYSA-M magnesium;fluorobenzene;bromide Chemical compound [Mg+2].[Br-].FC1=CC=[C-]C=C1 BRKADVNLTRCLOW-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229960002509 miconazole Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
- C07C29/40—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones with compounds containing carbon-to-metal bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2851116 | 1978-11-25 | ||
| DE19782851116 DE2851116A1 (de) | 1978-11-25 | 1978-11-25 | Hydroxyethyl-azole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI793689A7 FI793689A7 (fi) | 1980-05-26 |
| FI65993B FI65993B (fi) | 1984-04-30 |
| FI65993C true FI65993C (fi) | 1984-08-10 |
Family
ID=6055583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI793689A FI65993C (fi) | 1978-11-25 | 1979-11-23 | Foerfarande foer framstaellning av nya antimykotiska hydroxietyl-azolderivat |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4301166A (enFirst) |
| EP (1) | EP0011769B1 (enFirst) |
| JP (1) | JPS5573662A (enFirst) |
| AT (1) | ATE851T1 (enFirst) |
| AU (1) | AU534447B2 (enFirst) |
| CA (1) | CA1128528A (enFirst) |
| DD (1) | DD148219A5 (enFirst) |
| DE (2) | DE2851116A1 (enFirst) |
| DK (1) | DK499579A (enFirst) |
| ES (1) | ES486280A1 (enFirst) |
| FI (1) | FI65993C (enFirst) |
| HU (1) | HU179415B (enFirst) |
| IE (1) | IE48881B1 (enFirst) |
| IL (1) | IL58775A (enFirst) |
| NO (1) | NO793674L (enFirst) |
| NZ (1) | NZ192196A (enFirst) |
| PH (1) | PH15562A (enFirst) |
| ZA (1) | ZA796357B (enFirst) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4551469A (en) * | 1979-03-07 | 1985-11-05 | Imperial Chemical Industries Plc | Antifungal triazole ethanol derivatives |
| US4927839A (en) * | 1979-03-07 | 1990-05-22 | Imperial Chemical Industries Plc | Method of preventing fungal attack on wood, hides, leather or paint films using a triazole |
| US4654332A (en) | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| DE2912288A1 (de) * | 1979-03-28 | 1980-10-09 | Bayer Ag | Verfahren zur herstellung von hydroxyethyl-azolen |
| GB2069481B (en) * | 1980-02-13 | 1983-07-27 | Farmos Oy | Substituted imidazole derivatives |
| GB2078719B (en) * | 1980-06-02 | 1984-04-26 | Ici Ltd | Heterocyclic compounds |
| US5395942A (en) * | 1980-06-02 | 1995-03-07 | Zeneca Limited | Heterocyclic compounds |
| DE3177275D1 (de) * | 1980-08-18 | 1992-04-16 | Ici Plc | Verwendung von triazolylaethanol-derivate und deren zusammensetzungen als nichtlandwirtschaftliche fungizide. |
| JPS5764614A (en) * | 1980-08-28 | 1982-04-19 | Ici Ltd | Pharmaceutically or veterinarily antibacterial composition and method of controlling or sterilizing microbes of candida or trichophyton genus |
| US4479004A (en) * | 1980-11-03 | 1984-10-23 | Janssen Pharmaceutica N.V. | 1-[2-(4-Diphenyl)-1,3-dioxolan-2-yl-methyl]-1-H-triazoles |
| DE3106635A1 (de) * | 1981-02-23 | 1982-09-09 | Bayer Ag | Antimykotisches mittel mit hoher wirkstoff-freisetzung in form von stiften |
| US5466821A (en) * | 1981-03-18 | 1995-11-14 | Zeneca Limited | Heterocyclic compounds |
| DE3111238A1 (de) * | 1981-03-21 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| AU8314482A (en) * | 1981-05-19 | 1982-11-25 | Imperial Chemical Industries Plc | 3-triazolyl(imidazolyl)-2,2 bis phenyl-propionamides |
| JPS5815909A (ja) * | 1981-07-22 | 1983-01-29 | Toko Yakuhin Kogyo Kk | 抗真菌外用剤 |
| DE3245504A1 (de) * | 1982-12-09 | 1984-06-14 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, deren herstellung und verwendung |
| US4610716A (en) * | 1982-12-14 | 1986-09-09 | Ciba-Geigy Corporation | Fluorinated azolyl ethanol growth regulators and microbicides |
| US4624958A (en) * | 1983-04-14 | 1986-11-25 | Pfizer Inc. | Antiprotozoal 1,4-di(p-amidinophenyl)imidazoles |
| US4766140A (en) * | 1984-06-18 | 1988-08-23 | Eli Lilly And Company | Method of inhibiting aromatase |
| US4729986A (en) * | 1986-04-24 | 1988-03-08 | E. I. Du Pont De Nemours And Company | Fungicidal triazoles and imidazoles |
| US5096889A (en) * | 1987-11-09 | 1992-03-17 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US5006513A (en) * | 1987-11-09 | 1991-04-09 | Miles Inc. | Antimycotic compositions of nikkomycin compounds and azole antimycotica |
| US5194427A (en) * | 1987-11-09 | 1993-03-16 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US4914087A (en) * | 1988-02-29 | 1990-04-03 | Bayer Ag | Nikkomycin derivatives, antimycotic compositions of nikkomycin derivatives and azole antimycotics |
| US4859693A (en) * | 1988-08-10 | 1989-08-22 | E. I. Du Pont De Nemours And Company | Antiinflammatory carbinoloimidazoles |
| US5049570A (en) * | 1990-01-23 | 1991-09-17 | Du Pont Merck Pharmaceutical Company | Pyridylphenyl nitrogen heterocycle-substituted carbinols and derivatives thereof with anti-inflammatory activity |
| DE4027608A1 (de) * | 1990-08-31 | 1992-03-05 | Bayer Ag | Verfahren zur herstellung von 1-chlor-2-(1-chlor-cyclopropyl)-3-(2-chlor-phenyl)-propan-2-ol und/oder 2-(1-chlor-cyclopropyl)-2-(2-chlor-benzyl)-oxiran |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| GB1569267A (en) * | 1975-12-16 | 1980-06-11 | Ici Ltd | Substituted propiophenones and herbicidal and fungicidal compositions containing them |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
-
1978
- 1978-11-25 DE DE19782851116 patent/DE2851116A1/de not_active Withdrawn
-
1979
- 1979-11-09 US US06/092,806 patent/US4301166A/en not_active Expired - Lifetime
- 1979-11-13 NO NO793674A patent/NO793674L/no unknown
- 1979-11-14 DE DE7979104484T patent/DE2962527D1/de not_active Expired
- 1979-11-14 AT AT79104484T patent/ATE851T1/de not_active IP Right Cessation
- 1979-11-14 EP EP79104484A patent/EP0011769B1/de not_active Expired
- 1979-11-21 DD DD79217044A patent/DD148219A5/de unknown
- 1979-11-22 IL IL58775A patent/IL58775A/xx unknown
- 1979-11-22 NZ NZ192196A patent/NZ192196A/xx unknown
- 1979-11-22 JP JP15080179A patent/JPS5573662A/ja active Granted
- 1979-11-23 ES ES486280A patent/ES486280A1/es not_active Expired
- 1979-11-23 HU HU79BA3892A patent/HU179415B/hu not_active IP Right Cessation
- 1979-11-23 DK DK499579A patent/DK499579A/da unknown
- 1979-11-23 PH PH23325A patent/PH15562A/en unknown
- 1979-11-23 IE IE2242/79A patent/IE48881B1/en unknown
- 1979-11-23 FI FI793689A patent/FI65993C/fi not_active IP Right Cessation
- 1979-11-23 CA CA340,547A patent/CA1128528A/en not_active Expired
- 1979-11-23 ZA ZA00796357A patent/ZA796357B/xx unknown
- 1979-11-26 AU AU53173/79A patent/AU534447B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| AU534447B2 (en) | 1984-02-02 |
| FI793689A7 (fi) | 1980-05-26 |
| FI65993B (fi) | 1984-04-30 |
| HU179415B (en) | 1982-10-28 |
| EP0011769A1 (de) | 1980-06-11 |
| PH15562A (en) | 1983-02-11 |
| JPS5573662A (en) | 1980-06-03 |
| DE2962527D1 (en) | 1982-05-27 |
| IE48881B1 (en) | 1985-06-12 |
| NO793674L (no) | 1980-05-28 |
| DD148219A5 (de) | 1981-05-13 |
| ATE851T1 (de) | 1982-04-15 |
| NZ192196A (en) | 1981-04-24 |
| DE2851116A1 (de) | 1980-06-12 |
| CA1128528A (en) | 1982-07-27 |
| ZA796357B (en) | 1980-12-31 |
| EP0011769B1 (de) | 1982-04-14 |
| AU5317379A (en) | 1980-05-29 |
| IE792242L (en) | 1980-05-25 |
| IL58775A (en) | 1984-02-29 |
| DK499579A (da) | 1980-05-26 |
| ES486280A1 (es) | 1980-05-16 |
| US4301166A (en) | 1981-11-17 |
| JPS638939B2 (enFirst) | 1988-02-25 |
| IL58775A0 (en) | 1980-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI65993C (fi) | Foerfarande foer framstaellning av nya antimykotiska hydroxietyl-azolderivat | |
| FI71134B (fi) | Foerfarande foer framstaellning av antifungicid 2-(2,4-difluorfenyl)-1,3-bis-(1h-1,2,4-triatsol-1-yl)-propan-2-ol | |
| FI65992C (fi) | Foerfarande foer framstaellning av nya antimykotiska hydoxipropyl-triazolderivat | |
| FI62291C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara azlyl-(1)-metaner och syraadditionssalter daerav | |
| DE3018865A1 (de) | Antimikrobielle mittel | |
| IE42064B1 (en) | Triazole derivatives and their use as anti-microbial and plant-growth regulating agents | |
| GB2099818A (en) | Triazoles | |
| FI82933C (fi) | Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara 1-aryl-1-fluoralkyl-2-(1h-1,2,4-triazol-1 -yl) etanoler. | |
| HU195647B (en) | Fungicide composition containing triazol derivatives and process for producing the active agents | |
| US4894382A (en) | Substituted 1,3-diazolyl-2-propanols and their use as antimycotic agents | |
| FI75812C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara triazolderivat. | |
| US4554286A (en) | Antifungal 1-triazolyl-2-aryl-3-(5-trifluoromethylimidazol-1-yl)propan-2-ol derivatives | |
| DE3202613A1 (de) | Antimykotische mittel | |
| US4239765A (en) | Fluorenyl-azolylmethyl-carbinol compounds and their medicinal use | |
| JPH02172978A (ja) | 置換ビスアゾール、その製造方法およびその医薬としての使用 | |
| FI66851C (fi) | Foerfarande foer framstaellning av antimykotiska 2,4-diklorfenylimidazolyletanoner(oler) | |
| US4607045A (en) | Azolylmethylcycloacetals, their preparation and their use as drugs | |
| CS228931B2 (cs) | Způsob výroby 2-(2,4-difluorfenyl)-l,3-bis(lH-l,2,4-triazol-l-yl)propan- -2-oiu | |
| CZ291790B6 (cs) | Azolová sloučenina, způsob výroby a farmaceutický prostředek | |
| EP0308781A2 (de) | Antimykotische Mittel | |
| IL45672A (en) | Anti-microbial compositions containing 1-(1,2,4-triazol-1-yl)-2-phenoxy-4,4-dimethyl-pentan-3-one derivatives | |
| FI57946C (fi) | Foerfarande foer framstaellning av antimykotiskt aktiva 1-(dimetylfenyl-fenyl-2(eller 4)-pyridyl-metylimidazoler | |
| JPS6233228B2 (enFirst) | ||
| GB2175899A (en) | Azole derivatives | |
| KR830002277B1 (ko) | 하이드록시에틸-아졸 화합물의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BAYER AKTIENGESELLSCHAFT |